Detailed information for compound 1292326
Basic information
Technical information
- TDR Targets ID: 1292326
- Name: 3-[2-[(3-hydroxyphenyl)amino]-1,3-thiazol-4-y l]-6-methoxychromen-2-one
- MW: 366.39 | Formula: C19H14N2O4S
-
H donors: 2
H acceptors: 3
LogP: 4.1
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc2c(c1)cc(c(=O)o2)c1csc(n1)Nc1cccc(c1)O
- InChi: 1S/C19H14N2O4S/c1-24-14-5-6-17-11(7-14)8-15(18(23)25-17)16-10-26-19(21-16)20-12-3-2-4-13(22)9-12/h2-10,22H,1H3,(H,20,21)
- InChiKey: DGMUCJVEVOZWBL-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 3-[2-[(3-hydroxyphenyl)amino]thiazol-4-yl]-6-methoxy-chromen-2-one
- 3-[2-[(3-hydroxyphenyl)amino]-4-thiazolyl]-6-methoxy-2-chromenone
- 3-[2-[(3-hydroxyphenyl)amino]thiazol-4-yl]-6-methoxy-coumarin
- 3-[2-[(3-hydroxyphenyl)amino]-1,3-thiazol-4-yl]-6-methoxy-chromen-2-one
- Oprea1_486829
- 3-[2-(3-Hydroxy-phenylamino)-thiazol-4-yl]-6-methoxy-chromen-2-one
- BAS 04999564
- Oprea1_440613
- ZINC00789077
- MLS000548677
- SMR000172285
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | huntingtin | Starlite/ChEMBL | No references |
| Homo sapiens | APEX nuclease (multifunctional DNA repair enzyme) 1 | Starlite/ChEMBL | No references |
| Homo sapiens | multiple endocrine neoplasia I | No references | |
| Homo sapiens | microtubule-associated protein tau | Starlite/ChEMBL | No references |
| Homo sapiens | heat shock protein 90kDa alpha (cytosolic), class A member 1 | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed), eta | Starlite/ChEMBL | No references |
| Staphylococcus aureus (strain N315) | Probable nicotinate-nucleotide adenylyltransferase | Starlite/ChEMBL | No references |
| Photinus pyralis | Luciferin 4-monooxygenase | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific methyltransferase 2A | Starlite/ChEMBL | No references |
| Plasmodium falciparum | heat shock protein 90, putative | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | DNA gyrase/topoisomerase IV, A subunit family protein | 0.0008 | 0.0009 | 0.0054 |
| Brugia malayi | kinase, mitochondrial precursor | 0.0008 | 0.0009 | 0.0054 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Brugia malayi | DNA topoisomerase II, alpha isozyme | 0.0008 | 0.0009 | 0.0054 |
| Loa Loa (eye worm) | oxidoreductase | 0.0008 | 0.0014 | 0.0083 |
| Mycobacterium ulcerans | two component system response phosphate sensor kinase, PhoR | 0.0008 | 0.0009 | 0.0023 |
| Trypanosoma brucei | Histidine kinase-, DNA gyrase B-, and HSP90-like ATPase, putative | 0.0008 | 0.0009 | 0.0158 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0023 | 0.0195 | 0.3341 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0023 | 0.0195 | 0.3234 |
| Trypanosoma cruzi | mitochondrial DNA topoisomerase II, putative | 0.0008 | 0.0009 | 0.0158 |
| Trypanosoma brucei | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0244 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0023 | 0.0195 | 0.0195 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Echinococcus granulosus | cpg binding protein | 0.0037 | 0.0356 | 0.0347 |
| Plasmodium vivax | heat shock protein 90, putative | 0.0037 | 0.0357 | 0.0875 |
| Mycobacterium tuberculosis | Two component sensory transduction histidine kinase MtrB | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Echinococcus multilocularis | dna polymerase kappa | 0.0023 | 0.0195 | 0.0186 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0029 | 0.0259 | 0.0634 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0187 | 0.3218 |
| Echinococcus multilocularis | heat shock protein | 0.0055 | 0.0582 | 0.0574 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Trichomonas vaginalis | heat shock protein, putative | 0.004 | 0.0399 | 0.6804 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD8 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.0014 | 0.0035 |
| Toxoplasma gondii | histone lysine methyltransferase SET1 | 0.0066 | 0.0708 | 0.2888 |
| Mycobacterium ulcerans | long-chain-acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Toxoplasma gondii | propionate-CoA ligase | 0.0008 | 0.0014 | 0.0058 |
| Loa Loa (eye worm) | heat shock protein 75 | 0.0037 | 0.0357 | 0.2098 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0055 | 0.0582 | 1 |
| Trypanosoma brucei | unspecified product | 0.0023 | 0.0195 | 0.3341 |
| Mycobacterium tuberculosis | Probable peptide synthetase Nrp (peptide synthase) | 0.0008 | 0.0014 | 0.0035 |
| Entamoeba histolytica | heat shock protein 90, putative | 0.0055 | 0.0582 | 1 |
| Treponema pallidum | hypothetical protein | 0.0345 | 0.4084 | 1 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.0157 | 0.0385 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0009 | 0.0054 |
| Mycobacterium ulcerans | two component sensory transduction histidine kinase MtrB | 0.0008 | 0.0009 | 0.0023 |
| Leishmania major | developmentally regulated phosphoprotein-like protein | 0.0008 | 0.0009 | 0.0158 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.0157 | 0.0385 |
| Plasmodium vivax | nicotinate-nucleotide adenylyltransferase, putative | 0.0345 | 0.4084 | 1 |
| Loa Loa (eye worm) | TOPoisomerase family member | 0.0008 | 0.0009 | 0.0054 |
| Mycobacterium leprae | POSSIBLE FATTY-ACID-CoA LIGASE FADD10 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0008 | 0.0014 | 0.0012 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0029 | 0.0259 | 0.4448 |
| Plasmodium vivax | heat shock protein, putative | 0.021 | 0.2451 | 0.6002 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0029 | 0.0259 | 0.0613 |
| Wolbachia endosymbiont of Brugia malayi | heat shock protein 90 | 0.0052 | 0.0541 | 1 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0029 | 0.0259 | 0.4448 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0023 | 0.0195 | 0.0186 |
| Trichomonas vaginalis | DNA topoisomerase II, putative | 0.0008 | 0.0009 | 0.0029 |
| Toxoplasma gondii | exonuclease III APE | 0.0023 | 0.0187 | 0.0764 |
| Mycobacterium tuberculosis | Two component sensor histidine kinase DosT | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Leishmania major | DNA topoisomerase ii | 0.0008 | 0.0009 | 0.0158 |
| Toxoplasma gondii | DNA topoisomerase 2, putative | 0.0008 | 0.0009 | 0.0038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0171 | 0.1006 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.0157 | 0.0385 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0029 | 0.0259 | 0.0634 |
| Mycobacterium tuberculosis | Two component sensor kinase [second part] | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma brucei | Heat shock protein 83, putative | 0.0055 | 0.0582 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0029 | 0.0259 | 0.0634 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0244 |
| Echinococcus multilocularis | heat shock protein 90 | 0.0055 | 0.0582 | 0.0574 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0008 | 0.0014 | 0.0116 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0055 | 0.0582 | 1 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD1 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.0014 | 0.0035 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0029 | 0.0259 | 0.4359 |
| Toxoplasma gondii | heat shock protein 90, putative | 0.0055 | 0.0582 | 0.2376 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0029 | 0.0259 | 0.0634 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0259 | 0.1521 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0055 | 0.0582 | 1 |
| Onchocerca volvulus | 0.0008 | 0.0014 | 0.0029 | |
| Mycobacterium ulcerans | two component regulator - sensor kinase | 0.0008 | 0.0009 | 0.0023 |
| Schistosoma mansoni | endoplasmin | 0.0055 | 0.0582 | 0.0582 |
| Mycobacterium tuberculosis | Fatty-acid-CoA synthetase FadD17 (fatty-acid-CoA synthase) (fatty-acid-CoA ligase) | 0.0008 | 0.0014 | 0.0035 |
| Mycobacterium ulcerans | two component sensor kinase MprB | 0.0008 | 0.0009 | 0.0023 |
| Trypanosoma cruzi | Heat shock protein 83, putative | 0.0055 | 0.0582 | 1 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0187 | 0.0459 |
| Mycobacterium ulcerans | acetyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Treponema pallidum | exodeoxyribonuclease (exoA) | 0.0023 | 0.0187 | 0.0437 |
| Loa Loa (eye worm) | hypothetical protein | 0.0148 | 0.1703 | 1 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0054 | 0.0567 | 0.9737 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Mycobacterium tuberculosis | Conserved protein | 0.0008 | 0.0009 | 0.0022 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0023 | 0.0195 | 0.0186 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Plasmodium vivax | DNA gyrase subunit B, putative | 0.0008 | 0.0009 | 0.0023 |
| Mycobacterium ulcerans | two component sensor histidine kinase TrcS | 0.0008 | 0.0009 | 0.0023 |
| Leishmania major | DNA polymerase eta, putative | 0.0038 | 0.0372 | 0.6395 |
| Giardia lamblia | DINP protein human, muc B family | 0.0023 | 0.0195 | 0.3341 |
| Echinococcus multilocularis | dna polymerase eta | 0.0054 | 0.0567 | 0.0558 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0009 | 0.0054 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Trypanosoma cruzi | developmentally regulated phosphoprotein, putative | 0.0008 | 0.0009 | 0.0158 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0029 | 0.0259 | 0.0613 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0244 |
| Trypanosoma brucei | heat shock protein 84, putative | 0.0037 | 0.0357 | 0.6139 |
| Mycobacterium tuberculosis | Possible two component sensor kinase | 0.0008 | 0.0009 | 0.0022 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.0011 | 0.0042 | 0.0033 |
| Loa Loa (eye worm) | histone methyltransferase | 0.0011 | 0.0042 | 0.0248 |
| Trichomonas vaginalis | receptor histidine kinase, putative | 0.0008 | 0.0009 | 0.0029 |
| Mycobacterium tuberculosis | Bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ArCP synthetase | 0.0008 | 0.0014 | 0.0035 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0023 | 0.0195 | 0.0476 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0023 | 0.0187 | 0.3218 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.0023 | 0.0187 | 0.0459 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0029 | 0.0259 | 0.1521 |
| Giardia lamblia | Grp94/Hsp90 | 0.0052 | 0.0541 | 0.9293 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtE | 0.0008 | 0.0014 | 0.0035 |
| Brugia malayi | heat shock protein 90 | 0.0055 | 0.0582 | 0.3418 |
| Mycobacterium ulcerans | DNA gyrase subunit B | 0.0008 | 0.0009 | 0.0023 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0008 | 0.0014 | 0.0083 |
| Mycobacterium ulcerans | putative regultory protein | 0.0008 | 0.0009 | 0.0023 |
| Schistosoma mansoni | heat shock protein | 0.0037 | 0.0357 | 0.0357 |
| Brugia malayi | acetyl-Coenzyme A synthetase 2 | 0.0008 | 0.0014 | 0.0083 |
| Trichomonas vaginalis | sensory transduction histidine kinase bacterial, putative | 0.0008 | 0.0009 | 0.0029 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Onchocerca volvulus | Heat shock protein 75 kDa, mitochondrial homolog | 0.0037 | 0.0357 | 0.2055 |
| Mycobacterium tuberculosis | Two component sensor kinase MprB | 0.0008 | 0.0009 | 0.0022 |
| Echinococcus multilocularis | mixed lineage leukemia protein mll | 0.0009 | 0.0017 | 0.0008 |
| Mycobacterium tuberculosis | P-hydroxybenzoyl-AMP ligase FadD22 | 0.0008 | 0.0014 | 0.0035 |
| Leishmania major | lipophosphoglycan biosynthetic protein, putative,heat shock protein 90, putative,glucose regulated protein 94, putative | 0.0052 | 0.0541 | 0.9293 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Mycobacterium tuberculosis | Peptide synthetase MbtE (peptide synthase) | 0.0008 | 0.0014 | 0.0035 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0052 | 0.0541 | 0.9284 |
| Loa Loa (eye worm) | endoplasmin | 0.0055 | 0.0582 | 0.3418 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0032 | 0.0302 | 0.512 |
| Treponema pallidum | heat shock protein 90 | 0.0052 | 0.0541 | 0.1305 |
| Trypanosoma brucei | unspecified product | 0.0016 | 0.0107 | 0.1838 |
| Echinococcus multilocularis | cpg binding protein | 0.0037 | 0.0356 | 0.0347 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0008 | 0.0009 | 0.0023 |
| Plasmodium falciparum | endoplasmin, putative | 0.004 | 0.0399 | 0.0976 |
| Echinococcus granulosus | dna polymerase eta | 0.0054 | 0.0567 | 0.0558 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0054 | 0.0567 | 0.9737 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0054 | 0.0567 | 0.3328 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0008 | 0.0014 | 0.0083 |
| Brugia malayi | CXXC zinc finger family protein | 0.0035 | 0.0332 | 0.1951 |
| Plasmodium falciparum | DNA gyrase subunit B | 0.0008 | 0.0009 | 0.0023 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Toxoplasma gondii | Hsp90 domain-containing protein | 0.021 | 0.2451 | 1 |
| Plasmodium vivax | heat shock protein 86, putative | 0.0055 | 0.0582 | 0.1426 |
| Trypanosoma cruzi | DNA topoisomerase II, putative | 0.0008 | 0.0009 | 0.0158 |
| Plasmodium falciparum | DNA topoisomerase 2 | 0.0008 | 0.0009 | 0.0023 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0023 | 0.0195 | 0.1142 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.0023 | 0.0195 | 0.3254 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0023 | 0.0187 | 0.11 |
| Mycobacterium tuberculosis | Probable two component sensor kinase | 0.0008 | 0.0009 | 0.0022 |
| Loa Loa (eye worm) | heat shock protein 90 | 0.0055 | 0.0582 | 0.3418 |
| Plasmodium falciparum | DNA topoisomerase VI, b subunit, putative | 0.0008 | 0.0009 | 0.0023 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0047 | 0.0485 | 0.8316 |
| Schistosoma mansoni | acetyl-CoA synthetase | 0.0008 | 0.0014 | 0.0014 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0023 | 0.0195 | 0.0476 |
| Toxoplasma gondii | Acetyl-coenzyme A synthetase 2, putative | 0.0008 | 0.0014 | 0.0058 |
| Plasmodium falciparum | heat shock protein 90, putative | 0.0032 | 0.0302 | 0.0739 |
| Giardia lamblia | Heat shock protein HSP 90-alpha | 0.0055 | 0.0582 | 1 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0029 | 0.0259 | 0.0634 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0047 | 0.0485 | 0.8338 |
| Entamoeba histolytica | heat shock protein 90, putative | 0.0055 | 0.0582 | 1 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.0023 | 0.0195 | 0.3254 |
| Mycobacterium ulcerans | phenyloxazoline synthase MbtB | 0.0008 | 0.0014 | 0.0035 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.0014 | 0.0244 |
| Loa Loa (eye worm) | hypothetical protein | 0.0148 | 0.1703 | 1 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.0014 | 0.0083 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0029 | 0.0259 | 0.0634 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.0195 | 0.3341 |
| Schistosoma mansoni | DNA topoisomerase II | 0.0008 | 0.0009 | 0.0009 |
| Mycobacterium tuberculosis | Two component sensor histidine kinase TrcS | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.0014 | 0.0083 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.0195 | 0.3341 |
| Mycobacterium ulcerans | sensor kinase from two component regulatory system | 0.0008 | 0.0009 | 0.0023 |
| Trypanosoma brucei | DNA topoisomerase II alpha, putative | 0.0008 | 0.0009 | 0.0158 |
| Leishmania major | heat shock protein, putative | 0.0037 | 0.0357 | 0.6139 |
| Mycobacterium leprae | PROBABLE NICOTINATE-NUCLEOTIDE ADENYLYLTRANSFERASE NADD (DEAMIDO-NAD(+) PYROPHOSPHORYLASE) (DEAMIDO-NAD(+) DIPHOSPHORYLASE) (NIC | 0.0345 | 0.4084 | 1 |
| Leishmania major | DNA polymerase eta, putative | 0.0054 | 0.0567 | 0.9737 |
| Mycobacterium leprae | POSSIBLE O-SUCCINYLBENZOIC ACID--CoA LIGASE MENE (OSB-CoA SYNTHETASE) (O-SUCCINYLBENZOATE-CoA SYNTHASE) | 0.0008 | 0.0014 | 0.0012 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Leishmania major | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.0014 | 0.0244 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.0187 | 0.3129 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0023 | 0.0187 | 0.0178 |
| Brugia malayi | F/Y-rich N-terminus family protein | 0.0011 | 0.0041 | 0.0239 |
| Entamoeba histolytica | long-chain-fatty-acid--CoA ligase, putative | 0.0008 | 0.0014 | 0.0087 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Mycobacterium ulcerans | two component sensor histidine kinase DevS | 0.0008 | 0.0009 | 0.0023 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0259 | 0.1521 |
| Echinococcus granulosus | endoplasmin | 0.0052 | 0.0541 | 0.0532 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0021 | 0.0171 | 0.042 |
| Mycobacterium leprae | Probable fatty-acid-CoA synthetase FadD22 (fatty-acid-CoA ligase) (fatty-acid-CoA synthase) | 0.0008 | 0.0014 | 0.0012 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Mycobacterium tuberculosis | Probable nicotinate-nucleotide adenylyltransferase NadD (deamido-NAD(+) pyrophosphorylase) (deamido-NAD(+) diphosphorylase) (nic | 0.0345 | 0.4084 | 1 |
| Echinococcus multilocularis | acetyl coenzyme A synthetase, cytoplasmic | 0.0008 | 0.0014 | 0.0005 |
| Mycobacterium tuberculosis | Two component sensor histidine kinase DevS | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma cruzi | DNA topoisomerase II, putative | 0.0008 | 0.0009 | 0.0158 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.0009 | 0.0017 | 0.0008 |
| Leishmania major | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Onchocerca volvulus | 0.0008 | 0.0014 | 0.0029 | |
| Brugia malayi | Hsp90 protein | 0.0037 | 0.0357 | 0.2098 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0008 | 0.0014 | 0.0035 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0023 | 0.0187 | 0.3218 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0029 | 0.0259 | 0.1521 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0009 | 0.0054 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0021 | 0.0171 | 0.042 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0016 | 0.0107 | 0.1838 |
| Trichomonas vaginalis | sensory transduction histidine kinase, putative | 0.0008 | 0.0009 | 0.0029 |
| Trichomonas vaginalis | two component sensor and regulator histidine kinase bacteria, putative | 0.0008 | 0.0009 | 0.0029 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0029 | 0.0259 | 0.0634 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0029 | 0.0259 | 0.4448 |
| Mycobacterium ulcerans | peptide synthetase Nrp (peptide synthase) | 0.0008 | 0.0014 | 0.0035 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0009 | 0.0017 | 0.0017 |
| Trypanosoma cruzi | mitochondrial DNA topoisomerase II, putative | 0.0008 | 0.0009 | 0.0158 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.0023 | 0.0187 | 0.0459 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Schistosoma mansoni | cpg binding protein | 0.0037 | 0.0356 | 0.0356 |
| Mycobacterium tuberculosis | Probable sensor protein KdpD | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0008 | 0.0014 | 0.0083 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0029 | 0.0259 | 0.0634 |
| Toxoplasma gondii | ImpB/MucB/SamB family protein | 0.0038 | 0.0372 | 0.1519 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Leishmania major | mitochondrial DNA topoisomerase II | 0.0008 | 0.0009 | 0.0158 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0171 | 0.1006 |
| Schistosoma mansoni | hypothetical protein | 0.0494 | 0.5892 | 0.5892 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0021 | 0.0171 | 0.042 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0055 | 0.0582 | 1 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0029 | 0.0259 | 0.1521 |
| Schistosoma mansoni | cpg binding protein | 0.0035 | 0.0332 | 0.0332 |
| Wolbachia endosymbiont of Brugia malayi | exonuclease III | 0.0023 | 0.0187 | 0.3349 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Schistosoma mansoni | DNA polymerase eta | 0.0054 | 0.0567 | 0.0567 |
| Trichomonas vaginalis | mismatch repair protein Mlh1C (mutL homolog) | 0.0008 | 0.0009 | 0.0029 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0244 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0029 | 0.0259 | 0.0634 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Echinococcus granulosus | heat shock protein 75 kDa mitochondrial | 0.0037 | 0.0357 | 0.0349 |
| Toxoplasma gondii | AMP-binding enzyme domain-containing protein | 0.0008 | 0.0014 | 0.0058 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0023 | 0.0195 | 0.0476 |
| Onchocerca volvulus | 0.0035 | 0.0332 | 0.1907 | |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Plasmodium vivax | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0035 |
| Mycobacterium ulcerans | bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ACP synthetase | 0.0008 | 0.0014 | 0.0035 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Mycobacterium tuberculosis | Peptide synthetase MbtF (peptide synthase) | 0.0008 | 0.0014 | 0.0035 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0171 | 0.1006 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.0009 | 0.0017 | 0.0008 |
| Loa Loa (eye worm) | hypothetical protein | 0.0054 | 0.0567 | 0.3328 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0023 | 0.0187 | 0.11 |
| Echinococcus multilocularis | heat shock protein 90 | 0.0047 | 0.0485 | 0.0477 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0187 | 0.0187 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Mycobacterium ulcerans | heat shock protein 90 | 0.0052 | 0.0541 | 0.1325 |
| Plasmodium falciparum | nicotinamide/nicotinic acid mononucleotide adenylyltransferase | 0.0345 | 0.4084 | 1 |
| Onchocerca volvulus | Huntingtin homolog | 0.0148 | 0.1703 | 1 |
| Giardia lamblia | Heat shock protein HSP 90-alpha | 0.0047 | 0.0485 | 0.8338 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0029 | 0.0259 | 0.4359 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0047 | 0.0485 | 0.8338 |
| Brugia malayi | Probable DNA topoisomerase II | 0.0008 | 0.0009 | 0.0054 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0171 | 0.1006 |
| Echinococcus granulosus | mixed lineage leukemia protein mll | 0.0009 | 0.0017 | 0.0008 |
| Toxoplasma gondii | ATPase/histidine kinase/DNA gyrase B/HSP90 domain-containing protein | 0.0008 | 0.0009 | 0.0038 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Trypanosoma brucei | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.0014 | 0.0244 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0195 | 0.3341 |
| Trichomonas vaginalis | receptor histidine kinase, putative | 0.0008 | 0.0009 | 0.0029 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0023 | 0.0187 | 0.3129 |
| Brugia malayi | Endoplasmin precursor | 0.0055 | 0.0582 | 0.3418 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Onchocerca volvulus | 0.0029 | 0.0259 | 0.1475 | |
| Trypanosoma brucei | heat shock protein 90, putative | 0.0055 | 0.0582 | 1 |
| Mycobacterium ulcerans | O-succinylbenzoic acid--CoA ligase | 0.0008 | 0.0014 | 0.0035 |
| Entamoeba histolytica | exodeoxyribonuclease III, putative | 0.0023 | 0.0187 | 0.3109 |
| Toxoplasma gondii | heat shock protein 75, putative | 0.0037 | 0.0357 | 0.1458 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.0011 | 0.0042 | 0.0033 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.0014 | 0.0035 |
| Echinococcus granulosus | dna polymerase kappa | 0.0023 | 0.0195 | 0.0186 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0023 | 0.0187 | 0.0178 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0014 | 0.0083 |
| Leishmania major | hypothetical protein, conserved | 0.0008 | 0.0009 | 0.0158 |
| Giardia lamblia | Pms1-like protein | 0.0008 | 0.0009 | 0.0158 |
| Schistosoma mansoni | endoplasmin | 0.0055 | 0.0582 | 0.0582 |
| Mycobacterium ulcerans | two component sensor histidine kinase SenX3 | 0.0008 | 0.0009 | 0.0023 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.0014 | 0.0083 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0023 | 0.0195 | 0.0476 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0038 | 0.0372 | 0.6395 |
| Entamoeba histolytica | 90 kDa heat shock protein, putative | 0.0037 | 0.0357 | 0.6077 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0259 | 0.1521 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Mycobacterium ulcerans | two component sensor histidine kinase PrrB | 0.0008 | 0.0009 | 0.0023 |
| Trichomonas vaginalis | endoplasmin, putative | 0.004 | 0.0399 | 0.6804 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0029 | 0.0259 | 0.0634 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.0014 | 0.0083 |
| Onchocerca volvulus | Huntingtin homolog | 0.0148 | 0.1703 | 1 |
| Schistosoma mansoni | heat shock protein | 0.0055 | 0.0582 | 0.0582 |
| Plasmodium falciparum | heat shock protein 90 | 0.0055 | 0.0582 | 0.1426 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0187 | 0.3218 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0008 | 0.0014 | 0.0116 |
| Mycobacterium tuberculosis | Phenyloxazoline synthase MbtB (phenyloxazoline synthetase) | 0.0008 | 0.0014 | 0.0035 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0074 | 0.0803 | 0.0803 |
| Trypanosoma cruzi | heat shock protein, putative | 0.0037 | 0.0357 | 0.6139 |
| Echinococcus multilocularis | heat shock protein 75 kDa, mitochondrial | 0.0037 | 0.0357 | 0.0349 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0016 | 0.0107 | 0.1838 |
| Brugia malayi | hypothetical protein | 0.0148 | 0.1703 | 1 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0023 | 0.0195 | 0.0195 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0021 | 0.0171 | 0.042 |
| Trypanosoma brucei | DNA topoisomerase ii | 0.0008 | 0.0009 | 0.0158 |
| Mycobacterium tuberculosis | Two component sensor histidine kinase PrrB | 0.0008 | 0.0009 | 0.0022 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.0023 | 0.0187 | 0.3218 |
| Mycobacterium tuberculosis | DNA gyrase (subunit B) GyrB (DNA topoisomerase (ATP-hydrolysing)) (DNA topoisomerase II) (type II DNA topoisomerase) | 0.0008 | 0.0009 | 0.0022 |
| Trypanosoma brucei | unspecified product | 0.0016 | 0.0107 | 0.1838 |
| Echinococcus multilocularis | endoplasmin | 0.0052 | 0.0541 | 0.0532 |
| Schistosoma mansoni | pyruvate dehydrogenase | 0.0008 | 0.0009 | 0.0009 |
| Mycobacterium ulcerans | bifunctional nicotinate-nucleotide adenylyltransferase NadD/hypothetical protein | 0.0345 | 0.4084 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.0014 | 0.0083 |
| Echinococcus multilocularis | dnaJ subfamily B | 0.0494 | 0.5892 | 0.5888 |
| Trichomonas vaginalis | sensor histidine kinase, putative | 0.0008 | 0.0009 | 0.0029 |
| Toxoplasma gondii | heat shock protein HSP90 | 0.0055 | 0.0582 | 0.2376 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.0195 | 0.1142 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0023 | 0.0193 | 0.3313 |
| Schistosoma mansoni | heat shock protein | 0.0055 | 0.0582 | 0.0582 |
| Onchocerca volvulus | 0.0008 | 0.0014 | 0.0029 | |
| Plasmodium vivax | endoplasmin, putative | 0.0055 | 0.0582 | 0.1426 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtF | 0.0008 | 0.0014 | 0.0035 |
| Mycobacterium ulcerans | two component system membrane associated sensor kinase | 0.0008 | 0.0009 | 0.0023 |
| Toxoplasma gondii | ATPase/histidine kinase/DNA gyrase B/HSP90 domain-containing protein | 0.0008 | 0.0009 | 0.0038 |
| Echinococcus granulosus | heat shock protein | 0.0055 | 0.0582 | 0.0574 |
| Echinococcus granulosus | heat shock protein 90 | 0.0047 | 0.0485 | 0.0477 |
| Trichomonas vaginalis | sensory transduction histidine kinase bacterial, putative | 0.0008 | 0.0009 | 0.0029 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.0195 | 0.3341 |
| Toxoplasma gondii | ATPase/histidine kinase/DNA gyrase B/HSP90 domain-containing protein | 0.0008 | 0.0009 | 0.0038 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Plasmodium vivax | DNA topoisomerase II, putative | 0.0008 | 0.0009 | 0.0023 |
| Plasmodium falciparum | heat shock protein 90, putative | 0.021 | 0.2451 | 0.6002 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Trypanosoma brucei | heat shock protein 90, putative | 0.0055 | 0.0582 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0171 | 0.1006 |
| Loa Loa (eye worm) | CXXC zinc finger family protein | 0.0035 | 0.0332 | 0.1951 |
| Schistosoma mansoni | cpg binding protein | 0.0037 | 0.0356 | 0.0356 |
| Mycobacterium tuberculosis | Probable chaperone protein HtpG (heat shock protein) (HSP90 family protein) (high temperature protein G) | 0.0052 | 0.0541 | 0.1325 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0052 | 0.0541 | 0.9284 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0029 | 0.0259 | 0.4359 |
| Echinococcus granulosus | heat shock protein 90 | 0.0055 | 0.0582 | 0.0574 |
| Mycobacterium tuberculosis | Probable medium chain fatty-acid-CoA ligase FadD14 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.0014 | 0.0035 |
| Plasmodium falciparum | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0035 |
| Echinococcus granulosus | dnaJ subfamily B | 0.0494 | 0.5892 | 0.5888 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0187 | 0.0187 |
| Trypanosoma cruzi | Histidine kinase-, DNA gyrase B-, and HSP90-like ATPase, putative | 0.0008 | 0.0009 | 0.0158 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0055 | 0.0582 | 1 |
| Trypanosoma brucei | DNA topoisomerase II beta, putative | 0.0008 | 0.0009 | 0.0158 |
| Onchocerca volvulus | 0.0008 | 0.0014 | 0.0029 | |
| Echinococcus granulosus | acetyl coenzyme A synthetase cytoplasmic | 0.0008 | 0.0014 | 0.0005 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0016 | 0.0107 | 0.1838 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0008 | 0.0014 | 0.0244 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD10 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.0014 | 0.0035 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0582 | 1 |
| Mycobacterium tuberculosis | Possible two component sensor kinase TcrY | 0.0008 | 0.0009 | 0.0022 |
| Mycobacterium tuberculosis | Possible two component system response sensor kinase membrane associated PhoR | 0.0008 | 0.0009 | 0.0022 |
| Mycobacterium leprae | PROBABLE CHAPERONE PROTEIN HTPG (HEAT SHOCK PROTEIN) (HSP90 FAMILY PROTEIN) (HIGH TEMPERATURE PROTEIN G) | 0.0052 | 0.0541 | 0.1305 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.002 | 0.0157 | 0.0385 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.0014 | 0.0244 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0187 | 0.0459 |
| Chlamydia trachomatis | acylglycerophosphoethanolamine acyltransferase | 0.0021 | 0.0171 | 1 |
| Trypanosoma brucei | developmentally regulated phosphoprotein | 0.0008 | 0.0009 | 0.0158 |
| Echinococcus granulosus | heat shock protein heat shock protein 90 alpha | 0.0047 | 0.0485 | 0.0477 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| AbsAC1000_uM (functional) | = 4.912 uM | PUBCHEM_BIOASSAY: In vivo-based yeast HTS to detect compounds rescuing yeast growth/survival of Plasmodium Falciparum HSP40-mediated toxicity Measured in Whole Organism System Using Plate Reader - 2120-01_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504552] | ChEMBL. | No reference |
| AbsAC35 (functional) | = 12.05 uM | PubChem BioAssay. Cell-based secondary assay to test the inhibitory activity of small molecule on Plasmodium flaciparum (HB3 strain) survival in red blood cells Measured in Cell-Based System Using Plate Reader - 2120-06_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| AbsAC35 (functional) | = 15.71 uM | PubChem BioAssay. Cell-based secondary assay to test the inhibitory activity of small molecule on Plasmodium flaciparum (3D7 strain) survival in red blood cells Measured in Cell-Based System Using Plate Reader - 2120-05_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| AC50 (functional) | = 7.155 uM | PUBCHEM_BIOASSAY: HsHsp90 Counterscreen Measured in Microorganism System Using Plate Reader - 2121-02_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504596] | ChEMBL. | No reference |
| AC50 (functional) | = 7.929 uM | PUBCHEM_BIOASSAY: Anti-Malarial Hsp90 Inhibitors Measured in Microorganism System Using Plate Reader - 2121-01_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504596] | ChEMBL. | No reference |
| EC50 (functional) | > 89.175 uM | PUBCHEM_BIOASSAY: Luminescence-based cell-based high throughput dose response assay for biased ligands (agonists) of the melanocortin 4 receptor (MC4R). (Class of assay: confirmatory) | ChEMBL. | No reference |
| EC50 (functional) | > 99 uM | PUBCHEM_BIOASSAY: Dose response confirmation uHTS hits for MazEF TA System activators via a fluorescence-based single-stranded RNase assay counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504720, AID504743] | ChEMBL. | No reference |
| EC50 (functional) | > 99 uM | PUBCHEM_BIOASSAY: Dose response confirmation uHTS hits for MazEF TA System activators via a fluorescence-based single-stranded RNase assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504720, AID504743] | ChEMBL. | No reference |
| IC50 (functional) | 19.2 uM | PubChem BioAssay. Dose response confirmation of uHTS inhibitor hits from NadD in a Colorimetric assay. (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (functional) | = 21.9 uM | PUBCHEM_BIOASSAY: Dose Response confirmation of uHTS small molecule inhibitors of tim10-1 yeast via a luminescent assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463190, AID463194, AID504542, AID504544] | ChEMBL. | No reference |
| IC50 (functional) | 29 uM | PubChem BioAssay. Dose response confirmation of uHTS inhibitor hits from NadD in a Colorimetric assay - Set 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 1.6944 uM | PUBCHEM_BIOASSAY: qHTS profiling assay for firefly luciferase inhibitor/activator using purified enzyme and Km concentrations of substrates (counterscreen for miR-21 project). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2288, AID2289, AID2598, AID411] | ChEMBL. | No reference |
| Potency (functional) | 5.8048 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
| Potency (functional) | = 6.3096 um | PUBCHEM_BIOASSAY: Counterscreen qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. This assay monitors tau fibrillation by fluorescence polarization (FP) of Alexa 594-labeled K18 P301L, which does not fibrillize readily but incorporates into growing filaments of unlabeled tau. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | 10.4179 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Fluorescence Polarization Assay for Inhibitors of MLL CXXC domain - DNA interaction. (Class of assay: confirmatory) [Related pubchem assays: 2698 (Summary assay.)] | ChEMBL. | No reference |
| Potency (binding) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | 12.5893 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Eta. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588636] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Multiplex Assay to Identify Dual Action Probes in a Cell Model of Huntington: Aggregate Formation (GFP). (Class of assay: confirmatory) [Related pubchem assays: 1482, 1471 ] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors Targeting the Menin-MLL Interaction in MLL Related Leukemias: Competition With Texas Red Labeled MLL-derived Mutant Peptide. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Assay for Small Molecule Inhibitors of Mitochondrial Division or Activators of Mitochondrial Fusion. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 20.5962 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in SW480 colon adenocarcinoma cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 22.3872 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 23.1093 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in MCF 10a normal breast cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 23.1093 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Modulators of Lamin A Splicing. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (without detergent). (Class of assay: confirmatory) [Related pubchem assays: 2158 (Confirmation qHTS Assay for Inhibitors of Cruzain), 2249 (Probe Development Summary of Promiscuous Inhibitors (Artifacts) of Cruzain), 2161 (qHTS Assay for Inhibitors of Papain: Counterscreen for Cruzain Assay), 1478 (qHTS Assay for Promiscuous and Specific Inhibitors of Cruzain (with detergent))] | ChEMBL. | No reference |
| Potency (functional) | 25.929 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493107, AID493125] | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Human Jumonji Domain Containing 2E (JMJD2E). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PubChem BioAssay. qHTS for Small Molecule Inhibitors of the ERG Ets/DNA interaction. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of RanGTP induced Rango (Ran-regulated importin-beta cargo) - Importin beta complex dissociation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID540262] | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS Assay for Enhancers of SMN2 Splice Variant Expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PubChem BioAssay. qHTS Assay to Identify Small Molecule Activators of BRCA1 Expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PubChem BioAssay. qHTS of TDP-43 Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 44.6684 uM | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of Human Flap endonuclease 1 (FEN1). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488813] | ChEMBL. | No reference |
| Potency (functional) | 44.6684 uM | PubChem BioAssay. Inhibitors of USP1/UAF1: Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PubChem BioAssay. qHTS for Antagonists of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 53.5818 uM | PubChem BioAssay. qHTS Assay to Find Inhibitors of Pin1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 56.2341 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 79.4328 uM | PUBCHEM_BIOASSAY: Inhibitors of Regulator of G Protein Signaling (RGS) 4: qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504856] | ChEMBL. | No reference |
| Potency (functional) | 100 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Rango (Ran-regulated importin-beta cargo) - Importin beta complex formation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID540273] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | ||
| Homo sapiens | ChEMBL23 | ||
| Saccharomyces cerevisiae | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1406911
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.