Detailed information for compound 440504
Basic information
Technical information
- Name: Unnamed compound
- MW: 403.409 | Formula: C18H17N3O6S
-
H donors: 0
H acceptors: 4
LogP: 3.48
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: COc1cc(cc(c1OC)OC)c1nnsc1c1ccc(c(c1)[N+](=O)[O-])OC
- InChi: 1S/C18H17N3O6S/c1-24-13-6-5-10(7-12(13)21(22)23)18-16(19-20-28-18)11-8-14(25-2)17(27-4)15(9-11)26-3/h5-9H,1-4H3
- InChiKey: BGGPYTAMCXWPPJ-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | tubulin, beta 6 class V | References | |
| Homo sapiens | tubulin, alpha 3e | References | |
| Homo sapiens | tubulin, alpha 1a | References | |
| Homo sapiens | tubulin, beta 2B class IIb | Starlite/ChEMBL | References |
| Homo sapiens | tubulin, beta 4A class IVa | References | |
| Homo sapiens | tubulin, beta 8 class VIII | References | |
| Homo sapiens | tubulin, alpha 1b | References | |
| Homo sapiens | tubulin, beta 2A class IIa | References | |
| Homo sapiens | tubulin, alpha 3d | References | |
| Homo sapiens | tubulin, beta 4B class IVb | References | |
| Homo sapiens | tubulin, beta 1 class VI | References | |
| Homo sapiens | tubulin, alpha 1c | References | |
| Homo sapiens | tubulin, alpha 4a | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Plasmodium falciparum | tubulin gamma chain | tubulin, beta 8 class VIII | 444 aa | 438 aa | 33.8 % |
| Plasmodium falciparum | tubulin gamma chain | tubulin, beta 2B class IIb | 445 aa | 438 aa | 32.9 % |
| Plasmodium falciparum | tubulin gamma chain | tubulin, beta 6 class V | 446 aa | 438 aa | 32.4 % |
| Plasmodium falciparum | tubulin gamma chain | tubulin, beta 1 class VI | 451 aa | 438 aa | 32.2 % |
| Plasmodium falciparum | tubulin gamma chain | tubulin, beta 4B class IVb | 445 aa | 438 aa | 32.9 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Schistosoma mansoni | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | tubulin beta-2A chain | 0.0278 | 1 | 1 |
| Toxoplasma gondii | alpha tubulin TUBA1 | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Brugia malayi | Tubulin alpha-2 chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin alpha 1C chain | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Schistosoma mansoni | tubulin subunit beta | 0.0278 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Schistosoma mansoni | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | Tubulin alpha 1 chain | 0.021 | 0.5571 | 0.4682 |
| Schistosoma mansoni | tubulin subunit beta | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin beta 4A class IVa | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha 3 chain | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | hypothetical protein | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.021 | 0.5571 | 0.5571 |
| Plasmodium vivax | tubulin beta chain, putative | 0.0278 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin subunit TubB | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Brugia malayi | Tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Trypanosoma cruzi | alpha tubulin, putative | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin alpha-1 chain, putative | 0.0145 | 0.1296 | 0.1296 |
| Trypanosoma brucei | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 3 chain | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha 2 | 0.0145 | 0.1296 | 0.1296 |
| Plasmodium vivax | tubulin alpha chain, putative | 0.021 | 0.5571 | 0.4682 |
| Brugia malayi | alpha-tubulin | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | tubulin alpha chain | 0.021 | 0.5571 | 0.5571 |
| Plasmodium falciparum | alpha tubulin 2 | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin, putative | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Entamoeba histolytica | tubulin alpha chain, putative | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Entamoeba histolytica | tubulin alpha-1 chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin alpha 3 chain | 0.021 | 0.5571 | 0.4682 |
| Plasmodium vivax | tubulin alpha chain, putative | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Entamoeba histolytica | tubulin family protein | 0.0278 | 1 | 1 |
| Echinococcus granulosus | Tubulin alpha 1 chain | 0.021 | 0.5571 | 0.4682 |
| Trypanosoma brucei | beta tubulin | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.021 | 0.5571 | 0.5571 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 1C chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin alpha 1C chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Toxoplasma gondii | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | BEN-1 protein | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta chain | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | tubulin beta 1 chain | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | alpha-tubulin | 0.021 | 0.5571 | 0.5571 |
| Trypanosoma cruzi | beta tubulin, putative | 0.0278 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | Tubulin alpha 1 chain | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.021 | 0.5571 | 0.5571 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Giardia lamblia | Beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0278 | 1 | 1 |
| Schistosoma mansoni | tubulin subunit beta | 0.0278 | 1 | 1 |
| Giardia lamblia | Alpha-tubulin | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin subunit beta | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0151 | 0.1672 | 0.1672 |
| Echinococcus granulosus | peroxisome assembly protein 26 | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Brugia malayi | beta-tubulin, identical | 0.0278 | 1 | 1 |
| Echinococcus granulosus | beta tubulin | 0.0278 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | tubulin beta 1 chain | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | tubulin alpha-2 chain | 0.021 | 0.5571 | 0.5571 |
| Trypanosoma brucei | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | tubulin, beta 4A class IVa | 0.0278 | 1 | 1 |
| Trypanosoma brucei | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Schistosoma mansoni | tubulin subunit alpha | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Brugia malayi | Tubulin alpha-2 chain | 0.021 | 0.5571 | 0.4682 |
| Toxoplasma gondii | alpha-tubulin I, putative | 0.021 | 0.5571 | 0.4682 |
| Schistosoma mansoni | tubulin subunit alpha | 0.021 | 0.5571 | 0.4682 |
| Giardia lamblia | Alpha-tubulin | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Trypanosoma brucei | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Trypanosoma brucei | beta tubulin | 0.0278 | 1 | 1 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Brugia malayi | tubulin alpha chain - mouse | 0.021 | 0.5571 | 0.4682 |
| Plasmodium falciparum | tubulin beta chain | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 3 chain | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | alpha-tubulin isotype 2 | 0.0145 | 0.1296 | 0.1296 |
| Echinococcus granulosus | beta tubulin | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0151 | 0.1672 | 0.1672 |
| Schistosoma mansoni | tubulin subunit beta | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.021 | 0.5571 | 0.5571 |
| Loa Loa (eye worm) | tubulin alpha chain | 0.021 | 0.5571 | 0.5571 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Schistosoma mansoni | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.021 | 0.5571 | 0.5571 |
| Toxoplasma gondii | beta-1 tubulin, putative | 0.0278 | 1 | 1 |
| Echinococcus granulosus | Tubulin alpha 1 chain | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | alpha-tubulin | 0.021 | 0.5571 | 0.5571 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.021 | 0.5571 | 0.5571 |
| Schistosoma mansoni | tubulin subunit alpha | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | tubulin gamma chain | 0.0151 | 0.1672 | 0.1672 |
| Echinococcus multilocularis | beta tubulin | 0.0278 | 1 | 1 |
| Toxoplasma gondii | beta-tubulin, putative | 0.0278 | 1 | 1 |
| Echinococcus multilocularis | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | Tubulin alpha 1 chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus granulosus | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Brugia malayi | tubulin alpha-2 chain | 0.021 | 0.5571 | 0.4682 |
| Schistosoma mansoni | tubulin subunit beta | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha chain | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.021 | 0.5571 | 0.5571 |
| Echinococcus multilocularis | Tubulin alpha 1 chain | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | tubulin subunit TubB | 0.021 | 0.5571 | 0.4682 |
| Leishmania major | beta tubulin | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha-1 chain, putative | 0.021 | 0.5571 | 0.5571 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | tubulin beta-4 chain | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin subunit beta | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin alpha chain, putative | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin gamma chain, putative | 0.0151 | 0.1672 | 0.1672 |
| Echinococcus granulosus | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | hypothetical protein | 0.0145 | 0.1296 | 0.1296 |
| Schistosoma mansoni | tubulin subunit beta | 0.0278 | 1 | 1 |
| Leishmania major | alpha tubulin | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | beta-tubulin | 0.0278 | 1 | 1 |
| Echinococcus granulosus | tubulin alpha 1C chain | 0.021 | 0.5571 | 0.4682 |
| Loa Loa (eye worm) | tubulin alpha 2 | 0.0145 | 0.1296 | 0.1296 |
| Echinococcus multilocularis | Tubulin beta 2C chain | 0.0278 | 1 | 1 |
| Plasmodium falciparum | alpha tubulin 1 | 0.021 | 0.5571 | 0.4682 |
| Echinococcus multilocularis | peroxisome assembly protein 26 | 0.021 | 0.5571 | 0.4682 |
| Trichomonas vaginalis | tubulin beta chain, putative | 0.021 | 0.5571 | 0.5571 |
| Loa Loa (eye worm) | hypothetical protein | 0.021 | 0.5571 | 0.5571 |
| Entamoeba histolytica | tubulin family protein | 0.0278 | 1 | 1 |
| Loa Loa (eye worm) | tubulin beta-1 chain | 0.0278 | 1 | 1 |
| Trichomonas vaginalis | tubulin epsilon chain, putative | 0.0278 | 1 | 1 |
| Giardia lamblia | Beta tubulin | 0.0278 | 1 | 1 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | 0 | Disruption of cytoskeleton in HMEC1 cells at 1 uM after 30 mins | ChEMBL. | 17174089 |
| Activity (functional) | 0 | Effect on alteration in morphology of HMEC1 cells at 1 uM after 30 mins | ChEMBL. | 17174089 |
| Activity (functional) | = 21.8 g | Effect on body weight in mouse implanted with S180 cells at 100 mg/kg, ip after 7 days | ChEMBL. | 17174089 |
| Activity (functional) | = 21.8 g | Effect on body weight in mouse implanted with S180 cells at 100 mg/kg, ip after 7 days | ChEMBL. | 17174089 |
| IC50 (functional) | = 13.4 nM | Antiproliferative activity against human HL60 cells | ChEMBL. | 17174089 |
| IC50 (functional) | = 13.4 nM | Antiproliferative activity against human HL60 cells | ChEMBL. | 17174089 |
| IC50 (ADMET) | = 26.4 nM | Antiproliferative activity against human HMEC1 cells | ChEMBL. | 17174089 |
| IC50 (functional) | = 30.2 nM | Antiproliferative activity against human HCT116 cells | ChEMBL. | 17174089 |
| IC50 (functional) | = 30.2 nM | Antiproliferative activity against human HCT116 cells | ChEMBL. | 17174089 |
| IC50 (binding) | = 2.13 uM | Inhibition of tubulin polymerization | ChEMBL. | 17174089 |
| IC50 (binding) | = 2.13 uM | Inhibition of tubulin polymerization | ChEMBL. | 17174089 |
| Inhibition (functional) | = 64.2 % | Antitumor activity in mouse implanted with S180 cells at 100 mg/kg, ip after 7 days | ChEMBL. | 17174089 |
| Inhibition (functional) | = 64.2 % | Antitumor activity in mouse implanted with S180 cells at 100 mg/kg, ip after 7 days | ChEMBL. | 17174089 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | 17174089 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL234245
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.