Detailed information for compound 378934
Basic information
Technical information
- Name: Unnamed compound
- MW: 962.215 | Formula: C55H79NO13
-
H donors: 3
H acceptors: 7
LogP: 7.1
Rotable bonds: 10
Rule of 5 violations (Lipinski): 2 - SMILES: CO[C@@H]1CC(CC[C@H]1OC[C@H](c1ccc2c(c1)cccc2)O)/C=C(/[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)O[C@H]([C@H](C[C@H](C/C(=C/[C@H](C(=O)C[C@H]([C@H]1C)O)CC)/C)C)OC)[C@H](C[C@H]2C)OC)\C
- InChi: 1S/C55H79NO13/c1-10-38-24-32(2)23-33(3)25-48(65-8)51-49(66-9)27-35(5)55(63,69-51)52(60)53(61)56-22-14-13-17-42(56)54(62)68-50(36(6)43(57)30-44(38)58)34(4)26-37-18-21-46(47(28-37)64-7)67-31-45(59)41-20-19-39-15-11-12-16-40(39)29-41/h11-12,15-16,19-20,24,26,29,33,35-38,42-43,45-51,57,59,63H,10,13-14,17-18,21-23,25,27-28,30-31H2,1-9H3/b32-24+,34-26+/t33-,35+,36+,37?,38+,42-,43+,45+,46+,47+,48-,49-,50+,51+,55+/m0/s1
- InChiKey: VFCMWGVGMXLRFV-XRZJBRGTSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | FK506 binding protein 1A, 12kDa | Starlite/ChEMBL | References |
| Homo sapiens | protein phosphatase 3, catalytic subunit, alpha isozyme | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | macrophage infectivity potentiator, precursor, putative | FK506 binding protein 1A, 12kDa | 108 aa | 107 aa | 48.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | protein phosphatase-2b | 0.0051 | 0.7066 | 0.7066 |
| Onchocerca volvulus | Dopamine\/Ecdysteroid receptor homolog | 0.0016 | 0 | 0.5 |
| Plasmodium vivax | 70 kDa peptidylprolyl isomerase, putative | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Loa Loa (eye worm) | FKBP-type peptidyl-prolyl cis-trans isomerase-12 | 0.0065 | 1 | 1 |
| Echinococcus multilocularis | serine:threonine protein phosphatase 2B | 0.0051 | 0.7066 | 0.7066 |
| Schistosoma mansoni | immunophilin | 0.0056 | 0.8193 | 0.8193 |
| Trichomonas vaginalis | peptidylprolyl isomerase, putative | 0.0065 | 1 | 0.5 |
| Echinococcus multilocularis | peptidyl prolyl cis trans isomerase FKBP4 | 0.0056 | 0.8193 | 0.8193 |
| Brugia malayi | FKBP-type peptidyl-prolyl cis-trans isomerase-59, BmFKBP59 | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Toxoplasma gondii | protein phosphatase 2B catalytic subunit, calcineurin family phosphatse superfamily protein | 0.0051 | 0.7066 | 0.5 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Entamoeba histolytica | peptidyl-prolyl cis-trans isomerase, FKBP-type , putative | 0.0065 | 1 | 1 |
| Schistosoma mansoni | protein phosphatase-2b | 0.0051 | 0.7066 | 0.7066 |
| Trichomonas vaginalis | fk506-binding protein, putative | 0.0065 | 1 | 0.5 |
| Leishmania major | fk506-binding protein 1-like protein | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Schistosoma mansoni | immunophilin FK506 binding protein FKBP12 | 0.0065 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 0.7066 | 0.7066 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Schistosoma mansoni | immunophilin | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Brugia malayi | Serine/threonine protein phosphatase 2B catalytic subunit 2 | 0.0051 | 0.7066 | 0.7066 |
| Echinococcus multilocularis | peptidyl prolyl cis trans isomerase FKBP4 | 0.0065 | 1 | 1 |
| Leishmania major | peptidylprolyl isomerase-like protein | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Treponema pallidum | peptidyl-prolyl cis-trans isomerase, FKBP-type, 22 kDa (fklB) | 0.0065 | 1 | 0.5 |
| Giardia lamblia | FKBP-type peptidyl-prolyl cis-trans isomerase | 0.0065 | 1 | 0.5 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP4 | 0.0065 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.005 | 0.6922 | 0.6922 |
| Entamoeba histolytica | peptidyl-prolyl cis-trans isomerase, FKBP-type, putative | 0.0065 | 1 | 1 |
| Echinococcus multilocularis | serine:threonine protein phosphatase 2B | 0.0051 | 0.7066 | 0.7066 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Trypanosoma brucei | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 1 | 1 |
| Echinococcus granulosus | serine:threonine protein phosphatase 2B | 0.0051 | 0.7066 | 0.7066 |
| Echinococcus granulosus | serine:threonine protein phosphatase 2B | 0.0051 | 0.7066 | 0.7066 |
| Loa Loa (eye worm) | FKBP5 protein | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Trichomonas vaginalis | immunophilin, putative | 0.0065 | 1 | 0.5 |
| Trypanosoma cruzi | peptidyl-prolyl cis-trans isomerase, putative | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Mycobacterium ulcerans | FK-506 binding protein, peptidyl-prolyl cis-trans isomerase | 0.0065 | 1 | 0.5 |
| Schistosoma mansoni | immunophilin | 0.0065 | 1 | 1 |
| Onchocerca volvulus | Neuropeptide F receptor homolog | 0.0016 | 0 | 0.5 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP4 | 0.0056 | 0.8193 | 0.8193 |
| Plasmodium falciparum | peptidyl-prolyl cis-trans isomerase FKBP35 | 0.0065 | 1 | 1 |
| Trypanosoma cruzi | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 1 | 1 |
| Onchocerca volvulus | 0.0016 | 0 | 0.5 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0056 | 0.8193 | 0.8193 |
| Echinococcus multilocularis | fk506 binding protein | 0.0065 | 1 | 1 |
| Trichomonas vaginalis | peptidylprolyl isomerase, putative | 0.0065 | 1 | 0.5 |
| Trypanosoma cruzi | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 1 | 1 |
| Giardia lamblia | 70 kDa peptidylprolyl isomerase, putative | 0.0065 | 1 | 0.5 |
| Trypanosoma brucei | FK506-binding protein (FKBP)-type peptidyl-prolyl isomerase, putative | 0.0065 | 1 | 1 |
| Echinococcus granulosus | peptidyl prolyl cis trans isomerase FKBP1A | 0.0065 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (binding) | = 21.1 nM | Effective concentration against FK506 binding protein 12 using [3H]-dihydro FK-506 | ChEMBL. | 10450987 |
| EC50 (binding) | = 21.1 nM | Effective concentration against FK506 binding protein 12 using [3H]-dihydro FK-506 | ChEMBL. | 10450987 |
| ED50 (functional) | = 0.38 mg kg-1 | In vivo immunosuppression in murine models by splenic T-cell proliferation assay after intravenous administration | ChEMBL. | 10450987 |
| ED50 (functional) | = 0.38 mg kg-1 | In vivo immunosuppression in murine models by splenic T-cell proliferation assay after intravenous administration | ChEMBL. | 10450987 |
| ED50 (functional) | = 3.7 mg kg-1 | In vivo immunosuppression in murine models by splenic T-cell proliferation assay after peroral administration | ChEMBL. | 10450987 |
| ED50 (functional) | = 3.7 mg kg-1 | In vivo immunosuppression in murine models by splenic T-cell proliferation assay after peroral administration | ChEMBL. | 10450987 |
| ED50 (functional) | = 21.6 mg kg-1 | Cytotoxicity was determined by hypothermia induction after intravenous administration in rat | ChEMBL. | 10450987 |
| IC50 (functional) | = 0.33 nM | The compound was tested for its inhibitory activity against T-cell proliferation using murine splenic T-cells | ChEMBL. | 10450987 |
| IC50 (functional) | = 0.33 nM | The compound was tested for its inhibitory activity against T-cell proliferation using murine splenic T-cells | ChEMBL. | 10450987 |
| IC50 (binding) | = 2.8 nM | Inhibitory activity against Calcineurin (CaN phosphatase) | ChEMBL. | 10450987 |
| IC50 (binding) | = 2.8 nM | Inhibitory activity against Calcineurin (CaN phosphatase) | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | 0 mg dl-1 | Tested for nephrotoxicity in Dawley rats and measured for blood urea nitrogen levels after intravenous administration at dose 2.5 mg/kg; ND denotes not determined | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | 0 mg dl-1 | Tested for nephrotoxicity in Dawley rats and measured for plasma drug level after intravenous administration at dose 2.5 mg/kg; ND denotes not determined | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 16.3 mg dl-1 | Tested for nephrotoxicity in Dawley rats and measured for blood urea nitrogen levels after intravenous administration at dose 5 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 17.7 mg dl-1 | Tested for nephrotoxicity in Dawley rats and measured for blood urea nitrogen levels after intravenous administration at dose 10 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 24.7 mg dl-1 | Tested for nephrotoxicity in Dawley rats and measured for blood urea nitrogen levels after intravenous administration at dose 20 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 39.3 mg dl-1 | Tested for nephrotoxicity in Dawley rats and measured for blood urea nitrogen levels after intravenous administration at dose 40 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 239 ng ml-1 | Tested for nephrotoxicity in Dawley rats and measured for plasma drug level after intravenous administration at dose 5 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 478 ng ml-1 | Tested for nephrotoxicity in Dawley rats and measured for plasma drug level after intravenous administration at dose 10 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 1897 ng ml-1 | Tested for nephrotoxicity in Dawley rats and measured for plasma drug level after intravenous administration at dose 20 mg/kg | ChEMBL. | 10450987 |
| Nephrotoxicity (functional) | = 3120 ng ml-1 | Tested for nephrotoxicity in Dawley rats and measured for plasma drug level after intravenous administration at dose 40 mg/kg | ChEMBL. | 10450987 |
| Reduction (functional) | = 41 % | The compound was tested for % reduction of nephrotoxicity in rat after intravenous administration at dose 20 mg/kg | ChEMBL. | 10450987 |
| Therapeutic index (functional) | = 57 | Ratio of hypothermia (ED50) by Murine (ED50) in vivo | ChEMBL. | 10450987 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Mus musculus | ChEMBL23 | 10450987 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL407332
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.