Detailed information for compound 2001729
Basic information
Technical information
- Name: Unnamed compound
- MW: 373.471 | Formula: C22H19N3OS
-
H donors: 1
H acceptors: 1
LogP: 4.61
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: NC(=S)N(/N=C(/c1ccccc1)\c1cccc(c1)C(=O)c1ccccc1)C
- InChi: 1S/C22H19N3OS/c1-25(22(23)27)24-20(16-9-4-2-5-10-16)18-13-8-14-19(15-18)21(26)17-11-6-3-7-12-17/h2-15H,1H3,(H2,23,27)/b24-20-
- InChiKey: WZWOSKAWLSAHCD-GFMRDNFCSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | cathepsin L | Starlite/ChEMBL | No references |
| Homo sapiens | cathepsin B | Starlite/ChEMBL | No references |
| Homo sapiens | cathepsin K | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin L | 333 aa | 359 aa | 30.1 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin K | 329 aa | 349 aa | 33.2 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.1828 | 0.1828 |
| Entamoeba histolytica | cysteine protease, putative | 0.0059 | 0.1828 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0065 | 0.2232 | 1 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0041 | 0.0582 | 0.2606 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0059 | 0.1828 | 0.1828 |
| Plasmodium vivax | vivapain-2 | 0.0059 | 0.1828 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.1828 | 0.1828 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Plasmodium vivax | vivapain-2 | 0.0059 | 0.1828 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0059 | 0.1828 | 0.1828 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0041 | 0.0582 | 0.0582 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0059 | 0.1828 | 0.1828 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0059 | 0.1828 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0065 | 0.2232 | 0.2232 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0059 | 0.1828 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.1828 | 0.1828 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0059 | 0.1828 | 0.1828 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0059 | 0.1828 | 1 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0059 | 0.1828 | 0.1828 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0059 | 0.1828 | 0.1828 |
| Loa Loa (eye worm) | ctsf protein | 0.0059 | 0.1828 | 0.1323 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0041 | 0.0582 | 0.0582 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0059 | 0.1828 | 0.1828 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0059 | 0.1828 | 0.1828 |
| Loa Loa (eye worm) | cysteine protease | 0.0059 | 0.1828 | 0.1323 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0059 | 0.1828 | 0.1828 |
| Echinococcus granulosus | cathepsin b | 0.0176 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0041 | 0.0582 | 0.3182 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0059 | 0.1828 | 0.1828 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0059 | 0.1828 | 0.1828 |
| Loa Loa (eye worm) | cathepsin B | 0.0065 | 0.2232 | 0.1752 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0059 | 0.1828 | 0.1828 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0059 | 0.1828 | 0.1828 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0065 | 0.2232 | 1 |
| Loa Loa (eye worm) | fibroinase | 0.0059 | 0.1828 | 0.1323 |
| Giardia lamblia | Cathepsin B precursor | 0.0065 | 0.2232 | 0.5 |
| Brugia malayi | cathepsin L-like precursor | 0.0041 | 0.0582 | 0.0582 |
| Echinococcus multilocularis | cysteine protease | 0.0059 | 0.1828 | 0.1828 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0065 | 0.2232 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Echinococcus granulosus | cathepsin l1 | 0.0041 | 0.0582 | 0.0582 |
| Echinococcus multilocularis | cathepsin b | 0.0176 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0065 | 0.2232 | 0.2232 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0059 | 0.1828 | 0.1323 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0059 | 0.1828 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0059 | 0.1828 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0176 | 1 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0176 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0176 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0176 | 1 | 1 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0176 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Echinococcus granulosus | cathepsin b | 0.0176 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Loa Loa (eye worm) | hypothetical protein | 0.0176 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Loa Loa (eye worm) | hypothetical protein | 0.0059 | 0.1828 | 0.1323 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Toxoplasma gondii | cathepsin B | 0.0065 | 0.2232 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0041 | 0.0582 | 0.2606 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0176 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0059 | 0.1828 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0059 | 0.1828 | 0.1323 |
| Brugia malayi | Cathepsin L-like precursor | 0.0041 | 0.0582 | 0.0582 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.1828 | 0.8189 |
| Echinococcus multilocularis | cysteine protease | 0.0059 | 0.1828 | 0.1828 |
| Giardia lamblia | Cathepsin B precursor | 0.0065 | 0.2232 | 0.5 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0059 | 0.1828 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.1828 | 0.1828 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0059 | 0.1828 | 0.8189 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.1828 | 0.1828 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Giardia lamblia | Cathepsin B precursor | 0.0065 | 0.2232 | 0.5 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0059 | 0.1828 | 0.1828 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0059 | 0.1828 | 1 |
| Onchocerca volvulus | 0.0059 | 0.1828 | 1 | |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0041 | 0.0582 | 0.0582 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.1828 | 0.1828 |
| Brugia malayi | Cathepsin L-like precursor | 0.0041 | 0.0582 | 0.0582 |
| Echinococcus granulosus | cathepsin l1 | 0.0059 | 0.1828 | 0.1828 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 10.5 nM | BindingDB_Patents: Biological Assay. Human liver Cathepsin L (Sigma) was preincubated with test compounds at various concentrations for 5 minutes at 25C. The assay was initiated by addition of substrate Z-Phe-Arg-aminomethylcoumarin (Z-F-R-AMC Bacchem) and the final assay conditions were 1 nM cathepsin L, 50 uM Z-F-R-AMC, 100 mM sodium acetate pH 5.5, 1 mM EDTA (Omnipure), 3 mM DTT (EMD), 0.01% BRIJ 35 (Sigma), and 2.0% DMSO (Acros). Test compounds were serially diluted with DMSO and water to include a final concentration range of 10 uM to 10 pM. The reaction was monitored fluorometrically for 5 minutes at 25C. using black 96-well Corning 3686 assay microplates with a Thermo Fluoroskan Ascent FL microplate reader at excitation and emission filter wavelengths of 355 nm and 460 nm, respectively. | ChEMBL. | No reference |
| IC50 (binding) | = 17.4 nM | BindingDB_Patents: Biological Assay. Recombinant human procathepsin K was obtained from Enzo Life Sciences. Activation of the proenzyme was performed in 32.5 mM sodium acetate pH 3.5, EDTA 1 mM, NaCl 500 mM, human procathepsin K 5.5 uM, at room temperature. Activation times were optimized and varied between 35 and 150 minutes. Cathepsin K was preincubated with test compounds at various concentrations for 5 minutes at 25C. The assay was initiated by addition of substrate Z-Phe-Arg-aminomethylcoumarin ("Z-F-R-AMC" Bacchem) and the final assay conditions were 1.5 nM cathepsin K, 50 uM Z-F-R-AMC, 150 mM sodium acetate pH 5.5, 2.5 mM EDTA (Omnipure), 2.5 mM DTT (EMD), 0.01% BRIJ 35 (Sigma), and 4.0% DMSO (Acros). Test compounds were serially diluted with DMSO and water to include a final concentration range of 10 uM to 10 pM. The reaction was monitored fluorometrically for 5 minutes at 25C. using black 96-well Corning 3686 assay microplates with a Thermo Fluoroskan Ascent FL microplate reader. | ChEMBL. | No reference |
| IC50 (binding) | > 10000 nM | BindingDB_Patents: Biological Assay. Human liver Cathepsin B (Calbiochem) was pre-incubated with test compound at various concentrations for 5 minutes at 37C. The assay was initiated by addition of substrate Z-Arg-Arg-aminomethylcoumarin (Z-R-R-AMC Bacchem) and the final assay conditions were 1.1 nM cathepsin B, 60 uM Z-R-R-AMC, 126 mM sodium potassium phosphate pH 6.0 (Fisher), 0.3 mM EDTA (Omnipure), 2.7 mM DTT (Omnipure), 0.004% BRIJ 35 (Sigma), and 2.0% DMSO (Acros) in a final volume of 200 uL. Test compounds were serially diluted with DMSO and 0.01% BRIJ 35 to include a final concentration range of 20 uM to 10 pM. The reaction was monitored fluorometrically for 5 minutes at 37C. using black 96-well Corning 3686 assay microplates with a Thermo Fluoroskan Ascent FL microplate reader at excitation and emission filter wavelengths of 355 nm and 460 nm, respectively. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
No external resources registered for this compound
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.