Detailed information for compound 427925
Basic information
Technical information
- TDR Targets ID: 427925
- Name: (Z)-3-(4-chloroanilino)-2-(2-chlorobenzoyl)-N -pentan-3-ylprop-2-enamide
- MW: 405.318 | Formula: C21H22Cl2N2O2
-
H donors: 2
H acceptors: 2
LogP: 6.54
Rotable bonds: 9
Rule of 5 violations (Lipinski): 1 - SMILES: CCC(NC(=O)/C(=C\Nc1ccc(cc1)Cl)/C(=O)c1ccccc1Cl)CC
- InChi: 1S/C21H22Cl2N2O2/c1-3-15(4-2)25-21(27)18(13-24-16-11-9-14(22)10-12-16)20(26)17-7-5-6-8-19(17)23/h5-13,15,24H,3-4H2,1-2H3,(H,25,27)/b18-13-
- InChiKey: TYETXZTUVIKLFD-AQTBWJFISA-N
Network
Hover on a compound node to display the structore
Synonyms
- (Z)-3-(4-chloroanilino)-2-(2-chlorobenzoyl)-N-(1-ethylpropyl)prop-2-enamide
- (Z)-3-(4-chloroanilino)-2-[(2-chlorophenyl)-oxomethyl]-N-(1-ethylpropyl)-2-propenamide
- (Z)-3-[(4-chlorophenyl)amino]-2-(2-chlorophenyl)carbonyl-N-pentan-3-yl-prop-2-enamide
- (Z)-3-(4-chloroanilino)-2-(2-chlorobenzoyl)-N-(1-ethylpropyl)acrylamide
- (Z)-2-(2-chlorobenzoyl)-3-[(4-chlorophenyl)amino]-N-pentan-3-ylprop-2-enamide
- (Z)-2-(2-chlorobenzoyl)-3-[(4-chlorophenyl)amino]-N-(1-ethylpropyl)prop-2-enamide
- (Z)-3-[(4-chlorophenyl)amino]-2-[(2-chlorophenyl)-oxomethyl]-N-(1-ethylpropyl)prop-2-enamide
- (Z)-2-(2-chlorobenzoyl)-3-[(4-chlorophenyl)amino]-N-(1-ethylpropyl)acrylamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Rattus norvegicus | GABA-A receptor; alpha-1/beta-2/gamma-2 | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
| Species | Potential target | Known druggable target/s | Ortholog Group |
|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | Get druggable targets OG5_129441 | All targets in OG5_129441 |
| Brugia malayi | gamma-aminobutyric-acid receptor beta subunit precursor | Get druggable targets OG5_129441 | All targets in OG5_129441 |
| Loa Loa (eye worm) | hypothetical protein | Get druggable targets OG5_129441 | All targets in OG5_129441 |
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0204 | 0.6491 | 0.9625 |
| Mycobacterium leprae | probable 3-phosphoshikimate 1-carboxyvinyl transferase AroA (5-ENOLPYRUVYLSHIKIMATE-3-PHOSPHATE SYNTHASE) (EPSP SYNTHASE) (EPSPS | 0.03 | 1 | 1 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Trypanosoma brucei | metacaspase MCA2 | 0.0026 | 0 | 0.5 |
| Schistosoma mansoni | caspase-3 (C14 family) | 0.0098 | 0.2611 | 0.7886 |
| Echinococcus multilocularis | caspase 3, apoptosis cysteine peptidase | 0.0098 | 0.2611 | 1 |
| Trypanosoma cruzi | metacaspase, putative | 0.0026 | 0 | 0.5 |
| Chlamydia trachomatis | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | 0.0183 | 0.5737 | 0.3627 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Trypanosoma cruzi | metacaspase, putative | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Schistosoma mansoni | 3-dehydroquinate synthase | 0.0117 | 0.3311 | 1 |
| Onchocerca volvulus | Cell death protein 3 homolog | 0.0026 | 0 | 0.5 |
| Wolbachia endosymbiont of Brugia malayi | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | 0.0183 | 0.5737 | 0.5 |
| Plasmodium falciparum | metacaspase-like protein | 0.0026 | 0 | 0.5 |
| Trypanosoma cruzi | metacaspase 5, putative | 0.0026 | 0 | 0.5 |
| Leishmania major | metacaspase, putative | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0026 | 0 | 0.5 |
| Mycobacterium tuberculosis | 3-phosphoshikimate 1-carboxyvinyltransferase AroA (5-enolpyruvylshikimate-3-phosphate synthase) (EPSP synthase) (EPSPS) | 0.0117 | 0.3311 | 0.5 |
| Echinococcus multilocularis | caspase | 0.0098 | 0.2611 | 1 |
| Mycobacterium tuberculosis | 3-dehydroquinate synthase AroB | 0.0117 | 0.3311 | 0.5 |
| Toxoplasma gondii | shikimate dehydrogenase substrate binding domain-containing protein | 0.03 | 1 | 1 |
| Mycobacterium ulcerans | 3-phosphoshikimate 1-carboxyvinyltransferase | 0.03 | 1 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0026 | 0 | 0.5 |
| Plasmodium vivax | metacaspase 1, putative | 0.0026 | 0 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0211 | 0.6745 | 1 |
| Trypanosoma brucei | metacaspase | 0.0026 | 0 | 0.5 |
| Trypanosoma cruzi | metacaspase 5, putative | 0.0026 | 0 | 0.5 |
| Trypanosoma brucei | metacaspase 5, putative | 0.0026 | 0 | 0.5 |
| Mycobacterium ulcerans | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | 0.0183 | 0.5737 | 0.3627 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Schistosoma mansoni | caspase-7 (C14 family) | 0.0098 | 0.2611 | 0.7886 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0026 | 0 | 0.5 |
| Trypanosoma cruzi | metacaspase, putative | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Echinococcus granulosus | caspase 3 | 0.0072 | 0.1658 | 0.635 |
| Echinococcus granulosus | caspase 3 apoptosis cysteine peptidase | 0.0098 | 0.2611 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0026 | 0 | 0.5 |
| Trypanosoma cruzi | metacaspase, putative | 0.0026 | 0 | 0.5 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0026 | 0 | 0.5 |
| Plasmodium falciparum | metacaspase 1 | 0.0026 | 0 | 0.5 |
| Echinococcus multilocularis | caspase 3 | 0.0072 | 0.1658 | 0.635 |
| Treponema pallidum | UDP-N-acetylglucosamine 1-carboxyvinyltransferase | 0.0183 | 0.5737 | 0.5 |
| Trichomonas vaginalis | Clan CD, family C14, metacaspase-like cysteine peptidase | 0.0026 | 0 | 0.5 |
| Trypanosoma brucei | Metacaspase-4 | 0.0026 | 0 | 0.5 |
| Trypanosoma brucei | metacaspase MCA3 | 0.0026 | 0 | 0.5 |
| Echinococcus granulosus | caspase | 0.0098 | 0.2611 | 1 |
| Brugia malayi | gamma-aminobutyric-acid receptor beta subunit precursor | 0.0211 | 0.6745 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | Anticonvulsant activity against pentylenetetrazole-induced seizures in non-Swiss Albino mouse at 50 mg/kg, ip | ChEMBL. | 17571865 | |
| Activity (functional) | 0 | Anticonvulsant activity against pentylenetetrazole-induced seizures in non-Swiss Albino mouse at 50 mg/kg, ip | ChEMBL. | 17571865 |
| IC50 (binding) | = 7.1 | Inhibition of rat GABA alpha-1-beta-2-gamma-2 receptor | ChEMBL. | 20684859 |
| IC50 (binding) | = 80 nM | Displacement of [35S]TBPS from GABAA receptor in Sprague-Dawley rat cortex membrane | ChEMBL. | 17571865 |
| Imax (binding) | = 86 % | Displacement of [35S]TBPS from GABAA receptor in Sprague-Dawley rat cortex membrane | ChEMBL. | 17571865 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL229201
- PubChem: 16736448
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.