Detailed information for compound 596712
Basic information
Technical information
- TDR Targets ID: 596712
- Name: 1-[1-[(4-methylphenyl)methyl]benzimidazol-2-y l]-N-(thiophen-2-ylmethyl)piperidine-4-carbox amide
- MW: 444.592 | Formula: C26H28N4OS
-
H donors: 1
H acceptors: 2
LogP: 4.84
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: Cc1ccc(cc1)Cn1c(nc2c1cccc2)N1CCC(CC1)C(=O)NCc1cccs1
- InChi: 1S/C26H28N4OS/c1-19-8-10-20(11-9-19)18-30-24-7-3-2-6-23(24)28-26(30)29-14-12-21(13-15-29)25(31)27-17-22-5-4-16-32-22/h2-11,16,21H,12-15,17-18H2,1H3,(H,27,31)
- InChiKey: AOAJAGJXWRKYKA-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 1-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]-N-(2-thienylmethyl)piperidine-4-carboxamide
- 1-[1-[(4-methylphenyl)methyl]-2-benzimidazolyl]-N-(2-thienylmethyl)-4-piperidinecarboxamide
- 1-[1-(4-methylbenzyl)benzimidazol-2-yl]-N-(2-thienylmethyl)isonipecotamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Brugia malayi | hypothetical protein | 0.0012 | 0.0046 | 0.0151 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0023 | 0.0256 | 0.0392 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0149 | 0.0149 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0019 | 0.0177 | 0.0282 |
| Brugia malayi | nuclear receptor subfamily 1, group D, member 1, putative | 0.0011 | 0.0021 | 0.0069 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0149 | 0.0264 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus granulosus | Ataxin 2 N terminaldomain containing protein | 0.0013 | 0.0062 | 0.0094 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0149 | 0.0229 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0023 | 0.0256 | 0.0392 |
| Trypanosoma cruzi | mitochondrial DNA polymerase beta-PAK, putative | 0.0048 | 0.0721 | 0.1149 |
| Onchocerca volvulus | 0.0023 | 0.0256 | 0.4069 | |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0547 | 0.0838 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0023 | 0.0256 | 0.0392 |
| Echinococcus multilocularis | snurportin 1 | 0.0353 | 0.6524 | 1 |
| Brugia malayi | beta-lactamase family protein | 0.0041 | 0.0597 | 0.1945 |
| Trypanosoma brucei | mitochondrial DNA polymerase beta | 0.034 | 0.6275 | 1 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Brugia malayi | hypothetical protein | 0.0012 | 0.0046 | 0.0151 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0023 | 0.0256 | 0.0832 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0532 | 0.9728 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0041 | 0.0597 | 0.0915 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0023 | 0.0256 | 0.0392 |
| Echinococcus granulosus | cathepsin l1 | 0.0019 | 0.0177 | 0.0271 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0532 | 0.0816 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0046 | 0.0039 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0547 | 0.0838 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0019 | 0.0177 | 0.024 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0556 | 0.2515 |
| Giardia lamblia | GTP-binding nuclear protein RAN/TC4 | 0.0024 | 0.0275 | 0.3273 |
| Mycobacterium tuberculosis | Probable aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.4922 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Brugia malayi | Cathepsin L-like precursor | 0.0013 | 0.0056 | 0.0184 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0149 | 0.0197 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0041 | 0.0597 | 0.0957 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.7575 |
| Brugia malayi | nuclear receptor RXR | 0.0012 | 0.0046 | 0.0151 |
| Brugia malayi | RNA, U transporter 1 | 0.0094 | 0.16 | 0.5213 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0023 | 0.0256 | 0.0392 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0019 | 0.0177 | 0.024 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0011 | 0.0021 | 0.0032 |
| Leishmania major | cathepsin L-like protease | 0.0073 | 0.1203 | 0.172 |
| Trypanosoma brucei | GTP-binding nuclear protein rtb2, putative | 0.0024 | 0.0275 | 0.0438 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Plasmodium vivax | GTP-binding nuclear protein RAN/TC4, putative | 0.0024 | 0.0275 | 0.0275 |
| Leishmania major | cathepsin L-like protease | 0.0019 | 0.0177 | 0.0045 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Mycobacterium tuberculosis | Conserved protein | 0.0041 | 0.0597 | 0.0957 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0011 | 0.0021 | 0.0032 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0149 | 0.0487 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0348 | 0.1133 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0149 | 0.2227 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0532 | 0.0786 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Loa Loa (eye worm) | nucleolar RNA-associated protein alpha | 0.0353 | 0.6524 | 1 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0023 | 0.0256 | 0.0392 |
| Schistosoma mansoni | ran | 0.0024 | 0.0275 | 0.0421 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0547 | 0.0809 |
| Brugia malayi | nuclear hormone receptor | 0.0023 | 0.0256 | 0.0832 |
| Schistosoma mansoni | nuclear receptor | 0.0011 | 0.0021 | 0.0032 |
| Mycobacterium ulcerans | hypothetical protein | 0.0179 | 0.3216 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0029 | 0.0369 | 0.0587 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0029 | 0.0369 | 0.0587 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0019 | 0.0177 | 0.2707 |
| Plasmodium falciparum | importin beta, putative | 0.0033 | 0.0441 | 0.0441 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0547 | 0.0547 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0023 | 0.0256 | 0.036 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0149 | 0.0149 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0149 | 0.5 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0149 | 0.0197 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0547 | 0.0617 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0023 | 0.0256 | 0.4069 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Entamoeba histolytica | hypothetical protein | 0.0027 | 0.0322 | 0.5883 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0348 | 0.6357 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0023 | 0.0256 | 0.0392 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0348 | 0.0348 |
| Echinococcus granulosus | nuclear receptor nhr 48 | 0.0011 | 0.0021 | 0.0032 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0041 | 0.0597 | 0.0915 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0264 | 0.4828 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0029 | 0.0369 | 0.0369 |
| Leishmania major | cathepsin L-like protease | 0.0019 | 0.0177 | 0.0045 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 1 | 1 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0556 | 0.2515 |
| Echinococcus granulosus | nuclear receptor subfamily 1 group D | 0.0012 | 0.0046 | 0.0071 |
| Trypanosoma brucei | mitochondrial DNA polymerase beta-PAK | 0.0161 | 0.2871 | 0.4575 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Brugia malayi | nuclear hormone receptor family member nhr-6 | 0.0011 | 0.0021 | 0.0069 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0073 | 0.1203 | 0.1917 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0556 | 0.0887 |
| Toxoplasma gondii | HEAT repeat-containing protein | 0.0033 | 0.0441 | 0.0452 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0149 | 0.0487 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0547 | 0.0838 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Schistosoma mansoni | zinc finger protein | 0.0011 | 0.0021 | 0.0032 |
| Brugia malayi | Cathepsin L-like precursor | 0.0019 | 0.0177 | 0.0577 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0556 | 0.2515 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0023 | 0.0256 | 0.0832 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0029 | 0.0369 | 0.034 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0041 | 0.0597 | 0.0951 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0547 | 0.0838 |
| Brugia malayi | hypothetical protein | 0.0011 | 0.0021 | 0.0069 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Echinococcus multilocularis | GTP binding nuclear protein Ran | 0.0024 | 0.0275 | 0.0421 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0501 | 0.0769 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Echinococcus multilocularis | nuclear receptor subfamily 1 group D | 0.0012 | 0.0046 | 0.0071 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0149 | 0.0487 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Brugia malayi | beta-lactamase | 0.0041 | 0.0597 | 0.1945 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0532 | 0.2405 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0651 | 0.0651 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0012 | 0.0046 | 0.0151 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0023 | 0.0256 | 0.0392 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.0066 | 0.5 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0348 | 0.5182 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0019 | 0.0177 | 0.0177 |
| Loa Loa (eye worm) | fibroinase | 0.0019 | 0.0177 | 0.024 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0019 | 0.0177 | 0.0271 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Mycobacterium ulcerans | hypothetical protein | 0.0041 | 0.0597 | 0.1685 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.0177 | 0.024 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.3691 | 0.5495 |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0041 | 0.0597 | 0.0957 |
| Brugia malayi | hypothetical protein | 0.0029 | 0.0369 | 0.1201 |
| Schistosoma mansoni | hepatocyte nuclear factor 4-alpha (hnf-4-alpha) | 0.0011 | 0.0021 | 0.0032 |
| Toxoplasma gondii | ABC1 family protein | 0.0041 | 0.0597 | 0.0695 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0023 | 0.0256 | 0.0832 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0547 | 0.1782 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0013 | 0.0056 | 0.103 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0023 | 0.0256 | 0.0832 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0073 | 0.1203 | 0.1917 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.3691 | 0.3691 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0023 | 0.0256 | 0.0392 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0019 | 0.0177 | 0.3237 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0547 | 0.0547 |
| Echinococcus granulosus | muscleblind protein | 0.0171 | 0.3069 | 0.4704 |
| Trypanosoma cruzi | mitochondrial DNA polymerase beta, putative | 0.034 | 0.6275 | 1 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0073 | 0.1203 | 0.1917 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0023 | 0.0256 | 0.036 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.2212 | 0.2212 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0023 | 0.0256 | 0.0832 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0023 | 0.0256 | 0.4069 |
| Brugia malayi | Cathepsin L-like precursor | 0.0019 | 0.0177 | 0.0577 |
| Echinococcus multilocularis | aldehyde dehydrogenase, mitochondrial | 0.0139 | 0.2452 | 0.3759 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0056 | 0.0054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Brugia malayi | GTP-binding nuclear protein RAN/TC4 | 0.0024 | 0.0275 | 0.0895 |
| Brugia malayi | Importin beta-1 subunit | 0.0033 | 0.0441 | 0.1436 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0556 | 0.0664 |
| Trichomonas vaginalis | Importin beta-1 subunit, putative | 0.0027 | 0.0322 | 0.1454 |
| Onchocerca volvulus | 0.0013 | 0.0056 | 0.0611 | |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0023 | 0.0256 | 0.0392 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.3691 | 0.3691 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0348 | 0.0502 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0229 |
| Brugia malayi | Cathepsin L-like precursor | 0.0019 | 0.0177 | 0.0577 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0651 | 0.1038 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Brugia malayi | hypothetical protein | 0.0019 | 0.0171 | 0.0558 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0532 | 0.0816 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0023 | 0.0256 | 0.0392 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0023 | 0.0256 | 0.0832 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0067 | 0.1082 | 0.1725 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0041 | 0.0597 | 0.2699 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Schistosoma mansoni | nuclear receptor nhr-48 | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | esterase, putative | 0.0041 | 0.0597 | 0.2699 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Leishmania major | importin beta-1 subunit, putative | 0.0027 | 0.0322 | 0.0281 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0041 | 0.0597 | 0.2699 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0149 | 0.0197 |
| Brugia malayi | nuclear hormone receptor family member odr-7 | 0.0011 | 0.0021 | 0.0069 |
| Trypanosoma cruzi | GTP-binding nuclear protein rtb2, putative | 0.0024 | 0.0275 | 0.0438 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0547 | 0.0547 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0023 | 0.0256 | 0.0392 |
| Loa Loa (eye worm) | ctsf protein | 0.0019 | 0.0177 | 0.024 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0019 | 0.0177 | 0.0271 |
| Mycobacterium ulcerans | lipase LipD | 0.0041 | 0.0597 | 0.1685 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0041 | 0.0597 | 0.0915 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.3069 | 0.4687 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0023 | 0.0256 | 0.0392 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.0171 | 0.3069 | 0.4704 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0556 | 0.0664 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0597 | 0.0886 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Schistosoma mansoni | hypothetical protein | 0.0013 | 0.0062 | 0.0094 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0149 | 0.0238 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Onchocerca volvulus | 0.0041 | 0.0597 | 1 | |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0532 | 0.1734 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0348 | 0.0893 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0041 | 0.0597 | 0.0957 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0348 | 0.0554 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0149 | 0.0238 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0023 | 0.0256 | 0.0832 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0532 | 0.1734 |
| Brugia malayi | orphan nuclear receptor NR2E1 | 0.0011 | 0.0021 | 0.0069 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0282 | 0.1273 |
| Echinococcus multilocularis | importin subunit beta 1 | 0.0033 | 0.0441 | 0.0675 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Brugia malayi | cathepsin L-like precursor | 0.0013 | 0.0056 | 0.0184 |
| Trichomonas vaginalis | ran, putative | 0.0024 | 0.0275 | 0.1242 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0023 | 0.0256 | 0.0832 |
| Brugia malayi | Cathepsin L-like precursor | 0.0019 | 0.0177 | 0.0577 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0547 | 0.0547 |
| Toxoplasma gondii | GTP-binding nuclear protein ran/tc4 | 0.0024 | 0.0275 | 0.0194 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0149 | 0.0487 |
| Schistosoma mansoni | ecdysone-induced protein 78c (dr-78) | 0.0012 | 0.0046 | 0.0071 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0019 | 0.0177 | 0.2707 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0149 | 0.0487 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0556 | 0.2515 |
| Mycobacterium tuberculosis | Conserved protein | 0.0041 | 0.0597 | 0.0957 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0056 | 0.0054 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0108 | 0.0133 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0149 | 0.0487 |
| Leishmania major | hypothetical protein, conserved | 0.0029 | 0.0369 | 0.0358 |
| Trypanosoma cruzi | DNA polymerase beta thumb, putative | 0.0048 | 0.0721 | 0.1149 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0149 | 0.0229 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0556 | 0.0664 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0556 | 0.2515 |
| Trypanosoma brucei | importin beta-1 subunit, putative | 0.0033 | 0.0441 | 0.0702 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0597 | 0.0886 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0023 | 0.0256 | 0.0392 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0149 | 0.0229 |
| Leishmania major | cathepsin L-like protease | 0.0019 | 0.0177 | 0.0045 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0011 | 0.0021 | 0.0032 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0011 | 0.0021 | 0.0032 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2212 | 0.3391 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0019 | 0.0177 | 0.0271 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0023 | 0.0256 | 0.0392 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0597 | 0.0886 |
| Onchocerca volvulus | 0.0041 | 0.0597 | 1 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Onchocerca volvulus | 0.0041 | 0.0597 | 1 | |
| Mycobacterium tuberculosis | Conserved protein | 0.0041 | 0.0597 | 0.0957 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0019 | 0.0177 | 0.0577 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0023 | 0.0256 | 0.036 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0013 | 0.0056 | 0.0255 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0056 | 0.0054 |
| Echinococcus multilocularis | cysteine protease | 0.0019 | 0.0177 | 0.0271 |
| Schistosoma mansoni | nuclear hormone receptor superfamily protein-related | 0.0011 | 0.0021 | 0.0032 |
| Brugia malayi | beta-lactamase family protein | 0.0041 | 0.0597 | 0.1945 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0041 | 0.0597 | 0.0951 |
| Loa Loa (eye worm) | beta-lactamase | 0.0041 | 0.0597 | 0.0886 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0023 | 0.0256 | 0.036 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0023 | 0.0256 | 0.036 |
| Echinococcus multilocularis | nuclear receptor nhr 48 | 0.0011 | 0.0021 | 0.0032 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0267 | 0.0251 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0547 | 0.0547 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0348 | 0.0348 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0013 | 0.0056 | 0.0086 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.7575 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0675 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.6594 | 0.6594 |
| Echinococcus granulosus | GTP binding nuclear protein Ran | 0.0024 | 0.0275 | 0.0421 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0139 | 0.2449 | 0.3733 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0556 | 0.0887 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0023 | 0.0256 | 0.0832 |
| Leishmania major | mitochondrial DNA polymerase beta-PAK, putative | 0.0161 | 0.2871 | 0.4442 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0012 | 0.0046 | 0.0151 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0046 | 0.0039 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0019 | 0.0177 | 0.0271 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0041 | 0.0597 | 0.0957 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0149 | 0.0229 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0547 | 0.0617 |
| Leishmania major | cathepsin L-like protease | 0.0019 | 0.0177 | 0.0045 |
| Schistosoma mansoni | importin beta-1 | 0.0033 | 0.0441 | 0.0675 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Echinococcus multilocularis | muscleblind protein | 0.0171 | 0.3069 | 0.4704 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0532 | 0.0816 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Trypanosoma cruzi | GTP-binding nuclear protein rtb2, putative | 0.0024 | 0.0275 | 0.0438 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0651 | 0.0779 |
| Leishmania major | cathepsin L-like protease | 0.0019 | 0.0177 | 0.0045 |
| Brugia malayi | hypothetical protein | 0.0011 | 0.0021 | 0.0069 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0023 | 0.0256 | 0.0392 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0019 | 0.0177 | 0.2707 |
| Leishmania major | hypothetical protein, conserved | 0.0041 | 0.0597 | 0.0731 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0023 | 0.0256 | 0.0392 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0041 | 0.0597 | 0.0957 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.7575 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0556 | 0.2515 |
| Loa Loa (eye worm) | hypothetical protein | 0.0171 | 0.3069 | 0.4687 |
| Leishmania major | GTP-binding protein, putative | 0.0024 | 0.0275 | 0.0204 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0011 | 0.0021 | 0.0069 |
| Trypanosoma brucei | importin beta-1 subunit, putative | 0.0033 | 0.0441 | 0.0702 |
| Echinococcus multilocularis | retinoic acid receptor rxr beta a retinoic acid receptor rxr alpha a retinoic acid receptor rxr alpha | 0.0011 | 0.0021 | 0.0032 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0229 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0023 | 0.0256 | 0.0392 |
| Echinococcus granulosus | nuclear receptor subfamily 4 group A | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0013 | 0.0056 | 0.0255 |
| Trypanosoma cruzi | DNA polymerase beta thumb, putative | 0.0048 | 0.0721 | 0.1149 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0023 | 0.0256 | 0.0392 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0547 | 0.0617 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Echinococcus granulosus | thyroid hormone receptor alpha | 0.0011 | 0.0021 | 0.0032 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0057 | 0.0905 | 0.1443 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0651 | 0.0651 |
| Brugia malayi | Cathepsin L-like precursor | 0.0019 | 0.0177 | 0.0577 |
| Brugia malayi | Cathepsin L-like precursor | 0.0013 | 0.0056 | 0.0184 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0348 | 0.2447 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1875 | 0.2874 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0023 | 0.0256 | 0.0832 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0019 | 0.0177 | 0.0271 |
| Echinococcus multilocularis | cysteine protease | 0.0019 | 0.0177 | 0.0271 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0023 | 0.0256 | 0.0392 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0547 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor HR96 | 0.0011 | 0.0021 | 0.0032 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0149 | 0.0238 |
| Loa Loa (eye worm) | hypothetical protein | 0.0033 | 0.0441 | 0.0645 |
| Schistosoma mansoni | hypothetical protein | 0.0353 | 0.6524 | 1 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0229 |
| Brugia malayi | Cathepsin L-like precursor | 0.0019 | 0.0177 | 0.0577 |
| Leishmania major | mitochondrial DNA polymerase beta | 0.034 | 0.6275 | 1 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0532 | 0.0816 |
| Entamoeba histolytica | Ran family GTPase | 0.0024 | 0.0275 | 0.5022 |
| Echinococcus multilocularis | Ataxin 2, N terminal,domain containing protein | 0.0013 | 0.0062 | 0.0094 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0229 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0019 | 0.0177 | 0.0271 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0597 | 0.0886 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0348 | 0.0533 |
| Echinococcus granulosus | importin subunit beta 1 | 0.0033 | 0.0441 | 0.0675 |
| Leishmania major | aldehyde dehydrogenase, mitochondrial precursor | 0.0139 | 0.2452 | 0.376 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0532 | 0.8032 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.2212 | 1 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Loa Loa (eye worm) | cysteine protease | 0.0019 | 0.0177 | 0.024 |
| Brugia malayi | ecdysteroid receptor | 0.0023 | 0.0256 | 0.0832 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0041 | 0.0597 | 0.1685 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0651 | 0.0819 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0041 | 0.0597 | 0.0957 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0019 | 0.0177 | 0.3237 |
| Plasmodium vivax | vivapain-2 | 0.0019 | 0.0177 | 0.0177 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0019 | 0.0177 | 0.0271 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0149 | 0.0487 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0023 | 0.0256 | 0.0392 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.2212 | 0.7208 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1875 | 0.2874 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Schistosoma mansoni | coup transcription factor | 0.0023 | 0.0256 | 0.0392 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0556 | 0.0664 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0597 | 0.0886 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0019 | 0.0177 | 0.0177 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0023 | 0.0256 | 0.0392 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Trypanosoma brucei | DNA polymerase beta thumb, putative | 0.0048 | 0.0721 | 0.1149 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0348 | 0.0533 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0023 | 0.0256 | 0.0832 |
| Echinococcus granulosus | aldehyde dehydrogenase mitochondrial | 0.0139 | 0.2452 | 0.3759 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0012 | 0.0046 | 0.0071 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0651 | 0.0819 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0556 | 0.2515 |
| Brugia malayi | MH2 domain containing protein | 0.0139 | 0.2449 | 0.7978 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0041 | 0.0597 | 0.2699 |
| Schistosoma mansoni | nuclear receptor | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Brugia malayi | nuclear hormone receptor | 0.0011 | 0.0021 | 0.0069 |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0041 | 0.0597 | 0.1685 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0651 | 0.1038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0046 | 0.0039 |
| Toxoplasma gondii | cathepsin CPL | 0.0019 | 0.0177 | 0.0043 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0547 | 0.0547 |
| Entamoeba histolytica | cysteine protease, putative | 0.0019 | 0.0177 | 0.3237 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0029 | 0.0369 | 0.0587 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0547 | 0.1782 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0041 | 0.0597 | 0.0951 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0229 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0029 | 0.0369 | 0.0369 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0547 | 0.0547 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Leishmania major | cathepsin L-like protease | 0.0073 | 0.1203 | 0.172 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0532 | 0.0786 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Echinococcus granulosus | cathepsin l1 | 0.0013 | 0.0056 | 0.0086 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Leishmania major | cathepsin L-like protease | 0.0073 | 0.1203 | 0.172 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.6594 | 1 |
| Trypanosoma cruzi | mitochondrial DNA polymerase beta, putative | 0.034 | 0.6275 | 1 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0149 | 0.0238 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.2212 | 0.3369 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0023 | 0.0256 | 0.0392 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0532 | 1 |
| Trichomonas vaginalis | Importin beta-1 subunit, putative | 0.0027 | 0.0322 | 0.1454 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0556 | 0.0887 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.3759 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0023 | 0.0256 | 0.0392 |
| Trypanosoma cruzi | importin beta-1 subunit, putative | 0.0027 | 0.0322 | 0.0513 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0041 | 0.0597 | 0.0597 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0149 | 0.0229 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0041 | 0.0597 | 0.0886 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0149 | 0.0264 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0011 | 0.0021 | 0.0069 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0651 | 0.1038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0046 | 0.0039 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0023 | 0.0256 | 0.0392 |
| Brugia malayi | Muscleblind-like protein | 0.0171 | 0.3069 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0023 | 0.0256 | 0.036 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0149 | 0.0487 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0547 | 0.2472 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0219 | 0.0349 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0029 | 0.0369 | 0.0369 |
| Toxoplasma gondii | aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.3573 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0023 | 0.0256 | 0.0832 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Brugia malayi | nuclear receptor RXR | 0.0011 | 0.0021 | 0.0069 |
| Mycobacterium leprae | Probable lipase LipE | 0.0041 | 0.0597 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0139 | 0.2449 | 0.3733 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0013 | 0.0056 | 0.0184 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0041 | 0.0597 | 0.2699 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0041 | 0.0597 | 0.2699 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0019 | 0.0177 | 0.0045 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2212 | 0.3391 |
| Echinococcus granulosus | snurportin 1 | 0.0353 | 0.6524 | 1 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0023 | 0.0256 | 0.0392 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0023 | 0.0256 | 0.0392 |
| Echinococcus granulosus | Nuclear hormone receptor HR96 | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0348 | 0.1572 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0547 | 0.0649 |
| Loa Loa (eye worm) | GTP-binding nuclear protein RAN/TC4 | 0.0024 | 0.0275 | 0.039 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0348 | 0.0554 |
| Plasmodium vivax | vivapain-2 | 0.0019 | 0.0177 | 0.0177 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0023 | 0.0256 | 0.0832 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0041 | 0.0597 | 1 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0547 | 0.0547 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2212 | 0.3391 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0023 | 0.0256 | 0.0832 |
| Brugia malayi | ecdysone receptor | 0.0011 | 0.0021 | 0.0069 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0046 | 0.0039 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0023 | 0.0256 | 0.0392 |
| Brugia malayi | steroid hormone receptor | 0.0023 | 0.0256 | 0.0832 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.2212 | 0.3201 |
| Trypanosoma cruzi | mitochondrial DNA polymerase beta-PAK, putative | 0.0161 | 0.2871 | 0.4575 |
| Onchocerca volvulus | 0.0019 | 0.0177 | 0.2707 | |
| Trichomonas vaginalis | importin beta-1, putative | 0.0027 | 0.0322 | 0.1454 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0547 | 0.0838 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0547 | 0.0838 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0023 | 0.0256 | 0.0392 |
| Toxoplasma gondii | hypothetical protein | 0.0055 | 0.0854 | 0.1094 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0397 | 0.0578 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0149 | 0.0487 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0348 | 0.0893 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.2212 | 0.2212 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Schistosoma mansoni | ran | 0.0024 | 0.0275 | 0.0421 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0547 | 0.0809 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0149 | 0.0264 |
| Plasmodium falciparum | GTP-binding nuclear protein RAN/TC4 | 0.0024 | 0.0275 | 0.0275 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0369 | 0.0534 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0149 | 0.0487 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.2212 | 0.3391 |
| Brugia malayi | conserved hypotetical protein | 0.0011 | 0.0021 | 0.0069 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0139 | 0.2452 | 0.3759 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0023 | 0.0256 | 0.4069 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0041 | 0.0597 | 0.0915 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0023 | 0.0256 | 0.0832 |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0041 | 0.0597 | 0.0957 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0073 | 0.1203 | 0.1917 |
| Mycobacterium ulcerans | beta-lactamase | 0.0041 | 0.0597 | 0.1685 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0348 | 1 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0348 | 0.0324 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0023 | 0.0256 | 0.0392 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2212 | 0.3391 |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0019 | 0.0177 | 0.0177 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0023 | 0.0256 | 0.0832 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0547 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor-like 1 | 0.0012 | 0.0046 | 0.0039 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0179 | 0.3216 | 0.6555 |
| Trypanosoma cruzi | mitochondrial DNA polymerase beta-PAK, putative | 0.0058 | 0.0919 | 0.1465 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0149 | 0.0229 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0547 | 0.0872 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0149 | 0.0264 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0149 | 0.0238 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0041 | 0.0597 | 0.1945 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0267 | 0.0251 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0501 | 0.0769 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0675 |
| Brugia malayi | tailless protein | 0.0011 | 0.0021 | 0.0069 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0547 | 0.0547 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0348 | 0.0533 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0073 | 0.1203 | 0.1917 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0348 | 0.0533 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0556 | 0.0887 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0023 | 0.0256 | 0.0832 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0348 | 0.0308 |
| Plasmodium vivax | importin-beta 2, putative | 0.0033 | 0.0441 | 0.0441 |
| Brugia malayi | nuclear receptor NHR-67 | 0.0011 | 0.0021 | 0.0069 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0023 | 0.0256 | 0.036 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0256 | 0.036 |
| Echinococcus multilocularis | nuclear receptor subfamily 4 group A | 0.0011 | 0.0021 | 0.0032 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0019 | 0.0177 | 0.08 |
| Brugia malayi | Nuclear hormone receptor E75 | 0.0011 | 0.0021 | 0.0069 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0197 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0597 | 0.0886 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0023 | 0.0256 | 0.036 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0675 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0547 | 0.0809 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.2227 | |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0019 | 0.0177 | 0.0271 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | NOVARTIS: Antimalarial liver stage activity measured as a greater than 50% reduction in Plasmodium yoelii schizont area in HepG2-A16-CD81 cells at 10uM compound concentration, determined by immuno-fluorescence. | ChEMBL. | 22096101 | |
| CC50 (functional) | > 100 uM | Huh7 cytotoxicity for Pf inhibitors | Novartis-GNF Malaria Box. | No reference |
| CC50 | > 100 uM | NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7) | ChEMBL. | 18579783 |
| EC50 (functional) | = 947 nM | MMV: Inhibition of Plasmodium falciparum 3D7 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 0.2712 uM | W2 Pf proliferation inhibition | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.2712 uM | NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| EC50 (functional) | = 0.529 uM | PF proliferation inhibition 3D7 | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.529 uM | NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| Growth Inhibition (functional) | = -1.5746 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 825.6 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 25.398416519165 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 25.39841651916504 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IFI promiscuity index | = 0.02703 | IFI promiscuity index | Novartis-GNF Malaria Box. | No reference |
| Inhibition (functional) | = -22.4252156182134 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.98055996811062 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.980559968110615 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 LDH activity, using an LDH reporter assay. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Percent inhibition of human HepG2 cell line. Test compounds present at 10uM. | ChEMBL. | 20485427 |
| Inhibition (functional) | = 1.76 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 2.67 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 5.22 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 6.449193930011699 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 6.4491939300117 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 7.85 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 12.0956740825677 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 44.4 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 71 % | GSK_TCMDC: Inhibition of Plasmodium falciparum Dd2 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 73 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Inhibition (functional) | = 99 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 103 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 105 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition frequency index (IFI) (functional) | = 3.96 | Inhibition Frequency Index (IFI) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = -4 % | Percent inhibition of HepG2 growth (at 10 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = -1 % | Percent inhibition of P. falciparum lactate dehydrogenase activity (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 71 % | Percent inhibition of P. falciparum Dd2 growth (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 99 % | Percent inhibition of P. falciparum 3D7 growth (at 2 uM) | GSK. | 20485427 |
| Ratio (functional) | = 1.03174603174603 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.1621 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.105 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0044 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| XC50 (functional) | = 6.13 | XC50 determination of P. falciparum 3D7 growth | GSK. | 20485427 |
| XC50 (functional) | = 0.74773 uM | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole erythrocytes, using parasite LDH activity as an index of growth. | ChEMBL. | 20485427 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | 18579783 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL588732
- Search by GSK
- Search by Novartis-GNF Malaria Box
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.