Detailed information for compound 929774
Basic information
Technical information
- Name: Unnamed compound
- MW: 275.369 | Formula: C14H17N3OS
-
H donors: 2
H acceptors: 0
LogP: 1.68
Rotable bonds: 0
Rule of 5 violations (Lipinski): 1 - SMILES: N[C@@H]1CSCON2[C@@H]1c1[nH]c3c(c1CC2)cccc3
- InChi: 1S/C14H17N3OS/c15-11-7-19-8-18-17-6-5-10-9-3-1-2-4-12(9)16-13(10)14(11)17/h1-4,11,14,16H,5-8,15H2/t11-,14+/m1/s1
- InChiKey: SFAMFXNCPDEYGA-RISCZKNCSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
No curated genes were found associated with this compound
Predicted pathogen targets for this compound
By orthology
No druggable targets predicted by orthology data
By sequence similarity to non orthologous known druggable targets
No druggable targets predicted by sequence similarity
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | histamine-responsive GPCR (AAF21638) | 0.028 | 1 | 1 |
| Echinococcus granulosus | dro:myosuppressin receptor | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Schistosoma mansoni | myosin xvIII | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Echinococcus multilocularis | G protein coupled 5 hydroxytryptamine receptor | 0.028 | 1 | 1 |
| Brugia malayi | Tachykinin-like peptides receptor 99D | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.013 | 0.2972 | 0.5375 |
| Echinococcus granulosus | sex peptide receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | pyroglutamylated rfamide peptide receptor | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Schistosoma mansoni | neuropeptide receptor | 0.028 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0072 | 0.0242 | 0.5 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0177 | 0.5169 | 0.5169 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0072 | 0.0242 | 0.0242 |
| Brugia malayi | Dopamine receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | histamine h1 receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (octopamine/dopamine) receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.028 | 1 | 1 |
| Brugia malayi | GnHR receptor homolog | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0072 | 0.0242 | 0.0438 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0185 | 0.5529 | 1 |
| Echinococcus multilocularis | tachykinin peptides receptor 99D | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide Y receptor | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Schistosoma mansoni | peptide (allatostatin/somatostatin)-like receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | gonadotropin-releasing hormone receptor 2 | 0.028 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor | 0.028 | 1 | 1 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.028 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0072 | 0.0242 | 0.0438 |
| Echinococcus multilocularis | thyrotropin releasing hormone receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | 5-hydroxytryptamine 2C receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | neuropeptide receptor | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus multilocularis | G protein coupled receptor 139 | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | growth hormone secretagogue receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0177 | 0.5169 | 0.5169 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | 7tm_1 domain containing protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | fmrfamide receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0185 | 0.5529 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0072 | 0.0242 | 0.0242 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Brugia malayi | G protein-coupled receptor F59B2.13 | 0.028 | 1 | 1 |
| Echinococcus granulosus | 7TM GPCR rhodopsin | 0.028 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | neuropeptide f receptor 76f | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | serotonin receptor | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.028 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0072 | 0.0242 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0072 | 0.0242 | 0.0438 |
| Entamoeba histolytica | cysteine protease, putative | 0.0072 | 0.0242 | 0.5 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.028 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0185 | 0.5529 | 1 |
| Brugia malayi | larval opioid receptor | 0.028 | 1 | 1 |
| Brugia malayi | cathepsin B-like cysteine proteinase | 0.0177 | 0.5169 | 0.5049 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | cysteine protease | 0.0072 | 0.0242 | 0.0242 |
| Schistosoma mansoni | neuropeptide receptor | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus granulosus | tachykinin peptides receptor 99D | 0.028 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide FF receptor 2 | 0.028 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0072 | 0.0242 | 0.0438 |
| Brugia malayi | G-protein coupled receptor | 0.028 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0177 | 0.5169 | 0.9349 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1 | 0.028 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus granulosus | somatostatin receptor | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus granulosus | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.028 | 1 | 1 |
| Echinococcus granulosus | peptide allatostatin:somatostatin | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Echinococcus granulosus | growth hormone secretagogue receptor type 1 | 0.028 | 1 | 1 |
| Brugia malayi | RE15519p | 0.028 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.028 | 1 | 1 |
| Brugia malayi | sulfakinin receptor protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | g protein linked acetylcholine receptor gar 2a | 0.028 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0185 | 0.5529 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Giardia lamblia | Cathepsin B precursor | 0.0067 | 0 | 0.5 |
| Schistosoma mansoni | amine GPCR | 0.028 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | G protein coupled 5 hydroxytryptamine receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | alpha 1A adrenergic receptor | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Brugia malayi | G-protein-linked acetylcholine receptor protein 2, putative | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptides capa receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/somatostatin)-like receptor | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | growth hormone secretagogue receptor type 1 | 0.028 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | peptide (allatostatin)-like receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | g-protein coupled receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | sex peptide receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0072 | 0.0242 | 0.0242 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0072 | 0.0242 | 0.5 |
| Loa Loa (eye worm) | G-protein coupled receptor | 0.028 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0067 | 0 | 0.5 |
| Echinococcus multilocularis | peptide (allatostatin:somatostatin) | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Echinococcus multilocularis | neuropeptide Y receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | alpha 1A adrenergic receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0177 | 0.5169 | 0.5169 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0177 | 0.5169 | 0.5169 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | dro:myosuppressin receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | somatostatin receptor | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | orexin receptor type 2 | 0.028 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Schistosoma mansoni | opsin-like receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Toxoplasma gondii | cathepsin CPL | 0.0072 | 0.0242 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | peptide (FMRFamide/neurokinin-3)-like receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0177 | 0.5169 | 0.5169 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0072 | 0.0242 | 0.5 |
| Echinococcus multilocularis | allatostatin A receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Brugia malayi | Unidentified vitellogenin-linked transcript protein 6, putative | 0.028 | 1 | 1 |
| Brugia malayi | follicle stimulating hormone receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | thyrotropin-releasing hormone receptor | 0.028 | 1 | 1 |
| Plasmodium vivax | vivapain-2 | 0.0072 | 0.0242 | 0.5 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Echinococcus multilocularis | g protein linked acetylcholine receptor gar 2a | 0.028 | 1 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | G-protein coupled receptor, putative | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | 7TM GPCR, rhodopsin | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0185 | 0.5529 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | amine GPCR | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | pyroglutamylated rfamide peptide receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | orexin receptor type 2 | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0072 | 0.0242 | 0.5 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.028 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | biogenic amine (5HT) receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | alpha-1 adrenergic receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0067 | 0 | 0.5 |
| Brugia malayi | Melatonin receptor type 1A | 0.028 | 1 | 1 |
| Echinococcus granulosus | G protein coupled receptor 139 | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | fibroinase | 0.0072 | 0.0242 | 0.0242 |
| Schistosoma mansoni | muscarinic acetylcholine (GAR) receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Brugia malayi | ORL1-like opioid receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | g protein coupled receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | thyrotropin releasing hormone receptor | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0072 | 0.0242 | 0.0438 |
| Echinococcus multilocularis | g protein coupled receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide FF receptor 2 | 0.028 | 1 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0072 | 0.0242 | 0.0438 |
| Echinococcus multilocularis | cathepsin b | 0.0177 | 0.5169 | 0.5049 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Echinococcus granulosus | biogenic amine 5HT receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0177 | 0.5169 | 0.5049 |
| Brugia malayi | G-protein coupled receptor | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Brugia malayi | gonadotropin-releasing hormone receptor 2 | 0.028 | 1 | 1 |
| Schistosoma mansoni | adenoreceptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0072 | 0.0242 | 0.0242 |
| Brugia malayi | putative neuropeptide receptor NPR1 | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | G-protein-linked acetylcholine receptor protein 2 | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Schistosoma mansoni | amine GPCR | 0.028 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0163 | 0.4493 | 0.8125 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.028 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.028 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (5HT) receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | neuropeptide F-like receptor | 0.028 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 1, putative (partial) | 0.028 | 1 | 1 |
| Brugia malayi | putative neuropeptide receptor | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Echinococcus multilocularis | neuropeptides capa receptor | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.028 | 1 | 1 |
| Echinococcus granulosus | tm gpcr rhodopsin | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine receptor | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0072 | 0.0242 | 0.0438 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Brugia malayi | Dopamine receptor protein 2 | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | neuropeptide F receptor | 0.028 | 1 | 1 |
| Echinococcus granulosus | neuropeptide s receptor | 0.028 | 1 | 1 |
| Brugia malayi | neuropeptide F receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | neuropeptide receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0177 | 0.5169 | 0.5049 |
| Loa Loa (eye worm) | TYRA-2 protein | 0.028 | 1 | 1 |
| Brugia malayi | AKH receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | unidentified vitellogenin-linked transcript protein 6 | 0.028 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0185 | 0.5529 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus granulosus | cathepsin b | 0.0177 | 0.5169 | 0.5049 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus granulosus | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Echinococcus multilocularis | serotonin receptor | 0.028 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0072 | 0.0242 | 0.0242 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0185 | 0.5529 | 1 |
| Onchocerca volvulus | 0.028 | 1 | 1 | |
| Echinococcus granulosus | allatostatin A receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.028 | 1 | 1 |
| Brugia malayi | Serotonin/octopamine receptor family protein 7 | 0.028 | 1 | 1 |
| Brugia malayi | Serotonin receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | g-protein coupled receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | ancient conserved domain protein 2 (cyclin m2) | 0.028 | 1 | 1 |
| Echinococcus multilocularis | fmrfamide receptor | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.0072 | 0.0242 | 0.0242 |
| Plasmodium vivax | vivapain-2 | 0.0072 | 0.0242 | 0.5 |
| Echinococcus multilocularis | tm gpcr rhodopsin gpcr rhodopsin superfamily | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
| Echinococcus granulosus | g protein coupled receptor | 0.028 | 1 | 1 |
| Echinococcus multilocularis | rhodopsin orphan GPCR | 0.028 | 1 | 1 |
| Schistosoma mansoni | biogenic amine (dopamine) receptor | 0.028 | 1 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Loa Loa (eye worm) | melatonin receptor type 1A | 0.028 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0185 | 0.5529 | 1 |
| Schistosoma mansoni | rhodopsin-like orphan GPCR | 0.028 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0072 | 0.0242 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ID50 (functional) | = 0.075 ug ml-1 | Inhibitory effect on the proliferation of human T-lymphocyte (MT-4) | ChEMBL. | 1324318 |
| ID50 (functional) | = 0.11 ug ml-1 | Inhibitory effect on the proliferation of murine leukemia cells (L1210) | ChEMBL. | 1324318 |
| ID50 (functional) | = 0.12 ug ml-1 | Inhibitory effect on the proliferation of human T-lymphoblast cells (Molt-4F) | ChEMBL. | 1324318 |
| MCC (functional) | > 4 ug ml-1 | Evaluation in HeLa cell cultures for cytotoxicity that is to cause microscopically detectable alteration of normal cell morphology | ChEMBL. | 1324318 |
| MIC (functional) | = 0.2 ug ml-1 | Evaluation for antiviral activity against vesicular stomatitis virus in HeLa cell cultures(Concentration required to reduce virus-induced cytopathogenicity by 50%) | ChEMBL. | 1324318 |
| MIC (functional) | = 0.7 ug ml-1 | Evaluation for antiviral activity against Coxsackie virus B4 in HeLa cell cultures(Concentration required to reduce virus-induced cytopathogenicity by 50%) | ChEMBL. | 1324318 |
| MIC (functional) | = 0.7 ug ml-1 | Evaluation for antiviral activity against polio virus-1 in HeLa cell cultures(Concentration required to reduce virus-induced cytopathogenicity by 50%) | ChEMBL. | 1324318 |
| MIC (functional) | = 0.8 ug ml-1 | Compound was evaluated for antiviral activity against respiratory syncitial virus (long) in HeLa cell cultures(Concentration required to reduce virus-induced cytopathogenicity by 50%) | ChEMBL. | 1324318 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL2112491
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.