Detailed information for compound 107414
Basic information
Technical information
- TDR Targets ID: 107414
- Name: N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)- 2-[6-[(3-hydroxynaphthalen-1-yl)methylamino]p urin-9-yl]oxolan-3-yl]-3-methoxybenzamide
- MW: 556.569 | Formula: C29H28N6O6
-
H donors: 5
H acceptors: 7
LogP: 2.78
Rotable bonds: 9
Rule of 5 violations (Lipinski): 2 - SMILES: OC[C@H]1O[C@H]([C@@H]([C@@H]1O)NC(=O)c1cccc(c1)OC)n1cnc2c1ncnc2NCc1cc(O)cc2c1cccc2
- InChi: 1S/C29H28N6O6/c1-40-20-7-4-6-17(11-20)28(39)34-23-25(38)22(13-36)41-29(23)35-15-33-24-26(31-14-32-27(24)35)30-12-18-10-19(37)9-16-5-2-3-8-21(16)18/h2-11,14-15,22-23,25,29,36-38H,12-13H2,1H3,(H,34,39)(H,30,31,32)/t22-,23-,25-,29-/m1/s1
- InChiKey: SILGTCMBPCTNAZ-BYHVZLFPSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[(3-hydroxy-1-naphthyl)methylamino]purin-9-yl]tetrahydrofuran-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[(3-hydroxy-1-naphthyl)methylamino]-9-purinyl]-3-tetrahydrofuranyl]-3-methoxybenzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-[(3-hydroxynaphthalen-1-yl)methylamino]purin-9-yl]oxolan-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-2-[6-[(3-hydroxy-1-naphthyl)methylamino]purin-9-yl]-5-methylol-tetrahydrofuran-3-yl]-3-methoxy-benzamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Leishmania mexicana | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | Starlite/ChEMBL | References |
| Homo sapiens | glyceraldehyde-3-phosphate dehydrogenase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | glyceraldehyde-3-phosphate dehydrogenase | 293 aa | 259 aa | 28.2 % |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 331 aa | 331 aa | 27.8 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | cathepsin l1 | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cysteine protease | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 9 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium falciparum | serine repeat antigen 1 | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L, S or H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.0226 | 0.1973 | 0.1973 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3424 |
| Brugia malayi | Cathepsin L-like precursor | 0.03 | 0.2813 | 0.2813 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Calcium binding EGF domain containing protein | 0.0105 | 0.0592 | 0.0592 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium falciparum | serine repeat antigen 4 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0057 | 0.0034 | 0.0034 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Giardia lamblia | Encystation-specific protease | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase 1, putative | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0928 | 1 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Brugia malayi | cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0127 | 0.0838 | 0.0301 |
| Echinococcus granulosus | cathepsin L cysteine protease | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | unspecified product | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.0268 | 0.2454 | 0.5434 |
| Brugia malayi | cathepsin Z-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.0226 | 0.1973 | 0.1973 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | serine-repeat antigen 4 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin L | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0127 | 0.0838 | 0.0301 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen 3 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | dipeptidyl aminopeptidase 3, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, C-terminal domain, putative | 0.0127 | 0.0838 | 0.0301 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Wolbachia endosymbiont of Brugia malayi | glyceraldehyde-3-phosphate dehydrogenase, GapA | 0.0353 | 0.3424 | 0.5 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Echinococcus granulosus | cathepsin l1 | 0.0628 | 0.6574 | 0.6373 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Entamoeba histolytica | papain family cysteine protease domain containing protein | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Schistosoma mansoni | subfamily C1A non-peptidase homologue (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1809 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Giardia lamblia | Hypothetical protein | 0.0189 | 0.155 | 0.2847 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | vivapain-1 | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cathepsin L-like protease | 0.0189 | 0.155 | 0.2847 |
| Echinococcus granulosus | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Treponema pallidum | glyceraldehyde 3-phosphate dehydrogenase (gap) | 0.0353 | 0.3424 | 1 |
| Brugia malayi | eukaryotic initiation factor 4A | 0.0102 | 0.0554 | 0.0554 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0928 | 1 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus granulosus | cathepsin L | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0408 | 0.4049 | 0.37 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0127 | 0.0838 | 0.0301 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0408 | 0.4049 | 0.37 |
| Echinococcus multilocularis | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | serine-repeat antigen 4 (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | dipeptidyl aminopeptidase 2, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0628 | 0.6574 | 0.6373 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0102 | 0.0554 | 0.0554 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0628 | 0.6574 | 0.6373 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Giardia lamblia | Cathepsin B-like cysteine proteinase 3 precursor | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | serine-repeat antigen 2 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | unspecified product | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | fibroinase precursor | 0.0189 | 0.155 | 0.155 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0212 | 0.1809 | 0.1328 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0628 | 0.6574 | 0.6373 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium falciparum | serine repeat antigen 7 | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trypanosoma cruzi | cysteine peptidase (N-terminal), putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | serine-repeat antigen (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | fibroinase | 0.0928 | 1 | 1 |
| Toxoplasma gondii | cathepsin B | 0.0408 | 0.4049 | 0.37 |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | vivapain-3 | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 6 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH2 | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0489 | 0.4975 | 0.4975 |
| Toxoplasma gondii | cathepsin CPC1 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium vivax | dipeptidyl aminopeptidase 1, putative | 0.0189 | 0.155 | 0.1054 |
| Mycobacterium leprae | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0085 | 0.0358 | 0.5 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0212 | 0.1809 | 0.1328 |
| Onchocerca volvulus | 0.0189 | 0.155 | 0.155 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Onchocerca volvulus | 0.0105 | 0.0592 | 0.0592 | |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Echinococcus multilocularis | cathepsin L | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, cytosolic | 0.0353 | 0.3424 | 0.3038 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0189 | 0.155 | 0.155 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 2 | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.03 | 0.2813 | 0.2813 |
| Plasmodium falciparum | serine repeat antigen 8 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | dipeptidyl-peptidase I (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | glyceraldehyde 3-phosphate dehydrogenase | 0.0127 | 0.0838 | 0.0838 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | cathepsin B | 0.0408 | 0.4049 | 0.4049 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0628 | 0.6574 | 0.6373 |
| Plasmodium vivax | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | serine-repeat antigen (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin s | 0.03 | 0.2813 | 0.2391 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.8211 |
| Entamoeba histolytica | papain family cysteine protease domain containing protein | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 3 | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine proteinase 2 | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.0896 | 0.9633 | 0.9633 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0408 | 0.4049 | 0.37 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Echinococcus granulosus | cathepsin L | 0.0489 | 0.4975 | 0.4681 |
| Toxoplasma gondii | preprocathepsin c precursor, putative | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0628 | 0.6574 | 0.6373 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1328 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Chlamydia trachomatis | glyceraldehyde-3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.5 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.03 | 0.2813 | 0.2391 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Toxoplasma gondii | cathepsin CPL | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | calcium binding EGF domain-containing protein | 0.0105 | 0.0592 | 0.0592 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin F-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 3 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Brugia malayi | cathepsin L-like cysteine proteinase, identical | 0.03 | 0.2813 | 0.2813 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0489 | 0.4975 | 0.4681 |
| Toxoplasma gondii | cathepsin CPC2 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | unspecified product | 0.03 | 0.2813 | 0.2391 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0489 | 0.4975 | 0.4975 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | glyceraldehyde-3-phosphate dehydrogenase-like protein | 0.0844 | 0.9039 | 0.8983 |
| Schistosoma mansoni | cathepsin B (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | cathepsin L precursor | 0.0189 | 0.155 | 0.155 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0928 | 1 | 1 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0212 | 0.1809 | 0.1809 |
| Brugia malayi | cathepsin Z-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, C-terminal domain, putative | 0.0127 | 0.0838 | 0.0301 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | vivapain-2 | 0.0928 | 1 | 1 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Schistosoma mansoni | cathepsin S (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0141 | 0.1002 | 0.0474 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Mycobacterium ulcerans | glyceraldehyde 3-phosphate dehydrogenase Gap | 0.0353 | 0.3424 | 0.5 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.03 | 0.2813 | 0.2391 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Brugia malayi | cahepsin L-like non-peptiedase homolog | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | cysteine protease | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0628 | 0.6574 | 0.6574 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Plasmodium vivax | vivapain-2 | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L-like protease | 0.0189 | 0.155 | 0.2847 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1328 |
| Plasmodium vivax | serine-repeat antigen 5 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0408 | 0.4049 | 0.37 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | glyceraldehyde-3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.03 | 0.2813 | 0.2813 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0141 | 0.1002 | 0.1002 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1809 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | cysteine proteinase cathepsin Z | 0.0189 | 0.155 | 0.155 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin L-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Onchocerca volvulus | Eukaryotic initiation factor 4A homolog | 0.0102 | 0.0554 | 0.0554 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cysteine protease | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0628 | 0.6574 | 0.6574 | |
| Brugia malayi | cathepsin B-like cysteine proteinase | 0.0896 | 0.9633 | 0.9633 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0408 | 0.4049 | 0.37 |
| Schistosoma mansoni | cathepsin C | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0928 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0189 | 0.155 | 0.2847 |
| Mycobacterium tuberculosis | Probable cold-shock DeaD-box protein A homolog DeaD (ATP-dependent RNA helicase dead homolog) | 0.0102 | 0.0554 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 5 | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0083 | 0.0334 | 0.0334 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Echinococcus multilocularis | cysteine protease | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0896 | 0.9633 | 0.9611 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 2 | 0.0189 | 0.155 | 0.1054 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ED50 (functional) | = 35 uM | Effective concentration required to block the growth of bloodstream Trypanosoma brucei | ChEMBL. | 11405646 |
| ED50 (functional) | = 35 uM | Effective concentration required to block the growth of bloodstream Trypanosoma brucei | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective concentration required to inhibit the growth of mammalian stage of Trypanosoma cruzi grown in murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective concentration required to inhibit the growth of murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective concentration required to inhibit the growth of mammalian stage of Trypanosoma cruzi grown in murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective concentration required to inhibit the growth of murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| IC50 (binding) | = 6 uM | Inhibitory activity against Leishmania mexicana GAPDH | ChEMBL. | 11405646 |
| IC50 (binding) | = 6 uM | Inhibitory activity against Leishmania mexicana GAPDH | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma cruzi GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma cruzi GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 25 uM | In vitro inhibition of Trypanosoma brucei GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 25 uM | In vitro inhibition of Trypanosoma brucei GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | > 50 uM | In vitro inhibition of rabbit muscle GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | > 50 uM | In vitro inhibition of rabbit muscle GAPDH. | ChEMBL. | 11405646 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL431169
- PubChem: 11813682
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.