Detailed information for compound 602018
Basic information
Technical information
- TDR Targets ID: 602018
- Name: N-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-methoxyph enyl)piperazin-1-yl]ethyl]cyclohexanecarboxam ide
- MW: 465.585 | Formula: C27H35N3O4
-
H donors: 1
H acceptors: 1
LogP: 4.57
Rotable bonds: 8
Rule of 5 violations (Lipinski): 1 - SMILES: COc1ccc(cc1)N1CCN(CC1)C(c1ccc2c(c1)OCO2)CNC(=O)C1CCCCC1
- InChi: 1S/C27H35N3O4/c1-32-23-10-8-22(9-11-23)29-13-15-30(16-14-29)24(18-28-27(31)20-5-3-2-4-6-20)21-7-12-25-26(17-21)34-19-33-25/h7-12,17,20,24H,2-6,13-16,18-19H2,1H3,(H,28,31)
- InChiKey: GZKQFQMTVICWQB-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- N-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)-1-piperazinyl]ethyl]cyclohexanecarboxamide
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.041 | 0.1726 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0593 | 0.2521 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0051 | 0.0839 | 0.2264 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.0213 | 0.1971 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0026 | 0.0363 | 0.3362 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Toxoplasma gondii | histone lysine demethylase JMJC1/KDM5D/JARID1D | 0.0034 | 0.0528 | 0.0782 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Schistosoma mansoni | protein phosphatase 2C | 0.0034 | 0.0528 | 0.0912 |
| Echinococcus multilocularis | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0064 | 0.1079 | 0.2921 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0593 | 0.2521 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0213 | 0.0872 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.041 | 0.373 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0021 | 0.0271 | 0.026 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0593 | 1 |
| Leishmania major | hypothetical protein, conserved | 0.0034 | 0.0528 | 0.484 |
| Echinococcus granulosus | lysine specific demethylase 6a | 0.0034 | 0.0528 | 0.1414 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0711 | 0.6557 |
| Entamoeba histolytica | hypothetical protein | 0.004 | 0.0634 | 0.3995 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.041 | 0.1769 |
| Trypanosoma brucei | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0119 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0008 | 0.002 | 0.0078 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0026 | 0.0363 | 0.3291 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0129 | 0.2318 | 0.6312 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0021 | 0.0272 | 0.0714 |
| Echinococcus multilocularis | Jumonji, AT rich interactive domain 1B | 0.0034 | 0.0528 | 0.1414 |
| Trypanosoma brucei | unspecified product | 0.0021 | 0.0272 | 0.3729 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0213 | 0.0305 |
| Brugia malayi | mbt repeat family protein | 0.005 | 0.0818 | 0.3499 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0171 | 0.0692 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Entamoeba histolytica | exodeoxyribonuclease III, putative | 0.0021 | 0.0271 | 0.1668 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0617 | 0.5673 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.041 | 0.1726 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0026 | 0.0363 | 0.2256 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.0363 | 0.1523 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0213 | 0.0355 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.0363 | 0.1523 |
| Giardia lamblia | Sugar-proton symporter | 0.0018 | 0.0213 | 0.346 |
| Toxoplasma gondii | exonuclease III APE | 0.0021 | 0.0271 | 0.0393 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0213 | 0.0872 |
| Brugia malayi | jmjC domain containing protein | 0.0034 | 0.0528 | 0.224 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2262 | 0.3972 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0562 | 0.1508 |
| Mycobacterium tuberculosis | Peptide synthetase MbtE (peptide synthase) | 0.0008 | 0.002 | 0.0184 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 1 | 1 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0213 | 0.1885 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0026 | 0.0363 | 0.3291 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0129 | 0.2318 | 0.6312 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0213 | 0.0355 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0021 | 0.0272 | 0.1132 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0213 | 0.2415 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0593 | 0.1591 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0593 | 0.1026 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0051 | 0.0839 | 0.2264 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1927 | 0.5242 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0119 |
| Toxoplasma gondii | propionate-CoA ligase | 0.0008 | 0.002 | 0.0013 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.0021 | 0.0272 | 0.116 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0021 | 0.0272 | 0.3729 |
| Loa Loa (eye worm) | mbt repeat family protein | 0.005 | 0.0818 | 0.3499 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0213 | 0.0355 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0213 | 0.0551 |
| Schistosoma mansoni | hypothetical protein | 0.0307 | 0.5678 | 1 |
| Leishmania major | 3-oxoacyl-(acyl-carrier protein) reductase, putative | 0.0064 | 0.1079 | 1 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.041 | 0.373 |
| Toxoplasma gondii | AMP-binding enzyme domain-containing protein | 0.0008 | 0.002 | 0.0013 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0329 | 0.3053 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0593 | 1 |
| Echinococcus multilocularis | SAM and MBT domain containing protein | 0.005 | 0.0818 | 0.2208 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0213 | 0.0551 |
| Brugia malayi | mbt repeat family protein | 0.005 | 0.0818 | 0.3499 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0213 | 0.0872 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0078 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0711 | 1 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0014 | 0.015 | 0.1977 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Onchocerca volvulus | 0.0012 | 0.0101 | 0.1013 | |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0617 | 0.5673 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0593 | 0.3734 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0129 | 0.2318 | 0.6312 |
| Schistosoma mansoni | hypothetical protein | 0.004 | 0.0634 | 0.1098 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.3731 | 0.3724 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0034 | 0.0528 | 0.0912 |
| Schistosoma mansoni | ubiquitously transcribed sex (X/Y) chromosome tetratricopeptide repeat protein-related | 0.0034 | 0.0528 | 0.0912 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Mycobacterium leprae | Probable fatty-acid-CoA synthetase FadD22 (fatty-acid-CoA ligase) (fatty-acid-CoA synthase) | 0.0008 | 0.002 | 0.0144 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Schistosoma mansoni | ap endonuclease | 0.0021 | 0.0271 | 0.0458 |
| Toxoplasma gondii | Acetyl-coenzyme A synthetase 2, putative | 0.0008 | 0.002 | 0.0013 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Trypanosoma brucei | JmjC domain, hydroxylase, putative | 0.0034 | 0.0528 | 0.7381 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0213 | 0.1885 |
| Echinococcus granulosus | dna polymerase eta | 0.0021 | 0.0272 | 0.0714 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0608 | 0.0597 |
| Echinococcus granulosus | dna polymerase kappa | 0.0021 | 0.0272 | 0.0714 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.041 | 0.5689 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0034 | 0.0528 | 0.224 |
| Giardia lamblia | Hexose transporter | 0.0018 | 0.0213 | 0.346 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0711 | 0.6557 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0026 | 0.0363 | 0.3291 |
| Mycobacterium ulcerans | bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ACP synthetase | 0.0008 | 0.002 | 0.0078 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.024 | 0.0991 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Brugia malayi | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0064 | 0.1079 | 0.4628 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.002 | 0.0036 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0018 | 0.022 | 0.2041 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0213 | 0.2874 |
| Mycobacterium tuberculosis | Probable medium chain fatty-acid-CoA ligase FadD14 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.002 | 0.0184 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.024 | 0.0991 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0213 | 0.0551 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0608 | 0.1052 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0608 | 0.0597 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0617 | 0.269 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0617 | 0.8651 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0617 | 0.5673 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0617 | 0.269 |
| Mycobacterium ulcerans | long-chain-acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Entamoeba histolytica | hypothetical protein | 0.004 | 0.0634 | 0.3995 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.041 | 0.0703 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0608 | 0.0597 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0608 | 0.2585 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0014 | 0.015 | 0.1977 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0064 | 0.1079 | 1 |
| Echinococcus multilocularis | dna polymerase eta | 0.0021 | 0.0272 | 0.0714 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0608 | 0.0903 |
| Brugia malayi | C2-HC type zinc finger protein C.e-MyT1 | 0.0057 | 0.0949 | 0.4063 |
| Echinococcus multilocularis | phd:f box containing protein | 0.0034 | 0.0528 | 0.1414 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.041 | 0.0703 |
| Schistosoma mansoni | DNA polymerase eta | 0.0021 | 0.0272 | 0.0461 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD10 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.002 | 0.0184 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0026 | 0.0363 | 0.1523 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0608 | 0.2585 |
| Giardia lamblia | DINP protein human, muc B family | 0.0021 | 0.0272 | 0.4489 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0213 | 0.0201 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0021 | 0.0272 | 0.3729 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.0021 | 0.0271 | 0.2514 |
| Mycobacterium tuberculosis | P-hydroxybenzoyl-AMP ligase FadD22 | 0.0008 | 0.002 | 0.0184 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.041 | 0.5689 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0021 | 0.0272 | 0.1132 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0608 | 0.1052 |
| Brugia malayi | jmjC domain containing protein | 0.0034 | 0.0528 | 0.224 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0213 | 0.2874 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0008 | 0.002 | 0.0037 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0021 | 0.0272 | 0.2525 |
| Echinococcus multilocularis | jumonji domain containing 1A | 0.0034 | 0.0528 | 0.1414 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0051 | 0.0839 | 0.3587 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0213 | 0.0872 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.041 | 0.109 |
| Plasmodium falciparum | JmjC domain-containing protein, putative | 0.0034 | 0.0528 | 0.0517 |
| Mycobacterium tuberculosis | Peptide synthetase MbtF (peptide synthase) | 0.0008 | 0.002 | 0.0184 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0213 | 0.0305 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.004 | 0.0634 | 0.1702 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.002 | 0.0036 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Leishmania major | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.002 | 0.0078 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0078 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Onchocerca volvulus | Polycomb protein Sfmbt homolog | 0.005 | 0.0818 | 1 |
| Schistosoma mansoni | phosphatidylserine receptor | 0.0034 | 0.0528 | 0.0912 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0021 | 0.0271 | 0.026 |
| Mycobacterium tuberculosis | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase)(ThrRS) (threonine-tRNA ligase) | 0.0007 | 0.0011 | 0.0106 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0608 | 0.0597 |
| Echinococcus multilocularis | dna polymerase kappa | 0.0021 | 0.0272 | 0.0714 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0129 | 0.2318 | 0.6312 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0213 | 0.1885 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0617 | 0.8651 |
| Brugia malayi | jmjC domain containing protein | 0.0129 | 0.2318 | 1 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0213 | 0.2874 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0617 | 0.269 |
| Echinococcus multilocularis | acetyl coenzyme A synthetase, cytoplasmic | 0.0008 | 0.002 | 0.0023 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0119 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0051 | 0.0839 | 0.146 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0344 | 0.1477 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0129 | 0.2318 | 1 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0051 | 0.0839 | 0.3587 |
| Chlamydia trachomatis | acylglycerophosphoethanolamine acyltransferase | 0.0019 | 0.024 | 0.574 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0608 | 0.0597 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0617 | 0.8651 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0026 | 0.0363 | 0.2256 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0213 | 0.1885 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Schistosoma mansoni | ap endonuclease | 0.0021 | 0.0271 | 0.0458 |
| Wolbachia endosymbiont of Brugia malayi | exonuclease III | 0.0021 | 0.0271 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0089 | 0.1568 | 0.6751 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0051 | 0.0839 | 0.146 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.2262 | 0.3972 |
| Echinococcus multilocularis | endonuclease exonuclease phosphatase | 0.02 | 0.3665 | 1 |
| Echinococcus granulosus | Jumonji AT rich interactive domain 1B | 0.0034 | 0.0528 | 0.1414 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.024 | 0.0991 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0026 | 0.0363 | 0.1523 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.0213 | 0.1971 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0129 | 0.2318 | 0.407 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0213 | 0.0305 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0021 | 0.0272 | 0.1132 |
| Schistosoma mansoni | phd/f-box containing protein | 0.0034 | 0.0528 | 0.0912 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium tuberculosis | Probable peptide synthetase Nrp (peptide synthase) | 0.0008 | 0.002 | 0.0184 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0026 | 0.0363 | 0.2256 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0021 | 0.0272 | 0.2525 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.2262 | 0.2253 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Mycobacterium ulcerans | peptide synthetase Nrp (peptide synthase) | 0.0008 | 0.002 | 0.0078 |
| Toxoplasma gondii | histone lysine demethylase JMJD6a | 0.0034 | 0.0528 | 0.0782 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0213 | 0.0894 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0608 | 0.3829 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.004 | 0.0634 | 0.1098 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0617 | 0.269 |
| Leishmania major | DNA polymerase eta, putative | 0.0021 | 0.0272 | 0.2445 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0213 | 0.0872 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0213 | 0.0872 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0608 | 0.2585 |
| Loa Loa (eye worm) | hypothetical protein | 0.0034 | 0.0528 | 0.224 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0021 | 0.0272 | 0.0714 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.002 | 0.0036 |
| Echinococcus multilocularis | histone acetyltransferase MYST2 | 0.0057 | 0.0949 | 0.2565 |
| Loa Loa (eye worm) | 3-hydroxyacyl-CoA dehydrogenase type II | 0.0059 | 0.0998 | 0.4277 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0021 | 0.0271 | 0.0711 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0608 | 0.1052 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0034 | 0.0528 | 0.224 |
| Entamoeba histolytica | hypothetical protein | 0.004 | 0.0634 | 0.3995 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0021 | 0.0272 | 0.0461 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0026 | 0.0363 | 0.3291 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0711 | 0.0701 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0711 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0617 | 0.269 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0008 | 0.002 | 0.0037 |
| Trypanosoma brucei | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.002 | 0.0119 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0021 | 0.0271 | 0.1126 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0026 | 0.0363 | 0.3291 |
| Echinococcus granulosus | histone acetyltransferase MYST2 | 0.0057 | 0.0949 | 0.2565 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0018 | 0.022 | 0.2041 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Entamoeba histolytica | hypothetical protein | 0.004 | 0.0634 | 0.3995 |
| Schistosoma mansoni | sex comb on midleg homolog | 0.005 | 0.0818 | 0.1424 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0021 | 0.0271 | 0.3711 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0593 | 0.2583 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.041 | 0.6849 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.3731 | 0.3724 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0213 | 0.0355 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0034 | 0.0528 | 0.224 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0608 | 0.0597 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0213 | 0.1885 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0018 | 0.022 | 0.2041 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0617 | 0.269 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD8 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.002 | 0.0184 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0014 | 0.015 | 0.1977 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0018 | 0.022 | 0.2041 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.041 | 0.0603 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.0021 | 0.0271 | 0.2433 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0129 | 0.2318 | 0.407 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0213 | 0.2874 |
| Echinococcus granulosus | suppression of tumorigenicity 18 protein | 0.0057 | 0.0949 | 0.2565 |
| Trypanosoma brucei | unspecified product | 0.0014 | 0.015 | 0.1977 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0459 | 0.1939 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.2262 | 1 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.041 | 0.109 |
| Mycobacterium ulcerans | hypothetical protein | 0.0026 | 0.0363 | 0.3291 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD1 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0008 | 0.002 | 0.0184 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0213 | 0.7745 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.004 | 0.0634 | 0.1702 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0021 | 0.0272 | 0.2445 |
| Mycobacterium ulcerans | O-succinylbenzoic acid--CoA ligase | 0.0008 | 0.002 | 0.0078 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.041 | 0.0399 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.002 | 0.0119 |
| Mycobacterium tuberculosis | Bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ArCP synthetase | 0.0008 | 0.002 | 0.0184 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2262 | 0.3972 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0021 | 0.0271 | 0.3711 |
| Mycobacterium ulcerans | acetyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0213 | 0.0305 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0019 | 0.024 | 0.2225 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0213 | 0.1885 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Plasmodium vivax | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0008 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.041 | 0.0399 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Brugia malayi | jmjC domain containing protein | 0.0129 | 0.2318 | 1 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0608 | 0.5585 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0213 | 0.0872 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0711 | 1 |
| Entamoeba histolytica | Acid sphingomyelinase-like phosphodiesterase, putative | 0.0089 | 0.1568 | 1 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.0021 | 0.0272 | 0.116 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0562 | 0.1508 |
| Entamoeba histolytica | long-chain-fatty-acid--CoA ligase, putative | 0.0008 | 0.002 | 0.0054 |
| Mycobacterium tuberculosis | Fatty-acid-CoA synthetase FadD17 (fatty-acid-CoA synthase) (fatty-acid-CoA ligase) | 0.0008 | 0.002 | 0.0184 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0008 | 0.002 | 0.0119 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0021 | 0.0272 | 0.3729 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0213 | 0.0872 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.6616 | 0.6612 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Mycobacterium leprae | POSSIBLE FATTY-ACID-CoA LIGASE FADD10 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0008 | 0.002 | 0.0144 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1927 | 0.5242 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0034 | 0.0528 | 0.224 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0026 | 0.0363 | 0.3291 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0608 | 0.2585 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Brugia malayi | acetyl-Coenzyme A synthetase 2 | 0.0008 | 0.002 | 0.0036 |
| Echinococcus granulosus | JmjC domain containing protein 4 | 0.0034 | 0.0528 | 0.1414 |
| Schistosoma mansoni | sex comb on midleg homolog | 0.005 | 0.0818 | 0.1424 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.2262 | 0.2253 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0021 | 0.0271 | 0.1154 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.041 | 0.373 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0608 | 0.3829 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium tuberculosis | Phenyloxazoline synthase MbtB (phenyloxazoline synthetase) | 0.0008 | 0.002 | 0.0184 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0008 | 0.002 | 0.0036 |
| Brugia malayi | jmjC domain containing protein | 0.0034 | 0.0528 | 0.224 |
| Onchocerca volvulus | 0.005 | 0.0818 | 1 | |
| Chlamydia trachomatis | proline--tRNA ligase | 0.0013 | 0.013 | 0.2978 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0129 | 0.2318 | 0.407 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0593 | 0.2521 |
| Leishmania major | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.2445 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0213 | 0.2874 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0021 | 0.0272 | 0.3729 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0272 | 0.1132 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0051 | 0.0839 | 0.2264 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0593 | 0.2521 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0329 | 0.5469 |
| Loa Loa (eye worm) | hypothetical protein | 0.0034 | 0.0528 | 0.224 |
| Loa Loa (eye worm) | oxidoreductase | 0.0008 | 0.002 | 0.0036 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.041 | 1 |
| Mycobacterium ulcerans | phenyloxazoline synthase MbtB | 0.0008 | 0.002 | 0.0078 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0021 | 0.0271 | 0.0711 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0608 | 0.0903 |
| Mycobacterium leprae | POSSIBLE O-SUCCINYLBENZOIC ACID--CoA LIGASE MENE (OSB-CoA SYNTHETASE) (O-SUCCINYLBENZOATE-CoA SYNTHASE) | 0.0008 | 0.002 | 0.0144 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0282 | 0.386 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0021 | 0.0272 | 0.1676 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.041 | 0.2557 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0026 | 0.0363 | 0.3291 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Schistosoma mansoni | acetyl-CoA synthetase | 0.0008 | 0.002 | 0.0015 |
| Echinococcus granulosus | jumonji domain containing 1A | 0.0034 | 0.0528 | 0.1414 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0021 | 0.0272 | 0.3729 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0608 | 0.2585 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0711 | 0.0701 |
| Onchocerca volvulus | 0.0026 | 0.0363 | 0.4294 | |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0593 | 0.1026 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0213 | 0.0551 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0593 | 0.1591 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.0021 | 0.0271 | 0.4468 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0213 | 0.0201 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Echinococcus multilocularis | suppression of tumorigenicity 18 protein | 0.0057 | 0.0949 | 0.2565 |
| Echinococcus multilocularis | JmjC domain containing protein 4 | 0.0034 | 0.0528 | 0.1414 |
| Schistosoma mansoni | myelin transcription factor 1 myt1 | 0.0057 | 0.0949 | 0.1654 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.0363 | 0.1523 |
| Loa Loa (eye worm) | hypothetical protein | 0.0008 | 0.002 | 0.0036 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.0021 | 0.0271 | 0.1154 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Mycobacterium ulcerans | prolyl-tRNA synthetase | 0.0013 | 0.013 | 0.1111 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0034 | 0.0528 | 0.7381 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.002 | 0.0036 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0329 | 0.3053 |
| Loa Loa (eye worm) | hypothetical protein | 0.0057 | 0.0949 | 0.4063 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0008 | 0.002 | 0.0036 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0608 | 0.0597 |
| Treponema pallidum | exodeoxyribonuclease (exoA) | 0.0021 | 0.0271 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0608 | 0.1052 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0019 | 0.024 | 0.0229 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.2262 | 0.9759 |
| Entamoeba histolytica | Acid sphingomyelinase-like phosphodiesterase, putative | 0.0089 | 0.1568 | 1 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.0034 | 0.0528 | 0.7381 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.024 | 0.0991 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0026 | 0.0363 | 0.3291 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0026 | 0.0363 | 0.6043 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0608 | 0.0597 |
| Schistosoma mansoni | scm-relatedprotein containing 4 mbt domains (sfmbt) | 0.005 | 0.0818 | 0.1424 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.2262 | 0.9759 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0026 | 0.0363 | 0.6043 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0213 | 0.0894 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0608 | 0.1632 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0213 | 0.0355 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0019 | 0.024 | 0.2141 |
| Echinococcus granulosus | SAM and MBT domain containing protein | 0.005 | 0.0818 | 0.2208 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2262 | 0.616 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0213 | 0.0872 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0711 | 0.106 |
| Brugia malayi | hypothetical protein | 0.004 | 0.0634 | 0.2697 |
| Onchocerca volvulus | 0.0018 | 0.0213 | 0.2415 | |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0617 | 0.269 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0051 | 0.0839 | 0.146 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.2262 | 0.3408 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0213 | 0.0894 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0608 | 0.1632 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0021 | 0.0272 | 0.0461 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0026 | 0.0363 | 0.1523 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0008 | 0.002 | 0.0036 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0213 | 0.0551 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0213 | 0.0355 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.3731 | 0.5632 |
| Echinococcus granulosus | 3 hydroxyacyl coenzyme A dehydrogenase type 2 | 0.0064 | 0.1079 | 0.2921 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0008 | 0.002 | 0.0036 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0021 | 0.0271 | 0.2433 |
| Loa Loa (eye worm) | hypothetical protein | 0.0019 | 0.024 | 0.0991 |
| Schistosoma mansoni | 3-hydroxyacyl-CoA dehydrogenase | 0.0064 | 0.1079 | 0.1884 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0608 | 0.8517 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0021 | 0.0271 | 0.3711 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0026 | 0.0363 | 0.3291 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0021 | 0.0271 | 0.1126 |
| Plasmodium vivax | JmjC domain containing protein | 0.0034 | 0.0528 | 0.0517 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtF | 0.0008 | 0.002 | 0.0078 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0213 | 0.0872 |
| Trypanosoma brucei | unspecified product | 0.0014 | 0.015 | 0.1977 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0608 | 0.2648 |
| Echinococcus granulosus | acetyl coenzyme A synthetase cytoplasmic | 0.0008 | 0.002 | 0.0023 |
| Loa Loa (eye worm) | hypothetical protein | 0.005 | 0.0818 | 0.3499 |
| Echinococcus granulosus | phd:f box containing protein | 0.0034 | 0.0528 | 0.1414 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0026 | 0.0363 | 0.3362 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0608 | 0.0597 |
| Echinococcus multilocularis | polycomb protein SCMH1 | 0.005 | 0.0818 | 0.2208 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0213 | 0.0894 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0213 | 0.0894 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.041 | 0.6849 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtE | 0.0008 | 0.002 | 0.0078 |
| Echinococcus granulosus | polycomb protein SCMH1 | 0.005 | 0.0818 | 0.2208 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0008 | 0.002 | 0.0078 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0617 | 0.5673 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0026 | 0.0363 | 0.3291 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0021 | 0.0272 | 0.2445 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2262 | 0.3972 |
| Echinococcus multilocularis | lysine specific demethylase 6a | 0.0034 | 0.0528 | 0.1414 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0021 | 0.0272 | 0.2445 |
| Brugia malayi | jmjC domain containing protein | 0.0034 | 0.0528 | 0.224 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0019 | 0.024 | 0.0229 |
| Loa Loa (eye worm) | MBCTL1 | 0.0057 | 0.0949 | 0.4063 |
| Mycobacterium tuberculosis | Probable short-chain type dehydrogenase/reductase | 0.0064 | 0.1079 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0213 | 0.0872 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.6616 | 1 |
| Echinococcus granulosus | endonuclease exonuclease phosphatase | 0.02 | 0.3665 | 1 |
| Mycobacterium ulcerans | short-chain type dehydrogenase/reductase | 0.0064 | 0.1079 | 1 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0608 | 0.0903 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.013 | 0.4565 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0051 | 0.0839 | 0.2264 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0021 | 0.0272 | 0.3729 |
| Plasmodium falciparum | acetyl-CoA synthetase, putative | 0.0008 | 0.002 | 0.0008 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0617 | 0.8651 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 986 nM | MMV: Inhibition of Plasmodium falciparum K1 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 1110 nM | MMV: Inhibition of Plasmodium falciparum 3D7 (EC50). | ChEMBL. | No reference |
| Growth Inhibition (functional) | = 22.7332 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 569.1 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 22.5106735229492 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 25.8538589477539 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 25.853858947753906 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 26.62 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| Inhibition (functional) | = -25.2365426986592 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -25.236542698659182 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -22.8758644894619 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -5.59323740504756 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -3.89 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 LDH activity, using an LDH reporter assay. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 0.862 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 1 % | GSK_TCMDC: Percent inhibition of human HepG2 cell line. Test compounds present at 10uM. | ChEMBL. | 20485427 |
| Inhibition (functional) | = 3.65 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 4.28 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 4.35 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 17 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 29.7312163121955 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 51 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 83 % | GSK_TCMDC: Inhibition of Plasmodium falciparum Dd2 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 92 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 97 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Inhibition frequency index (IFI) (functional) | = 0 | Inhibition Frequency Index (IFI) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = -1 % | Percent inhibition of P. falciparum lactate dehydrogenase activity (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 1 % | Percent inhibition of HepG2 growth (at 10 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 83 % | Percent inhibition of P. falciparum Dd2 growth (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 92 % | Percent inhibition of P. falciparum 3D7 growth (at 2 uM) | GSK. | 20485427 |
| Ratio (functional) | = 0.920634920634921 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.124 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0986 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0299 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| XC50 (functional) | = 6.25 | XC50 determination of P. falciparum 3D7 growth | GSK. | 20485427 |
| XC50 (functional) | = 0.5656 uM | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole erythrocytes, using parasite LDH activity as an index of growth. | ChEMBL. | 20485427 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL528245
- Search by GSK
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.