Detailed information for compound 1424604
Basic information
Technical information
- Name: Unnamed compound
- MW: 868.396 | Formula: C32H57N3O6S9
-
H donors: 5
H acceptors: 4
LogP: 16.6
Rotable bonds: 11
Rule of 5 violations (Lipinski): 2 - SMILES: CC([C@@H]1CC[C@@H]2[C@]1(C)CC[C@H]1C2C[C@@H]([C@@H]2[C@]1(C)C[C@H](OS(=S)(=S)O)[C@H](C2)OS(=S)(=S)O)OS(=S)(=S)O)CCC(C(C)(C)C)C.Nc1ncc[nH]1
- InChi: 1S/C29H52O6S9.C3H5N3/c1-17(8-9-18(2)27(3,4)5)20-10-11-21-19-14-24(33-42(30,36)37)23-15-25(34-43(31,38)39)26(35-44(32,40)41)16-29(23,7)22(19)12-13-28(20,21)6;4-3-5-1-2-6-3/h17-26H,8-16H2,1-7H3,(H,30,36,37)(H,31,38,39)(H,32,40,41);1-2H,(H3,4,5,6)/t17?,18?,19?,20-,21-,22-,23+,24-,25-,26-,28+,29+;/m0./s1
- InChiKey: FCISAPOTRKLQGS-BWWYLJGPSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | polo-like kinase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed) iota | Starlite/ChEMBL | No references |
| Homo sapiens | ubiquitin specific peptidase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed) kappa | Starlite/ChEMBL | No references |
| Homo sapiens | tyrosyl-DNA phosphodiesterase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | Rap guanine nucleotide exchange factor (GEF) 3 | Starlite/ChEMBL | No references |
| Homo sapiens | ubiquitin specific peptidase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | isocitrate dehydrogenase 1 (NADP+), soluble | Starlite/ChEMBL | No references |
| Homo sapiens | Rap guanine nucleotide exchange factor (GEF) 4 | Starlite/ChEMBL | No references |
| Homo sapiens | K(lysine) acetyltransferase 2A | Starlite/ChEMBL | No references |
| Homo sapiens | geminin, DNA replication inhibitor | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed), eta | Starlite/ChEMBL | No references |
| Caenorhabditis elegans | Protein GLD-1 | Starlite/ChEMBL | No references |
| Human immunodeficiency virus type 1 group M subtype B (isolate HXB2)(HIV-1) | Protein Rev | Starlite/ChEMBL | No references |
| Homo sapiens | flap structure-specific endonuclease 1 | Starlite/ChEMBL | No references |
| Homo sapiens | synuclein, alpha (non A4 component of amyloid precursor) | Starlite/ChEMBL | No references |
| Homo sapiens | ataxin 2 | Starlite/ChEMBL | No references |
| Homo sapiens | Werner syndrome, RecQ helicase-like | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
| Species | Potential target | Known druggable target | Length | Alignment span | Identity |
|---|---|---|---|---|---|
| Brugia malayi | Hypothetical 65.5 kDa Trp-Asp repeats containing protein F02E8.5 inchromosome X | geminin, DNA replication inhibitor | 209 aa | 176 aa | 27.8 % |
| Leishmania infantum | hypothetical protein, conserved | Protein Rev | 116 aa | 95 aa | 26.3 % |
| Leishmania donovani | hypothetical protein, conserved | Protein Rev | 116 aa | 95 aa | 26.3 % |
| Trypanosoma brucei | exonuclease, putative | flap structure-specific endonuclease 1 | 380 aa | 322 aa | 24.5 % |
| Plasmodium falciparum | ubiquitin specific protease, putative | ubiquitin specific peptidase 2 | 362 aa | 378 aa | 25.7 % |
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trichomonas vaginalis | Clan CA, family C19, ubiquitin hydrolase-like cysteine peptidase | 0.0048 | 0.0403 | 0.3712 |
| Treponema pallidum | catabolite gene activator | 0.0009 | 0.0014 | 0.5 |
| Mycobacterium tuberculosis | Probable transcriptional regulatory protein Cmr | 0.0009 | 0.0014 | 0.0225 |
| Mycobacterium tuberculosis | Probable glutamine-transport ATP-binding protein ABC transporter GlnQ | 0.0009 | 0.0014 | 0.0225 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0064 | 0.0562 | 0.2801 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.0135 | 0.1272 | 1 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Trypanosoma cruzi | hypothetical protein | 0.0015 | 0.0073 | 0.0468 |
| Trichomonas vaginalis | DNA helicase recq1, putative | 0.0029 | 0.021 | 0.1871 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.0225 | 0.1672 |
| Toxoplasma gondii | histone lysine acetyltransferase GCN5-A | 0.0051 | 0.0435 | 1 |
| Plasmodium vivax | isocitrate dehydrogenase [NADP], mitochondrial, putative | 0.0019 | 0.0111 | 0.2298 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.003 | 0.0225 | 0.4999 |
| Echinococcus granulosus | Protein son of sevenless | 0.0015 | 0.0073 | 0.0302 |
| Loa Loa (eye worm) | DIX domain-containing protein | 0.0021 | 0.0135 | 0.0121 |
| Entamoeba histolytica | serine/threonine protein kinase, putative | 0.0114 | 0.1062 | 1 |
| Brugia malayi | vab-3 gene. | 0.0019 | 0.0113 | 0.0099 |
| Trypanosoma brucei | chrX additional, unordered contigs | 0.002 | 0.0119 | 0.0834 |
| Echinococcus multilocularis | dna polymerase eta | 0.0095 | 0.0869 | 0.4377 |
| Trypanosoma cruzi | flap endonuclease-1 (FEN-1), putative | 0.0031 | 0.0235 | 0.1753 |
| Echinococcus multilocularis | segment polarity protein dishevelled | 0.0021 | 0.0135 | 0.0617 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.0225 | 0.5567 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0072 | 0.0641 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0205 | 0.1968 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0146 | 0.138 | 0.1368 |
| Echinococcus multilocularis | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.0718 | 0.3601 |
| Echinococcus granulosus | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.0718 | 0.3601 |
| Schistosoma mansoni | tyrosyl-DNA phosphodiesterase | 0.008 | 0.0718 | 0.3601 |
| Loa Loa (eye worm) | RasGEF domain-containing protein | 0.0015 | 0.0073 | 0.0059 |
| Trypanosoma brucei | unspecified product | 0.0044 | 0.0363 | 0.2767 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0113 | 0.0099 |
| Trypanosoma cruzi | DNA damage repair protein, putative | 0.002 | 0.0119 | 0.0834 |
| Echinococcus granulosus | segment polarity protein dishevelled | 0.0021 | 0.0135 | 0.0617 |
| Schistosoma mansoni | guanine-nucleotide-exchange-factor | 0.0015 | 0.0073 | 0.0302 |
| Brugia malayi | Bloom's syndrome protein homolog | 0.0029 | 0.021 | 0.0196 |
| Trypanosoma cruzi | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.0111 | 0.0769 |
| Echinococcus multilocularis | segment polarity protein dishevelled | 0.0021 | 0.0135 | 0.0617 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.001 | 0.0018 | 0.0019 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Plasmodium falciparum | flap endonuclease 1 | 0.0031 | 0.0235 | 0.5834 |
| Echinococcus granulosus | Peptidase C19 ubiquitin carboxyl terminal hydrolase 2 | 0.0048 | 0.0403 | 0.199 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Plasmodium vivax | DNA repair protein REV1, putative | 0.002 | 0.0119 | 0.2492 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0096 | 0.0883 | 1 |
| Brugia malayi | hypothetical protein | 0.003 | 0.0225 | 0.0211 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0441 | 0.0427 |
| Leishmania major | DNA polymerase kappa, putative | 0.002 | 0.0119 | 0.0834 |
| Toxoplasma gondii | ImpB/MucB/SamB family protein | 0.002 | 0.0119 | 0.2492 |
| Echinococcus granulosus | flap endonuclease 1 | 0.0031 | 0.0235 | 0.1129 |
| Leishmania major | hypothetical protein, conserved | 0.003 | 0.0225 | 0.1672 |
| Brugia malayi | Egg laying defective protein 4 | 0.001 | 0.0018 | 0.0004 |
| Trichomonas vaginalis | ras GTP exchange factor, putative | 0.0015 | 0.0073 | 0.0562 |
| Trypanosoma brucei | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0015 | 0.0075 | 0.0483 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Echinococcus multilocularis | Peptidase C19, ubiquitin carboxyl terminal hydrolase 2 | 0.0048 | 0.0403 | 0.199 |
| Schistosoma mansoni | regulator of G protein signaling | 0.0021 | 0.0135 | 0.0617 |
| Echinococcus granulosus | Ataxin 2 N terminaldomain containing protein | 0.0014 | 0.0057 | 0.0217 |
| Brugia malayi | Tyrosyl-DNA phosphodiesterase family protein | 0.008 | 0.0718 | 0.0704 |
| Leishmania major | protein kinase, putative,polo-like protein kinase, putative | 0.0114 | 0.1062 | 0.8324 |
| Echinococcus granulosus | geminin | 0.0205 | 0.1968 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0113 | 0.0099 |
| Schistosoma mansoni | paired box protein pax-6 | 0.0019 | 0.0113 | 0.0506 |
| Schistosoma mansoni | blooms syndrome DNA helicase | 0.0023 | 0.0149 | 0.069 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.002 | 0.0119 | 0.0834 |
| Onchocerca volvulus | Rap guanine nucleotide exchange factor 1 homolog | 0.0015 | 0.0073 | 0.0059 |
| Echinococcus multilocularis | isocitrate dehydrogenase 2 (NADP+) | 0.0019 | 0.0111 | 0.0495 |
| Plasmodium falciparum | ADP-dependent DNA helicase RecQ | 0.0025 | 0.0175 | 0.4251 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0064 | 0.0562 | 0.0548 |
| Brugia malayi | paired box pox-meso protein | 0.0019 | 0.0113 | 0.0099 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0048 | 0.0403 | 0.3712 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.0012 | 0.004 | 0.0026 |
| Schistosoma mansoni | dep domain containing protein | 0.0021 | 0.0135 | 0.0617 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0009 | 0.0014 | 0.0225 |
| Brugia malayi | Ubiquitin carboxyl-terminal hydrolase family protein | 0.0048 | 0.0403 | 0.0389 |
| Schistosoma mansoni | NADP-specific isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0495 |
| Giardia lamblia | DNA damage repair protein | 0.002 | 0.0119 | 0.1001 |
| Mycobacterium leprae | Conserved hypothetical protein | 0.0009 | 0.0014 | 0.5 |
| Trypanosoma brucei | DNA damage repair protein, putative | 0.002 | 0.0119 | 0.0834 |
| Trypanosoma cruzi | ubiquitin carboxyl-terminal hydrolase, putative | 0.0048 | 0.0403 | 0.309 |
| Echinococcus granulosus | regulator of G protein signaling 7 | 0.0021 | 0.0135 | 0.0617 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0015 | 0.0075 | 0.058 |
| Brugia malayi | polk-prov protein | 0.0052 | 0.0441 | 0.0427 |
| Echinococcus multilocularis | paired box protein pax 6 | 0.0019 | 0.0113 | 0.0506 |
| Schistosoma mansoni | paired box protein pax-6 | 0.0019 | 0.0113 | 0.0506 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.0135 | 0.1272 | 1 |
| Echinococcus granulosus | paired box gene 3/7 (eyeless, eyegone, twin of eyeless) | 0.0019 | 0.0113 | 0.0506 |
| Entamoeba histolytica | ubiquitin carboxyl-terminal hydrolase domain containing protein | 0.0048 | 0.0403 | 0.3338 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0064 | 0.0562 | 0.2801 |
| Echinococcus granulosus | cGMP dependent protein kinase 1 | 0.001 | 0.0018 | 0.0019 |
| Loa Loa (eye worm) | PLK/PLK1 protein kinase | 0.0114 | 0.1062 | 0.1049 |
| Onchocerca volvulus | Segment polarity protein dishevelled homolog | 0.0021 | 0.0135 | 0.0121 |
| Schistosoma mansoni | hypothetical protein | 0.0033 | 0.0249 | 0.1201 |
| Schistosoma mansoni | z-protein (S1r protein) | 0.0021 | 0.0135 | 0.0617 |
| Onchocerca volvulus | 0.1007 | 1 | 1 | |
| Trypanosoma brucei | polo-like protein kinase | 0.0114 | 0.1062 | 0.8324 |
| Echinococcus granulosus | histone acetyltransferase KAT2B | 0.0051 | 0.0435 | 0.2155 |
| Schistosoma mansoni | flap endonuclease-1 | 0.0028 | 0.0205 | 0.0974 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0029 | 0.021 | 0.1871 |
| Trichomonas vaginalis | Clan CA, family C19, ubiquitin hydrolase-like cysteine peptidase | 0.0048 | 0.0403 | 0.3712 |
| Echinococcus granulosus | dna polymerase eta | 0.0095 | 0.0869 | 0.4377 |
| Schistosoma mansoni | camp-dependent rap1 guanine-nucleotide exchange factor | 0.0015 | 0.0066 | 0.0263 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Brugia malayi | Domain found in Dishevelled, Egl-10, and Pleckstrin family protein | 0.0021 | 0.0135 | 0.0121 |
| Mycobacterium tuberculosis | Conserved protein | 0.0009 | 0.0014 | 0.0225 |
| Giardia lamblia | DINP protein human, muc B family | 0.0072 | 0.0641 | 0.5986 |
| Echinococcus multilocularis | rap guanine nucleotide exchange factor 1 | 0.0015 | 0.0073 | 0.0302 |
| Onchocerca volvulus | Serine\/threonine kinase homolog | 0.0114 | 0.1062 | 0.1049 |
| Loa Loa (eye worm) | RasGEF domain-containing protein | 0.0015 | 0.0073 | 0.0059 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Echinococcus multilocularis | geminin | 0.0205 | 0.1968 | 1 |
| Echinococcus granulosus | regulator of G protein signaling 7 | 0.0021 | 0.0135 | 0.0617 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Trichomonas vaginalis | cat eye syndrome critical region protein 2, cscr2, putative | 0.0051 | 0.0435 | 0.4019 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0056 | 0.0485 | 0.4496 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0718 | 0.5592 |
| Trypanosoma brucei | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0718 | 0.5592 |
| Giardia lamblia | Histone acetyltransferase GCN5 | 0.0047 | 0.0392 | 0.3609 |
| Brugia malayi | 'Paired box' domain containing protein | 0.0019 | 0.0113 | 0.0099 |
| Echinococcus multilocularis | paired box protein pax 6 | 0.0019 | 0.0113 | 0.0506 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Echinococcus granulosus | ATP dependent DNA helicase Q5 | 0.0012 | 0.004 | 0.0131 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C2, putative | 0.0135 | 0.1272 | 1 |
| Brugia malayi | regulator of G-protein signaling egl-10 | 0.0021 | 0.0135 | 0.0121 |
| Brugia malayi | N-terminal motif family protein | 0.0436 | 0.4283 | 0.4275 |
| Echinococcus multilocularis | paired box protein pax 6 | 0.0019 | 0.0113 | 0.0506 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.001 | 0.0018 | 0.0019 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0073 | 0.0059 |
| Leishmania major | DNA damage repair protein, putative | 0.002 | 0.0119 | 0.0834 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Brugia malayi | serine/threonine-protein kinase plk-2 | 0.0114 | 0.1062 | 0.1049 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0009 | 0.0014 | 0.0225 |
| Brugia malayi | 'Paired box' domain containing protein | 0.0019 | 0.0113 | 0.0099 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0495 |
| Leishmania major | tyrosyl-DNA phosphodiesterase 1 | 0.008 | 0.0718 | 0.5592 |
| Onchocerca volvulus | Retinal homeobox protein Rx homolog | 0.0019 | 0.0113 | 0.0099 |
| Echinococcus multilocularis | regulator of G protein signaling 7 | 0.0021 | 0.0135 | 0.0617 |
| Schistosoma mansoni | fyve finger-containing phosphoinositide kinase fyv1 | 0.0021 | 0.0135 | 0.0617 |
| Entamoeba histolytica | recQ family helicase, putative | 0.0015 | 0.0075 | 0.0019 |
| Loa Loa (eye worm) | ATP-dependent DNA helicase | 0.0012 | 0.004 | 0.0026 |
| Loa Loa (eye worm) | G protein signaling regulator EGL-10 | 0.0021 | 0.0135 | 0.0121 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0718 | 0.5592 |
| Toxoplasma gondii | protein kinase G AGC kinase family member PKG | 0.001 | 0.0018 | 0.0088 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q5 | 0.0012 | 0.004 | 0.0131 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Toxoplasma gondii | flap structure-specific endonuclease 1, putative | 0.0031 | 0.0235 | 0.5239 |
| Brugia malayi | RasGEF domain containing protein | 0.0015 | 0.0073 | 0.0059 |
| Brugia malayi | Gooseberry protein | 0.0019 | 0.0113 | 0.0099 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0064 | 0.0562 | 0.0548 |
| Plasmodium vivax | histone acetyltransferase GCN5, putative | 0.0051 | 0.0435 | 1 |
| Schistosoma mansoni | ubiquitin-specific peptidase 8 (C19 family) | 0.0048 | 0.0403 | 0.199 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0064 | 0.0562 | 0.2801 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Loa Loa (eye worm) | isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0097 |
| Echinococcus granulosus | ubiquitin carboxyl terminal hydrolase 8 | 0.0048 | 0.0403 | 0.199 |
| Brugia malayi | acetyltransferase, GNAT family protein | 0.0175 | 0.1672 | 0.166 |
| Trypanosoma cruzi | guanine nucleotide releasing protein, putative | 0.0015 | 0.0073 | 0.0468 |
| Echinococcus granulosus | bloom syndrome protein | 0.0029 | 0.021 | 0.1003 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.0096 | 0.0883 | 0.8293 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0019 | 0.0114 | 0.2367 |
| Mycobacterium tuberculosis | Probable conserved transmembrane transport protein | 0.0009 | 0.0014 | 0.0225 |
| Schistosoma mansoni | kinase | 0.0058 | 0.05 | 0.2488 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.0135 | 0.1272 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0441 | 0.3388 |
| Loa Loa (eye worm) | acetyltransferase | 0.0175 | 0.1672 | 0.166 |
| Brugia malayi | hypothetical protein | 0.002 | 0.0117 | 0.0103 |
| Echinococcus multilocularis | flap endonuclease 1 | 0.0031 | 0.0235 | 0.1129 |
| Plasmodium falciparum | isocitrate dehydrogenase [NADP], mitochondrial | 0.0019 | 0.0111 | 0.2559 |
| Echinococcus granulosus | cGMP dependent protein kinase 1 | 0.001 | 0.0018 | 0.0019 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0135 | 0.0121 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0225 | 0.0211 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0073 | 0.0059 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.002 | 0.0119 | 0.0834 |
| Loa Loa (eye worm) | tyrosyl-DNA phosphodiesterase | 0.008 | 0.0718 | 0.0704 |
| Trypanosoma cruzi | hypothetical protein | 0.0015 | 0.0073 | 0.0468 |
| Loa Loa (eye worm) | tumor suppressor | 0.0388 | 0.3806 | 0.3797 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.0012 | 0.004 | 0.0026 |
| Loa Loa (eye worm) | pax transcription factor protein 2 | 0.1007 | 1 | 1 |
| Trypanosoma cruzi | polo-like protein kinase, putative | 0.0114 | 0.1062 | 0.8324 |
| Loa Loa (eye worm) | AGC/PKG protein kinase | 0.001 | 0.0018 | 0.0004 |
| Schistosoma mansoni | dishevelled | 0.0021 | 0.0135 | 0.0617 |
| Echinococcus multilocularis | bloom syndrome protein | 0.0029 | 0.021 | 0.1003 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0096 | 0.0883 | 0.6903 |
| Toxoplasma gondii | isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.2298 |
| Schistosoma mansoni | paired box protein pax-6 | 0.0019 | 0.0113 | 0.0506 |
| Echinococcus granulosus | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0495 |
| Entamoeba histolytica | tyrosyl-DNA phosphodiesterase, putative | 0.008 | 0.0718 | 0.6522 |
| Entamoeba histolytica | acetyltransferase, GNAT family | 0.0047 | 0.0392 | 0.3228 |
| Echinococcus granulosus | segment polarity protein dishevelled | 0.0021 | 0.0135 | 0.0617 |
| Treponema pallidum | cyclic nucleotide binding protein | 0.0009 | 0.0014 | 0.5 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.0249 | 0.0235 |
| Echinococcus granulosus | paired box protein pax 1 | 0.0019 | 0.0113 | 0.0506 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0135 | 0.0121 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0135 | 0.0121 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0096 | 0.0883 | 1 |
| Leishmania major | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0015 | 0.0075 | 0.0483 |
| Echinococcus multilocularis | cGMP dependent protein kinase 1 | 0.001 | 0.0018 | 0.0019 |
| Trypanosoma cruzi | ubiquitin carboxyl-terminal hydrolase, putative | 0.0048 | 0.0403 | 0.309 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0135 | 0.0121 |
| Echinococcus granulosus | paired box protein pax 6 | 0.0019 | 0.0113 | 0.0506 |
| Trypanosoma cruzi | calpain cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Echinococcus granulosus | ubiquitin specific protease 41 | 0.0048 | 0.0403 | 0.199 |
| Onchocerca volvulus | 0.0015 | 0.0073 | 0.0059 | |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0113 | 0.0099 |
| Treponema pallidum | catabolite gene activator (Crp) | 0.0009 | 0.0014 | 0.5 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Echinococcus multilocularis | isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0495 |
| Echinococcus granulosus | transcription factor Dp 1 | 0.0046 | 0.0382 | 0.1882 |
| Trypanosoma cruzi | polo-like protein kinase, putative | 0.0114 | 0.1062 | 0.8324 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Echinococcus multilocularis | transcription factor Dp 1 | 0.0046 | 0.0382 | 0.1882 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0403 | 0.0389 |
| Onchocerca volvulus | 0.0019 | 0.0113 | 0.0099 | |
| Plasmodium vivax | ADP-dependent DNA helicase RecQ, putative | 0.002 | 0.0116 | 0.2423 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.0135 | 0.1272 | 1 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0096 | 0.0883 | 0.6903 |
| Trypanosoma brucei | isocitrate dehydrogenase, putative | 0.0019 | 0.0111 | 0.0769 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Toxoplasma gondii | isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.2298 |
| Echinococcus multilocularis | regulator of G protein signaling 7 | 0.0021 | 0.0135 | 0.0617 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0113 | 0.0099 |
| Echinococcus granulosus | hypothetical protein | 0.0033 | 0.0249 | 0.1201 |
| Echinococcus granulosus | histone acetyltransferase KAT2B | 0.017 | 0.1623 | 0.8232 |
| Loa Loa (eye worm) | hypothetical protein | 0.0095 | 0.0869 | 0.0856 |
| Trypanosoma cruzi | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0015 | 0.0075 | 0.0483 |
| Giardia lamblia | Kinase, PLK | 0.0114 | 0.1062 | 1 |
| Schistosoma mansoni | DNA helicase recq1 | 0.0012 | 0.004 | 0.0131 |
| Echinococcus granulosus | rap guanine nucleotide exchange factor 6 | 0.0015 | 0.0073 | 0.0302 |
| Loa Loa (eye worm) | vab-3 | 0.0019 | 0.0113 | 0.0099 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.001 | 0.0018 | 0.0019 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.004 | 0.0026 |
| Schistosoma mansoni | hypothetical protein | 0.0033 | 0.0249 | 0.1201 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.0225 | 0.1672 |
| Echinococcus granulosus | ATP dependent DNA helicase Q1 | 0.0012 | 0.004 | 0.0131 |
| Brugia malayi | N-terminal motif family protein | 0.0015 | 0.0073 | 0.0059 |
| Brugia malayi | paired box protein | 0.0019 | 0.0113 | 0.0099 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0056 | 0.0485 | 0.4496 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0064 | 0.0562 | 0.8757 |
| Echinococcus granulosus | Pleckstrin G protein interacting region | 0.0021 | 0.0135 | 0.0617 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Trichomonas vaginalis | flap endonuclease-1, putative | 0.0031 | 0.0235 | 0.2106 |
| Trypanosoma brucei | ubiquitin carboxyl-terminal hydrolase, putative | 0.0048 | 0.0403 | 0.309 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Brugia malayi | Domain found in Dishevelled, Egl-10, and Pleckstrin family protein | 0.0021 | 0.0135 | 0.0121 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.0096 | 0.0883 | 0.8293 |
| Echinococcus granulosus | cGMP dependent protein kinase | 0.001 | 0.0018 | 0.0019 |
| Trypanosoma brucei | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.0111 | 0.0769 |
| Chlamydia trachomatis | cAMP-dependent protein kinase regulatory subunit | 0.0009 | 0.0014 | 0.5 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0072 | 0.0641 | 0.4983 |
| Echinococcus multilocularis | rap guanine nucleotide exchange factor 6 | 0.0015 | 0.0073 | 0.0302 |
| Trypanosoma brucei | calpain-like protein, putative | 0.0135 | 0.1272 | 1 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0441 | 0.3388 |
| Loa Loa (eye worm) | RasGEF domain-containing protein | 0.0015 | 0.0073 | 0.0059 |
| Leishmania major | protein kinase, putative | 0.001 | 0.0018 | 0.003 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Brugia malayi | isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0097 |
| Trypanosoma brucei | unspecified product | 0.0044 | 0.0363 | 0.2767 |
| Trypanosoma brucei | calpain, putative | 0.0135 | 0.1272 | 1 |
| Treponema pallidum | cyclic nucleotide binding protein | 0.0009 | 0.0014 | 0.5 |
| Echinococcus multilocularis | ras GTP exchange factor | 0.0015 | 0.0073 | 0.0302 |
| Brugia malayi | tumor suppressor. | 0.0388 | 0.3806 | 0.3797 |
| Toxoplasma gondii | hypothetical protein | 0.0021 | 0.0135 | 0.2864 |
| Giardia lamblia | Sgs1 DNA helicase, putative | 0.0012 | 0.004 | 0.0244 |
| Schistosoma mansoni | dishevelled | 0.0021 | 0.0135 | 0.0617 |
| Loa Loa (eye worm) | hypothetical protein | 0.0436 | 0.4283 | 0.4275 |
| Schistosoma mansoni | hypothetical protein | 0.0205 | 0.1968 | 1 |
| Echinococcus multilocularis | ubiquitin carboxyl terminal hydrolase 8 | 0.0048 | 0.0403 | 0.199 |
| Schistosoma mansoni | hypothetical protein | 0.0014 | 0.0057 | 0.0217 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0012 | 0.004 | 0.0607 |
| Echinococcus multilocularis | ubiquitin specific protease 41 | 0.0048 | 0.0403 | 0.199 |
| Echinococcus multilocularis | protein quaking | 0.0033 | 0.0249 | 0.1201 |
| Trypanosoma cruzi | isocitrate dehydrogenase, putative | 0.0019 | 0.0111 | 0.0769 |
| Entamoeba histolytica | Flap nuclease, putative | 0.0031 | 0.0235 | 0.1635 |
| Giardia lamblia | Flap structure-specific endonuclease | 0.0031 | 0.0235 | 0.2106 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Leishmania major | protein kinase, putative | 0.001 | 0.0018 | 0.003 |
| Schistosoma mansoni | ras GTP exchange factor son of sevenless | 0.0015 | 0.0073 | 0.0302 |
| Leishmania major | DNA polymerase kappa, putative | 0.0072 | 0.0641 | 0.4983 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0135 | 0.0121 |
| Echinococcus granulosus | son of sevenless 1 | 0.0015 | 0.0073 | 0.0302 |
| Echinococcus granulosus | protein quaking | 0.0033 | 0.0249 | 0.1201 |
| Trichomonas vaginalis | bromodomain-containing protein, putative | 0.0051 | 0.0435 | 0.4019 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Giardia lamblia | Ubiquitin carboxyl-terminal hydrolase 4 | 0.0048 | 0.0403 | 0.3712 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0883 | 0.6903 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0072 | 0.0641 | 0.4983 |
| Loa Loa (eye worm) | flap endonuclease-1 | 0.0031 | 0.0235 | 0.0221 |
| Plasmodium falciparum | cGMP-dependent protein kinase | 0.001 | 0.0018 | 0.0098 |
| Brugia malayi | RasGEF domain containing protein | 0.0015 | 0.0073 | 0.0059 |
| Schistosoma mansoni | ras GTP exchange factor son of sevenless | 0.0015 | 0.0073 | 0.0302 |
| Echinococcus multilocularis | gcn5proteinral control of amino acid synthesis | 0.0175 | 0.1672 | 0.8484 |
| Leishmania major | ubiquitin hydrolase, putative,cysteine peptidase, Clan CA, family C19, putative | 0.0048 | 0.0403 | 0.309 |
| Brugia malayi | DIX domain containing protein | 0.0021 | 0.0135 | 0.0121 |
| Echinococcus granulosus | rap guanine nucleotide exchange factor 1 | 0.0015 | 0.0073 | 0.0302 |
| Mycobacterium ulcerans | hypothetical protein | 0.002 | 0.0119 | 0.1207 |
| Toxoplasma gondii | BRCA1 C Terminus (BRCT) domain-containing protein | 0.0028 | 0.0199 | 0.4386 |
| Brugia malayi | Isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0097 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0442 | 0.3401 |
| Loa Loa (eye worm) | paired box protein | 0.0019 | 0.0113 | 0.0099 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.003 | 0.0225 | 0.4999 |
| Plasmodium falciparum | ATP-dependent DNA helicase Q1 | 0.0012 | 0.004 | 0.0676 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0095 | 0.0869 | 0.6796 |
| Echinococcus multilocularis | Ataxin 2, N terminal,domain containing protein | 0.0014 | 0.0057 | 0.0217 |
| Onchocerca volvulus | Rap guanine nucleotide exchange factor 1 homolog | 0.0436 | 0.4283 | 0.4275 |
| Trypanosoma brucei | variant surface glycoprotein (VSG), putative | 0.0135 | 0.1272 | 1 |
| Mycobacterium tuberculosis | Probable conserved transmembrane protein | 0.0009 | 0.0014 | 0.0225 |
| Trypanosoma brucei | flap endonuclease-1 (FEN-1), putative | 0.0031 | 0.0235 | 0.1753 |
| Leishmania major | flap endonuclease-1 (FEN-1), putative | 0.0031 | 0.0235 | 0.1753 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.0119 | 0.0834 |
| Loa Loa (eye worm) | RecQ helicase | 0.0029 | 0.021 | 0.0196 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0064 | 0.0562 | 0.2801 |
| Brugia malayi | RasGEF domain containing protein | 0.0015 | 0.0073 | 0.0059 |
| Echinococcus multilocularis | Pleckstrin G protein, interacting region | 0.0021 | 0.0135 | 0.0617 |
| Brugia malayi | Temporarily assigned gene name protein 44 | 0.0033 | 0.0249 | 0.0235 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0495 |
| Schistosoma mansoni | DNA polymerase IV / kappa | 0.002 | 0.0119 | 0.0537 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0012 | 0.004 | 0.0607 |
| Schistosoma mansoni | paired box protein pax-1-related | 0.0019 | 0.0113 | 0.0506 |
| Brugia malayi | Flap endonuclease-1 | 0.0031 | 0.0235 | 0.0221 |
| Leishmania major | DNA polymerase eta, putative | 0.0095 | 0.0869 | 0.6796 |
| Schistosoma mansoni | ubiquitin-specific peptidase 2 (C19 family) | 0.0048 | 0.0403 | 0.199 |
| Echinococcus granulosus | ras GTP exchange factor | 0.0015 | 0.0073 | 0.0302 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0442 | 0.3401 |
| Brugia malayi | N-terminal motif family protein | 0.0015 | 0.0073 | 0.0059 |
| Leishmania major | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.0111 | 0.0769 |
| Trypanosoma cruzi | DNA damage repair protein, putative | 0.002 | 0.0119 | 0.0834 |
| Echinococcus multilocularis | cGMP dependent protein kinase 1 | 0.001 | 0.0018 | 0.0019 |
| Plasmodium falciparum | DNA repair protein REV1, putative | 0.002 | 0.0119 | 0.2774 |
| Trichomonas vaginalis | ras GTP exchange factor, son of sevenless, putative | 0.0015 | 0.0073 | 0.0562 |
| Schistosoma mansoni | ras GTP exchange factor son of sevenless | 0.0015 | 0.0073 | 0.0302 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.0225 | 0.5567 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.003 | 0.0225 | 0.1672 |
| Brugia malayi | hypothetical protein | 0.0033 | 0.0249 | 0.0235 |
| Plasmodium vivax | flap endonuclease 1, putative | 0.0031 | 0.0235 | 0.5239 |
| Brugia malayi | 'Paired box' domain containing protein | 0.0019 | 0.0113 | 0.0099 |
| Plasmodium falciparum | histone acetyltransferase GCN5 | 0.0047 | 0.0392 | 1 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0088 | 0.0803 | 0.6269 |
| Echinococcus multilocularis | son of sevenless 1 | 0.0015 | 0.0073 | 0.0302 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0114 | 0.1062 | 1 |
| Toxoplasma gondii | histone lysine acetyltransferase GCN5-B | 0.0051 | 0.0435 | 1 |
| Trichomonas vaginalis | ras GTP exchange factor, putative | 0.0015 | 0.0073 | 0.0562 |
| Mycobacterium tuberculosis | Probable isocitrate dehydrogenase [NADP] Icd1 (oxalosuccinate decarboxylase) (IDH) (NADP+-specific ICDH) (IDP) | 0.0019 | 0.0111 | 0.1734 |
| Echinococcus multilocularis | expressed conserved protein | 0.001 | 0.0018 | 0.0019 |
| Onchocerca volvulus | 0.0021 | 0.0135 | 0.0121 | |
| Trichomonas vaginalis | guanine nucleotide exchange factor, putative | 0.0015 | 0.0073 | 0.0562 |
| Toxoplasma gondii | ImpB/MucB/SamB family protein | 0.0051 | 0.0427 | 0.9805 |
| Echinococcus granulosus | paired box protein pax 6 | 0.0019 | 0.0113 | 0.0506 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.0119 | 0.0834 |
| Echinococcus multilocularis | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0111 | 0.0495 |
| Trypanosoma brucei | unspecified product | 0.0088 | 0.0803 | 0.6269 |
| Schistosoma mansoni | ras GTP exchange factor | 0.0015 | 0.0073 | 0.0302 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0114 | 0.1062 | 0.5361 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0095 | 0.0869 | 0.0856 |
| Schistosoma mansoni | DNA polymerase eta | 0.0095 | 0.0869 | 0.4377 |
| Leishmania major | DNA polymerase eta, putative | 0.0051 | 0.0427 | 0.328 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.0135 | 0.1272 | 1 |
| Echinococcus multilocularis | Protein son of sevenless | 0.0015 | 0.0073 | 0.0302 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0442 | 0.3401 |
| Trypanosoma brucei | DNA damage repair protein, putative | 0.002 | 0.0119 | 0.0834 |
| Echinococcus multilocularis | serine:threonine protein kinase PLK1 | 0.0114 | 0.1062 | 0.5361 |
| Echinococcus granulosus | dna polymerase kappa | 0.0096 | 0.0883 | 0.4446 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0064 | 0.0562 | 0.494 |
| Echinococcus multilocularis | dna polymerase kappa | 0.0096 | 0.0883 | 0.4446 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q1 | 0.0012 | 0.004 | 0.0131 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0095 | 0.0869 | 0.6796 |
| Trypanosoma brucei | hypothetical protein | 0.0135 | 0.1272 | 1 |
| Schistosoma mansoni | gcn5proteinral control of amino-acid synthesis 5-like 2 gcnl2 | 0.0175 | 0.1672 | 0.8484 |
| Schistosoma mansoni | DNA helicase recq5 | 0.0012 | 0.004 | 0.0131 |
| Echinococcus granulosus | serine:threonine protein kinase PLK1 | 0.0114 | 0.1062 | 0.5361 |
| Echinococcus multilocularis | paired box protein pax 1 | 0.0019 | 0.0113 | 0.0506 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0051 | 0.0427 | 0.328 |
| Onchocerca volvulus | 0.0019 | 0.0113 | 0.0099 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (binding) | = 3.663 uM | PUBCHEM_BIOASSAY: Fluorescence polarization-based biochemical high throughput dose response assay for inhibitors of GLD-1 protein - TGE RNA interaction. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2280, AID2290, AID2459] | ChEMBL. | No reference |
| IC50 (binding) | = 8.337 um | PUBCHEM_BIOASSAY: Counterscreen for inhibitors of gld-1: Fluorescence polarization-based biochemical high throughput dose response assay for inhibitors of the HIV Rev protein-RRE RNA interaction. (Class of assay: confirmatory) [Related pubchem assays: 2290 (Summary (gld-1 inhibitors)), 2280 (Primary screen (gld-1 inhibitors in singlicate))] | ChEMBL. | No reference |
| Potency (functional) | 0.1158 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in SW480 colon adenocarcinoma cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 2.8184 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of GCN5L2. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504398] | ChEMBL. | No reference |
| Potency (functional) | 3.2643 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in MCF 10a normal breast cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 3.5481 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (functional) | 3.5481 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Eta. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588636] | ChEMBL. | No reference |
| Potency (functional) | 4.7444 uM | PubChem BioAssay. qHTS for Inhibitors of PLK1-PDB (polo-like kinase 1 - polo-box domain): Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 5.0119 uM | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of Human Flap endonuclease 1 (FEN1). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488813] | ChEMBL. | No reference |
| Potency (functional) | 5.6234 uM | PubChem BioAssay. qHTS of alpha-syn Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 9.2 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PubChem BioAssay. qHTS for Inhibitors of WRN Helicase. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PubChem BioAssay. qHTS for Antagonist of cAMP-regulated guanine nucleotide exchange factor 3 (EPAC1): primary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 17.7828 uM | PubChem BioAssay. qHTS for Inhibitors of ATXN expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 17.7828 uM | PubChem BioAssay. Inhibitors of USP1/UAF1: Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 19.9526 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Ubiquitin-specific Protease USP2a Using CHOP2 as the Reporter. (Class of assay: confirmatory) [Related pubchem assays: 2281 (Summary of qHTS Assay for Inhibitors of Ubiquitin-specific Protease USP2a), 463106 (LOPAC Validation Assay for Inhibitors of Ubiquitin-specific Protease USP2a)] | ChEMBL. | No reference |
| Potency (binding) | = 19.9526 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Tyrosyl-DNA Phosphodiesterase (TDP1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 19.9526 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Kappa. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588638] | ChEMBL. | No reference |
| Potency (functional) | 19.9526 uM | PubChem BioAssay. qHTS for Antagonist of cAMP-regulated guanine nucleotide exchange factor 2 (EPAC2): primary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 22.3872 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of JMJD2A-Tudor Domain. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504402] | ChEMBL. | No reference |
| Potency (functional) | 22.3872 uM | PUBCHEM_BIOASSAY: Inhibitors of the vitamin D receptor (VDR): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504855] | ChEMBL. | No reference |
| Potency (functional) | 22.3872 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 22.3872 uM | PubChem BioAssay. qHTS for Antagonists of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 23.1093 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | 25.1189 uM | PUBCHEM_BIOASSAY: qHTS Assay to Find Inhibitors of Phosphoglycerate Kinase. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PubChem BioAssay. qHTS for Inhibitors of Glutaminase (GLS). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PubChem BioAssay. Inhibitors of Secretory Acid Sphingomyelinase (S-ASM): qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PubChem BioAssay. qHTS Assay to Find Inhibitors of Pin1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the HIV-1 protein Vpr. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 29.081 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493107, AID493125] | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of L3MBTL1. (Class of assay: confirmatory) [Related pubchem assays: 485292 (Probe Development Summary for Inhibitors of L3MBTL1)] | ChEMBL. | No reference |
| Potency (functional) | 31.6228 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PubChem BioAssay. qHTS of TDP-43 Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 37.6858 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of the Phosphatase Activity of Eya2. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488939] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: HTS for Inhibitors of HP1-beta Chromodomain Interactions with Methylated Histone Tails. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488962] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of mutant isocitrate dehydrogenase 1 (IDH1): qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 79.4328 uM | PUBCHEM_BIOASSAY: qHTS Assay for Iinhibitors of HIV-1 Budding by Blocking the Interaction of PTAP/TSG101. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID485342, AID485388] | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1555842
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.