Detailed information for compound 308289
Basic information
Technical information
- TDR Targets ID: 308289
- Name: N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)- 2-[6-(naphthalen-1-ylmethylamino)purin-9-yl]o xolan-3-yl]-3-methoxybenzamide
- MW: 540.57 | Formula: C29H28N6O5
-
H donors: 4
H acceptors: 6
LogP: 3.13
Rotable bonds: 9
Rule of 5 violations (Lipinski): 2 - SMILES: OC[C@H]1O[C@H]([C@@H]([C@@H]1O)NC(=O)c1cccc(c1)OC)n1cnc2c1ncnc2NCc1cccc2c1cccc2
- InChi: 1S/C29H28N6O5/c1-39-20-10-5-8-18(12-20)28(38)34-23-25(37)22(14-36)40-29(23)35-16-33-24-26(31-15-32-27(24)35)30-13-19-9-4-7-17-6-2-3-11-21(17)19/h2-12,15-16,22-23,25,29,36-37H,13-14H2,1H3,(H,34,38)(H,30,31,32)/t22-,23-,25-,29-/m1/s1
- InChiKey: UMWAFTCCAGNLMN-BYHVZLFPSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(1-naphthylmethylamino)purin-9-yl]tetrahydrofuran-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(1-naphthalenylmethylamino)-9-purinyl]-3-tetrahydrofuranyl]-3-methoxybenzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(naphthalen-1-ylmethylamino)purin-9-yl]oxolan-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-methylol-2-[6-(1-naphthylmethylamino)purin-9-yl]tetrahydrofuran-3-yl]-3-methoxy-benzamide
- N-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[6-(1-naphthylmethylamino)-9-purinyl]-3-tetrahydrofuranyl]-3-methoxybenzamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | Curated by TDR Targets | No references |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | Curated by TDR Targets | No references |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | Starlite/ChEMBL | References |
| Leishmania mexicana | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | Starlite/ChEMBL | References |
| Homo sapiens | glyceraldehyde-3-phosphate dehydrogenase | Starlite/ChEMBL | References |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | glyceraldehyde-3-phosphate dehydrogenase, putative | 371 aa | 344 aa | 36.0 % |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | glyceraldehyde 3-phosphate dehydrogenase, putative | 359 aa | 370 aa | 40.0 % |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 331 aa | 331 aa | 27.8 % |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | glyceraldehyde-3-phosphate dehydrogenase | 293 aa | 259 aa | 28.2 % |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | glyceraldehyde-3-phosphate dehydrogenase, putative | 347 aa | 341 aa | 27.6 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Schistosoma mansoni | SmCB2 peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0141 | 0.1002 | 0.0474 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Mycobacterium ulcerans | glyceraldehyde 3-phosphate dehydrogenase Gap | 0.0353 | 0.3424 | 0.5 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.03 | 0.2813 | 0.2391 |
| Brugia malayi | cahepsin L-like non-peptiedase homolog | 0.0189 | 0.155 | 0.155 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0928 | 1 | 1 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0212 | 0.1809 | 0.1809 |
| Brugia malayi | cathepsin Z-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, C-terminal domain, putative | 0.0127 | 0.0838 | 0.0301 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | vivapain-2 | 0.0928 | 1 | 1 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Schistosoma mansoni | cathepsin S (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | cysteine protease | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0628 | 0.6574 | 0.6574 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Plasmodium vivax | vivapain-2 | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | cysteine proteinase cathepsin Z | 0.0189 | 0.155 | 0.155 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin L-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Onchocerca volvulus | Eukaryotic initiation factor 4A homolog | 0.0102 | 0.0554 | 0.0554 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Dipeptidyl-peptidase I precursor | 0.0189 | 0.155 | 0.2847 |
| Giardia lamblia | Cathepsin L-like protease | 0.0189 | 0.155 | 0.2847 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1328 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen 5 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0408 | 0.4049 | 0.37 |
| Plasmodium falciparum | glyceraldehyde-3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.03 | 0.2813 | 0.2813 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0141 | 0.1002 | 0.1002 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1809 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 5 | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0083 | 0.0334 | 0.0334 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Echinococcus multilocularis | cysteine protease | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0896 | 0.9633 | 0.9611 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 2 | 0.0189 | 0.155 | 0.1054 |
| Echinococcus granulosus | cysteine protease | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0628 | 0.6574 | 0.6574 | |
| Brugia malayi | cathepsin B-like cysteine proteinase | 0.0896 | 0.9633 | 0.9633 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0408 | 0.4049 | 0.37 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | cathepsin C | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0928 | 1 | 1 |
| Giardia lamblia | Hypothetical protein | 0.0189 | 0.155 | 0.2847 |
| Mycobacterium tuberculosis | Probable cold-shock DeaD-box protein A homolog DeaD (ATP-dependent RNA helicase dead homolog) | 0.0102 | 0.0554 | 1 |
| Brugia malayi | glyceraldehyde 3-phosphate dehydrogenase | 0.0127 | 0.0838 | 0.0838 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | cathepsin B | 0.0408 | 0.4049 | 0.4049 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0628 | 0.6574 | 0.6373 |
| Plasmodium vivax | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Onchocerca volvulus | 0.0189 | 0.155 | 0.155 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0105 | 0.0592 | 0.0592 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Echinococcus multilocularis | cathepsin L | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, cytosolic | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium falciparum | serine repeat antigen 8 | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0189 | 0.155 | 0.155 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 2 | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | cathepsin F-like cysteine proteinase | 0.03 | 0.2813 | 0.2813 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Schistosoma mansoni | dipeptidyl-peptidase I (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | hypothetical protein | 0.0896 | 0.9633 | 0.9633 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0896 | 0.9633 | 0.9611 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH1 | 0.0353 | 0.3424 | 0.3038 |
| Leishmania major | cysteine peptidase C (CPC),CPC cysteine peptidase, Clan CA, family C1, Cathepsin B-like | 0.0408 | 0.4049 | 0.37 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin s | 0.03 | 0.2813 | 0.2391 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen (SERA) | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | papain family cysteine protease domain containing protein | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.8211 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 3 | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine proteinase 2 | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Chlamydia trachomatis | glyceraldehyde-3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.5 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.03 | 0.2813 | 0.2391 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.03 | 0.2813 | 0.2813 |
| Loa Loa (eye worm) | calcium binding EGF domain-containing protein | 0.0105 | 0.0592 | 0.0592 |
| Toxoplasma gondii | cathepsin CPL | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin L | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0628 | 0.6574 | 0.6373 |
| Toxoplasma gondii | preprocathepsin c precursor, putative | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Plasmodium falciparum | dipeptidyl aminopeptidase 1 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1328 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | unspecified product | 0.03 | 0.2813 | 0.2391 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0489 | 0.4975 | 0.4975 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | glyceraldehyde-3-phosphate dehydrogenase-like protein | 0.0844 | 0.9039 | 0.8983 |
| Schistosoma mansoni | cathepsin B (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Leishmania major | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | cathepsin L precursor | 0.0189 | 0.155 | 0.155 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin F-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 3 | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Brugia malayi | cathepsin L-like cysteine proteinase, identical | 0.03 | 0.2813 | 0.2813 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Toxoplasma gondii | cathepsin CPC2 | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0489 | 0.4975 | 0.4681 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | glyceraldehyde 3-phosphate dehydrogenase | 0.0212 | 0.1809 | 0.1809 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Hypothetical protein | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Schistosoma mansoni | subfamily C1A non-peptidase homologue (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0127 | 0.0838 | 0.0301 |
| Trypanosoma brucei | cysteine peptidase C (CPC) | 0.0408 | 0.4049 | 0.37 |
| Echinococcus multilocularis | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | vivapain-1 | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cathepsin L-like protease | 0.0189 | 0.155 | 0.2847 |
| Echinococcus granulosus | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Treponema pallidum | glyceraldehyde 3-phosphate dehydrogenase (gap) | 0.0353 | 0.3424 | 1 |
| Brugia malayi | eukaryotic initiation factor 4A | 0.0102 | 0.0554 | 0.0554 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0928 | 1 | 1 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus granulosus | cathepsin L | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | cysteine peptidase C (CPC), putative | 0.0408 | 0.4049 | 0.37 |
| Giardia lamblia | Cathepsin B precursor | 0.0408 | 0.4049 | 1 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | unspecified product | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | fibroinase precursor | 0.0189 | 0.155 | 0.155 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | ctsf protein | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0928 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Plasmodium vivax | serine-repeat antigen (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0628 | 0.6574 | 0.6373 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0212 | 0.1809 | 0.1328 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | serine-repeat antigen 4 (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0928 | 1 | 1 |
| Leishmania major | cathepsin L-like protease | 0.0928 | 1 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Schistosoma mansoni | subfamily C1A unassigned peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium vivax | dipeptidyl aminopeptidase 2, putative | 0.0189 | 0.155 | 0.1054 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0628 | 0.6574 | 0.6373 |
| Loa Loa (eye worm) | hypothetical protein | 0.0102 | 0.0554 | 0.0554 |
| Echinococcus granulosus | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0628 | 0.6574 | 0.6373 |
| Giardia lamblia | Cathepsin B-like cysteine proteinase 3 precursor | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Plasmodium vivax | serine-repeat antigen 2 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0189 | 0.155 | 0.155 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Toxoplasma gondii | glyceraldehyde-3-phosphate dehydrogenase GAPDH2 | 0.0353 | 0.3424 | 0.3038 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0489 | 0.4975 | 0.4975 |
| Toxoplasma gondii | cathepsin CPC1 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium vivax | dipeptidyl aminopeptidase 1, putative | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0189 | 0.155 | 0.1054 |
| Mycobacterium leprae | Probable glyceraldehyde 3-phosphate dehydrogenase Gap (GAPDH) | 0.0085 | 0.0358 | 0.5 |
| Trichomonas vaginalis | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0212 | 0.1809 | 0.1328 |
| Plasmodium falciparum | serine repeat antigen 7 | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | hypothetical protein | 0.0628 | 0.6574 | 0.6574 |
| Trypanosoma cruzi | cysteine peptidase (N-terminal), putative | 0.0489 | 0.4975 | 0.4681 |
| Plasmodium vivax | serine-repeat antigen (SERA), putative | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Toxoplasma gondii | cathepsin B | 0.0408 | 0.4049 | 0.37 |
| Loa Loa (eye worm) | fibroinase | 0.0928 | 1 | 1 |
| Trypanosoma brucei | glyceraldehyde-3-phosphate dehydrogenase, putative | 0.0844 | 0.9039 | 0.8983 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | glyceraldehyde 3 phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3038 |
| Plasmodium vivax | vivapain-3 | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Plasmodium falciparum | serine repeat antigen 6 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, putative | 0.0353 | 0.3424 | 0.3038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0928 | 1 | 1 |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 1 | 0.0189 | 0.155 | 0.1054 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0353 | 0.3424 | 0.3038 |
| Echinococcus granulosus | cathepsin l1 | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cysteine protease | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 9 | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | Cathepsin L-like precursor | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0928 | 1 | 1 |
| Plasmodium falciparum | serine repeat antigen 4 | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0057 | 0.0034 | 0.0034 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0928 | 1 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin B-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Encystation-specific protease | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine proteinase 1, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L, S or H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.0226 | 0.1973 | 0.1973 |
| Brugia malayi | Glyceraldehyde 3-phosphate dehydrogenase | 0.0353 | 0.3424 | 0.3424 |
| Brugia malayi | Cathepsin L-like precursor | 0.03 | 0.2813 | 0.2813 |
| Brugia malayi | Calcium binding EGF domain containing protein | 0.0105 | 0.0592 | 0.0592 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or H-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0928 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0489 | 0.4975 | 0.4681 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin L cysteine protease | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0928 | 1 | 1 |
| Giardia lamblia | Cysteine protease | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | unspecified product | 0.0489 | 0.4975 | 0.4681 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Giardia lamblia | Glyceraldehyde 3-phosphate dehydrogenase | 0.0268 | 0.2454 | 0.5434 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0928 | 1 | 1 |
| Entamoeba histolytica | cysteine protease, putative | 0.0189 | 0.155 | 0.1054 |
| Loa Loa (eye worm) | glyceraldehyde-3-phosphate dehydrogenase | 0.0226 | 0.1973 | 0.1973 |
| Brugia malayi | cathepsin Z-like cysteine proteinase | 0.0189 | 0.155 | 0.155 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0928 | 1 | 1 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0489 | 0.4975 | 0.4681 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0189 | 0.155 | 0.1054 |
| Brugia malayi | cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0127 | 0.0838 | 0.0301 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | dipeptidyl aminopeptidase 3, putative | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin b | 0.0896 | 0.9633 | 0.9611 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, C-terminal domain, putative | 0.0127 | 0.0838 | 0.0301 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Wolbachia endosymbiont of Brugia malayi | glyceraldehyde-3-phosphate dehydrogenase, GapA | 0.0353 | 0.3424 | 0.5 |
| Entamoeba histolytica | cysteine protease, putative | 0.0489 | 0.4975 | 0.4681 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Onchocerca volvulus | 0.0928 | 1 | 1 | |
| Brugia malayi | Cathepsin L-like precursor | 0.0628 | 0.6574 | 0.6574 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Echinococcus granulosus | cathepsin l1 | 0.0628 | 0.6574 | 0.6373 |
| Entamoeba histolytica | papain family cysteine protease domain containing protein | 0.0189 | 0.155 | 0.1054 |
| Schistosoma mansoni | glyceraldehyde-3-phosphate dehydrogenase (phosphorylating) | 0.0353 | 0.3424 | 0.3038 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Plasmodium vivax | serine-repeat antigen 4 (SERA) | 0.0189 | 0.155 | 0.1054 |
| Echinococcus multilocularis | cathepsin L | 0.0489 | 0.4975 | 0.4681 |
| Trypanosoma brucei | glyceraldehyde 3-phosphate dehydrogenase, glycosomal | 0.0353 | 0.3424 | 0.3038 |
| Trypanosoma cruzi | glyceraldehyde 3-phosphate dehydrogenase, cytosolic, putative | 0.0127 | 0.0838 | 0.0301 |
| Loa Loa (eye worm) | hypothetical protein | 0.0189 | 0.155 | 0.155 |
| Giardia lamblia | Cathepsin L precursor | 0.0189 | 0.155 | 0.2847 |
| Schistosoma mansoni | cathepsin B-like peptidase (C01 family) | 0.0189 | 0.155 | 0.1054 |
| Giardia lamblia | Cathepsin B precursor | 0.0189 | 0.155 | 0.2847 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0928 | 1 | 1 |
| Plasmodium vivax | serine-repeat antigen 3 (SERA) | 0.0189 | 0.155 | 0.1054 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| ED50 (functional) | = 10 uM | Effective concentration required to inhibit the growth of mammalian stage of Trypanosoma cruzi grown in murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | = 10 uM | Effective concentration required to inhibit the growth of mammalian stage of Trypanosoma cruzi grown in murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | = 18 uM | Effective concentration required to block the growth of bloodstream Trypanosoma brucei | ChEMBL. | 11405646 |
| ED50 (functional) | = 18 uM | Effective concentration required to block the growth of bloodstream Trypanosoma brucei | ChEMBL. | 11405646 |
| ED50 (functional) | = 20 uM | Effective dose required against T. cruzi in bloodstream | ChEMBL. | 11206479 |
| ED50 (functional) | = 20 uM | Effective dose required against T. cruzi in bloodstream | ChEMBL. | 11206479 |
| ED50 (functional) | = 30 uM | Effective dose required against T. brucei in bloodstream | ChEMBL. | 11206479 |
| ED50 (functional) | = 30 uM | Effective dose required against T. brucei in bloodstream | ChEMBL. | 11206479 |
| ED50 (functional) | = 40 uM | Effective concentration required to inhibit the growth of murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | = 40 uM | Effective concentration required to inhibit the growth of murine 3T3 fibroblasts | ChEMBL. | 11405646 |
| ED50 (functional) | > 50 uM | Effective dose required against T. cruzi amastigotes in 3T3 Fibroblasts | ChEMBL. | 11206479 |
| ED50 (functional) | > 50 uM | Effective dose required against T. cruzi amastigotes in 3T3 Fibroblasts | ChEMBL. | 11206479 |
| IC50 (binding) | = 6 uM | Inhibitory concentration against T. mexicana glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | = 6 uM | Inhibitory activity against Leishmania mexicana GAPDH | ChEMBL. | 11405646 |
| IC50 (binding) | = 6 uM | Inhibitory concentration against T. mexicana glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | = 6 uM | Inhibitory activity against Leishmania mexicana GAPDH | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | Inhibitory concentration against T. cruzi glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma cruzi GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | Inhibitory concentration against T. cruzi glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | = 12 uM | In vitro inhibition of Trypanosoma cruzi GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 12 uM | Inhibition of Trypanosoma cruzi recombinant glycosomal GAPDH expressed in Escherichia coli by spectrophotometry | ChEMBL. | 19254846 |
| IC50 (binding) | = 25 uM | Inhibitory concentration against T. brucei glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | = 25 uM | In vitro inhibition of Trypanosoma brucei GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | = 25 uM | Inhibitory concentration against T. brucei glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | = 25 uM | In vitro inhibition of Trypanosoma brucei GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | > 50 uM | Inhibitory concentration against rabbit muscle glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | > 50 uM | In vitro inhibition of rabbit muscle GAPDH. | ChEMBL. | 11405646 |
| IC50 (binding) | > 50 uM | Inhibitory concentration against rabbit muscle glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| IC50 (binding) | > 50 uM | In vitro inhibition of rabbit muscle GAPDH. | ChEMBL. | 11405646 |
| Km (binding) | = 0.04 uM | Binding affinity for NAD- in human glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| Km (binding) | = 0.04 uM | Binding affinity for NAD- in human glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| Km (binding) | = 0.45 uM | Binding affinity for NAD- in trapanosomal glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
| Km (binding) | = 0.45 uM | Binding affinity for NAD- in trapanosomal glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | ChEMBL. | 11206479 |
Phenotypes
Whole-cell/tissue/organism interactions
We have no records of whole-cell/tissue assays done with this compound
What does this mean?
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
| Affected Entity | Phenotypic quality | Occurs in | Occurs at | Evidence | Observed in | Targets |
|---|---|---|---|---|---|---|
| growth (GO:0040007) | decreased (PATO:0000468) | amastigote (BTO:0000062) | inferred from in vitro culture assay (ECO:0000182) | Trypanosoma cruzi | 52306 | |
| Annotator: | millerja@u.washington.edu | Comment: | References: | 10200252 | ||
| growth (GO:0040007) | decreased (PATO:0000468) | amastigote (BTO:0000062) | inferred from in vitro culture assay (ECO:0000182) | Trypanosoma cruzi | 30533 | |
| Annotator: | millerja@u.washington.edu | Comment: | References: | 10200252 | ||
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL464924
- PubChem: 11753045
Bibliographic References
3 literature references were collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.