Detailed information for compound 1088943
Basic information
Technical information
- TDR Targets ID: 1088943
- Name: 2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]qui nolin-4-amine hydrochloride
- MW: 352.781 | Formula: C18H16ClF3N2
-
H donors: 1
H acceptors: 1
LogP: 6.18
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: Cc1ccc2c(c1)c(Nc1cccc(c1)C(F)(F)F)cc(n2)C.Cl
- InChi: 1S/C18H15F3N2.ClH/c1-11-6-7-16-15(8-11)17(9-12(2)22-16)23-14-5-3-4-13(10-14)18(19,20)21;/h3-10H,1-2H3,(H,22,23);1H
- InChiKey: KHVHAQIJCRZTCR-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]-4-quinolinamine hydrochloride
- (2,6-dimethyl-4-quinolyl)-[3-(trifluoromethyl)phenyl]amine hydrochloride
- ST5323605
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0621 | 0.274 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Schistosoma mansoni | phd/f-box containing protein | 0.0015 | 0.0174 | 0.0213 |
| Trichomonas vaginalis | glutathione reductase, putative | 0.0016 | 0.0187 | 0.0827 |
| Echinococcus granulosus | cpg binding protein | 0.003 | 0.0448 | 0.0578 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0058 | 0.0979 | 0.1286 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0612 | 0.0597 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.006 | 0.101 | 0.2373 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.0134 | 0.0894 |
| Plasmodium falciparum | thioredoxin reductase | 0.0047 | 0.0764 | 0.075 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0217 | 0.2836 |
| Trichomonas vaginalis | mercuric reductase, putative | 0.0016 | 0.0187 | 0.0827 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0611 | 0.2699 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0015 | 0.0174 | 0.0379 |
| Brugia malayi | jmjC domain containing protein | 0.0058 | 0.0979 | 0.23 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.2266 | 1 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0057 | 0.0952 | 0.125 |
| Echinococcus granulosus | Threonyl tRNA synthetase C | 0.0007 | 0.0016 | 0.0001 |
| Schistosoma mansoni | ubiquitously transcribed sex (X/Y) chromosome tetratricopeptide repeat protein-related | 0.0015 | 0.0174 | 0.0213 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0217 | 0.0956 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0057 | 0.0952 | 0.71 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Plasmodium vivax | JmjC domain containing protein | 0.0015 | 0.0174 | 0.0159 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0414 | 0.0532 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0611 | 0.0796 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0621 | 0.274 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0016 | 0.0176 | 0.0215 |
| Echinococcus granulosus | Jumonji AT rich interactive domain 1B | 0.0017 | 0.0205 | 0.0253 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.2266 | 0.5371 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.3734 | 0.5643 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0058 | 0.0979 | 0.1286 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0217 | 0.0327 |
| Mycobacterium tuberculosis | Putative ferredoxin reductase | 0.0107 | 0.1895 | 0.894 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Schistosoma mansoni | cpg binding protein | 0.003 | 0.0448 | 0.0578 |
| Mycobacterium leprae | PROBABLE NADH DEHYDROGENASE NDH | 0.0107 | 0.1895 | 0.894 |
| Trichomonas vaginalis | helicase, putative | 0.0006 | 0.0003 | 0.0013 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0414 | 0.5414 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0217 | 0.2836 |
| Onchocerca volvulus | 0.0028 | 0.0418 | 1 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Loa Loa (eye worm) | hypothetical protein | 0.0077 | 0.1341 | 0.3164 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0229 | 0.4204 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0404 | 0.7516 | 1 |
| Echinococcus granulosus | ATP dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 0.1768 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Schistosoma mansoni | phosphatidylserine receptor | 0.0015 | 0.0174 | 0.0213 |
| Chlamydia trachomatis | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 1 |
| Plasmodium falciparum | JmjC domain-containing protein, putative | 0.0015 | 0.0174 | 0.0159 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0016 | 0.0176 | 0.0215 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.006 | 0.1018 | 0.1338 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0715 | 0.9361 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0597 | 0.1387 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.0009 | 0.0047 | 0.0044 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.0176 | 0.0215 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.193 | 0.2554 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0612 | 0.0597 |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.0217 | 0.1022 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0286 | 0.3739 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.0016 | 0.0187 | 0.023 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0118 | 0.2119 | 1 |
| Loa Loa (eye worm) | CXXC zinc finger family protein | 0.0028 | 0.0418 | 0.0959 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0217 | 0.1616 |
| Leishmania major | threonyl-tRNA synthetase, putative | 0.0007 | 0.0016 | 0.0164 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0016 | 0.0187 | 0.1295 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0597 | 0.1387 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2266 | 0.3001 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.0176 | 0.0215 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0057 | 0.0952 | 0.2236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus multilocularis | jumonji domain containing 1A | 0.0015 | 0.0174 | 0.0213 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0049 | 0.0812 | 0.1901 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Echinococcus multilocularis | Jumonji, AT rich interactive domain 1B | 0.0017 | 0.0205 | 0.0253 |
| Brugia malayi | jmjC domain containing protein | 0.0015 | 0.0174 | 0.0379 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0047 | 0.0764 | 0.1787 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0715 | 0.9361 |
| Leishmania major | 2-oxoglutarate dehydrogenase, e3 component, lipoamidedehydrogenase-like protein | 0.0016 | 0.0187 | 0.1967 |
| Leishmania major | trypanothione reductase | 0.0047 | 0.0764 | 0.8024 |
| Trypanosoma brucei | trypanothione reductase | 0.0047 | 0.0764 | 1 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0047 | 0.0764 | 0.3605 |
| Loa Loa (eye worm) | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0053 | 0.088 | 0.2064 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Toxoplasma gondii | threonyl-tRNA synthetase family protein | 0.0007 | 0.0016 | 0.0024 |
| Mycobacterium tuberculosis | NAD(P)H quinone reductase LpdA | 0.0118 | 0.2119 | 1 |
| Brugia malayi | jmjC domain containing protein | 0.006 | 0.101 | 0.2373 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Mycobacterium ulcerans | threonyl-tRNA synthetase | 0.0007 | 0.0016 | 0.0116 |
| Echinococcus multilocularis | phd:f box containing protein | 0.0015 | 0.0174 | 0.0213 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0597 | 0.9752 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0217 | 0.0956 |
| Wolbachia endosymbiont of Brugia malayi | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 1 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0229 | 0.4204 | 1 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0175 | 0.0381 |
| Plasmodium falciparum | glutathione reductase | 0.0047 | 0.0764 | 0.075 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase | 0.0016 | 0.0187 | 0.1397 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0217 | 0.0956 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.2266 | 0.5371 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0217 | 0.2836 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0217 | 0.0956 |
| Giardia lamblia | Hexose transporter | 0.0018 | 0.0217 | 0.346 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Brugia malayi | Probable ClpP-like protease | 0.0077 | 0.1341 | 0.3164 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0611 | 0.1423 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0715 | 0.9361 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0611 | 0.0796 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0597 | 0.1387 |
| Trypanosoma brucei | dihydrolipoyl dehydrogenase | 0.0016 | 0.0187 | 0.2452 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0217 | 0.0269 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0015 | 0.0174 | 0.0213 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0414 | 0.0399 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0611 | 0.1423 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0217 | 0.1616 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Mycobacterium tuberculosis | Probable ATP-dependent CLP protease proteolytic subunit 1 ClpP1 (endopeptidase CLP) | 0.0051 | 0.0838 | 0.3955 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0611 | 1 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0611 | 0.8004 |
| Echinococcus multilocularis | ATP dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 0.1768 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, mitochondrial, putative | 0.0016 | 0.0187 | 0.0172 |
| Mycobacterium ulcerans | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 1 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0566 | 0.0735 |
| Schistosoma mansoni | peptidase Clp (S14 family) | 0.0077 | 0.1341 | 0.1768 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0217 | 0.048 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0597 | 1 |
| Mycobacterium tuberculosis | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase)(ThrRS) (threonine-tRNA ligase) | 0.0007 | 0.0016 | 0.0074 |
| Plasmodium falciparum | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 0.1328 |
| Echinococcus multilocularis | JmjC domain containing protein 4 | 0.0015 | 0.0174 | 0.0213 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0217 | 0.0269 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0414 | 0.0625 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0217 | 0.0327 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0621 | 0.274 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0597 | 0.2634 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0217 | 0.0201 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Mycobacterium ulcerans | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 1 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0217 | 0.048 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0612 | 0.0597 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0621 | 0.274 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0217 | 0.048 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.193 | 0.2554 |
| Toxoplasma gondii | hypothetical protein | 0.0027 | 0.0384 | 0.0581 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Loa Loa (eye worm) | hypothetical protein | 0.0034 | 0.0518 | 0.1198 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0414 | 0.3003 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0612 | 0.0925 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0107 | 0.1895 | 0.894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Echinococcus multilocularis | Threonyl tRNA synthetase, C | 0.0007 | 0.0016 | 0.0001 |
| Plasmodium falciparum | glutathione reductase | 0.0016 | 0.0187 | 0.0172 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0611 | 0.6422 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.006 | 0.101 | 0.1327 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0057 | 0.0952 | 1 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0414 | 0.0532 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0715 | 0.7511 |
| Schistosoma mansoni | hypothetical protein | 0.0034 | 0.0518 | 0.067 |
| Echinococcus granulosus | JmjC domain containing protein 4 | 0.0015 | 0.0174 | 0.0213 |
| Schistosoma mansoni | glycyl-tRNA synthetase | 0.0007 | 0.0016 | 0.0001 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0414 | 0.095 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0333 | 0.1573 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0611 | 1 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.2266 | 0.3001 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0049 | 0.0812 | 0.1901 |
| Mycobacterium leprae | PROBABLE ATP-DEPENDENT CLP PROTEASE PROTEOLYTIC SUBUNIT 1 CLPP1 (ENDOPEPTIDASE CLP) | 0.0051 | 0.0838 | 0.3955 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Echinococcus granulosus | GPCR family 2 | 0.0016 | 0.0176 | 0.0215 |
| Brugia malayi | jmjC domain containing protein | 0.0015 | 0.0174 | 0.0379 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0058 | 0.0979 | 0.1286 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0217 | 0.048 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0217 | 0.2836 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0217 | 0.0956 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0621 | 0.8126 |
| Mycobacterium leprae | PROBABLE ATP-DEPENDENT CLP PROTEASE PROTEOLYTIC SUBUNIT 2 CLPP2 (ENDOPEPTIDASE CLP 2) | 0.0077 | 0.1341 | 0.6328 |
| Schistosoma mansoni | cpg binding protein | 0.0028 | 0.0418 | 0.0537 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0016 | 0.0187 | 0.2452 |
| Brugia malayi | CXXC zinc finger family protein | 0.0028 | 0.0418 | 0.0959 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0047 | 0.0764 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0174 | 0.0379 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Chlamydia trachomatis | proline--tRNA ligase | 0.0013 | 0.0134 | 0.0894 |
| Leishmania major | acetoin dehydrogenase e3 component-like protein | 0.0016 | 0.0187 | 0.1967 |
| Echinococcus granulosus | jumonji domain containing 1A | 0.0015 | 0.0174 | 0.0213 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0016 | 0.0176 | 0.0215 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0015 | 0.0174 | 0.0379 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0612 | 0.0925 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0621 | 0.274 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0612 | 0.0597 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0217 | 0.0269 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0217 | 0.0269 |
| Leishmania major | hypothetical protein, conserved | 0.0015 | 0.0174 | 0.183 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0217 | 0.2276 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0348 | 0.1536 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0715 | 0.7511 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0174 | 0.0379 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0597 | 0.1387 |
| Loa Loa (eye worm) | glutathione reductase | 0.0047 | 0.0764 | 0.1787 |
| Toxoplasma gondii | histone lysine demethylase JMJD6a | 0.0015 | 0.0174 | 0.0263 |
| Mycobacterium ulcerans | glycyl-tRNA synthetase | 0.0007 | 0.0016 | 0.0116 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0715 | 0.0701 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | chromodomain-helicase-DNA-binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0057 | 0.0952 | 0.4493 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0217 | 0.048 |
| Loa Loa (eye worm) | hypothetical protein | 0.0016 | 0.0176 | 0.0383 |
| Echinococcus granulosus | dnaJ subfamily B | 0.0404 | 0.7516 | 1 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.1967 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0217 | 0.0269 |
| Echinococcus multilocularis | peptidase Clp (S14 family) | 0.0051 | 0.0838 | 0.1098 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0016 | 0.0204 |
| Mycobacterium tuberculosis | Probable reductase | 0.0107 | 0.1895 | 0.894 |
| Trypanosoma brucei | glycyl-tRNA synthetase, putative | 0.0007 | 0.0016 | 0.0204 |
| Brugia malayi | alpha keto acid dehydrogenase complex, E3 component, lipoamide dehydrogenase | 0.0012 | 0.0106 | 0.0216 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0612 | 0.0597 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0463 | 0.1067 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0621 | 0.652 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.2266 | 0.2253 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.3734 | 0.3724 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0597 | 0.0776 |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0118 | 0.2119 | 1 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0057 | 0.0952 | 0.125 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.6617 | 0.6612 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0047 | 0.0764 | 0.0999 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0566 | 0.0735 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0217 | 0.0269 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0611 | 0.0796 |
| Schistosoma mansoni | dihydrolipoamide dehydrogenase | 0.0016 | 0.0187 | 0.023 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.0176 | 0.0215 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0414 | 0.6849 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2266 | 0.3001 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase, point mutation | 0.0016 | 0.0187 | 0.2452 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0217 | 0.0269 |
| Brugia malayi | jmjC domain containing protein | 0.0015 | 0.0174 | 0.0379 |
| Plasmodium vivax | ATP-dependent Clp protease proteolytic subunit, putative | 0.0027 | 0.0384 | 0.0369 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0612 | 0.0597 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0611 | 0.1423 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Echinococcus granulosus | phd:f box containing protein | 0.0015 | 0.0174 | 0.0213 |
| Giardia lamblia | NADH oxidase lateral transfer candidate | 0.0016 | 0.0187 | 0.2955 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0414 | 0.6679 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0611 | 0.1423 |
| Brugia malayi | glutathione reductase | 0.0047 | 0.0764 | 0.1787 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0016 | 0.0187 | 0.1295 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0016 | 0.0176 | 0.0215 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Mycobacterium tuberculosis | Dihydrolipoamide dehydrogenase LpdC (lipoamide reductase (NADH)) (lipoyl dehydrogenase) (dihydrolipoyl dehydrogenase) (diaphoras | 0.0118 | 0.2119 | 1 |
| Mycobacterium ulcerans | prolyl-tRNA synthetase | 0.0013 | 0.0134 | 0.1 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0414 | 0.3084 |
| Mycobacterium tuberculosis | Probable soluble pyridine nucleotide transhydrogenase SthA (STH) (NAD(P)(+) transhydrogenase [B-specific]) (nicotinamide nucleot | 0.0016 | 0.0187 | 0.0884 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0621 | 0.274 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.006 | 0.101 | 0.1327 |
| Mycobacterium tuberculosis | Probable membrane NADH dehydrogenase NdhA | 0.0107 | 0.1895 | 0.894 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0217 | 0.048 |
| Mycobacterium tuberculosis | Probable NADH dehydrogenase Ndh | 0.0107 | 0.1895 | 0.894 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0612 | 0.0597 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0015 | 0.0174 | 0.0379 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.0176 | 0.0215 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0621 | 0.8126 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0612 | 0.0597 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0217 | 0.048 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0217 | 0.048 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.0217 | 0.1022 |
| Loa Loa (eye worm) | histone methyltransferase | 0.0009 | 0.0047 | 0.0076 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Plasmodium falciparum | ATP-dependent Clp protease proteolytic subunit | 0.0027 | 0.0384 | 0.0369 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0057 | 0.0952 | 0.125 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0016 | 0.0187 | 0.041 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0621 | 0.8126 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0016 | 0.0176 | 0.0383 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0217 | 0.1517 |
| Echinococcus multilocularis | dnaJ subfamily B | 0.0404 | 0.7516 | 1 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0414 | 0.0532 |
| Loa Loa (eye worm) | hypothetical protein | 0.0049 | 0.0812 | 0.1901 |
| Toxoplasma gondii | ATP-dependent Clp endopeptidase, proteolytic subunit ClpP domain-containing protein | 0.0077 | 0.1341 | 0.2027 |
| Mycobacterium tuberculosis | Probable nitrite reductase [NAD(P)H] large subunit [FAD flavoprotein] NirB | 0.0107 | 0.1895 | 0.894 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.1967 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0057 | 0.0952 | 0.71 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0621 | 0.274 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0597 | 0.0776 |
| Giardia lamblia | Sugar-proton symporter | 0.0018 | 0.0217 | 0.346 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Echinococcus granulosus | peptidase Clp S14 family | 0.0051 | 0.0838 | 0.1098 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase, LpdB | 0.0016 | 0.0187 | 0.1397 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0217 | 0.0269 |
| Plasmodium vivax | glutathione reductase, putative | 0.0047 | 0.0764 | 0.075 |
| Toxoplasma gondii | histone lysine demethylase JMJC1/KDM5D/JARID1D | 0.0015 | 0.0174 | 0.0263 |
| Toxoplasma gondii | ATP-dependent Clp endopeptidase, proteolytic subunit ClpP domain-containing protein | 0.0077 | 0.1341 | 0.2027 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0217 | 0.0201 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0016 | 0.0187 | 0.2452 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0621 | 0.652 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0217 | 0.048 |
| Toxoplasma gondii | histone lysine methyltransferase SET1 | 0.0054 | 0.0897 | 0.1356 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0217 | 0.0327 |
| Trichomonas vaginalis | chromodomain-helicase-DNA-binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Trypanosoma brucei | threonyl-tRNA synthetase, putative | 0.0007 | 0.0016 | 0.0204 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Toxoplasma gondii | pyruvate dehydrogenase complex subunit PDH-E3II | 0.0016 | 0.0187 | 0.0283 |
| Mycobacterium leprae | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase) (ThrRS) (Threonine-tRNA ligase) | 0.0007 | 0.0016 | 0.0074 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.6617 | 1 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0333 | 0.1573 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0621 | 0.652 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0217 | 0.0269 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.0009 | 0.0047 | 0.0044 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0414 | 0.1826 |
| Brugia malayi | jmjC domain containing protein | 0.0015 | 0.0174 | 0.0379 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0217 | 0.0269 |
| Toxoplasma gondii | NADPH-glutathione reductase | 0.0016 | 0.0187 | 0.0283 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0016 | 0.0176 | 0.0383 |
| Treponema pallidum | ATP-dependent Clp protease proteolytic subunit | 0.0027 | 0.0384 | 0.2782 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0715 | 0.0701 |
| Echinococcus granulosus | glycyl tRNA synthetase | 0.0007 | 0.0016 | 0.0001 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0611 | 0.0796 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0003 | 0.0013 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0016 | 0.0187 | 0.2452 |
| Toxoplasma gondii | glycyl-tRNA synthetase | 0.0007 | 0.0016 | 0.0024 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0217 | 0.1616 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0217 | 0.2276 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | 0.0016 | 0.0187 | 0.0172 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0217 | 0.1616 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0414 | 0.095 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0016 | 0.0176 | 0.0215 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, mitochondrial | 0.0016 | 0.0187 | 0.0172 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.3734 | 0.3724 |
| Chlamydia trachomatis | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 1 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2266 | 0.3001 |
| Treponema pallidum | NADH oxidase | 0.0016 | 0.0187 | 0.1295 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0414 | 0.4344 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Mycobacterium leprae | ATP-dependent Clp protease proteolytic subunit 1 | 0.0027 | 0.0384 | 0.1814 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.2266 | 0.2253 |
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.0016 | 0.0187 | 0.023 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0414 | 0.5414 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 1 | 1 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0597 | 0.0776 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0217 | 0.048 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0217 | 0.0956 |
| Echinococcus granulosus | lysine specific demethylase 6a | 0.0015 | 0.0174 | 0.0213 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0015 | 0.0174 | 0.228 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0621 | 0.652 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0414 | 0.1952 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0003 | 0.0013 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0333 | 0.1573 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase, dimerisation domain containing protein | 0.0012 | 0.0106 | 0.0216 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0174 | 0.0379 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0611 | 0.0796 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0058 | 0.0979 | 0.1286 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0611 | 0.0796 |
| Brugia malayi | Thioredoxin reductase | 0.0047 | 0.0764 | 0.1787 |
| Plasmodium falciparum | thioredoxin reductase | 0.0016 | 0.0187 | 0.0172 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0217 | 0.0269 |
| Schistosoma mansoni | protein phosphatase 2C | 0.0015 | 0.0174 | 0.0213 |
| Echinococcus multilocularis | glycyl tRNA synthetase | 0.0007 | 0.0016 | 0.0001 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0612 | 0.0597 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0016 | 0.0176 | 0.0383 |
| Chlamydia trachomatis | dihydrolipoyl dehydrogenase | 0.0016 | 0.0187 | 0.1295 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0016 | 0.0204 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0217 | 0.2836 |
| Mycobacterium ulcerans | flavoprotein disulfide reductase | 0.0016 | 0.0187 | 0.1397 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0414 | 0.3084 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.006 | 0.101 | 0.1327 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0034 | 0.0518 | 0.1198 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0016 | 0.0187 | 0.2452 |
| Echinococcus multilocularis | cpg binding protein | 0.003 | 0.0448 | 0.0578 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0217 | 0.048 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0611 | 0.1423 |
| Treponema pallidum | ATP-dependent Clp protease proteolytic subunit | 0.0077 | 0.1341 | 1 |
| Plasmodium vivax | ATP-dependent Clp protease proteolytic subunit, putative | 0.0077 | 0.1341 | 0.1328 |
| Trypanosoma brucei | JmjC domain, hydroxylase, putative | 0.0015 | 0.0174 | 0.228 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2266 | 0.3001 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0612 | 0.0925 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0015 | 0.0174 | 0.228 |
| Brugia malayi | F/Y-rich N-terminus family protein | 0.0009 | 0.0045 | 0.0071 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0414 | 0.0532 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.2266 | 0.3424 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0047 | 0.0764 | 0.075 |
| Schistosoma mansoni | cpg binding protein | 0.003 | 0.0448 | 0.0578 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, apicoplast, putative | 0.0016 | 0.0187 | 0.0172 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0621 | 0.8126 |
| Trichomonas vaginalis | threonyl-tRNA synthetase, putative | 0.0007 | 0.0016 | 0.0069 |
| Mycobacterium tuberculosis | Probable ATP-dependent CLP protease proteolytic subunit 2 ClpP2 (endopeptidase CLP 2) | 0.0051 | 0.0838 | 0.3955 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0597 | 0.2816 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0217 | 0.0956 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0217 | 0.0327 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0597 | 0.0776 |
| Echinococcus multilocularis | lysine specific demethylase 6a | 0.0015 | 0.0174 | 0.0213 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0715 | 0.1081 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0049 | 0.0812 | 0.1901 |
| Toxoplasma gondii | thioredoxin reductase | 0.0047 | 0.0764 | 0.1155 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0047 | 0.0764 | 0.0999 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0414 | 0.0399 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 1170 nM | MMV: Inhibition of Plasmodium falciparum 3D7 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | 0.8787 uM | ST_JUDE: Plasmodium falciparum 3D7 EC50 (uM) as measured by SYBR green dye | ChEMBL. | 20485428 |
| EC50 (functional) | 6.0126 uM | ST_JUDE: Plasmodium falciparum K1 EC50 (uM) as measured by SYBR green dye | ChEMBL. | 20485428 |
| Growth Inhibition (functional) | = -5.193 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 1393 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 3.06393265724182 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 3.0639326572418213 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 3.85670399665833 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 4.11720895767212 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 5.95651340484619 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 5.956513404846191 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 | = 28.877058029174805 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| Inhibition (functional) | = -27.5346153876285 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -16.1954021856606 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.57432764927538 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.574327649275375 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 10.4 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 39 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 48 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 53.24584799726389 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 53.2458479972639 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 98 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Inhibition (functional) | = 106 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Ratio (functional) | = 0.875 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.1571 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0826 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0219 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 2 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 2 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 3 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | 20485428 | |
| Trypanosoma brucei gambiense | |||
| Leishmania infantum | ChEMBL23 | ||
| Trypanosoma cruzi | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL589723
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.