Detailed information for compound 317419
Basic information
Technical information
- Name: Unnamed compound
- MW: 289.31 | Formula: C13H11N3O3S
-
H donors: 1
H acceptors: 2
LogP: 1.28
Rotable bonds: 2
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc2[nH]c(=S)n(c(=O)c2cc1c1cnco1)C
- InChi: 1S/C13H11N3O3S/c1-16-12(17)7-3-8(11-5-14-6-19-11)10(18-2)4-9(7)15-13(16)20/h3-6H,1-2H3,(H,15,20)
- InChiKey: FSSKEPZFXMWHPD-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | IMP (inosine 5'-monophosphate) dehydrogenase 2 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0128 | 1 | 0.5 |
| Brugia malayi | G-protein coupled receptor | 0.0128 | 1 | 1 |
| Brugia malayi | Dopamine receptor | 0.0128 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0095 | 0.5962 | 0.5 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0128 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0128 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus granulosus | g protein coupled receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0128 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0128 | 1 | 1 |
| Trypanosoma brucei | inosine-5'-monophosphate dehydrogenase | 0.0095 | 0.5962 | 0.5 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0128 | 1 | 1 |
| Mycobacterium ulcerans | inosine 5-monophosphate dehydrogenase | 0.0089 | 0.5288 | 0.8869 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0128 | 1 | 1 |
| Trypanosoma brucei | GMP reductase | 0.0095 | 0.5962 | 0.5 |
| Echinococcus granulosus | neuropeptide receptor | 0.0128 | 1 | 1 |
| Wolbachia endosymbiont of Brugia malayi | IMP dehydrogenase | 0.0095 | 0.5962 | 0.5 |
| Echinococcus granulosus | g protein coupled receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0128 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0128 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0128 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0095 | 0.5962 | 0.5 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0128 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Mycobacterium ulcerans | inosine 5'-monophosphate dehydrogenase | 0.0095 | 0.5962 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0128 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0128 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Plasmodium falciparum | inosine-5'-monophosphate dehydrogenase | 0.0089 | 0.5288 | 0.5 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Mycobacterium leprae | Probable inosine-5'-monophosphate dehydrogenase GuaB3 (IMP dehydrogenase 2) (inosinic acid dehydrogenase) (inosinate dehydrogena | 0.005 | 0.0569 | 0.0954 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0128 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0128 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0128 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Leishmania major | guanosine monophosphate reductase | 0.0095 | 0.5962 | 0.5 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0128 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0128 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0128 | 1 | 1 |
| Trypanosoma cruzi | GMP reductase | 0.0095 | 0.5962 | 0.5 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0128 | 1 | 0.5 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus multilocularis | somatostatin receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Plasmodium vivax | inosine-5'-monophosphate dehydrogenase, putative | 0.0089 | 0.5288 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Schistosoma mansoni | biogenic amine receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.0128 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus granulosus | somatostatin receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0128 | 1 | 1 |
| Trypanosoma cruzi | inosine-5'-monophosphate dehydrogenase, putative | 0.0095 | 0.5962 | 0.5 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0128 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0128 | 1 | 1 |
| Mycobacterium tuberculosis | Probable inosine-5'-monophosphate dehydrogenase GuaB2 (imp dehydrogenase) (inosinic acid dehydrogenase) (inosinate dehydrogenase | 0.0095 | 0.5962 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0128 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0128 | 1 | 1 |
| Mycobacterium leprae | Probable inosine-5'-monophosphate dehydrogenase GuaB2 (IMP dehydrogenase) (IMPDH) (IMPD) | 0.0095 | 0.5962 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Schistosoma mansoni | amine GPCR | 0.0128 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Trypanosoma cruzi | GMP reductase | 0.0095 | 0.5962 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0128 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0128 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0128 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0128 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0128 | 1 | 1 |
| Toxoplasma gondii | IMP dehydrogenas | 0.0095 | 0.5962 | 0.5 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0128 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0128 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0128 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0128 | 1 | 1 |
| Leishmania major | inosine-5-monophosphate dehydrogenase | 0.0095 | 0.5962 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0128 | 1 | 1 |
| Onchocerca volvulus | 0.0128 | 1 | 0.5 | |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0128 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0128 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0128 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0128 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0128 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0128 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0128 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0128 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0128 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0128 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 17 nM | In vitro inhibitory concentration against inosine-5'-monophosphate dehydrogenase | ChEMBL. | 15664851 |
| IC50 (binding) | = 17 nM | In vitro inhibitory concentration against inosine-5'-monophosphate dehydrogenase | ChEMBL. | 15664851 |
| IC50 (functional) | = 1.1 uM | In vitro concentration required to inhibit peripheral blood mononuclear cell proliferation was determined | ChEMBL. | 15664851 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL180007
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.