Detailed information for compound 1129019
Basic information
Technical information
- Name: Unnamed compound
- MW: 403.401 | Formula: C20H20F3N5O
-
H donors: 0
H acceptors: 3
LogP: 3.33
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: N#Cc1nc(cc2c1ncn2C)c1ccc(c(c1)C(F)(F)F)OCCCN(C)C
- InChi: 1S/C20H20F3N5O/c1-27(2)7-4-8-29-18-6-5-13(9-14(18)20(21,22)23)15-10-17-19(16(11-24)26-15)25-12-28(17)3/h5-6,9-10,12H,4,7-8H2,1-3H3
- InChiKey: CZLJABZJYZVKFX-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | cathepsin S | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin K | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin V | Starlite/ChEMBL | References |
| Mus musculus | cathepsin S | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin L | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin B | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin K | 329 aa | 349 aa | 33.2 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin S | 281 aa | 226 aa | 34.1 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin S | 341 aa | 375 aa | 29.9 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin L | 333 aa | 359 aa | 30.1 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin V | 334 aa | 357 aa | 29.7 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Papain family cysteine protease containing protein | 0.014 | 0.562 | 0.562 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.008 | 0.0446 | 0.5 |
| Onchocerca volvulus | Cathepsin L homolog | 0.014 | 0.562 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.014 | 0.562 | 0.5415 |
| Loa Loa (eye worm) | hypothetical protein | 0.0095 | 0.1788 | 0.1405 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Toxoplasma gondii | cathepsin CPL | 0.014 | 0.562 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0095 | 0.1788 | 0.1405 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.014 | 0.562 | 0.562 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.014 | 0.562 | 0.5415 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.014 | 0.562 | 0.562 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.014 | 0.562 | 0.562 |
| Brugia malayi | Cathepsin L-like precursor | 0.0095 | 0.1788 | 0.1788 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Echinococcus granulosus | cathepsin l1 | 0.0095 | 0.1788 | 0.1788 |
| Echinococcus granulosus | cathepsin b | 0.0191 | 1 | 1 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.014 | 0.562 | 0.562 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.014 | 0.562 | 0.5415 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.014 | 0.562 | 0.562 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Plasmodium vivax | vivapain-2 | 0.014 | 0.562 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.014 | 0.562 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.008 | 0.0446 | 0.0794 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.008 | 0.0446 | 0.0794 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.014 | 0.562 | 0.562 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.008 | 0.0446 | 0.5 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.014 | 0.562 | 0.562 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.014 | 0.562 | 0.562 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0095 | 0.1788 | 0.3182 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Onchocerca volvulus | Cathepsin L homolog | 0.014 | 0.562 | 1 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0095 | 0.1788 | 0.1788 |
| Loa Loa (eye worm) | cysteine protease | 0.014 | 0.562 | 0.5415 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.014 | 0.562 | 0.562 |
| Onchocerca volvulus | Cathepsin F homolog | 0.014 | 0.562 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.014 | 0.562 | 0.562 |
| Echinococcus granulosus | cathepsin l1 | 0.014 | 0.562 | 0.562 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.014 | 0.562 | 0.562 |
| Loa Loa (eye worm) | hypothetical protein | 0.0095 | 0.1788 | 0.1405 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.014 | 0.562 | 1 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.008 | 0.0446 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.014 | 0.562 | 0.562 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.014 | 0.562 | 0.562 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.014 | 0.562 | 0.562 |
| Brugia malayi | Cathepsin L-like precursor | 0.0095 | 0.1788 | 0.1788 |
| Brugia malayi | Cathepsin L-like precursor | 0.014 | 0.562 | 0.562 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0095 | 0.1788 | 0.3182 |
| Echinococcus multilocularis | cysteine protease | 0.014 | 0.562 | 0.562 |
| Leishmania major | cathepsin L-like protease | 0.014 | 0.562 | 1 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0191 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0095 | 0.1788 | 0.1788 |
| Loa Loa (eye worm) | hypothetical protein | 0.014 | 0.562 | 0.5415 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Plasmodium vivax | vivapain-2 | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Brugia malayi | cathepsin L-like precursor | 0.0095 | 0.1788 | 0.1788 |
| Loa Loa (eye worm) | fibroinase | 0.014 | 0.562 | 0.5415 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0191 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0191 | 1 | 1 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.014 | 0.562 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0191 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Leishmania major | cysteine peptidase A (CPA) | 0.014 | 0.562 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.008 | 0.0446 | 0.0446 |
| Entamoeba histolytica | cysteine protease, putative | 0.014 | 0.562 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.014 | 0.562 | 0.562 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.008 | 0.0446 | 0.0446 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0191 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0095 | 0.1788 | 0.3182 |
| Brugia malayi | Cathepsin L-like precursor | 0.014 | 0.562 | 0.562 |
| Echinococcus multilocularis | cysteine protease | 0.014 | 0.562 | 0.562 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.014 | 0.562 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.014 | 0.562 | 1 |
| Onchocerca volvulus | 0.014 | 0.562 | 1 | |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0095 | 0.1788 | 0.1788 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.014 | 0.562 | 0.562 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0191 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0191 | 1 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0191 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.014 | 0.562 | 0.562 |
| Echinococcus granulosus | cathepsin b | 0.0191 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Cp (ADMET) | = 94 nM | Drug level in C57BI/6 mouse plasma at 30 mg/kg, po after 4 hrs | ChEMBL. | 21227690 |
| Drug uptake (ADMET) | = 2433 nM | Drug level in C57BI/6 mouse spleen at 30 mg/kg, po after 4 hrs | ChEMBL. | 21227690 |
| IC50 (binding) | = 2.6 nM | Inhibition of mouse cathepsin S by fluorescence assay | ChEMBL. | 20598883 |
| IC50 (binding) | = 32 nM | BindingDB_Patents: In Vitro Inhibition Assay. The inhibitory activity of the compounds of the invention was demonstrated in vitro by measuring the inhibition of recombinant human Cathepsin S as follows: To a 384 well microtitre plate is added 10 µl of a 100 µM solution of test compound in assay buffer (100 mM sodium acetate pH5.5, 5 mM EDTA, 5 mM dithiothreitol) with 10% dimethylsulfoxide (DMSO), plus 20 µl of 250 µM solution of the substrate Z-Val-Val-Arg-AMC (7-amido-coumarine derivative of the tripeptide N-benzyloxy-carbonyl-Val-Val-Arg-OH) in assay buffer and 45 µl of assay buffer. 25 µl of a 2 mg/l solution of activated recombinant human cathepsin S, in assay buffer, is then added to the well, yielding a final inhibitor concentration of 10 µM.Enzyme activity is determined by measuring the fluorescence of the liberated aminomethylcoumarin at 440 nM using 390 nM excitation, at 20 minutes. | ChEMBL. | No reference |
| IC50 (binding) | = 41 nM | Inhibition of human cathepsin S by fluorescence assay | ChEMBL. | 20598883 |
| IC50 (binding) | = 41 nM | Inhibition of human cathepsin S | ChEMBL. | 21227690 |
| IC50 (binding) | = 84 nM | Inhibition of cathepsin S-mediated proteolytic cleavage of MHC2 associated invariant chain in human JY cells assessed as accumulation of lip10 by Western blot analysis | ChEMBL. | 20598883 |
| IC50 (binding) | = 84 nM | Inhibition of cathepsin S in human JY cells assessed as accumulation of lip10 by Western blot analysis | ChEMBL. | 21227690 |
| IC50 (binding) | = 776 nM | Inhibition of human cathepsin K by fluorescence assay | ChEMBL. | 20598883 |
| IC50 (binding) | = 776 nM | Inhibition of human cathepsin K | ChEMBL. | 21227690 |
| IC50 (binding) | > 10 uM | Inhibition of human cathepsin B | ChEMBL. | 21227690 |
| IC50 (binding) | > 10 uM | Inhibition of human cathepsin V | ChEMBL. | 21227690 |
| IC50 (binding) | > 10 uM | Inhibition of human cathepsin L | ChEMBL. | 21227690 |
| Inhibition (binding) | Inhibition of human cathepsin L by fluorescence assay | ChEMBL. | 20598883 | |
| Inhibition (binding) | Inhibition of human cathepsin B by fluorescence assay | ChEMBL. | 20598883 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1209086
Bibliographic References
2 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.