Detailed information for compound 227822
Basic information
Technical information
- TDR Targets ID: 227822
- Name: methyl 2-(4-methoxyphenyl)-1H-benzimidazole-4 -carboxylate
- MW: 282.294 | Formula: C16H14N2O3
-
H donors: 1
H acceptors: 2
LogP: 2.97
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1)c1[nH]c2c(n1)c(ccc2)C(=O)OC
- InChi: 1S/C16H14N2O3/c1-20-11-8-6-10(7-9-11)15-17-13-5-3-4-12(14(13)18-15)16(19)21-2/h3-9H,1-2H3,(H,17,18)
- InChiKey: DOTKOAHLDHXKOF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2-(4-methoxyphenyl)-1H-benzimidazole-4-carboxylic acid methyl ester
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | dimethylglycine dehydrogenase, mitochondrial precursor, putative | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | glycerol-3-phosphate dehydrogenase (FAD-dependent), putative | 0.0012 | 0.0453 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | chromodomain-helicase-DNA-binding protein, putative | 0.0007 | 0.0174 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0007 | 0.0174 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0158 | 1 | 1 |
| Schistosoma mansoni | receptor tyrosine phosphatase type r2a | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.0008 | 0.022 | 0.0062 |
| Echinococcus granulosus | somatostatin receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine phosphatase n11 (shp2) | 0.0007 | 0.0159 | 0.0159 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | protein-tyrosine phosphatase non-receptor type nt5 | 0.0007 | 0.0159 | 0.0159 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | glycerol-3-phosphate dehydrogenase | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | glycerol 3 phosphate dehydrogenase | 0.0012 | 0.0453 | 0.0298 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | chromodomain-helicase-DNA-binding protein, putative | 0.0007 | 0.0174 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | glycerol-3-phosphate dehydrogenase | 0.0012 | 0.0453 | 0.0453 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0158 | 1 | 1 |
| Mycobacterium ulcerans | D-amino acid oxidase Aao | 0.0139 | 0.873 | 1 |
| Schistosoma mansoni | receptor tyrosine phosphatase type r2a | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0453 | 0.0298 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Schistosoma mansoni | receptor tyrosine phosphatase type r2a | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus multilocularis | FAD dependent oxidoreductase domain containing protein | 0.0012 | 0.0453 | 0.0298 |
| Schistosoma mansoni | neuropeptide receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Schistosoma mansoni | non-receptor protein-tyrosine phosphatase | 0.0007 | 0.0159 | 0.0159 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | CXXC zinc finger family protein | 0.0032 | 0.1792 | 0.1659 |
| Schistosoma mansoni | receptor tyrosine phosphatase type r2a | 0.0007 | 0.0159 | 0.0159 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tyrosine protein phosphatase non receptor type | 0.0143 | 0.8982 | 0.8965 |
| Echinococcus granulosus | serotonin receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0051 | 0.3032 | 0.3032 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Schistosoma mansoni | fad oxidoreductase | 0.0012 | 0.0453 | 0.0453 |
| Brugia malayi | RE15519p | 0.0158 | 1 | 1 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.001 | 0.0347 | 0.0191 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0158 | 1 | 1 |
| Mycobacterium leprae | PROBABLE D-AMINO ACID OXIDASE AAO | 0.0139 | 0.873 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0158 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0007 | 0.0174 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | pcd6 interacting protein-related | 0.0007 | 0.0159 | 0.0159 |
| Trypanosoma brucei | glycerol-3-phosphate dehydrogenase (FAD-dependent), mitochondrial | 0.0012 | 0.0453 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0158 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0158 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus granulosus | FAD dependent oxidoreductase domain containing protein | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Mycobacterium tuberculosis | Probable D-amino acid oxidase Aao | 0.0127 | 0.7978 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0158 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0012 | 0.0453 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0051 | 0.3032 | 0.3032 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0051 | 0.3032 | 0.2919 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | Present in the outer mitochondrial membrane proteome 20 | 0.0012 | 0.0453 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | CXXC zinc finger family protein | 0.0032 | 0.1792 | 0.1659 |
| Schistosoma mansoni | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0158 | 1 | 1 |
| Trypanosoma brucei | L-2-hydroxyglutarate dehydrogenase, mitochondrial, putative | 0.0012 | 0.0453 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Leishmania major | glycerol-3-phosphate dehydrogenase-like protein | 0.0012 | 0.0453 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0158 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | receptor protein tyrosine phosphatase r (pcptp1) | 0.0007 | 0.0159 | 0.0159 |
| Trypanosoma brucei | electron transfer flavoprotein-ubiquinone oxidoreductase, putative | 0.0012 | 0.0453 | 1 |
| Giardia lamblia | Glycerol-3-phosphate dehydrogenase | 0.0012 | 0.0453 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine phosphatase | 0.0007 | 0.0159 | 0.0159 |
| Schistosoma mansoni | protein-tyrosine phosphatase n9 | 0.0007 | 0.0159 | 0.0159 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0158 | 1 | 1 |
| Toxoplasma gondii | histone lysine methyltransferase SET1 | 0.0061 | 0.3663 | 1 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0068 | 0.4137 | 0.4137 |
| Brugia malayi | neuropeptide F receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | L-2-hydroxyglutarate dehydrogenase, mitochondrial, putative | 0.0012 | 0.0453 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | cpg binding protein | 0.0034 | 0.1911 | 0.1911 |
| Onchocerca volvulus | 0.0032 | 0.1792 | 0.1659 | |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rgs-gaip interacting protein gipc | 0.0007 | 0.0159 | 0.0159 |
| Schistosoma mansoni | receptor protein tyrosine phosphatase n (ia2) | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0051 | 0.3032 | 0.2919 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0158 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0051 | 0.3032 | 0.2919 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Trypanosoma brucei | FAD dependent oxidoreductase, putative | 0.0012 | 0.0453 | 1 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0051 | 0.3032 | 0.2919 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Entamoeba histolytica | anaerobic glycerol-3-phosphate dehydrogenase subunit A, putative | 0.0012 | 0.0453 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0158 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | cpg binding protein | 0.0032 | 0.1792 | 0.1792 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0158 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | receptor protein tyrosine phosphatase n (ia2) | 0.0007 | 0.0159 | 0.0159 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus granulosus | neuropeptide receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus granulosus | cpg binding protein | 0.0034 | 0.1911 | 0.178 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0158 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0158 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | mixed lineage leukemia protein mll | 0.0008 | 0.022 | 0.0062 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0158 | 1 | 1 |
| Brugia malayi | cDNA sequence BC016226 | 0.0012 | 0.0453 | 0.0298 |
| Plasmodium falciparum | FAD-dependent glycerol-3-phosphate dehydrogenase, putative | 0.0012 | 0.0453 | 0.5 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0158 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine phosphatase non-receptor type nt1 | 0.0143 | 0.8982 | 0.8982 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0158 | 1 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0012 | 0.0453 | 1 |
| Schistosoma mansoni | cpg binding protein | 0.0034 | 0.1911 | 0.1911 |
| Schistosoma mansoni | amine GPCR | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0158 | 1 | 1 |
| Chlamydia trachomatis | D-amino acid dehydrogenase | 0.0012 | 0.0453 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Schistosoma mansoni | NAD dehydrogenase | 0.0012 | 0.0453 | 0.0453 |
| Echinococcus multilocularis | tyrosine protein phosphatase non receptor type | 0.0143 | 0.8982 | 0.8965 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0158 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0158 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | protein-tyrosine phosphatase | 0.0143 | 0.8982 | 0.8965 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0007 | 0.0174 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0158 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | glycerol-3-phosphate dehydrogenase, putative | 0.0012 | 0.0453 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0139 | 0.873 | 0.871 |
| Onchocerca volvulus | Dimethylglycine dehydrogenase, mitochondrial homolog | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus multilocularis | mixed lineage leukemia protein mll | 0.0008 | 0.022 | 0.0062 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0453 | 0.0298 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine phosphatase | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | receptor protein tyrosine phosphatase | 0.0007 | 0.0159 | 0.0159 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0158 | 1 | 1 |
| Echinococcus granulosus | glycerol 3 phosphate dehydrogenase | 0.0012 | 0.0453 | 0.0298 |
| Trypanosoma brucei | glycerol-3-phosphate dehydrogenase (FAD-dependent), putative | 0.0012 | 0.0453 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Echinococcus granulosus | g-protein coupled receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Trypanosoma cruzi | glycerol-3-phosphate dehydrogenase (FAD-dependent), putative | 0.0012 | 0.0453 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Schistosoma mansoni | ATP:guanidino kinase (Smc74) | 0.0012 | 0.0453 | 0.0453 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0158 | 1 | 1 |
| Schistosoma mansoni | fad oxidoreductase | 0.0012 | 0.0453 | 0.0453 |
| Onchocerca volvulus | Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial homolog | 0.0012 | 0.0453 | 0.0298 |
| Schistosoma mansoni | neuropeptide receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0158 | 1 | 1 |
| Brugia malayi | Protein-tyrosine phosphatase containing protein | 0.0143 | 0.8982 | 0.8965 |
| Brugia malayi | F/Y-rich N-terminus family protein | 0.001 | 0.0339 | 0.0183 |
| Loa Loa (eye worm) | histone methyltransferase | 0.001 | 0.0347 | 0.0191 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | helicase, putative | 0.0007 | 0.0174 | 1 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.001 | 0.0347 | 0.0191 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0007 | 0.0174 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0158 | 1 | 1 |
| Plasmodium vivax | FAD-dependent glycerol-3-phosphate dehydrogenase, putative | 0.0012 | 0.0453 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Entamoeba histolytica | NAD(FAD)-dependent dehydrogenase, putative | 0.0012 | 0.0453 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0008 | 0.022 | 0.022 |
| Brugia malayi | GnHR receptor homolog | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0158 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0158 | 1 | 1 |
| Trypanosoma cruzi | L-2-hydroxyglutarate dehydrogenase, mitochondrial, putative | 0.0012 | 0.0453 | 1 |
| Echinococcus multilocularis | cpg binding protein | 0.0034 | 0.1911 | 0.178 |
| Brugia malayi | RE18450p | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus multilocularis | serotonin receptor | 0.0158 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | protein tyrosine phosphatase | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0158 | 1 | 1 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0051 | 0.3032 | 0.3032 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0007 | 0.0174 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0158 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Brugia malayi | G-protein coupled receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0158 | 1 | 1 |
| Onchocerca volvulus | Putative fad oxidoreductase | 0.0012 | 0.0453 | 0.0298 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | d-amino acid oxidase | 0.0139 | 0.873 | 0.873 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0158 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.0008 | 0.022 | 0.0062 |
| Trypanosoma cruzi | FAD dependent oxidoreductase, putative | 0.0012 | 0.0453 | 1 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0007 | 0.0174 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0158 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0158 | 1 | 1 |
| Brugia malayi | pyruvate dehydrogenase phosphatase regulatory subunit precursor | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0158 | 1 | 1 |
| Onchocerca volvulus | 0.0158 | 1 | 1 | |
| Schistosoma mansoni | histamine h1 receptor | 0.0158 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0453 | 0.0298 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0158 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0158 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0158 | 1 | 1 |
| Schistosoma mansoni | receptor tyrosine phosphatase type r2a | 0.0007 | 0.0159 | 0.0159 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0051 | 0.3032 | 0.2919 |
| Loa Loa (eye worm) | hypothetical protein | 0.0158 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0158 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0158 | 1 | 1 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0051 | 0.3032 | 0.2919 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0158 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0158 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0007 | 0.0174 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ND (binding) | 0 nM | In vitro inhibition against human full length PARP protein; NT means not tested | ChEMBL. | 11063605 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- PubChem: 10493143
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.