Detailed information for compound 1973961
Basic information
Technical information
- Name: Unnamed compound
- MW: 867.999 | Formula: C45H62FN5O11
-
H donors: 6
H acceptors: 9
LogP: 4.3
Rotable bonds: 10
Rule of 5 violations (Lipinski): 3 - SMILES: CC(=O)CC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc2cc(O)cc(c2)F)C(=O)N2CCCC(N2)C(=O)O[C@@H](C/C=C/C=C/[C@@H]([C@@H]([C@H]1O)C)O)/C(=C/C=C/C(=O)N1CCCCO1)/C
- InChi: 1S/C45H62FN5O11/c1-27(2)40-43(58)47-36(25-31-23-32(46)26-33(53)24-31)44(59)50-20-12-14-35(49-50)45(60)62-38(28(3)13-11-17-39(55)51-21-9-10-22-61-51)16-8-6-7-15-37(54)30(5)41(56)34(42(57)48-40)19-18-29(4)52/h6-8,11,13,15,17,23-24,26-27,30,34-38,40-41,49,53-54,56H,9-10,12,14,16,18-22,25H2,1-5H3,(H,47,58)(H,48,57)/b8-6+,15-7+,17-11+,28-13+/t30-,34+,35?,36-,37-,38-,40-,41+/m0/s1
- InChiKey: CFLBTKFHBBDVKC-RROFBZPUSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | peptidylprolyl isomerase A (cyclophilin A)-like 4C | Starlite/ChEMBL | No references |
| Homo sapiens | ATP-binding cassette, sub-family B (MDR/TAP), member 11 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier organic anion transporter family, member 1B1 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier organic anion transporter family, member 1B3 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Brugia malayi | sodium-independent organic anion transporter family protein | solute carrier organic anion transporter family, member 1B1 | 691 aa | 634 aa | 27.3 % |
| Plasmodium falciparum | peptidyl-prolyl cis-trans isomerase | peptidylprolyl isomerase A (cyclophilin A)-like 4C | 164 aa | 171 aa | 46.8 % |
| Brugia malayi | sodium-independent organic anion transporter family protein | solute carrier organic anion transporter family, member 1B3 | 702 aa | 652 aa | 28.4 % |
| Brugia malayi | ABC transporter transmembrane region family protein | ATP-binding cassette, sub-family B (MDR/TAP), member 11 | 1321 aa | 1106 aa | 23.5 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | kazal-type serine protease inhibitor domain-containing protein | 0.0046 | 0.6345 | 0.6098 |
| Entamoeba histolytica | P-glycoprotein-5 | 0.0013 | 0.0658 | 0.5 |
| Echinococcus multilocularis | ATP binding cassette sub family B | 0.0013 | 0.0634 | 0.0634 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Brugia malayi | secreted modular calcium-binding protein 1 | 0.0046 | 0.6345 | 0.6088 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Trichomonas vaginalis | ABC transporter, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus granulosus | ATP binding cassette subfamily B MDR:TAP | 0.0013 | 0.0658 | 0.0658 |
| Loa Loa (eye worm) | sodium-independent organic anion transporter | 0.0067 | 1 | 1 |
| Trichomonas vaginalis | ATP-binding cassette transporter, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus multilocularis | ATP binding cassette subfamily B (MDR:TAP) | 0.0013 | 0.0658 | 0.0658 |
| Brugia malayi | SPARC precursor | 0.0046 | 0.6345 | 0.6088 |
| Echinococcus granulosus | follistatin | 0.0046 | 0.6345 | 0.6345 |
| Loa Loa (eye worm) | ATP-binding cassette sub-family B member 2 | 0.0013 | 0.0658 | 0.0025 |
| Loa Loa (eye worm) | multidrug resistance protein 3 | 0.0013 | 0.0658 | 0.0025 |
| Schistosoma mansoni | organic anion transporter | 0.0067 | 1 | 1 |
| Trichomonas vaginalis | ABC transporter, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus multilocularis | ATP binding cassette subfamily B (MDR:TAP) | 0.0013 | 0.0658 | 0.0658 |
| Trichomonas vaginalis | abcb9, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | ABC transporter, putative | 0.0013 | 0.0658 | 1 |
| Onchocerca volvulus | Putative organic anion transporter | 0.0067 | 1 | 1 |
| Trichomonas vaginalis | ATP-binding cassette transporter, putative | 0.0013 | 0.0658 | 1 |
| Brugia malayi | Kazal-type serine protease inhibitor domain containing protein | 0.0046 | 0.6345 | 0.6088 |
| Brugia malayi | Kazal-type serine protease inhibitor domain containing protein | 0.0046 | 0.6345 | 0.6088 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | sodium-independent organic anion transporter family protein | 0.0067 | 1 | 1 |
| Echinococcus granulosus | multidrug resistance protein 1 | 0.0013 | 0.0658 | 0.0658 |
| Trichomonas vaginalis | ATP-binding cassette transporter, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | ABC transporter, putative | 0.0013 | 0.0658 | 1 |
| Entamoeba histolytica | P-glycoprotein-2 | 0.0013 | 0.0658 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.6345 | 0.6098 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Onchocerca volvulus | 0.0046 | 0.6345 | 0.6088 | |
| Schistosoma mansoni | follistatin | 0.0046 | 0.6345 | 0.6088 |
| Echinococcus multilocularis | ATP binding cassette subfamily B (MDR:TAP) | 0.0013 | 0.0658 | 0.0658 |
| Echinococcus multilocularis | multidrug resistance protein 1 | 0.0013 | 0.0658 | 0.0658 |
| Toxoplasma gondii | Kazal-type serine protease inhibitor domain-containing protein | 0.0046 | 0.6345 | 0.6088 |
| Echinococcus multilocularis | multidrug resistance protein 1 | 0.0013 | 0.0658 | 0.0658 |
| Onchocerca volvulus | Putative organic anion transporter | 0.0067 | 1 | 1 |
| Echinococcus granulosus | 5'partial|ATP binding cassette sub family B | 0.0013 | 0.0634 | 0.0634 |
| Trichomonas vaginalis | abcb9, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | ATP-binding cassette transporter, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus multilocularis | ATP binding cassette subfamily B (MDR:TAP) | 0.0013 | 0.0658 | 0.0658 |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus granulosus | ATP binding cassette subfamily B MDR:TAP | 0.0013 | 0.0658 | 0.0658 |
| Trichomonas vaginalis | abcb9, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus granulosus | multidrug resistance protein 1 | 0.0013 | 0.0658 | 0.0658 |
| Toxoplasma gondii | Kazal-type serine protease inhibitor domain-containing protein | 0.0046 | 0.6345 | 0.6088 |
| Trichomonas vaginalis | taga, putative | 0.0013 | 0.0658 | 1 |
| Chlamydia trachomatis | ABC transporter ATP binding protein/permease | 0.0013 | 0.0658 | 0.5 |
| Toxoplasma gondii | protease inhibitor PI2 | 0.0046 | 0.6345 | 0.6088 |
| Echinococcus granulosus | ATP binding cassette subfamily B MDR:TAP | 0.0013 | 0.0658 | 0.0658 |
| Brugia malayi | hypothetical protein | 0.0067 | 1 | 1 |
| Leishmania major | ATP-binding cassette protein subfamily B, member 2, putative | 0.0013 | 0.0658 | 0.5 |
| Echinococcus multilocularis | follistatin | 0.0046 | 0.6345 | 0.6345 |
| Brugia malayi | prostaglandin transporter | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus granulosus | agrin | 0.0046 | 0.6345 | 0.6345 |
| Entamoeba histolytica | P-glyco protein 6, putative | 0.0013 | 0.0658 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Brugia malayi | sodium-independent organic anion transporter family protein | 0.0067 | 1 | 1 |
| Plasmodium vivax | multidrug resistance protein 1, putative | 0.0013 | 0.0658 | 0.5 |
| Echinococcus granulosus | Solute carrier organic anion transporter family | 0.0067 | 1 | 1 |
| Echinococcus multilocularis | agrin | 0.0046 | 0.6345 | 0.6345 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0658 | 0.0025 |
| Trichomonas vaginalis | ATP-binding cassette transporter, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus granulosus | multidrug resistance protein 1 | 0.0013 | 0.0658 | 0.0658 |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Entamoeba histolytica | P-glycoprotein 5, putative | 0.0013 | 0.0658 | 0.5 |
| Schistosoma mansoni | agrin | 0.0046 | 0.6345 | 0.6088 |
| Trichomonas vaginalis | ABC transporter, half transporter, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus multilocularis | ATP binding cassette subfamily B (MDR:TAP) | 0.0013 | 0.0658 | 0.0658 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.6345 | 0.6098 |
| Echinococcus granulosus | organic anion transporting polypeptide 30B | 0.0067 | 1 | 1 |
| Entamoeba histolytica | P-glycoprotein-1 | 0.0013 | 0.0658 | 0.5 |
| Leishmania major | p-glycoprotein | 0.0013 | 0.0658 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Toxoplasma gondii | Kazal-type serine protease inhibitor domain-containing protein | 0.0046 | 0.6345 | 0.6088 |
| Entamoeba histolytica | P-glycoprotein-2, putative | 0.0013 | 0.0658 | 0.5 |
| Echinococcus multilocularis | expressed protein | 0.0046 | 0.6345 | 0.6345 |
| Entamoeba histolytica | P-glycoprotein-2 | 0.0013 | 0.0658 | 0.5 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Echinococcus granulosus | ATP binding cassette subfamily B MDR:TAP | 0.0013 | 0.0658 | 0.0658 |
| Toxoplasma gondii | Kazal-type serine protease inhibitor domain-containing protein | 0.0046 | 0.6345 | 0.6088 |
| Brugia malayi | Kazal-type serine protease inhibitor domain containing protein | 0.0046 | 0.6345 | 0.6088 |
| Loa Loa (eye worm) | agrin synaptic family protein | 0.0046 | 0.6345 | 0.6098 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0658 | 0.0025 |
| Plasmodium falciparum | multidrug resistance protein 1 | 0.0013 | 0.0658 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Trypanosoma cruzi | MFS transporter, putative | 0.0067 | 1 | 0.5 |
| Trichomonas vaginalis | lipid A export ATP-binding/permease protein msba, putative | 0.0013 | 0.0658 | 1 |
| Trichomonas vaginalis | ABC transporter, half transporter, putative | 0.0013 | 0.0658 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.6345 | 0.6098 |
| Echinococcus multilocularis | Solute carrier organic anion transporter family | 0.0067 | 1 | 1 |
| Onchocerca volvulus | 0.0067 | 1 | 1 | |
| Echinococcus multilocularis | organic anion transporting polypeptide 30B | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Mycobacterium tuberculosis | Probable transmembrane multidrug efflux pump | 0.0013 | 0.0658 | 0.5 |
| Trichomonas vaginalis | multidrug resistance protein 1, 2, putative | 0.0013 | 0.0658 | 1 |
| Brugia malayi | Kazal-type serine protease inhibitor domain containing protein | 0.0046 | 0.6345 | 0.6088 |
| Schistosoma mansoni | organic anion transporter | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.6345 | 0.6098 |
| Onchocerca volvulus | Putative organic anion transporter | 0.0067 | 1 | 1 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0067 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 0.31 nM | BindingDB_Patents: Inhibition Assay. The PPlase activity of recombinant CypA or D, produced by thrombin cleavage of GST-CypA or D, was determined by following the rate of hydrolysis of N-succinyl-Ala-Ala-Pro-Phe-p-nitroanilide by chymotrypsin. Chymotrypsin only hydrolyzes the trans form of the peptide, and hydrolysis of the cis form, the concentration of which is maximized by using a stock dissolved in trifluoroethanol containing 470 mM LiCl, is limited by the rate of cis-trans isomerization. CypA or D was equilibrated for 1 h at 5° C. with selected test article using a drug concentration range from 0.1 to 20 nM. The reaction was started by addition of the peptide, and the change in absorbance was monitored spectrophotometrically at 10 data points per second. The blank rates of hydrolysis (in the absence of CypA or D) were subtracted from the rates in the presence of CypA or D. | ChEMBL. | No reference |
| IC50 (binding) | = 1800 nM | BindingDB_Patents: In Vitro Uptake Transporter Assay. To assess the inhibition of the OAT1B1 and OAT1B3 uptake transporters, an in vitro uptake transporter assay from Solvo Biotechnology Inc. was used. Uptake experiments with Test Article (TA) at 0.068, 0.2, 0.62, 1.8, 5.5, 16.7 and 50 uM, were performed on CHO cells stably expressing human SLC transporters OATP1B1 and OATP1B3. Parental cell line CHO-K was used as negative control. Cells (1x105 in 200 ul 1:1 mixture of Dulbecco's Modified Eagle's Medium and Ham's F-12 DMEM (F-12, Lonza, N.J., US) supplemented with 5 mM sodium butyrate) were plated on standard 96-well tissue culture plates and incubated 24 hours before the experiment at 37 C. in an atmosphere of 5% CO2 and 95% air. Before experiments the medium was aspirated by vacuum suction, cells were washed with 2x100 ul of Krebs-Henseleit buffer pH 7.3 (prepared from Sigma chemicals, Sigma-Aldrich, St Louis, Mo.). Uptake experiments were carried out at 37 C. in 50 ul of Krebs-Henseleit buffer. | ChEMBL. | No reference |
| IC50 (binding) | = 12300 nM | BindingDB_Patents: Inhibition Assay. To assess the inhibition of the MRP2, MRP3 and BSEP efflux transporters, an in vitro vesicular transporter assay from Solvo Biotechnology Inc. was used. The Test Articles (TAs) (at 0.068, 0.2, 0.62, 1.8, 5.5, 16.7 and 50 uM) were incubated with efflux transporter membrane vesicles (Solvo Biotechnology Inc.) both in the absence and presence of 4 mM ATP to distinguish between transporter mediated uptake and passive diffusion of TA's into the vesicles. In the case of MRP2 and MRP3 transporters reactions were carried out in the presence of 2 mM glutathione. Reaction mixtures were preincubated for ten minutes at 37 C. Reactions were started by the addition of 25 ul of 12 mM MgATP (4 mM final concentration in assay) or assay buffer for background controls. Reactions were stopped by adding 200 ul of ice-cold washing buffer and immediately followed by filtration on glass fiber filters in a 96-well format (filter plate). | ChEMBL. | No reference |
| IC50 (binding) | > 50000 nM | BindingDB_Patents: In Vitro ATPase Assay. To assess the inhibition of the P-glycoprotein (Pgp/MDR1) transporter, an in vitro ATPase assay from Cyprotex was used. MDR1MDCK cells obtained from the NIH (Rockville, Md., USA) were used. Following culture, the monolayers were prepared by rinsing both basolateral and apical surfaces twice with buffer at pH 7.4 and 37 C. Cells were then incubated with pH 7.4 buffer in both apical and basolateral compartments for 40 min at 37 C. and 5% CO2 with a relative humidity of 95% to stabilise physiological parameters. For the apical to basolateral study (A-B), buffer at pH 7.4 was removed from the apical compartment and replaced with loperamide dosing solutions before being placed in the companion plates. The solutions were prepared by diluting loperamide in DMSO with buffer to give a final loperamide concentration of 5 uM (final DMSO concentration adjusted to 1%). The fluorescent integrity marker Lucifer yellow was also included in the dosing solution. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
No external resources registered for this compound
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.