Detailed information for compound 1350449
Basic information
Technical information
- TDR Targets ID: 1350449
- Name: 3-(4-morpholin-4-ylsulfonylphenyl)-5,6-dihydr oimidazo[2,1-b][1,3]thiazole hydrobromide
- MW: 432.356 | Formula: C15H18BrN3O3S2
-
H donors: 0
H acceptors: 2
LogP: 1.51
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: O=S(=O)(c1ccc(cc1)c1csc2=NCCn12)N1CCOCC1.Br
- InChi: 1S/C15H17N3O3S2.BrH/c19-23(20,17-7-9-21-10-8-17)13-3-1-12(2-4-13)14-11-22-15-16-5-6-18(14)15;/h1-4,11H,5-10H2;1H
- InChiKey: RVMJHZOGHCIWPU-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- hydron; 3-(4-morpholin-4-ylsulfonylphenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole; bromide
- 3-(4-morpholinosulfonylphenyl)-5,6-dihydroimidazo[2,1-b]thiazole hydrobromide
- hydron; 3-(4-morpholinosulfonylphenyl)-5,6-dihydroimidazo[2,1-b]thiazole; bromide
- 3-[4-(morpholin-4-ylsulfonyl)phenyl]-5,6-dihydroimidazo[2,1-b][1,3]thiazole
- MLS000047719
- SMR000033728
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Equus caballus | Ferritin light chain | Starlite/ChEMBL | No references |
| Homo sapiens | aldehyde dehydrogenase 1 family, member A1 | Starlite/ChEMBL | No references |
| Trypanosoma cruzi | cysteine peptidase, putative | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Schistosoma mansoni | apoferritin-2 | Ferritin light chain | 175 aa | 142 aa | 29.6 % |
| Schistosoma mansoni | ferritin | Ferritin light chain | 175 aa | 171 aa | 44.4 % |
| Echinococcus multilocularis | expressed protein | Ferritin light chain | 175 aa | 146 aa | 30.1 % |
| Echinococcus granulosus | expressed protein | Ferritin light chain | 175 aa | 146 aa | 28.8 % |
| Schistosoma mansoni | ferritin | Ferritin light chain | 175 aa | 171 aa | 43.9 % |
| Schistosoma japonicum | Ferritin, putative | Ferritin light chain | 175 aa | 144 aa | 24.3 % |
| Mycobacterium tuberculosis | Succinate-semialdehyde dehydrogenase [NADP+] dependent (SSDH) GabD1 | aldehyde dehydrogenase 1 family, member A1 | 501 aa | 456 aa | 33.3 % |
| Schistosoma mansoni | apoferritin-2 | Ferritin light chain | 175 aa | 146 aa | 28.8 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0014 | 0.0108 | 0.0108 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.034 | 0.034 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.2181 | 0.5 |
| Schistosoma mansoni | choline/ethanolamine kinase | 0.0029 | 0.0643 | 0.2946 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.2181 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.034 | 0.529 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.034 | 0.4337 |
| Onchocerca volvulus | Cathepsin F homolog | 0.002 | 0.034 | 0.4337 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0108 | 0.0108 |
| Schistosoma mansoni | choline kinase | 0.0029 | 0.0643 | 0.2946 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.034 | 0.034 |
| Onchocerca volvulus | 0.0029 | 0.0643 | 1 | |
| Loa Loa (eye worm) | cysteine protease | 0.002 | 0.034 | 0.0234 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.002 | 0.034 | 0.0234 |
| Trypanosoma cruzi | choline kinase | 0.0029 | 0.0643 | 0.2782 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.231 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Loa Loa (eye worm) | choline Kinase A | 0.0029 | 0.0643 | 0.054 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.034 | 0.0234 |
| Echinococcus multilocularis | aldehyde dehydrogenase, mitochondrial | 0.0073 | 0.2181 | 0.2181 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.002 | 0.034 | 0.034 |
| Plasmodium falciparum | ethanolamine kinase | 0.0029 | 0.0643 | 0.0643 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0014 | 0.0108 | 0.0496 |
| Trypanosoma cruzi | choline ethanolamine kinase, putative | 0.0029 | 0.0643 | 0.2782 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0014 | 0.0108 | 0.0108 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.034 | 0.034 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.002 | 0.034 | 0.1472 |
| Mycobacterium tuberculosis | Probable aldehyde dehydrogenase | 0.0073 | 0.2181 | 0.5 |
| Plasmodium falciparum | choline kinase | 0.0299 | 1 | 1 |
| Plasmodium vivax | choline kinase, putative | 0.0299 | 1 | 1 |
| Entamoeba histolytica | choline/ethanolamine kinase, putative | 0.0029 | 0.0643 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0014 | 0.0108 | 0.1683 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0108 | 0.1683 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.231 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Echinococcus multilocularis | choline:ethanolamine kinase | 0.0299 | 1 | 1 |
| Giardia lamblia | Ethanolamine kinase, putative | 0.0029 | 0.0643 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0014 | 0.0108 | 0.1683 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0073 | 0.2181 | 1 |
| Trypanosoma brucei | choline/ethanolamine kinase | 0.0029 | 0.0643 | 0.2782 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Plasmodium vivax | ethanolamine kinase, putative | 0.0029 | 0.0643 | 0.0643 |
| Leishmania major | cathepsin L-like protease | 0.0077 | 0.231 | 1 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.2181 | 0.5 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.002 | 0.034 | 0.034 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.034 | 0.034 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.034 | 0.034 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.002 | 0.034 | 0.0234 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.034 | 0.1558 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.231 | 1 |
| Echinococcus multilocularis | ethanolamine kinase 2 | 0.0029 | 0.0643 | 0.0643 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.002 | 0.034 | 0.529 |
| Echinococcus granulosus | choline:ethanolamine kinase | 0.0299 | 1 | 1 |
| Leishmania major | aldehyde dehydrogenase, mitochondrial precursor | 0.0073 | 0.2181 | 0.9347 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.231 | 1 |
| Leishmania major | choline/ethanolamine kinase, putative | 0.0029 | 0.0643 | 0.1536 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0061 | 0.1738 | 0.7525 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0643 | 0.054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Toxoplasma gondii | phosphotransferase enzyme family protein | 0.0299 | 1 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.034 | 0.034 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.002 | 0.034 | 0.034 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0073 | 0.2181 | 1 |
| Toxoplasma gondii | aldehyde dehydrogenase | 0.0073 | 0.2181 | 0.1906 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.002 | 0.034 | 0.034 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.002 | 0.034 | 0.034 |
| Echinococcus granulosus | cathepsin l1 | 0.002 | 0.034 | 0.034 |
| Toxoplasma gondii | phosphotransferase enzyme family protein | 0.0029 | 0.0643 | 0.0313 |
| Onchocerca volvulus | Cathepsin L homolog | 0.002 | 0.034 | 0.4337 |
| Echinococcus granulosus | ethanolamine kinase 2 | 0.0029 | 0.0643 | 0.0643 |
| Brugia malayi | Choline/ethanolamine kinase family protein | 0.0029 | 0.0643 | 0.0643 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Echinococcus granulosus | aldehyde dehydrogenase mitochondrial | 0.0073 | 0.2181 | 0.2181 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.034 | 0.034 |
| Loa Loa (eye worm) | fibroinase | 0.002 | 0.034 | 0.0234 |
| Loa Loa (eye worm) | ctsf protein | 0.002 | 0.034 | 0.0234 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Schistosoma mansoni | choline/ethanolamine kinase | 0.0029 | 0.0643 | 0.2946 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0077 | 0.231 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.002 | 0.034 | 0.034 |
| Trypanosoma brucei | choline kinase | 0.0029 | 0.0643 | 0.2782 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.034 | 0.034 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.002 | 0.034 | 0.034 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.002 | 0.034 | 0.1558 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trichomonas vaginalis | choline/ethanolamine kinase, putative | 0.0029 | 0.0643 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Onchocerca volvulus | 0.002 | 0.034 | 0.4337 | |
| Loa Loa (eye worm) | choline/ethanolamine kinase | 0.0299 | 1 | 1 |
| Loa Loa (eye worm) | choline/ethanolamine kinase | 0.0029 | 0.0643 | 0.054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Leishmania major | choline kinase | 0.0029 | 0.0643 | 0.1536 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.007 | 0.2078 | 0.8997 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0077 | 0.231 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Toxoplasma gondii | phosphotransferase enzyme family protein | 0.0029 | 0.0643 | 0.0313 |
| Echinococcus multilocularis | cysteine protease | 0.002 | 0.034 | 0.034 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.002 | 0.034 | 0.034 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Brugia malayi | cathepsin L-like precursor | 0.0014 | 0.0108 | 0.0108 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.034 | 0.034 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Entamoeba histolytica | cysteine protease, putative | 0.002 | 0.034 | 0.529 |
| Echinococcus granulosus | cathepsin l1 | 0.0014 | 0.0108 | 0.0108 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Entamoeba histolytica | choline/ethanolamine kinase, putative | 0.0029 | 0.0643 | 1 |
| Plasmodium vivax | vivapain-2 | 0.002 | 0.034 | 0.034 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0077 | 0.231 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.002 | 0.034 | 0.034 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.002 | 0.034 | 0.529 |
| Brugia malayi | Choline/ethanolamine kinase family protein | 0.0029 | 0.0643 | 0.0643 |
| Onchocerca volvulus | Putative choline\/ethanolamine kinase | 0.0029 | 0.0643 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Potency (binding) | = 0.8913 um | PUBCHEM_BIOASSAY: qHTS Assay for Identification of Novel General Anesthetics. In this assay, a GABAergic mimetic model system, apoferritin and a profluorescent 1-aminoanthracene ligand (1-AMA), was used to construct a competitive binding assay for identification of novel general anesthetics (Class of assay: confirmatory) [Related pubchem assays: 2385 (Probe Development Summary for Identification of Novel General Anesthetics), 2323 (Validation apoferritin assay run on SigmaAldrich LOPAC1280 collection)] | ChEMBL. | No reference |
| Potency (functional) | 2.9362 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HADH2 (Hydroxyacyl-Coenzyme A Dehydrogenase, Type II). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Human Jumonji Domain Containing 2E (JMJD2E). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase). (Class of assay: confirmatory) [Related pubchem assays: 2429 (Confirmation qHTS Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2407 (Probe Development Summary for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase)), 2427 (Thermal Shift Assay for Inhibitors of HPGD (15-Hydroxyprostaglandin Dehydrogenase))] | ChEMBL. | No reference |
| Potency (functional) | 39.8107 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Activators of N370S glucocerebrosidase as a Potential Chaperone Treatment of Gaucher Disease. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID1473, AID2293, AID2577, AID2578, AID2587, AID2588, AID2589, AID2590, AID2592, AID2593, AID2595, AID2596, AID2597, AID2613, AID2671, AID488845] | ChEMBL. | No reference |
| Potency (functional) | = 56.2341 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1445467
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.