Detailed information for compound 200305
Basic information
Technical information
- TDR Targets ID: 200305
- Name: [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[[(2S)-4-m ethyl-2-(phenylmethoxycarbonylamino)pentanoyl ]amino]pentanoyl]amino]butyl]boronic acid
- MW: 491.428 | Formula: C25H42BN3O6
-
H donors: 5
H acceptors: 5
LogP: 4.27
Rotable bonds: 18
Rule of 5 violations (Lipinski): 1 - SMILES: CC(C[C@@H](C(=O)N[C@H](C(=O)N[C@H](B(O)O)CC(C)C)CC(C)C)NC(=O)OCc1ccccc1)C
- InChi: 1S/C25H42BN3O6/c1-16(2)12-20(24(31)29-22(26(33)34)14-18(5)6)27-23(30)21(13-17(3)4)28-25(32)35-15-19-10-8-7-9-11-19/h7-11,16-18,20-22,33-34H,12-15H2,1-6H3,(H,27,30)(H,28,32)(H,29,31)/t20-,21-,22-/m0/s1
- InChiKey: MWKOOGAFELWOCD-FKBYEOEOSA-N
Network
Hover on a compound node to display the structore
Synonyms
- [(1R)-1-[[(2S)-2-[[(2S)-2-(benzyloxycarbonylamino)-4-methyl-pentanoyl]amino]-4-methyl-pentanoyl]amino]-3-methyl-butyl]boronic acid
- [(1R)-1-[[(2S)-2-[[(2S)-2-(benzyloxycarbonylamino)-4-methyl-1-oxopentyl]amino]-4-methyl-1-oxopentyl]amino]-3-methylbutyl]boronic acid
- [(1R)-3-methyl-1-[[(2S)-4-methyl-2-[[(2S)-4-methyl-1-oxo-2-[[oxo-(phenylmethoxy)methyl]amino]pentyl]amino]-1-oxopentyl]amino]butyl]boronic acid
- AIDS113552
- L-Leucinamide, N-[(phenylmethoxy)carbonyl]-L-leucyl-N1-[(1R)-1-borono-3-methylbutyl]-
- AIDS-113552
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | cathepsin B | Starlite/ChEMBL | References |
| Homo sapiens | proteasome (prosome, macropain) subunit, beta type, 5 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Plasmodium falciparum | proteasome subunit alpha type-5, putative | proteasome (prosome, macropain) subunit, beta type, 5 | 160 aa | 148 aa | 23.0 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0166 | 0.3075 | 0.2386 |
| Leishmania major | proteasome beta 5 subunit, putative | 0.0086 | 0.1518 | 0.0674 |
| Echinococcus multilocularis | mitogen activated protein kinase 11 | 0.052 | 1 | 1 |
| Echinococcus granulosus | mitogen activated protein kinase 11 | 0.052 | 1 | 1 |
| Schistosoma mansoni | proteasome catalytic subunit 3 (T01 family) | 0.0086 | 0.1518 | 0.4638 |
| Echinococcus multilocularis | cathepsin b | 0.0166 | 0.3075 | 0.2954 |
| Trypanosoma cruzi | mitogen-activated protein kinase 3, putative | 0.052 | 1 | 1 |
| Mycobacterium leprae | proteasome (beta subunit) PrcB | 0.0086 | 0.1518 | 0.5 |
| Trypanosoma cruzi | proteasome subunit beta type-5, putative | 0.0086 | 0.1518 | 0.0674 |
| Loa Loa (eye worm) | hypothetical protein | 0.0166 | 0.3075 | 0.2954 |
| Giardia lamblia | Proteasome subunit beta type 5 precursor | 0.0086 | 0.1518 | 1 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0037 | 0.0561 | 0.0396 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 0.3075 | 1 |
| Echinococcus multilocularis | mitogen activated protein kinase 11 | 0.052 | 1 | 1 |
| Brugia malayi | cathepsin B-like cysteine proteinase | 0.0166 | 0.3075 | 0.2954 |
| Echinococcus granulosus | proteasome prosome macropain | 0.0086 | 0.1518 | 0.137 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0054 | 0.0897 | 0.0738 |
| Mycobacterium ulcerans | proteasome PrcB | 0.0086 | 0.1518 | 0.5 |
| Mycobacterium tuberculosis | Proteasome beta subunit PrcB; assembles with alpha subunit PrcA. | 0.0086 | 0.1518 | 0.5 |
| Echinococcus multilocularis | cathepsin b | 0.0166 | 0.3075 | 0.2954 |
| Brugia malayi | Proteasome A-type and B-type family protein | 0.0086 | 0.1518 | 0.137 |
| Echinococcus multilocularis | mitogen activated protein kinase 14 | 0.052 | 1 | 1 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0054 | 0.0897 | 0.0738 |
| Trypanosoma cruzi | mitogen-activated protein kinase 3, putative | 0.052 | 1 | 1 |
| Echinococcus granulosus | mitogen activated protein kinase 14 | 0.052 | 1 | 1 |
| Loa Loa (eye worm) | CMGC/MAPK/P38 protein kinase | 0.052 | 1 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0166 | 0.3075 | 0.2954 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 0.3075 | 1 |
| Trichomonas vaginalis | Family T1, proteasome beta subunit, threonine peptidase | 0.0086 | 0.1518 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0037 | 0.0561 | 0.0396 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0055 | 0.0905 | 0.2526 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0166 | 0.3075 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0166 | 0.3075 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0054 | 0.0897 | 0.0738 |
| Leishmania major | mitogen-activated protein kinase 3, putative,map kinase 3, putative | 0.052 | 1 | 1 |
| Plasmodium falciparum | proteasome subunit beta type-5 | 0.0086 | 0.1518 | 0.5 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0054 | 0.0897 | 0.0738 |
| Echinococcus multilocularis | mitogen activated protein kinase 14 | 0.052 | 1 | 1 |
| Echinococcus multilocularis | proteasome (prosome, macropain) | 0.0086 | 0.1518 | 0.137 |
| Trypanosoma cruzi | proteasome subunit beta type-5, putative | 0.0086 | 0.1518 | 0.0674 |
| Loa Loa (eye worm) | cathepsin B | 0.0055 | 0.0905 | 0.0746 |
| Schistosoma mansoni | hypothetical protein | 0.0037 | 0.0561 | 0.1341 |
| Trypanosoma brucei | mitogen-activated protein kinase 3, putative | 0.052 | 1 | 1 |
| Entamoeba histolytica | proteasome subunit beta type 5 precursor, putative | 0.0086 | 0.1518 | 1 |
| Toxoplasma gondii | proteasome subunit beta type, putative | 0.0086 | 0.1518 | 1 |
| Loa Loa (eye worm) | proteasome A-type and B-type family protein | 0.0086 | 0.1518 | 0.137 |
| Echinococcus granulosus | cathepsin b | 0.0166 | 0.3075 | 0.2954 |
| Trypanosoma brucei | proteasome subunit beta type-5, putative | 0.0086 | 0.1518 | 0.0674 |
| Plasmodium vivax | proteasome subunit beta type-5, putative | 0.0086 | 0.1518 | 0.5 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | = 13.76 nM | Cytotoxicity against human RPMI8226 cells after 48 to 72 hrs by SRB assay | ChEMBL. | 24119559 |
| Ki (binding) | = 0.03 nM | Inhibitory activity against 20S Proteasome | ChEMBL. | 9871680 |
| Ki (binding) | = 6.1 nM | Inhibitory activity against Cathepsin B | ChEMBL. | 9871680 |
| Ki (binding) | = 6.1 nM | Inhibitory activity against Cathepsin B | ChEMBL. | 9871680 |
| Ki (binding) | = 0.0023 uM | Inhibition of chymotrypsin-like proteasome activity of human 20S proteasome | ChEMBL. | 16686537 |
| Ki (binding) | = 48 uM | Inhibition of post glutamyl peptide hydrolase-like proteasome activity of human 20S proteasome | ChEMBL. | 16686537 |
| Ki (binding) | = 110 uM | Inhibition of trypsin-like proteasome activity of human 20S proteasome | ChEMBL. | 16686537 |
| Ki app (binding) | Inhibition of cathepsin B | ChEMBL. | 16686537 | |
| Ki app (binding) | 0 | Inhibition of cathepsin B | ChEMBL. | 16686537 |
| Ki app (binding) | 0 | Inhibition of cathepsin S | ChEMBL. | 16686537 |
| Ki app (binding) | = 0.0023 uM | Inhibition of chymotrypsin-like proteasome activity of human 20S proteasome | ChEMBL. | 16686537 |
| Ki app (binding) | = 48 uM | Inhibition of post glutamyl peptide hydrolase-like proteasome activity of human 20S proteasome | ChEMBL. | 16686537 |
| Ki app (binding) | = 110 uM | Inhibition of trypsin-like proteasome activity of human 20S proteasome | ChEMBL. | 16686537 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 24119559 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL114388
- PubChem: 490002
Bibliographic References
2 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.