Detailed information for compound 322086
Basic information
Technical information
- Name: Unnamed compound
- MW: 541.586 | Formula: C27H21F2NO5S2
-
H donors: 1
H acceptors: 3
LogP: 6.17
Rotable bonds: 10
Rule of 5 violations (Lipinski): 2 - SMILES: OC(=O)CN1C(=S)S/C(=C\c2ccc(c(c2)OCc2ccccc2)OCCc2cc(F)cc(c2)F)/C1=O
- InChi: 1S/C27H21F2NO5S2/c28-20-10-19(11-21(29)14-20)8-9-34-22-7-6-18(12-23(22)35-16-17-4-2-1-3-5-17)13-24-26(33)30(15-25(31)32)27(36)37-24/h1-7,10-14H,8-9,15-16H2,(H,31,32)/b24-13-
- InChiKey: FGZACNIHZAQEQN-CFRMEGHHSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Candida albicans | similar to dolichyl-P-mannose:protein mannosyltransferase involved in mannosylation of serine and threonine residues | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0134 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0134 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0134 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0134 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | mannosyltransferase 1, putative | 0.0085 | 0.5181 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | allatostatin A receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0134 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0134 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.0134 | 1 | 1 |
| Brugia malayi | G-protein coupled receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.0134 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.0134 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
| Brugia malayi | Dopamine receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0134 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0134 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.0134 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0134 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0134 | 1 | 1 |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.0134 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | allatostatin A receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Brugia malayi | RE15519p | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.0134 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0134 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | mannosyltransferase 1, putative | 0.0085 | 0.5181 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.0134 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0134 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0134 | 1 | 1 |
| Brugia malayi | larval opioid receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | mannosyltransferase 1, putative | 0.0085 | 0.5181 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.0134 | 1 | 1 |
| Brugia malayi | Melatonin receptor type 1A | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | sex peptide receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | somatostatin receptor | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.0134 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.0134 | 1 | 1 |
| Entamoeba histolytica | MIR domain protein | 0.0031 | 0 | 0.5 |
| Schistosoma mansoni | histamine h1 receptor | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0134 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.0134 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Echinococcus granulosus | fmrfamide receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.0134 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.0134 | 1 | 1 |
| Brugia malayi | ORL1-like opioid receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.0134 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.0134 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.0134 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.0134 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.0134 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.0134 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.0134 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.0134 | 1 | 1 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.0134 | 1 | 1 |
| Onchocerca volvulus | 0.0134 | 1 | 1 | |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.0134 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0134 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.0134 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.0134 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.0134 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0085 | 0.5181 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 0.11 uM | In vitro inhibition of Candida albicans G418-sensitive proliferation | ChEMBL. | 15225710 |
| IC50 (functional) | = 0.11 uM | In vitro inhibition of Candida albicans G418-sensitive proliferation | ChEMBL. | 15225710 |
| IC50 (binding) | = 0.85 uM | In vitro inhibition of Candida albicans protein mannosyl transferase 1 | ChEMBL. | 15225710 |
| IC50 (binding) | = 0.85 uM | In vitro inhibition of Candida albicans protein mannosyl transferase 1 | ChEMBL. | 15225710 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Candida albicans | ChEMBL23 | 15225710 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL184842
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.