Detailed information for compound 212584
Basic information
Technical information
- TDR Targets ID: 212584
- Name: 4-[3-[1-(cyanomethylamino)-4-methyl-1-oxopent an-2-yl]phenyl]benzamide
- MW: 349.426 | Formula: C21H23N3O2
-
H donors: 2
H acceptors: 3
LogP: 3.15
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: N#CCNC(=O)C(c1cccc(c1)c1ccc(cc1)C(=O)N)CC(C)C
- InChi: 1S/C21H23N3O2/c1-14(2)12-19(21(26)24-11-10-22)18-5-3-4-17(13-18)15-6-8-16(9-7-15)20(23)25/h3-9,13-14,19H,11-12H2,1-2H3,(H2,23,25)(H,24,26)
- InChiKey: UPARRLOVIJKCQH-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 4-[3-[1-(cyanomethylcarbamoyl)-3-methyl-butyl]phenyl]benzamide
- 4-[3-[1-[(cyanomethylamino)-oxomethyl]-3-methylbutyl]phenyl]benzamide
- 4-[3-[1-(cyanomethylamino)-4-methyl-1-oxo-pentan-2-yl]phenyl]benzamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | cathepsin K | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin S | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin B | Starlite/ChEMBL | References |
| Homo sapiens | cathepsin L | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | cathepsin B | 339 aa | 368 aa | 26.9 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin K | 329 aa | 349 aa | 33.2 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin L | 333 aa | 359 aa | 30.1 % |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | cathepsin S | 281 aa | 226 aa | 34.1 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0086 | 0.2924 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0181 | 1 | 1 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.093 | 0.093 |
| Giardia lamblia | Cathepsin B precursor | 0.007 | 0.1716 | 0.5 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.007 | 0.1716 | 0.1716 |
| Brugia malayi | cathepsin L-like precursor | 0.0059 | 0.093 | 0.093 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0086 | 0.2924 | 0.2924 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.093 | 0.3182 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0181 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0086 | 0.2924 | 0.2924 |
| Echinococcus granulosus | cathepsin l1 | 0.0059 | 0.093 | 0.093 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0086 | 0.2924 | 0.2924 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0059 | 0.093 | 0.093 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0181 | 1 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0086 | 0.2924 | 0.2924 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0181 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0086 | 0.2924 | 0.2924 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0086 | 0.2924 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Plasmodium vivax | vivapain-2 | 0.0086 | 0.2924 | 1 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0086 | 0.2924 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0086 | 0.2924 | 0.2198 |
| Loa Loa (eye worm) | fibroinase | 0.0086 | 0.2924 | 0.2198 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0086 | 0.2924 | 0.2924 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Loa Loa (eye worm) | cathepsin B | 0.007 | 0.1716 | 0.0866 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0059 | 0.093 | 0.093 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0181 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0086 | 0.2924 | 0.2198 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0086 | 0.2924 | 0.2924 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0086 | 0.2924 | 0.2924 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0059 | 0.093 | 0.3182 |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0086 | 0.2924 | 0.2924 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0086 | 0.2924 | 0.2924 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0059 | 0.093 | 0.3182 |
| Brugia malayi | Cathepsin L-like precursor | 0.0086 | 0.2924 | 0.2924 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0181 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0086 | 0.2924 | 1 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0086 | 0.2924 | 0.2198 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0086 | 0.2924 | 0.2924 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0086 | 0.2924 | 0.2924 |
| Giardia lamblia | Cathepsin B precursor | 0.007 | 0.1716 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.007 | 0.1716 | 0.1716 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0086 | 0.2924 | 0.2924 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0059 | 0.093 | 0.093 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0086 | 0.2924 | 0.2924 |
| Loa Loa (eye worm) | hypothetical protein | 0.0181 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0181 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.007 | 0.1716 | 0.5868 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0086 | 0.2924 | 0.2924 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Loa Loa (eye worm) | cysteine protease | 0.0086 | 0.2924 | 0.2198 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0086 | 0.2924 | 0.2924 |
| Toxoplasma gondii | cathepsin CPL | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0059 | 0.093 | 0.093 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.0086 | 0.2924 | 0.2198 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Echinococcus granulosus | cathepsin l1 | 0.0086 | 0.2924 | 0.2924 |
| Giardia lamblia | Cathepsin B precursor | 0.007 | 0.1716 | 0.5 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cysteine protease | 0.0086 | 0.2924 | 0.2924 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0086 | 0.2924 | 0.2924 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0086 | 0.2924 | 1 |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0181 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cysteine protease | 0.0086 | 0.2924 | 0.2924 |
| Onchocerca volvulus | 0.0086 | 0.2924 | 1 | |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0181 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0086 | 0.2924 | 1 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0086 | 0.2924 | 0.2924 |
| Leishmania major | cathepsin L-like protease | 0.0086 | 0.2924 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0086 | 0.2924 | 0.2924 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.007 | 0.1716 | 0.5868 |
| Plasmodium vivax | vivapain-2 | 0.0086 | 0.2924 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0086 | 0.2924 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0086 | 0.2924 | 1 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0086 | 0.2924 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 1015 nM | In vitro inhibitory activity against human cathepsin K, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | = 1015 nM | In vitro inhibitory activity against human cathepsin K, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | = 1373 nM | In vitro inhibitory activity against human cathepsin S, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | = 1373 nM | In vitro inhibitory activity against human cathepsin S, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | > 10000 nM | In vitro inhibitory activity against human cathepsin L, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | > 10000 nM | In vitro inhibitory activity against human cathepsin B, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | > 10000 nM | In vitro inhibitory activity against human cathepsin L, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
| IC50 (binding) | > 10000 nM | In vitro inhibitory activity against human cathepsin B, using 2 microM of Z -Leu-Arg-AMC as substrate | ChEMBL. | 12904076 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL333987
- PubChem: 23648449
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.