Species | Target name | Source | Bibliographic reference |
---|---|---|---|
Homo sapiens | epidermal growth factor receptor | Starlite/ChEMBL | References |
Species | Potential target | Raw | Global | Species |
---|---|---|---|---|
Trypanosoma cruzi | Silent information regulator 2 related protein 1 | 0.1224 | 1 | 1 |
Schistosoma mansoni | tyrosine kinase | 0.0096 | 0.0342 | 0.0327 |
Echinococcus multilocularis | chromatin regulatory protein sir2 | 0.1224 | 1 | 1 |
Plasmodium falciparum | transcriptional regulatory protein sir2a | 0.0181 | 0.1069 | 0.5 |
Schistosoma mansoni | tyrosine kinase | 0.0096 | 0.0342 | 0.0327 |
Plasmodium vivax | hypothetical protein, conserved | 0.0181 | 0.1069 | 0.5 |
Loa Loa (eye worm) | sirtuin 4 | 0.0181 | 0.1069 | 0.1055 |
Schistosoma mansoni | tyrosine kinase | 0.0097 | 0.0351 | 0.0336 |
Leishmania major | silent information regulator 2, putative | 0.1224 | 1 | 1 |
Echinococcus granulosus | NAD dependent deacetylase sirtuin 7 | 0.0181 | 0.1069 | 0.1055 |
Brugia malayi | NAD-dependent deacetylase SIRT1 | 0.0181 | 0.1069 | 0.1055 |
Echinococcus multilocularis | insulin growth factor 1 receptor beta | 0.0058 | 0.0015 | 0.0015 |
Trichomonas vaginalis | chromatin regulatory protein sir2, putative | 0.1224 | 1 | 1 |
Schistosoma mansoni | tyrosine kinase | 0.0096 | 0.0342 | 0.0327 |
Mycobacterium tuberculosis | Transcriptional regulatory protein | 0.0181 | 0.1069 | 0.5 |
Trypanosoma brucei | Silent information regulator 2 related protein 1 | 0.1224 | 1 | 1 |
Plasmodium falciparum | transcriptional regulatory protein sir2b | 0.0181 | 0.1069 | 0.5 |
Echinococcus multilocularis | NAD dependent deacetylase sirtuin 3 | 0.1224 | 1 | 1 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.0181 | 0.1069 | 0.1055 |
Mycobacterium ulcerans | NAD-dependent deacetylase | 0.0181 | 0.1069 | 0.5 |
Echinococcus granulosus | melanoma receptor tyrosine protein kinase | 0.0097 | 0.0351 | 0.0336 |
Echinococcus multilocularis | NAD dependent deacetylase sirtuin 6 | 0.0181 | 0.1069 | 0.1069 |
Toxoplasma gondii | histone deacetylase SIR2 | 0.0181 | 0.1069 | 0.5 |
Loa Loa (eye worm) | transcriptional regulator | 0.1224 | 1 | 1 |
Echinococcus granulosus | NAD dependent deacetylase sirtuin 1 | 0.0181 | 0.1069 | 0.1055 |
Loa Loa (eye worm) | hypothetical protein | 0.0181 | 0.1069 | 0.1055 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.0181 | 0.1069 | 0.1055 |
Mycobacterium ulcerans | Sir2-like regulatory protein | 0.0181 | 0.1069 | 0.5 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.1224 | 1 | 1 |
Entamoeba histolytica | Sir2 family transcriptional regulator, putative | 0.1224 | 1 | 1 |
Echinococcus granulosus | chromatin regulatory protein sir2 | 0.1224 | 1 | 1 |
Giardia lamblia | Hypothetical protein | 0.1224 | 1 | 1 |
Schistosoma mansoni | tyrosine kinase | 0.0097 | 0.0351 | 0.0336 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.0181 | 0.1069 | 0.1055 |
Brugia malayi | transcriptional regulator, Sir2 family protein | 0.0181 | 0.1069 | 0.1055 |
Loa Loa (eye worm) | TK/EGFR protein kinase | 0.018 | 0.1064 | 0.105 |
Trypanosoma cruzi | Silent information regulator 2 related protein 1 | 0.1224 | 1 | 1 |
Echinococcus multilocularis | epidermal growth factor receptor | 0.0097 | 0.0351 | 0.0351 |
Echinococcus multilocularis | NAD dependent deacetylase sirtuin 7 | 0.0181 | 0.1069 | 0.1069 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.1224 | 1 | 1 |
Echinococcus granulosus | epidermal growth factor receptor | 0.018 | 0.1064 | 0.105 |
Brugia malayi | Furin-like cysteine rich region family protein | 0.018 | 0.1064 | 0.105 |
Toxoplasma gondii | histone deacetylase SIR2-like | 0.0181 | 0.1069 | 0.5 |
Loa Loa (eye worm) | transcriptional regulator | 0.0181 | 0.1069 | 0.1055 |
Echinococcus multilocularis | epidermal growth factor receptor | 0.018 | 0.1064 | 0.1064 |
Trichomonas vaginalis | chromatin regulatory protein sir2, putative | 0.1224 | 1 | 1 |
Loa Loa (eye worm) | transcriptional regulator | 0.0181 | 0.1069 | 0.1055 |
Echinococcus granulosus | epidermal growth factor receptor | 0.0097 | 0.0351 | 0.0336 |
Schistosoma mansoni | tyrosine kinase | 0.018 | 0.1064 | 0.105 |
Echinococcus granulosus | NAD dependent deacetylase sirtuin 6 | 0.0181 | 0.1069 | 0.1055 |
Brugia malayi | transcriptional regulator, Sir2 family protein | 0.0181 | 0.1069 | 0.1055 |
Entamoeba histolytica | Sir2 family transcriptional regulator, putative | 0.1224 | 1 | 1 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.0181 | 0.1069 | 0.1055 |
Echinococcus multilocularis | NAD dependent deacetylase sirtuin 1 | 0.0181 | 0.1069 | 0.1069 |
Echinococcus granulosus | NAD dependent deacetylase sirtuin 3 | 0.1224 | 1 | 1 |
Echinococcus multilocularis | insulin receptor | 0.0058 | 0.0015 | 0.0015 |
Schistosoma mansoni | chromatin regulatory protein sir2 | 0.1224 | 1 | 1 |
Plasmodium vivax | NAD-dependent deacetylase, putative | 0.0181 | 0.1069 | 0.5 |
Activity type | Activity value | Assay description | Source | Reference |
---|---|---|---|---|
IC50 (binding) | = 12.1 nM | Inhibition of EGFR (unknown origin) using biotinylated-PTP1B (Tyr66) as substrate incubated for 5 mins prior to substrate addition measured after 1 hr by ELISA | ChEMBL. | 22867529 |
Inhibition (binding) | = 100 % | Inhibition of EGFR (unknown origin) using biotinylated-PTP1B (Tyr66) as substrate at 10 uM incubated for 5 mins prior to substrate addition measured after 1 hr by ELISA relative to N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinazolin-4-amine | ChEMBL. | 22867529 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
1 literature reference was collected for this gene.