Detailed information for compound 592755
Basic information
Technical information
- TDR Targets ID: 592755
- Name: 10-hydroxy-3-methyl-8-propyl-2,4-dihydro-1H-c hromeno[3,4-c]pyridin-5-one
- MW: 273.327 | Formula: C16H19NO3
-
H donors: 1
H acceptors: 2
LogP: 2.32
Rotable bonds: 2
Rule of 5 violations (Lipinski): 1 - SMILES: CCCc1cc(O)c2c(c1)oc(=O)c1c2CCN(C1)C
- InChi: 1S/C16H19NO3/c1-3-4-10-7-13(18)15-11-5-6-17(2)9-12(11)16(19)20-14(15)8-10/h7-8,18H,3-6,9H2,1-2H3
- InChiKey: JYZGRMRMVUUYHG-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- Oprea1_756977
- STK329758
- Oprea1_815795
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0048 | 0.0643 | 0.0643 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.0007 | 0.0026 | 0.0026 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0588 | 0.1081 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.019 | 0.0201 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Echinococcus granulosus | FTZ F1 alpha | 0.001 | 0.007 | 0.007 |
| Toxoplasma gondii | glycyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0024 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.001 | 0.007 | 0.0303 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0512 | 0.868 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0493 | 0.2142 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.2997 | 0.3724 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Echinococcus granulosus | dnaJ subfamily B | 0.0396 | 0.5895 | 0.5895 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0035 | 0.045 | 0.2396 |
| Trypanosoma cruzi | glycosyl hydrolase-like protein, putative | 0.0013 | 0.0119 | 0.1787 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0347 | 0.6849 |
| Trichomonas vaginalis | maltase-glucoamylase, putative | 0.0013 | 0.0119 | 0.0564 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0007 | 0.0026 | 0.0026 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0013 | 0.0119 | 0.0564 |
| Brugia malayi | nuclear hormone receptor | 0.001 | 0.007 | 0.0303 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0512 | 0.868 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0347 | 0.1507 |
| Mycobacterium leprae | PROBABLE DNA LIGASE [NAD DEPENDENT] LIGA (POLYDEOXYRIBONUCLEOTIDE SYNTHASE [NAD+]) | 0.001 | 0.0074 | 0.1215 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.019 | 0.0824 |
| Schistosoma mansoni | alpha-glucosidase | 0.0136 | 0.197 | 0.197 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | hypothetical protein | 0.0037 | 0.0479 | 0.0479 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0013 | 0.0119 | 0.0564 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.001 | 0.007 | 0.0303 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0493 | 0.2142 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0094 | 0.1346 | 0.1346 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.001 | 0.007 | 0.0303 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0029 | 0.0218 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.001 | 0.0074 | 0.032 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.001 | 0.007 | 0.007 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0048 | 0.0643 | 0.2795 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0156 | 0.068 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.019 | 0.0327 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 0.7999 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.1825 | 0.1825 |
| Loa Loa (eye worm) | CXXC zinc finger family protein | 0.0028 | 0.0341 | 0.1484 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0505 | 0.855 |
| Echinococcus multilocularis | Threonyl tRNA synthetase, C | 0.0007 | 0.0029 | 0.0029 |
| Brugia malayi | hypothetical protein | 0.0037 | 0.0479 | 0.2082 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Schistosoma mansoni | hypothetical protein | 0.0048 | 0.0643 | 0.0643 |
| Trichomonas vaginalis | chromodomain-helicase-DNA-binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | Threonyl tRNA synthetase C | 0.0007 | 0.0029 | 0.0029 |
| Echinococcus multilocularis | geminin | 0.0164 | 0.2397 | 0.2397 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 0.045 | 0.759 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.019 | 0.0824 |
| Echinococcus granulosus | GPCR family 2 | 0.0048 | 0.0643 | 0.0643 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.001 | 0.007 | 0.007 |
| Echinococcus granulosus | replication factor c subunit 1 | 0.001 | 0.0074 | 0.0074 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.001 | 0.007 | 0.0303 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.019 | 0.019 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0493 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.019 | 0.0956 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0347 | 0.5783 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.001 | 0.007 | 0.007 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0505 | 0.0925 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.019 | 0.019 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | chromosome transmission fidelity factor | 0.001 | 0.0074 | 0.0074 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.019 | 0.0956 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0347 | 0.0399 |
| Loa Loa (eye worm) | hypothetical protein | 0.0153 | 0.2235 | 0.9714 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0469 | 0.0469 |
| Schistosoma mansoni | microtubule-associated protein tau | 0.0668 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Brugia malayi | ATP dependent DNA ligase C terminal region family protein | 0.001 | 0.0074 | 0.0324 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.001 | 0.007 | 0.0303 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.2997 | 0.5643 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0294 | 0.1536 |
| Treponema pallidum | DNA ligase (lig) | 0.001 | 0.0074 | 0.4799 |
| Entamoeba histolytica | hypothetical protein | 0.0037 | 0.0479 | 0.9463 |
| Toxoplasma gondii | histone lysine methyltransferase SET1 | 0.0053 | 0.0717 | 0.1325 |
| Entamoeba histolytica | hypothetical protein | 0.001 | 0.0074 | 0.0955 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.019 | 0.5239 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Schistosoma mansoni | alpha glucosidase | 0.0035 | 0.045 | 0.045 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0013 | 0.0119 | 0.0564 |
| Echinococcus granulosus | neutral alpha glucosidase AB | 0.0035 | 0.045 | 0.045 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0505 | 0.0597 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0037 | 0.0479 | 0.0479 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | nuclear receptor NHR-88 | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0013 | 0.0119 | 0.0516 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0347 | 0.0347 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0035 | 0.045 | 0.2396 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0037 | 0.0479 | 0.0479 |
| Trichomonas vaginalis | maltase-glucoamylase, putative | 0.0035 | 0.045 | 0.2396 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0588 | 1 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0505 | 0.0597 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0347 | 0.5783 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Echinococcus granulosus | geminin | 0.0164 | 0.2397 | 0.2397 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0505 | 0.0597 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0094 | 0.1346 | 0.1346 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Trypanosoma brucei | BRCA1 C Terminus (BRCT) domain containing protein, putative | 0.001 | 0.0074 | 0.1013 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Schistosoma mansoni | hypothetical protein | 0.0164 | 0.2397 | 0.2397 |
| Schistosoma mansoni | mixed-lineage leukemia protein mll | 0.0059 | 0.0812 | 0.0812 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.019 | 0.0824 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0493 | 0.0493 |
| Brugia malayi | topoisomerase | 0.001 | 0.0074 | 0.0324 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.019 | 0.0956 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0512 | 0.868 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.019 | 0.0327 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.019 | 0.303 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Onchocerca volvulus | 0.0091 | 0.1298 | 1 | |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.1825 | 0.7931 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0158 | 0.2301 | 0.2301 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.5299 | 1 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0347 | 0.0347 |
| Echinococcus multilocularis | nibrin | 0.001 | 0.0074 | 0.0074 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.019 | 0.019 |
| Trichomonas vaginalis | RNA polymerase II ctd phosphatase, putative | 0.001 | 0.0074 | 0.032 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Wolbachia endosymbiont of Brugia malayi | NAD-dependent DNA ligase, Lig | 0.001 | 0.0074 | 0.2829 |
| Schistosoma mansoni | hypothetical protein | 0.0164 | 0.2397 | 0.2397 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.019 | 0.0327 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0035 | 0.045 | 0.759 |
| Echinococcus granulosus | nibrin | 0.001 | 0.0074 | 0.0074 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.001 | 0.007 | 0.007 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0283 | 0.5587 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.001 | 0.007 | 0.007 |
| Chlamydia trachomatis | proline--tRNA ligase | 0.0013 | 0.0124 | 0.2978 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.1825 | 0.3424 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.019 | 0.6499 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0347 | 1 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0035 | 0.045 | 0.2396 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Mycobacterium ulcerans | NAD-dependent DNA ligase LigA | 0.001 | 0.0074 | 0.1753 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0119 | 0.0516 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0512 | 0.274 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.001 | 0.007 | 0.007 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Echinococcus granulosus | glycyl tRNA synthetase | 0.0007 | 0.0029 | 0.0029 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0505 | 0.0597 |
| Brugia malayi | probable proline-trna synthetase - fission yeast, putative | 0.0007 | 0.0029 | 0.0126 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0048 | 0.0643 | 0.2795 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0469 | 0.0469 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.001 | 0.007 | 0.0303 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0512 | 0.274 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus multilocularis | muscleblind protein | 0.0153 | 0.2235 | 0.2235 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0158 | 0.2301 | 0.2301 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0512 | 0.868 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.001 | 0.007 | 0.0303 |
| Leishmania major | glycosyl hydrolase-like protein | 0.0013 | 0.0119 | 0.1787 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0347 | 0.5783 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0505 | 0.855 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.001 | 0.007 | 0.0303 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0505 | 0.0505 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0103 | 0.148 | 0.6432 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0035 | 0.045 | 0.8849 |
| Mycobacterium ulcerans | threonyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0377 |
| Onchocerca volvulus | 0.0028 | 0.0341 | 0.2213 | |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.001 | 0.007 | 0.007 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.001 | 0.007 | 0.007 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0512 | 0.868 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0013 | 0.0119 | 0.0564 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.019 | 0.5239 |
| Trichomonas vaginalis | RNA polymerase II ctd phosphatase, putative | 0.001 | 0.0074 | 0.032 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0347 | 0.0347 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0505 | 0.0505 |
| Schistosoma mansoni | cpg binding protein | 0.0029 | 0.0365 | 0.0365 |
| Entamoeba histolytica | Activator 1 140 kDa subunit, putative | 0.001 | 0.0074 | 0.0955 |
| Toxoplasma gondii | ATPase, AAA family protein | 0.001 | 0.0074 | 0.011 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.019 | 0.0824 |
| Echinococcus multilocularis | cpg binding protein | 0.0029 | 0.0365 | 0.0365 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0094 | 0.1346 | 0.5847 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0512 | 0.274 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0505 | 0.0597 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0283 | 1 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.001 | 0.007 | 0.007 |
| Schistosoma mansoni | DNA ligase IV | 0.001 | 0.0074 | 0.0074 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0035 | 0.045 | 0.2396 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0588 | 1 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.019 | 0.5239 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0029 | 0.0218 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.019 | 0.0824 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.001 | 0.0074 | 0.1013 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1825 | 0.1825 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.0007 | 0.0026 | 0.0026 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Echinococcus multilocularis | replication factor c subunit 1 | 0.001 | 0.0074 | 0.0074 |
| Trichomonas vaginalis | threonyl-tRNA synthetase, putative | 0.0007 | 0.0029 | 0.0069 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.001 | 0.007 | 0.007 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Trypanosoma cruzi | BRCA1 C Terminus (BRCT) domain containing protein, putative | 0.001 | 0.0074 | 0.1013 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.001 | 0.007 | 0.0303 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0505 | 0.0597 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.001 | 0.007 | 0.007 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0505 | 1 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0505 | 0.0925 |
| Leishmania major | threonyl-tRNA synthetase, putative | 0.0007 | 0.0029 | 0.0218 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.001 | 0.007 | 0.007 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0505 | 0.0505 |
| Onchocerca volvulus | 0.001 | 0.0074 | 0.004 | |
| Entamoeba histolytica | hypothetical protein | 0.0037 | 0.0479 | 0.9463 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.019 | 0.019 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.001 | 0.007 | 0.007 |
| Brugia malayi | F/Y-rich N-terminus family protein | 0.0008 | 0.005 | 0.0218 |
| Trichomonas vaginalis | chromodomain-helicase-DNA-binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.019 | 0.303 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Plasmodium falciparum | protein kinase 6 | 0.0536 | 0.7999 | 1 |
| Chlamydia trachomatis | DNA ligase | 0.001 | 0.0074 | 0.1429 |
| Mycobacterium leprae | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase) (ThrRS) (Threonine-tRNA ligase) | 0.0007 | 0.0029 | 0.0262 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Trypanosoma brucei | glucosidase, putative | 0.0035 | 0.045 | 0.759 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.001 | 0.007 | 0.007 |
| Echinococcus granulosus | muscleblind protein | 0.0153 | 0.2235 | 0.2235 |
| Trypanosoma brucei | glycyl-tRNA synthetase, putative | 0.0007 | 0.0029 | 0.0218 |
| Giardia lamblia | Hexose transporter | 0.0018 | 0.019 | 0.346 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0493 | 0.0493 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0035 | 0.045 | 0.2396 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0151 | 0.2202 | 0.9566 |
| Schistosoma mansoni | hypothetical protein | 0.0048 | 0.0643 | 0.0643 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | lysosomal alpha glucosidase | 0.0158 | 0.2301 | 0.2301 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0347 | 0.0347 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.0124 | 1 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0493 | 0.0493 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0512 | 0.274 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | hypothetical protein | 0.001 | 0.0074 | 0.0324 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0512 | 0.274 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0347 | 0.0399 |
| Loa Loa (eye worm) | threonyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0126 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.001 | 0.007 | 0.0303 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0512 | 0.868 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Brugia malayi | glycyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0126 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0505 | 0.2193 |
| Trypanosoma cruzi | glycosyl hydrolase-like protein, putative | 0.0013 | 0.0119 | 0.1787 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.019 | 1 |
| Giardia lamblia | Sugar-proton symporter | 0.0018 | 0.019 | 0.346 |
| Plasmodium vivax | replication factor C subunit 1, putative | 0.001 | 0.0074 | 0.0057 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.001 | 0.0074 | 0.032 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0347 | 0.6932 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.019 | 0.303 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0158 | 0.2301 | 1 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0505 | 0.0597 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.019 | 0.303 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0588 | 0.0701 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.1825 | 0.7931 |
| Trichomonas vaginalis | chromodomain helicase DNA binding protein, putative | 0.0006 | 0.0017 | 0.0002 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.019 | 0.303 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0094 | 0.1346 | 0.1346 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0013 | 0.0119 | 0.0564 |
| Brugia malayi | DKFZp564C0469 protein | 0.001 | 0.0074 | 0.0324 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0048 | 0.0643 | 0.0643 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Entamoeba histolytica | hypothetical protein | 0.0037 | 0.0479 | 0.9463 |
| Toxoplasma gondii | threonyl-tRNA synthetase family protein | 0.0007 | 0.0029 | 0.0024 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0283 | 1 |
| Echinococcus multilocularis | dnaJ subfamily B | 0.0396 | 0.5895 | 0.5895 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0013 | 0.0119 | 0.0564 |
| Brugia malayi | CXXC zinc finger family protein | 0.0028 | 0.0341 | 0.1484 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0493 | 0.2634 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.019 | 0.303 |
| Mycobacterium ulcerans | prolyl-tRNA synthetase | 0.0013 | 0.0124 | 0.3243 |
| Trypanosoma cruzi | FHA domain containing protein, putative | 0.001 | 0.0074 | 0.1013 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.001 | 0.007 | 0.0303 |
| Schistosoma mansoni | thyroid hormone receptor | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0347 | 0.1826 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.2997 | 0.3724 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0013 | 0.0119 | 0.0564 |
| Plasmodium falciparum | replication factor C subunit 1, putative | 0.001 | 0.0074 | 0.0057 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0094 | 0.1346 | 0.1346 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.001 | 0.007 | 0.0303 |
| Loa Loa (eye worm) | hypothetical protein | 0.0151 | 0.2202 | 0.9566 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0347 | 1 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0347 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.019 | 0.0956 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.001 | 0.007 | 0.007 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0035 | 0.045 | 0.1955 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Brugia malayi | ecdysteroid receptor | 0.001 | 0.007 | 0.0303 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0029 | 0.0126 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.001 | 0.0074 | 0.1013 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.001 | 0.007 | 0.0303 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0588 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0505 | 0.2193 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Toxoplasma gondii | poly(ADP-ribose) polymerase catalytic domain-containing protein | 0.001 | 0.0074 | 0.011 |
| Schistosoma mansoni | coup transcription factor | 0.001 | 0.007 | 0.007 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.019 | 0.019 |
| Trypanosoma brucei | glycosyl hydrolase-like protein | 0.0013 | 0.0119 | 0.1787 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0386 | 0.1677 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0512 | 0.274 |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.019 | 0.6499 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0094 | 0.1346 | 0.1346 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.019 | 0.0824 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0151 | 0.2202 | 0.9566 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0505 | 0.0925 |
| Toxoplasma gondii | glycosyl hydrolase, family 31 protein | 0.0035 | 0.045 | 0.082 |
| Loa Loa (eye worm) | hypothetical protein | 0.0153 | 0.2235 | 0.9714 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0588 | 0.0701 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.001 | 0.007 | 0.007 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.001 | 0.007 | 0.007 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0588 | 1 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0505 | 0.2193 |
| Loa Loa (eye worm) | histone methyltransferase | 0.0009 | 0.0052 | 0.0225 |
| Brugia malayi | Pax transcription activation domain interacting protein | 0.001 | 0.0074 | 0.0324 |
| Echinococcus granulosus | mixed lineage leukemia protein mll | 0.0007 | 0.0026 | 0.0026 |
| Trichomonas vaginalis | chromosome transmission fidelity factor, putative | 0.001 | 0.0074 | 0.032 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.001 | 0.007 | 0.0303 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0505 | 0.2193 |
| Schistosoma mansoni | hypothetical protein | 0.0048 | 0.0643 | 0.0643 |
| Echinococcus multilocularis | neutral alpha glucosidase AB | 0.0035 | 0.045 | 0.045 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.001 | 0.007 | 0.007 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0493 | 0.0493 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0048 | 0.0643 | 0.2795 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.001 | 0.007 | 0.0303 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.001 | 0.0074 | 0.032 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0347 | 0.6679 |
| Mycobacterium ulcerans | glycyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0377 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0643 | 0.2795 |
| Echinococcus multilocularis | glycyl tRNA synthetase | 0.0007 | 0.0029 | 0.0029 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0493 | 0.2142 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.019 | 0.0201 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0035 | 0.045 | 0.1955 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.1825 | 0.2253 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0347 | 0.0625 |
| Loa Loa (eye worm) | hypothetical protein | 0.0103 | 0.148 | 0.6432 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Giardia lamblia | Replication factor C, subunit 1 | 0.001 | 0.0074 | 0.0979 |
| Echinococcus multilocularis | microtubule associated protein 2 | 0.0668 | 1 | 1 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.5299 | 0.6612 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.1825 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.001 | 0.007 | 0.0303 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0505 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0094 | 0.1346 | 0.1346 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0017 | 0.0002 |
| Schistosoma mansoni | nuclear hormone receptor | 0.001 | 0.007 | 0.007 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Schistosoma mansoni | alpha-glucosidase | 0.0136 | 0.197 | 0.197 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.001 | 0.0074 | 0.032 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0505 | 0.0597 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0048 | 0.0643 | 0.0643 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Brugia malayi | Muscleblind-like protein | 0.0153 | 0.2235 | 0.9714 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.019 | 0.0327 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0588 | 1 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.001 | 0.007 | 0.0303 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0505 | 0.2193 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0512 | 0.274 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0094 | 0.1346 | 0.5847 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0151 | 0.2202 | 0.9566 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Schistosoma mansoni | topbp1 | 0.001 | 0.0074 | 0.0074 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.001 | 0.007 | 0.007 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.019 | 0.0824 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.019 | 0.019 |
| Schistosoma mansoni | hypothetical protein | 0.0396 | 0.5895 | 0.5895 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1825 | 0.1825 |
| Mycobacterium tuberculosis | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase)(ThrRS) (threonine-tRNA ligase) | 0.0007 | 0.0029 | 0.0468 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.019 | 0.5239 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.019 | 0.019 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.019 | 0.019 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0493 | 0.9752 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.1825 | 0.2253 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0505 | 0.0505 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.019 | 0.019 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Brugia malayi | steroid hormone receptor | 0.001 | 0.007 | 0.0303 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0035 | 0.045 | 0.2396 |
| Trichomonas vaginalis | replication factor C large subunit, putative | 0.001 | 0.0074 | 0.032 |
| Schistosoma mansoni | hypothetical protein | 0.0048 | 0.0643 | 0.0643 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0245 | 0.3994 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.019 | 0.0824 |
| Entamoeba histolytica | hypothetical protein | 0.0037 | 0.0479 | 0.9463 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0493 | 0.2142 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0013 | 0.0119 | 0.1883 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.0153 | 0.2235 | 0.2235 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1558 | 0.1558 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | thyroid hormone receptor | 0.001 | 0.007 | 0.007 |
| Leishmania major | alpha glucosidase II subunit, putative | 0.0035 | 0.045 | 0.759 |
| Schistosoma mansoni | hypothetical protein | 0.0103 | 0.148 | 0.148 |
| Echinococcus granulosus | histone lysine N methyltransferase MLL3 | 0.0009 | 0.0052 | 0.0052 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.001 | 0.007 | 0.0303 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0035 | 0.045 | 0.2396 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | glycyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0029 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1558 | 0.1558 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.019 | 0.0824 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0505 | 0.0505 |
| Trypanosoma brucei | threonyl-tRNA synthetase, putative | 0.0007 | 0.0029 | 0.0218 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.019 | 0.019 |
| Trichomonas vaginalis | chromosome transmission fidelity factor, putative | 0.001 | 0.0074 | 0.032 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0505 | 0.0597 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1825 | 0.1825 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1825 | 0.1825 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0035 | 0.045 | 0.8849 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.019 | 0.0824 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Onchocerca volvulus | 0.0018 | 0.019 | 0.0977 | |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0505 | 0.0505 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0048 | 0.0643 | 0.0643 |
| Echinococcus multilocularis | histone lysine N methyltransferase MLL3 | 0.0009 | 0.0052 | 0.0052 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.001 | 0.0074 | 0.032 |
| Schistosoma mansoni | cpg binding protein | 0.0029 | 0.0365 | 0.0365 |
| Schistosoma mansoni | topbp1 | 0.001 | 0.0074 | 0.0074 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0158 | 0.2301 | 1 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0048 | 0.0643 | 0.0643 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0493 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.001 | 0.007 | 0.0303 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.019 | 0.0824 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0512 | 0.868 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0094 | 0.1346 | 0.1346 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0037 | 0.0479 | 0.0479 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | cpg binding protein | 0.0029 | 0.0365 | 0.0365 |
| Echinococcus multilocularis | mixed lineage leukemia protein mll | 0.0007 | 0.0026 | 0.0026 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0347 | 0.1507 |
| Brugia malayi | threonyl-tRNA synthetase, cytoplasmic | 0.0007 | 0.0029 | 0.0126 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.019 | 0.0977 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0512 | 0.868 |
| Trichomonas vaginalis | helicase, putative | 0.0006 | 0.0017 | 0.0002 |
| Onchocerca volvulus | Uncharacterized family 31 glucosidase KIAA1161 homolog | 0.0013 | 0.0119 | 0.0399 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.001 | 0.007 | 0.0303 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.019 | 0.019 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.019 | 0.303 |
| Schistosoma mansoni | cpg binding protein | 0.0028 | 0.0341 | 0.0341 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.001 | 0.007 | 0.007 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.007 | 0.0303 |
| Trichomonas vaginalis | sucrase-isomaltase, putative | 0.0035 | 0.045 | 0.2396 |
| Loa Loa (eye worm) | glycyl-tRNA synthetase | 0.0007 | 0.0029 | 0.0126 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.019 | 0.0956 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.001 | 0.007 | 0.007 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0505 | 0.2699 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | NOVARTIS: Antimalarial liver stage activity measured as a greater than 50% reduction in Plasmodium yoelii schizont area in HepG2-A16-CD81 cells at 10uM compound concentration, determined by immuno-fluorescence. | ChEMBL. | 22096101 | |
| CC50 (functional) | > 100 uM | Huh7 cytotoxicity for Pf inhibitors | Novartis-GNF Malaria Box. | No reference |
| CC50 | > 100 uM | NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7) | ChEMBL. | 18579783 |
| EC50 (functional) | = 80.7 nM | MMV: Inhibition of Plasmodium falciparum K1 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 146 nM | MMV: Inhibition of Plasmodium falciparum 3D7 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 0.2939 uM | W2 Pf proliferation inhibition | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.2939 uM | NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| EC50 (functional) | = 0.554 uM | PF proliferation inhibition 3D7 | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.554 uM | NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| Growth Inhibition (functional) | = 31.2868 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 2573 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: 3H-Hyoxanthine uptake assay; 5% O2, 5% CO2 in N2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: Modified 3H-Hyoxanthine uptake assay; 1% O2, 5% CO2 in N2. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IFI promiscuity index | = 0 | IFI promiscuity index | Novartis-GNF Malaria Box. | No reference |
| Inhibition (functional) | = -49.5019514400795 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -49.50195144007949 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -29.9145486406901 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -29.335912211534342 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -29.3359122115343 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 LDH activity, using an LDH reporter assay. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 0.29 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 0.97 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 1.39 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 2.75798555836485 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 12 % | GSK_TCMDC: Percent inhibition of human HepG2 cell line. Test compounds present at 10uM. | ChEMBL. | 20485427 |
| Inhibition (functional) | = 14.1 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 16 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 46 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 50 % | GSK_TCMDC: Inhibition of Plasmodium falciparum Dd2 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 94 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 97 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Inhibition (functional) | = 98 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition frequency index (IFI) (functional) | = 0 | Inhibition Frequency Index (IFI) | GSK. | 20485427 |
| IZ | = 0 mm | MMV: Selection for compounds that exhibit enhanced toxicity in combination with artemisinin. Assay utilized the disc diffusion method with the observance of a clear zone indicating inhibition of growth. Synthetic complete medium containing 3% glycerol as a carbon source (SCG) was used in each assay. 10 uL of each compound was added to a paper disc which was placed on SCG and SCG+Artemisinin (0.2 uM) plates seeded with 10e6 yeast cells (WC081 strain: Mat a, leu2 delta 0, lys2 delta 0, ura3 delta 0, his3 delta 1, pdr1 delta::HIS3, pdr3 delta::kanMX4, derived from BY4742, regulators of Multi-drug resistance transporters have been deleted to enhance toxicity of compounds). Plates were incubated at 30 degrees C for 5 days and clear zones were measured. Compounds that produced a larger clear zone in the presence of artemisinin was considered to have an additive interaction with artemisinin. Results are reported as diameter of clear zone on SCG+artemisinin plates - diameter of clear zone on SCG plates without artemisinin. | ChEMBL. | No reference |
| Percent growth inhibition (functional) | = 0 % | Percent inhibition of P. falciparum lactate dehydrogenase activity (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 12 % | Percent inhibition of HepG2 growth (at 10 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 50 % | Percent inhibition of P. falciparum Dd2 growth (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 98 % | Percent inhibition of P. falciparum 3D7 growth (at 2 uM) | GSK. | 20485427 |
| Ratio (functional) | = 0.802816901408451 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0292 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0215 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0062 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| XC50 (functional) | = 6.06 | XC50 determination of P. falciparum 3D7 growth | GSK. | 20485427 |
| XC50 (functional) | = 0.87277 uM | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole erythrocytes, using parasite LDH activity as an index of growth. | ChEMBL. | 20485427 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | 18579783 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL586344
- Search by GSK
- Search by Novartis-GNF Malaria Box
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.