Detailed information for compound 722591
Basic information
Technical information
- TDR Targets ID: 722591
- Name: 4-[(5-bromo-2-methoxyphenyl)methylamino]pheno l
- MW: 308.17 | Formula: C14H14BrNO2
-
H donors: 2
H acceptors: 1
LogP: 3.71
Rotable bonds: 4
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1CNc1ccc(cc1)O)Br
- InChi: 1S/C14H14BrNO2/c1-18-14-7-2-11(15)8-10(14)9-16-12-3-5-13(17)6-4-12/h2-8,16-17H,9H2,1H3
- InChiKey: MOTUUYZYYKGOPA-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 4-[(5-bromo-2-methoxy-phenyl)methylamino]phenol
- 4-[(5-bromo-2-methoxy-benzyl)amino]phenol
- 4-[(5-bromo-2-methoxybenzyl)amino]phenol
- MLS000064028
- SMR000075803
- ZINC00359741
- AN-465/41672872
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | muscleblind-like splicing regulator 1 | Starlite/ChEMBL | No references |
| Homo sapiens | ubiquitin specific peptidase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed) iota | Starlite/ChEMBL | No references |
| Homo sapiens | huntingtin | Starlite/ChEMBL | No references |
| Homo sapiens | Bloom syndrome, RecQ helicase-like | Starlite/ChEMBL | No references |
| Homo sapiens | thyroid hormone receptor, beta | Starlite/ChEMBL | No references |
| Homo sapiens | microtubule-associated protein tau | Starlite/ChEMBL | No references |
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
| Homo sapiens | glycoprotein hormones, alpha polypeptide | Starlite/ChEMBL | No references |
| Homo sapiens | aldehyde dehydrogenase 1 family, member A1 | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific demethylase 4E | Starlite/ChEMBL | No references |
| Homo sapiens | glucosidase, alpha | Starlite/ChEMBL | No references |
| Giardia intestinalis | Putative fructose-1,6-bisphosphate aldolase | Starlite/ChEMBL | No references |
| Homo sapiens | arachidonate 15-lipoxygenase | Starlite/ChEMBL | No references |
| Homo sapiens | tumor protein p53 | Starlite/ChEMBL | No references |
| Bacillus subtilis | 4'-phosphopantetheinyl transferase ffp | Starlite/ChEMBL | No references |
| Homo sapiens | glutaminase | Starlite/ChEMBL | No references |
| Human immunodeficiency virus 1 | Aberrant vpr protein | Starlite/ChEMBL | No references |
| Homo sapiens | tyrosyl-DNA phosphodiesterase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | euchromatic histone-lysine N-methyltransferase 2 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Echinococcus granulosus | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.0176 | 0.0171 |
| Leishmania major | aldehyde dehydrogenase, mitochondrial precursor | 0.0073 | 0.0158 | 0.7617 |
| Schistosoma mansoni | hypothetical protein | 0.0076 | 0.0164 | 0.0159 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0031 | 0.015 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0024 | 0.002 | 0.0176 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0035 | 0.005 | 0.0045 |
| Treponema pallidum | NADH oxidase | 0.0031 | 0.004 | 0.0153 |
| Loa Loa (eye worm) | TAR-binding protein | 0.0064 | 0.0131 | 0.1446 |
| Schistosoma mansoni | alpha-glucosidase | 0.0169 | 0.0428 | 0.0423 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 0.002 | 0.0176 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0038 | 0.0058 | 0.0073 |
| Brugia malayi | Muscleblind-like protein | 0.018 | 0.0459 | 0.5188 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0176 | 0.0447 | 0.0443 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0023 | 0.0017 | 0.0012 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0048 | 0.0086 | 0.0742 |
| Toxoplasma gondii | ATP-dependent Clp endopeptidase, proteolytic subunit ClpP domain-containing protein | 0.0076 | 0.0166 | 0.8091 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Echinococcus multilocularis | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.0176 | 0.0171 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0197 | 0.0505 | 0.05 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0038 | 0.0058 | 0.0053 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.009 | 0.0205 | 1 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0031 | 0.004 | 0.0397 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Brugia malayi | nuclear hormone receptor | 0.0024 | 0.002 | 0.0176 |
| Echinococcus granulosus | aldehyde dehydrogenase mitochondrial | 0.0073 | 0.0158 | 0.0153 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.009 | 0.0205 | 0.0335 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0038 | 0.0058 | 0.0053 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 0.002 | 0.0015 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0024 | 0.002 | 0.0015 |
| Mycobacterium tuberculosis | Transcriptional regulatory repressor protein (TetR-family) EthR | 0.2022 | 0.5634 | 1 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0026 | 0.0024 | 0.0075 |
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.0031 | 0.004 | 0.0035 |
| Loa Loa (eye worm) | beta-lactamase | 0.0038 | 0.0058 | 0.0611 |
| Loa Loa (eye worm) | hypothetical protein | 0.0048 | 0.0086 | 0.0926 |
| Loa Loa (eye worm) | RecQ helicase | 0.0026 | 0.0024 | 0.0219 |
| Mycobacterium tuberculosis | Probable ATP-dependent CLP protease proteolytic subunit 2 ClpP2 (endopeptidase CLP 2) | 0.005 | 0.0092 | 0.0134 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0035 | 0.005 | 0.0515 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0038 | 0.0058 | 0.0445 |
| Treponema pallidum | fructose-bisphosphate aldolase | 0.0353 | 0.0944 | 1 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0024 | 0.002 | 0.0015 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0036 | 0.0053 | 0.0048 |
| Loa Loa (eye worm) | hypothetical protein | 0.0148 | 0.0367 | 0.4146 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0035 | 0.005 | 0.0515 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0038 | 0.0058 | 0.2664 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 0.002 | 0.0015 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.0459 | 0.5188 |
| Echinococcus multilocularis | microtubule associated protein 2 | 0.3575 | 1 | 1 |
| Brugia malayi | hypothetical protein | 0.0148 | 0.0367 | 0.4146 |
| Schistosoma mansoni | ubiquitin-specific peptidase 2 (C19 family) | 0.0048 | 0.0086 | 0.0081 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0024 | 0.002 | 0.0015 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0074 | 0.0617 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.009 | 0.0205 | 0.2295 |
| Brugia malayi | Doublecortin family protein | 0.0024 | 0.0019 | 0.0157 |
| Trichomonas vaginalis | maltase-glucoamylase, putative | 0.0044 | 0.0074 | 0.0617 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0024 | 0.002 | 0.0015 |
| Plasmodium falciparum | ADP-dependent DNA helicase RecQ | 0.0023 | 0.0015 | 0.0518 |
| Echinococcus multilocularis | lipoxygenase domain containing protein | 0.0024 | 0.0019 | 0.0014 |
| Echinococcus multilocularis | dna polymerase kappa | 0.0023 | 0.0017 | 0.0012 |
| Schistosoma mansoni | cellular tumor antigen P53 | 0.0154 | 0.0384 | 0.038 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0024 | 0.002 | 0.0176 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0023 | 0.0017 | 0.0012 |
| Echinococcus granulosus | dna polymerase eta | 0.0023 | 0.0017 | 0.0012 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, mitochondrial, putative | 0.0031 | 0.004 | 0.1904 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0024 | 0.002 | 0.0015 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0076 | 0.0164 | 0.1819 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0091 | 0.0207 | 0.0202 |
| Brugia malayi | jmjC domain containing protein | 0.0071 | 0.0151 | 0.1674 |
| Schistosoma mansoni | DNA polymerase eta | 0.0023 | 0.0017 | 0.0012 |
| Plasmodium falciparum | thioredoxin reductase | 0.009 | 0.0205 | 1 |
| Entamoeba histolytica | tyrosyl-DNA phosphodiesterase, putative | 0.008 | 0.0176 | 0.1711 |
| Schistosoma mansoni | hypothetical protein | 0.0024 | 0.0019 | 0.0014 |
| Entamoeba histolytica | fructose-1,6-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0243 | 0.0633 | 0.1097 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0197 | 0.0505 | 0.5714 |
| Trypanosoma brucei | dihydrolipoyl dehydrogenase | 0.0031 | 0.004 | 0.1732 |
| Schistosoma mansoni | loxhd1 | 0.0024 | 0.0019 | 0.0014 |
| Schistosoma mansoni | dihydrolipoamide dehydrogenase | 0.0031 | 0.004 | 0.0035 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0023 | 0.0017 | 0.0611 |
| Onchocerca volvulus | 0.0154 | 0.0384 | 0.4962 | |
| Trichomonas vaginalis | esterase, putative | 0.0038 | 0.0058 | 0.0445 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0038 | 0.0058 | 0.0073 |
| Mycobacterium ulcerans | flavoprotein disulfide reductase | 0.0031 | 0.004 | 0.004 |
| Plasmodium falciparum | LCCL domain-containing protein | 0.0024 | 0.0019 | 0.0682 |
| Onchocerca volvulus | 0.0036 | 0.0053 | 0.0467 | |
| Mycobacterium tuberculosis | Dihydrolipoamide dehydrogenase LpdC (lipoamide reductase (NADH)) (lipoyl dehydrogenase) (dihydrolipoyl dehydrogenase) (diaphoras | 0.0229 | 0.0595 | 0.1029 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0024 | 0.002 | 0.0015 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0035 | 0.005 | 0.0045 |
| Echinococcus granulosus | muscleblind protein | 0.018 | 0.0459 | 0.0454 |
| Mycobacterium ulcerans | fructose-bisphosphate aldolase | 0.0172 | 0.0436 | 0.0745 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.005 | 0.0515 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.0036 | 0.0053 | 0.2575 |
| Onchocerca volvulus | 0.0024 | 0.002 | 0.0023 | |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0035 | 0.005 | 0.0045 |
| Brugia malayi | hypothetical protein | 0.0025 | 0.0023 | 0.0209 |
| Toxoplasma gondii | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0074 | 0.3616 |
| Mycobacterium ulcerans | AcrR family transcriptional regulator | 0.2026 | 0.5645 | 1 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0028 | 0.0031 | 0.1302 |
| Mycobacterium tuberculosis | NAD(P)H quinone reductase LpdA | 0.0229 | 0.0595 | 0.1029 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.0017 | 0.0611 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase, dimerisation domain containing protein | 0.0023 | 0.0016 | 0.013 |
| Schistosoma mansoni | lipoxygenase | 0.0024 | 0.0019 | 0.0014 |
| Loa Loa (eye worm) | glutathione reductase | 0.009 | 0.0205 | 0.2295 |
| Onchocerca volvulus | 0.0038 | 0.0058 | 0.054 | |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0024 | 0.002 | 0.0176 |
| Brugia malayi | Thioredoxin reductase | 0.009 | 0.0205 | 0.2295 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0035 | 0.0049 | 0.0044 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0058 | 0.0611 |
| Echinococcus granulosus | bloom syndrome protein | 0.0026 | 0.0024 | 0.0019 |
| Plasmodium falciparum | thioredoxin reductase | 0.0031 | 0.004 | 0.1732 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0044 | 0.0074 | 0.0617 |
| Echinococcus multilocularis | tumor protein p63 | 0.1052 | 0.2907 | 0.2904 |
| Mycobacterium tuberculosis | Probable NADH dehydrogenase Ndh | 0.0206 | 0.0531 | 0.0914 |
| Loa Loa (eye worm) | hypothetical protein | 0.01 | 0.0234 | 0.2618 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0038 | 0.0058 | 0.0445 |
| Treponema pallidum | 4'-phosphopantetheinyl transferase | 0.0028 | 0.0031 | 0.0059 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.0036 | 0.0053 | 0.0048 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0024 | 0.002 | 0.0176 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0036 | 0.0053 | 0.0048 |
| Trichomonas vaginalis | set domain proteins, putative | 0.0286 | 0.0756 | 0.7971 |
| Trichomonas vaginalis | mercuric reductase, putative | 0.0031 | 0.004 | 0.0243 |
| Mycobacterium tuberculosis | Probable aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.025 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0024 | 0.002 | 0.0176 |
| Mycobacterium ulcerans | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 0.0265 |
| Onchocerca volvulus | 0.0038 | 0.0058 | 0.054 | |
| Trichomonas vaginalis | DNA helicase recq1, putative | 0.0026 | 0.0024 | 0.0075 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0036 | 0.0053 | 0.0048 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0031 | 0.004 | 0.1732 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0074 | 0.0617 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0058 | 0.0611 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0023 | 0.0017 | 0.0611 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0176 | 0.8512 |
| Echinococcus granulosus | GPCR family 2 | 0.0035 | 0.005 | 0.0045 |
| Echinococcus granulosus | transcription factor Dp 1 | 0.0046 | 0.0081 | 0.0076 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0038 | 0.0058 | 0.2664 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.005 | 0.0045 |
| Trypanosoma brucei | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0176 | 0.8512 |
| Leishmania major | tyrosyl-DNA phosphodiesterase 1 | 0.008 | 0.0176 | 0.8512 |
| Schistosoma mansoni | glutaminase | 0.033 | 0.0879 | 0.0875 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.025 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0038 | 0.0058 | 0.2817 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.0017 | 0.014 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0071 | 0.0151 | 0.0146 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0024 | 0.002 | 0.0015 |
| Mycobacterium ulcerans | lipase LipD | 0.0038 | 0.0058 | 0.0073 |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0038 | 0.0058 | 0.0611 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0038 | 0.0058 | 0.0053 |
| Echinococcus multilocularis | RUN | 0.0024 | 0.0019 | 0.0014 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.0153 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0023 | 0.0017 | 0.014 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0044 | 0.0074 | 0.3462 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0197 | 0.0505 | 0.05 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 0.002 | 0.0015 |
| Schistosoma mansoni | microtubule-associated protein tau | 0.3575 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0058 | 0.0611 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0064 | 0.0131 | 0.1446 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0122 | 0.0294 | 0.3304 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0023 | 0.0017 | 0.0012 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0024 | 0.002 | 0.0015 |
| Loa Loa (eye worm) | hypothetical protein | 0.0076 | 0.0166 | 0.1846 |
| Trypanosoma cruzi | ubiquitin carboxyl-terminal hydrolase, putative | 0.0048 | 0.0086 | 0.4036 |
| Treponema pallidum | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 0.1533 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0024 | 0.002 | 0.0015 |
| Echinococcus granulosus | Peptidase C19 ubiquitin carboxyl terminal hydrolase 2 | 0.0048 | 0.0086 | 0.0081 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0197 | 0.0505 | 0.5714 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0025 | 0.0023 | 0.0911 |
| Brugia malayi | hypothetical protein | 0.0024 | 0.0019 | 0.0157 |
| Leishmania major | alpha glucosidase II subunit, putative | 0.0044 | 0.0074 | 0.3462 |
| Chlamydia trachomatis | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 1 |
| Echinococcus multilocularis | ubiquitin carboxyl terminal hydrolase 8 | 0.0048 | 0.0086 | 0.0081 |
| Echinococcus multilocularis | Peptidase C19, ubiquitin carboxyl terminal hydrolase 2 | 0.0048 | 0.0086 | 0.0081 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0074 | 0.0617 |
| Leishmania major | acetoin dehydrogenase e3 component-like protein | 0.0031 | 0.004 | 0.1732 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0038 | 0.0058 | 0.0073 |
| Mycobacterium tuberculosis | Putative ferredoxin reductase | 0.0206 | 0.0531 | 0.0914 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase | 0.0031 | 0.004 | 0.004 |
| Trichomonas vaginalis | Clan CA, family C19, ubiquitin hydrolase-like cysteine peptidase | 0.0048 | 0.0086 | 0.0742 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.005 | 0.0045 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.0017 | 0.0611 |
| Mycobacterium tuberculosis | Probable nitrite reductase [NAD(P)H] large subunit [FAD flavoprotein] NirB | 0.0206 | 0.0531 | 0.0914 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Brugia malayi | Tyrosyl-DNA phosphodiesterase family protein | 0.008 | 0.0176 | 0.1953 |
| Echinococcus multilocularis | lipoxygenase domain containing protein | 0.0024 | 0.0019 | 0.0014 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Echinococcus multilocularis | Polycystic kidney disease protein | 0.0024 | 0.0019 | 0.0014 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.0153 |
| Schistosoma mansoni | coup transcription factor | 0.0024 | 0.002 | 0.0015 |
| Plasmodium vivax | holo-[acyl-carrier-protein] synthase, putative | 0.0028 | 0.0031 | 0.1483 |
| Toxoplasma gondii | thioredoxin reductase | 0.009 | 0.0205 | 1 |
| Brugia malayi | Ubiquitin carboxyl-terminal hydrolase family protein | 0.0048 | 0.0086 | 0.0926 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0024 | 0.002 | 0.0176 |
| Plasmodium vivax | JmjC domain containing protein | 0.0019 | 0.0005 | 0.0208 |
| Loa Loa (eye worm) | doublecortin family protein | 0.0024 | 0.0019 | 0.0157 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0044 | 0.0074 | 0.0794 |
| Plasmodium falciparum | glutathione reductase | 0.009 | 0.0205 | 1 |
| Brugia malayi | aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase | 0.01 | 0.0234 | 0.2618 |
| Echinococcus granulosus | tumor protein p63 | 0.1052 | 0.2907 | 0.2904 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0024 | 0.002 | 0.0015 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0111 | 0.0262 | 0.2943 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0024 | 0.002 | 0.0015 |
| Mycobacterium leprae | PROBABLE ATP-DEPENDENT CLP PROTEASE PROTEOLYTIC SUBUNIT 1 CLPP1 (ENDOPEPTIDASE CLP) | 0.005 | 0.0092 | 0.0119 |
| Mycobacterium tuberculosis | Probable reductase | 0.0206 | 0.0531 | 0.0914 |
| Onchocerca volvulus | Huntingtin homolog | 0.0148 | 0.0367 | 0.4734 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0071 | 0.0151 | 0.0146 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Onchocerca volvulus | Huntingtin homolog | 0.0148 | 0.0367 | 0.4734 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0058 | 0.0611 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0038 | 0.0058 | 0.0073 |
| Trypanosoma brucei | glucosidase, putative | 0.0044 | 0.0074 | 0.3462 |
| Mycobacterium tuberculosis | holo-[acyl-carrier protein] synthase AcpS (holo-ACP synthase) (CoA:APO-[ACP]pantetheinephosphotransferase) (CoA:APO-[acyl-carrie | 0.0028 | 0.0031 | 0.0025 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0038 | 0.0058 | 0.0073 |
| Echinococcus multilocularis | arachidonate 5 lipoxygenase | 0.0067 | 0.0139 | 0.0134 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Trypanosoma brucei | trypanothione reductase | 0.009 | 0.0205 | 1 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0025 | 0.0023 | 0.0911 |
| Loa Loa (eye worm) | hypothetical protein | 0.0154 | 0.0384 | 0.4338 |
| Echinococcus granulosus | peptidase Clp S14 family | 0.005 | 0.0092 | 0.0088 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Leishmania major | DNA polymerase eta, putative | 0.0023 | 0.0017 | 0.0611 |
| Trichomonas vaginalis | sucrase-isomaltase, putative | 0.0044 | 0.0074 | 0.0617 |
| Trypanosoma brucei | ubiquitin carboxyl-terminal hydrolase, putative | 0.0048 | 0.0086 | 0.4036 |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0038 | 0.0058 | 0.0073 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.0131 | 0.0127 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0038 | 0.0058 | 0.0073 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0025 | 0.0023 | 0.11 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0017 | 0.014 |
| Schistosoma mansoni | ubiquitin-specific peptidase 8 (C19 family) | 0.0048 | 0.0086 | 0.0081 |
| Plasmodium vivax | ATP-dependent Clp protease proteolytic subunit, putative | 0.0076 | 0.0166 | 0.8086 |
| Leishmania major | ubiquitin hydrolase, putative,cysteine peptidase, Clan CA, family C19, putative | 0.0048 | 0.0086 | 0.4036 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0024 | 0.002 | 0.0176 |
| Brugia malayi | alpha keto acid dehydrogenase complex, E3 component, lipoamide dehydrogenase | 0.0023 | 0.0016 | 0.013 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0038 | 0.0058 | 0.0445 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0023 | 0.0017 | 0.0012 |
| Plasmodium falciparum | glutathione reductase | 0.0031 | 0.004 | 0.1732 |
| Brugia malayi | beta-lactamase family protein | 0.0038 | 0.0058 | 0.0611 |
| Toxoplasma gondii | ATP-dependent Clp endopeptidase, proteolytic subunit ClpP domain-containing protein | 0.0076 | 0.0166 | 0.8091 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0024 | 0.002 | 0.0015 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.0031 | 0.004 | 0.0035 |
| Echinococcus multilocularis | ATP dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 0.0162 |
| Mycobacterium tuberculosis | Probable soluble pyridine nucleotide transhydrogenase SthA (STH) (NAD(P)(+) transhydrogenase [B-specific]) (nicotinamide nucleot | 0.0031 | 0.004 | 0.004 |
| Brugia malayi | hypothetical protein | 0.0024 | 0.0019 | 0.0157 |
| Mycobacterium leprae | Probable lipase LipE | 0.0038 | 0.0058 | 0.0058 |
| Mycobacterium tuberculosis | Conserved protein | 0.0038 | 0.0058 | 0.0073 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0044 | 0.0074 | 0.0794 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0064 | 0.0131 | 0.0127 |
| Schistosoma mansoni | tyrosyl-DNA phosphodiesterase | 0.008 | 0.0176 | 0.0171 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0023 | 0.0017 | 0.0611 |
| Trichomonas vaginalis | Clan CA, family C19, ubiquitin hydrolase-like cysteine peptidase | 0.0048 | 0.0086 | 0.0742 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0024 | 0.002 | 0.0015 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0111 | 0.0262 | 0.2943 |
| Mycobacterium tuberculosis | Probable ATP-dependent CLP protease proteolytic subunit 1 ClpP1 (endopeptidase CLP) | 0.005 | 0.0092 | 0.0134 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0038 | 0.0058 | 0.0611 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0019 | 0.0157 |
| Echinococcus multilocularis | bloom syndrome protein | 0.0026 | 0.0024 | 0.0019 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0024 | 0.002 | 0.0015 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Echinococcus granulosus | tar DNA binding protein | 0.0064 | 0.0131 | 0.0127 |
| Echinococcus granulosus | ubiquitin carboxyl terminal hydrolase 8 | 0.0048 | 0.0086 | 0.0081 |
| Echinococcus granulosus | ubiquitin specific protease 41 | 0.0048 | 0.0086 | 0.0081 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0031 | 0.004 | 0.0637 |
| Mycobacterium ulcerans | hypothetical protein | 0.0038 | 0.0058 | 0.0073 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0038 | 0.0058 | 0.0445 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0024 | 0.002 | 0.0015 |
| Leishmania major | 2-oxoglutarate dehydrogenase, e3 component, lipoamidedehydrogenase-like protein | 0.0031 | 0.004 | 0.1732 |
| Echinococcus granulosus | ATP dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 0.0162 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Echinococcus granulosus | Polycystic kidney disease protein | 0.0024 | 0.0019 | 0.0014 |
| Giardia lamblia | NADH oxidase lateral transfer candidate | 0.0031 | 0.004 | 0.0243 |
| Brugia malayi | ecdysteroid receptor | 0.0024 | 0.002 | 0.0176 |
| Echinococcus granulosus | neutral alpha glucosidase AB | 0.0044 | 0.0074 | 0.007 |
| Echinococcus granulosus | L aminoadipate semialdehyde | 0.01 | 0.0234 | 0.0229 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0206 | 0.0531 | 0.0914 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Onchocerca volvulus | 0.01 | 0.0234 | 0.2921 | |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0031 | 0.004 | 0.1732 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Toxoplasma gondii | NADPH-glutathione reductase | 0.0031 | 0.004 | 0.1927 |
| Mycobacterium ulcerans | beta-lactamase | 0.0038 | 0.0058 | 0.0073 |
| Schistosoma mansoni | aminoadipate-semialdehyde dehydrogenase | 0.01 | 0.0234 | 0.0229 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0071 | 0.0151 | 0.0146 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0038 | 0.0058 | 0.0058 |
| Giardia lamblia | Ubiquitin carboxyl-terminal hydrolase 4 | 0.0048 | 0.0086 | 0.0742 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 0.002 | 0.0176 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase, point mutation | 0.0031 | 0.004 | 0.1732 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0038 | 0.0058 | 0.2664 |
| Brugia malayi | Probable ClpP-like protease | 0.0076 | 0.0166 | 0.1846 |
| Trypanosoma brucei | unspecified product | 0.0023 | 0.0017 | 0.0611 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.018 | 0.0459 | 0.0454 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Onchocerca volvulus | 0.0114 | 0.0271 | 0.3431 | |
| Plasmodium vivax | ATP-dependent Clp protease proteolytic subunit, putative | 0.0026 | 0.0026 | 0.122 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0122 | 0.0294 | 0.3304 |
| Echinococcus multilocularis | dna polymerase eta | 0.0023 | 0.0017 | 0.0012 |
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.0036 | 0.0053 | 0.0048 |
| Echinococcus granulosus | lipoxygenase domain containing protein | 0.0024 | 0.0019 | 0.0014 |
| Chlamydia trachomatis | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 1 |
| Plasmodium vivax | SET domain protein, putative | 0.0036 | 0.0053 | 0.2554 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0229 | 0.0595 | 0.1029 |
| Plasmodium falciparum | holo-[acyl-carrier-protein] synthase, putative | 0.0028 | 0.0031 | 0.1302 |
| Giardia lamblia | Fructose-bisphosphate aldolase | 0.0353 | 0.0944 | 1 |
| Echinococcus multilocularis | muscleblind protein | 0.018 | 0.0459 | 0.0454 |
| Plasmodium falciparum | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 0.8045 |
| Mycobacterium ulcerans | glutaminase | 0.033 | 0.0879 | 0.1532 |
| Echinococcus multilocularis | L aminoadipate semialdehyde | 0.01 | 0.0234 | 0.0229 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.009 | 0.0205 | 1 |
| Brugia malayi | MH2 domain containing protein | 0.0122 | 0.0294 | 0.3304 |
| Mycobacterium leprae | PROBABLE NADH DEHYDROGENASE NDH | 0.0206 | 0.0531 | 0.0899 |
| Wolbachia endosymbiont of Brugia malayi | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 1 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0038 | 0.0058 | 0.0053 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Brugia malayi | glutathione reductase | 0.009 | 0.0205 | 0.2295 |
| Schistosoma mansoni | alpha glucosidase | 0.0044 | 0.0074 | 0.007 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | 0.0031 | 0.004 | 0.1732 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0024 | 0.002 | 0.0015 |
| Loa Loa (eye worm) | hypothetical protein | 0.0076 | 0.0164 | 0.1819 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.0131 | 0.0127 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0024 | 0.002 | 0.0015 |
| Leishmania major | phosphopantetheinyl transferase-like protein | 0.0028 | 0.0031 | 0.1302 |
| Echinococcus multilocularis | peptidase Clp (S14 family) | 0.005 | 0.0092 | 0.0088 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.0131 | 0.0127 |
| Echinococcus granulosus | arachidonate 5 lipoxygenase | 0.0067 | 0.0139 | 0.0134 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0035 | 0.005 | 0.0515 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 0.002 | 0.0176 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 0.002 | 0.0015 |
| Leishmania major | hypothetical protein, conserved | 0.0025 | 0.0023 | 0.0911 |
| Onchocerca volvulus | 0.0286 | 0.0756 | 1 | |
| Schistosoma mansoni | polycystin 1-related | 0.0024 | 0.0019 | 0.0014 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.0131 | 0.0127 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0024 | 0.002 | 0.0176 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0024 | 0.002 | 0.0015 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, apicoplast, putative | 0.0031 | 0.004 | 0.1904 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Schistosoma mansoni | rab6-interacting | 0.0024 | 0.0019 | 0.0014 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0025 | 0.0023 | 0.0911 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0024 | 0.002 | 0.0015 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0176 | 0.0447 | 0.0443 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0071 | 0.0151 | 0.0146 |
| Schistosoma mansoni | alpha-glucosidase | 0.0169 | 0.0428 | 0.0423 |
| Plasmodium vivax | glutathione reductase, putative | 0.009 | 0.0205 | 1 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0031 | 0.004 | 0.1732 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0074 | 0.0617 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0024 | 0.002 | 0.0015 |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0038 | 0.0058 | 0.0073 |
| Toxoplasma gondii | aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.7673 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.0024 | 0.002 | 0.0023 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0024 | 0.002 | 0.0176 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0024 | 0.002 | 0.0015 |
| Brugia malayi | Pre-SET motif family protein | 0.0251 | 0.0658 | 0.7468 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0023 | 0.0017 | 0.014 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0038 | 0.0058 | 0.0445 |
| Plasmodium vivax | multidomain scavenger receptor, putative | 0.0024 | 0.0019 | 0.0876 |
| Brugia malayi | RNA binding protein | 0.0064 | 0.0131 | 0.1446 |
| Loa Loa (eye worm) | RNA binding protein | 0.0064 | 0.0131 | 0.1446 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Echinococcus multilocularis | transcription factor Dp 1 | 0.0046 | 0.0081 | 0.0076 |
| Mycobacterium ulcerans | TetR family transcriptional regulator | 0.2026 | 0.5645 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 0.002 | 0.0176 |
| Toxoplasma gondii | 4'-phosphopantetheinyl transferase superfamily protein | 0.0028 | 0.0031 | 0.1507 |
| Loa Loa (eye worm) | hypothetical protein | 0.0111 | 0.0262 | 0.2943 |
| Echinococcus multilocularis | ubiquitin specific protease 41 | 0.0048 | 0.0086 | 0.0081 |
| Mycobacterium ulcerans | 4'-phosphopantetheinyl transferase | 0.0028 | 0.0031 | 0.0025 |
| Brugia malayi | Pre-SET motif family protein | 0.0036 | 0.0053 | 0.055 |
| Brugia malayi | beta-lactamase | 0.0038 | 0.0058 | 0.0611 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0024 | 0.002 | 0.0176 |
| Schistosoma mansoni | peptidase Clp (S14 family) | 0.0076 | 0.0166 | 0.0162 |
| Entamoeba histolytica | ubiquitin carboxyl-terminal hydrolase domain containing protein | 0.0048 | 0.0086 | 0.0742 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0064 | 0.0131 | 0.0127 |
| Toxoplasma gondii | 4'-phosphopantetheinyl transferase domain-containing protein | 0.0028 | 0.0031 | 0.1507 |
| Loa Loa (eye worm) | hypothetical protein | 0.0025 | 0.0023 | 0.0209 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0038 | 0.0058 | 0.0073 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.0024 | 0.002 | 0.0023 |
| Chlamydia trachomatis | dihydrolipoyl dehydrogenase | 0.0031 | 0.004 | 0.0637 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0028 | 0.0031 | 0.001 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0024 | 0.002 | 0.0176 |
| Plasmodium falciparum | ATP-dependent Clp protease proteolytic subunit | 0.0026 | 0.0026 | 0.1033 |
| Mycobacterium tuberculosis | Probable membrane NADH dehydrogenase NdhA | 0.0206 | 0.0531 | 0.0914 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase, LpdB | 0.0031 | 0.004 | 0.004 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0024 | 0.002 | 0.0015 |
| Mycobacterium tuberculosis | Conserved protein | 0.0038 | 0.0058 | 0.0073 |
| Toxoplasma gondii | histone lysine demethylase JMJD6a | 0.0019 | 0.0005 | 0.0236 |
| Mycobacterium tuberculosis | Probable fructose-bisphosphate aldolase Fba | 0.0172 | 0.0436 | 0.0746 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0025 | 0.0023 | 0.0911 |
| Leishmania major | trypanothione reductase | 0.009 | 0.0205 | 1 |
| Toxoplasma gondii | pyruvate dehydrogenase complex subunit PDH-E3II | 0.0031 | 0.004 | 0.1927 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0152 | 0.0379 | 0.0374 |
| Brugia malayi | steroid hormone receptor | 0.0024 | 0.002 | 0.0176 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0044 | 0.0074 | 0.3462 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0176 | 0.8512 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0035 | 0.005 | 0.0045 |
| Loa Loa (eye worm) | tyrosyl-DNA phosphodiesterase | 0.008 | 0.0176 | 0.1953 |
| Loa Loa (eye worm) | glutaminase | 0.033 | 0.0879 | 1 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0074 | 0.0617 |
| Leishmania major | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Brugia malayi | glutaminase DH11.1 | 0.033 | 0.0879 | 1 |
| Trypanosoma cruzi | ubiquitin carboxyl-terminal hydrolase, putative | 0.0048 | 0.0086 | 0.4036 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.025 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0019 | 0.0157 |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0229 | 0.0595 | 0.1014 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0009 | 0.0052 |
| Echinococcus granulosus | lipoxygenase domain containing protein | 0.0024 | 0.0019 | 0.0014 |
| Mycobacterium leprae | Probable fructose bisphosphate aldolase Fba | 0.0172 | 0.0436 | 0.0731 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0024 | 0.002 | 0.0176 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0025 | 0.0023 | 0.1125 |
| Mycobacterium leprae | PROBABLE ATP-DEPENDENT CLP PROTEASE PROTEOLYTIC SUBUNIT 2 CLPP2 (ENDOPEPTIDASE CLP 2) | 0.0076 | 0.0166 | 0.025 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, mitochondrial | 0.0031 | 0.004 | 0.1732 |
| Schistosoma mansoni | rab6-interacting | 0.0024 | 0.0019 | 0.0014 |
| Schistosoma mansoni | lipoxygenase | 0.0067 | 0.0139 | 0.0134 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.005 | 0.0045 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 0.002 | 0.0176 |
| Mycobacterium ulcerans | ATP-dependent Clp protease proteolytic subunit | 0.0076 | 0.0166 | 0.0265 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0024 | 0.002 | 0.0176 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.0073 | 0.0158 | 0.025 |
| Mycobacterium ulcerans | phosphopantetheinyl transferase, PptII | 0.0028 | 0.0031 | 0.0025 |
| Toxoplasma gondii | hypothetical protein | 0.0026 | 0.0026 | 0.1244 |
| Entamoeba histolytica | fructose-1,6-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0031 | 0.004 | 0.0637 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.0024 | 0.002 | 0.0023 |
| Brugia malayi | Bloom's syndrome protein homolog | 0.0026 | 0.0024 | 0.0219 |
| Mycobacterium ulcerans | transcriptional regulator | 0.2026 | 0.5645 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0058 | 0.0611 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0024 | 0.002 | 0.0176 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 0.002 | 0.0176 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0058 | 0.0611 |
| Mycobacterium leprae | Probable transcriptional regulatory repressor protein (TetR-family) EthR | 0.2026 | 0.5645 | 1 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0023 | 0.0017 | 0.0611 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0025 | 0.0023 | 0.0911 |
| Echinococcus granulosus | Mitotic checkpoint protein PRCC C terminal | 0.0152 | 0.0379 | 0.0374 |
| Trichomonas vaginalis | glutathione reductase, putative | 0.0031 | 0.004 | 0.0243 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0044 | 0.0074 | 0.0617 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0044 | 0.0074 | 0.0617 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0036 | 0.0053 | 0.0048 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0071 | 0.0151 | 0.0146 |
| Onchocerca volvulus | 0.0038 | 0.0058 | 0.054 | |
| Leishmania major | hypothetical protein, conserved | 0.0038 | 0.0058 | 0.2664 |
| Echinococcus granulosus | RUN | 0.0024 | 0.0019 | 0.0014 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Brugia malayi | jmjC domain containing protein | 0.0071 | 0.0151 | 0.1674 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0091 | 0.0207 | 0.0202 |
| Brugia malayi | TAR-binding protein | 0.0064 | 0.0131 | 0.1446 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0044 | 0.0074 | 0.0617 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0024 | 0.002 | 0.0176 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0031 | 0.004 | 0.1732 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Toxoplasma gondii | ABC1 family protein | 0.0038 | 0.0058 | 0.2837 |
| Echinococcus granulosus | lysosomal alpha glucosidase | 0.0197 | 0.0505 | 0.05 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0071 | 0.0151 | 0.0146 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0251 | 0.0658 | 0.7468 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.0459 | 0.5188 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0053 | 0.055 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0071 | 0.0151 | 0.0146 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0176 | 0.0447 | 0.0443 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0024 | 0.002 | 0.0176 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0023 | 0.0017 | 0.0611 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0024 | 0.002 | 0.0015 |
| Echinococcus granulosus | dna polymerase kappa | 0.0023 | 0.0017 | 0.0012 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0024 | 0.002 | 0.0176 |
| Loa Loa (eye worm) | hypothetical protein | 0.0148 | 0.0367 | 0.4146 |
| Trichomonas vaginalis | glutaminase, putative | 0.033 | 0.0879 | 0.9307 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0036 | 0.0053 | 0.0048 |
| Mycobacterium tuberculosis | Conserved protein | 0.0038 | 0.0058 | 0.0073 |
| Loa Loa (eye worm) | glutaminase 2 | 0.033 | 0.0879 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.005 | 0.0045 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0035 | 0.005 | 0.0045 |
| Echinococcus multilocularis | Mitotic checkpoint protein PRCC, C terminal | 0.0152 | 0.0379 | 0.0374 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.002 | 0.0176 |
| Echinococcus multilocularis | aldehyde dehydrogenase, mitochondrial | 0.0073 | 0.0158 | 0.0153 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0071 | 0.0151 | 0.1674 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0024 | 0.002 | 0.0176 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0024 | 0.002 | 0.0176 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0111 | 0.0262 | 0.2943 |
| Echinococcus multilocularis | neutral alpha glucosidase AB | 0.0044 | 0.0074 | 0.007 |
| Brugia malayi | beta-lactamase family protein | 0.0038 | 0.0058 | 0.0611 |
| Toxoplasma gondii | histone lysine demethylase JMJC1/KDM5D/JARID1D | 0.0019 | 0.0005 | 0.0236 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0353 | 0.0944 | 1 |
| Schistosoma mansoni | blooms syndrome DNA helicase | 0.002 | 0.0009 | 0.0004 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0064 | 0.0131 | 0.1446 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| IC50 (functional) | 26.79 uM | PubChem BioAssay. Discovery of small molecule inhibitors of the oncogenic and cytokinetic protein MgcRacGAP - Primary and Confirmatory Screens. (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (functional) | 46.688 uM | PubChem BioAssay. An HIV-1 Tat-TAR Fluorescence Polarization (FP) Counter Screen to evaluate Inhibitors Targeting HIV-1 Vif-dependent Degradation of Human APOBEC3G. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 1.7783 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Human Jumonji Domain Containing 2E (JMJD2E). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 1.7783 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | 2.8184 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (functional) | = 3.1623 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of 15-hLO (15-human lipoxygenase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 3.1699 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a: Hit Confirmation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504404] | ChEMBL. | No reference |
| Potency (functional) | = 7.8826 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Activators of Human alpha-Glucosidase Cleavage of Glycogen. (Class of assay: confirmatory) [Related pubchem assays: 1473, 1466 ] | ChEMBL. | No reference |
| Potency (functional) | = 8.9125 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 8.9125 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 10 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1). (Class of assay: confirmatory) [Related pubchem assays: 1030 (qHTS Validation Assay for Inhibitors of aldehyde dehydrogenase 1 (ALDH1A1))] | ChEMBL. | No reference |
| Potency (functional) | = 11.2202 um | PUBCHEM_BIOASSAY: Counterscreen qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. This assay monitors tau fibrillation by fluorescence polarization (FP) of Alexa 594-labeled K18 P301L, which does not fibrillize readily but incorporates into growing filaments of unlabeled tau. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Ubiquitin-specific Protease USP2a. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 12.5893 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 14.1254 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the HIV-1 protein Vpr. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 15.8114 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Fructose-1,6-bisphosphate Aldolase from Giardia Lamblia. (Class of assay: confirmatory) [Related pubchem assays: 2472, 2464 ] | ChEMBL. | No reference |
| Potency (functional) | = 15.8489 um | PUBCHEM_BIOASSAY: qHTS Multiplex Assay to Identify Dual Action Probes in a Cell Model of Huntington: Aggregate Formation (GFP). (Class of assay: confirmatory) [Related pubchem assays: 1482, 1471 ] | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PubChem BioAssay. qHTS for Activators of Integrin-Mediated Alleviation for Muscular Dystrophy. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | 15.8489 uM | PubChem BioAssay. qHTS Assay for Inhibitors of MBNL1-poly(CUG) RNA binding. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | = 17.7828 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Tyrosyl-DNA Phosphodiesterase (TDP1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 17.7828 uM | PUBCHEM_BIOASSAY: qHTS assay for re-activators of p53 using a Luc reporter. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504709] | ChEMBL. | No reference |
| Potency (functional) | 18.526 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | = 19.9526 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 19.9526 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bloom's syndrome helicase (BLM). (Class of assay: confirmatory) [Related pubchem assays: 593 (Fluorescein region spectral profiling screen), 2386 (Probe Development Summary for Inhibitors of Bloom's syndrome helicase (BLM)), 594 (Rhodamine region spectral profiling screen), 2364 (qHTS Validation Assay for Inhibitors of Bloom's syndrome helicase (BLM))] | ChEMBL. | No reference |
| Potency (functional) | 19.9526 uM | PubChem BioAssay. qHTS for Inhibitors of Glutaminase (GLS). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 20.5962 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in MCF 10a normal breast cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 22.3872 um | PUBCHEM_BIOASSAY: VP16 counterscreen qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 22.3872 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of L3MBTL1. (Class of assay: confirmatory) [Related pubchem assays: 485292 (Probe Development Summary for Inhibitors of L3MBTL1)] | ChEMBL. | No reference |
| Potency (functional) | 23.1093 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493107, AID493125] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Tau Fibril Formation, Fluorescence Polarization. (Class of assay: confirmatory) [Related pubchem assays: 596 ] | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors Targeting the Menin-MLL Interaction in MLL Related Leukemias: Competition With Texas Red Labeled MLL-derived Mutant Peptide. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HADH2 (Hydroxyacyl-Coenzyme A Dehydrogenase, Type II). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 25.1189 um | PUBCHEM_BIOASSAY: qHTS Assay for Allosteric/Competitive Inhibitors of Caspase-1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 25.1189 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors and Activators of N370S glucocerebrosidase as a Potential Chaperone Treatment of Gaucher Disease. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID1473, AID2293, AID2577, AID2578, AID2587, AID2588, AID2589, AID2590, AID2592, AID2593, AID2595, AID2596, AID2597, AID2613, AID2671, AID488845] | ChEMBL. | No reference |
| Potency (functional) | 25.1189 uM | PUBCHEM_BIOASSAY: Inhibitors of the vitamin D receptor (VDR): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504855] | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1). (Class of assay: confirmatory) [Related pubchem assays: 594 (Rhodamine region spectral profiling screen), 593 (Fluorescein region spectral profiling screen), 2367 (Probe Development Summary for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1)), 2353 (qHTS Validation Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1))] | ChEMBL. | No reference |
| Potency (functional) | = 28.1838 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of Schistosoma Mansoni Peroxiredoxins. (Class of assay: confirmatory) [Related pubchem assays: 1011 (Confirmation Concentration-Response Assay for Inhibitors of the Schistosoma mansoni Redox Cascade ), 448 (Schistosoma Mansoni Peroxiredoxins (Prx2) and thioredoxin glutathione reductase (TGR) coupled assay)] | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in SW480 colon adenocarcinoma cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 29.9349 uM | PubChem BioAssay. qHTS for Inhibitors of PLK1-PDB (polo-like kinase 1 - polo-box domain): Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | 31.6228 uM | PUBCHEM_BIOASSAY: qHTS Assay for Compounds Blocking the Interaction Between CBF-beta and RUNX1 for the Treatment of Acute Myeloid Leukemia. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID1484, AID504370, AID504374, AID504375] | ChEMBL. | No reference |
| Potency (functional) | 31.6228 uM | PUBCHEM_BIOASSAY: HTS for Inhibitors of HP1-beta Chromodomain Interactions with Methylated Histone Tails. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488962] | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PubChem BioAssay. Inhibitors of USP1/UAF1: Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 39.8107 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of HSD17B4, hydroxysteroid (17-beta) dehydrogenase 4. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 39.8107 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
| Potency (functional) | = 41.8398 um | PUBCHEM_BIOASSAY: Confirmation qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) [Related pubchem assays: 1490 (qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase)), 1819 (Probe Development Summary of Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase))] | ChEMBL. | No reference |
| Potency (functional) | = 44.6684 um | PUBCHEM_BIOASSAY: Total Fluorescence Counterscreen for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 44.6684 uM | PubChem BioAssay. qHTS for Antagonist of cAMP-regulated guanine nucleotide exchange factor 3 (EPAC1): primary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Mammalian Selenoprotein Thioredoxin Reductase 1 (TrxR1): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488771] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PUBCHEM_BIOASSAY: qHTS for Inducers of the Endoplasmic Reticulum Stress Response (ERSR) in Human Glioma: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 56.2341 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of JMJD2A-Tudor Domain. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504402] | ChEMBL. | No reference |
| Potency (functional) | 56.2341 uM | PUBCHEM_BIOASSAY: Inhibitors of Regulator of G Protein Signaling (RGS) 4: qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504856] | ChEMBL. | No reference |
| Potency (functional) | = 89.1251 um | PUBCHEM_BIOASSAY: qHTS Inhibitors of AmpC Beta-Lactamase (assay with detergent). (Class of assay: confirmatory) [Related pubchem assays: 1002 (Confirmation Concentration-Response Assay for Inhibitors of AmpC Beta-Lactamase (assay with detergent)), 585 (Promiscuous and Specific Inhibitors of AmpC Beta-Lactamase (assay without detergent) - a screen old NIH MLSMR collection), 584 (Promiscuous and Specific Inhibitors of AmpC Beta-Lactamase (assay with detergent) - a screen of the old NIH MLSMR collection), 1003 (Confirmation Cuvette-Based Assay for Inhibitors of AmpC Beta-Lactamase (assay with detergent))] | ChEMBL. | No reference |
| Potency (functional) | 95.2834 uM | PubChem BioAssay. qHTS Assay to Find Inhibitors of Pin1. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 166.67 uM | PubChem BioAssay. Gel-Based Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Homo sapiens | ChEMBL23 | ||
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL1438907
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.