Detailed information for compound 605827
Basic information
Technical information
- TDR Targets ID: 605827
- Name: 6-chloro-4-[[1-(3-phenylpropyl)piperidin-4-yl ]amino]chromen-2-one
- MW: 396.91 | Formula: C23H25ClN2O2
-
H donors: 1
H acceptors: 1
LogP: 5.15
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1ccc2c(c1)c(NC1CCN(CC1)CCCc1ccccc1)cc(=O)o2
- InChi: 1S/C23H25ClN2O2/c24-18-8-9-22-20(15-18)21(16-23(27)28-22)25-19-10-13-26(14-11-19)12-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-9,15-16,19,25H,4,7,10-14H2
- InChiKey: DBVHRKVRLJTZND-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 6-chloro-4-[[1-(3-phenylpropyl)-4-piperidyl]amino]chromen-2-one
- 6-chloro-4-[[1-(3-phenylpropyl)-4-piperidinyl]amino]-2-chromenone
- 6-chloro-4-[[1-(3-phenylpropyl)-4-piperidyl]amino]coumarin
- Oprea1_352986
- AI-204/31681056
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Chlamydia trachomatis | acylglycerophosphoethanolamine acyltransferase | 0.0017 | 0.0236 | 0.4909 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0438 | 0.6932 |
| Leishmania major | threonyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0456 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0438 | 0.0431 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0089 | 0.0147 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.062 | 1 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtE | 0.0007 | 0.0036 | 0.0265 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Brugia malayi | RNA, U transporter 1 | 0.008 | 0.1417 | 0.5318 |
| Giardia lamblia | Hexose transporter | 0.0018 | 0.0241 | 0.346 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0241 | 0.0882 |
| Entamoeba histolytica | threonyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0642 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0007 | 0.0036 | 0.0265 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0644 | 0.2797 |
| Schistosoma mansoni | hypothetical protein | 0.0034 | 0.0539 | 0.0967 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0635 | 0.1139 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0218 | 0.5876 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0025 | 0.0375 | 0.0367 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Schistosoma mansoni | hypothetical protein | 0.0301 | 0.5577 | 1 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0739 | 0.0732 |
| Trypanosoma cruzi | importin beta-1 subunit, putative | 0.0023 | 0.0338 | 0.438 |
| Toxoplasma gondii | HEAT repeat-containing protein | 0.0005 | 0.0007 | 0.0011 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0016 | 0.02 | 0.0345 |
| Plasmodium vivax | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0029 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0635 | 0.1139 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0241 | 0.3199 |
| Trypanosoma brucei | glycyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0456 |
| Entamoeba histolytica | glycyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0642 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0438 | 0.0773 |
| Brugia malayi | acetyl-Coenzyme A synthetase 2 | 0.0007 | 0.0036 | 0.0108 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0241 | 0.0433 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0007 | 0.0036 | 0.0052 |
| Echinococcus multilocularis | snurportin 1 | 0.0301 | 0.5577 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Entamoeba histolytica | hypothetical protein | 0.0023 | 0.0338 | 0.5316 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0438 | 1 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.375 | 0.3745 |
| Brugia malayi | hypothetical protein | 0.0035 | 0.057 | 0.2121 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0023 | 0.0347 | 0.5404 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.02 | 0.0358 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0241 | 1 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0017 | 0.0236 | 0.0228 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0025 | 0.0078 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0347 | 0.7796 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0017 | 0.0236 | 0.0228 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0241 | 0.1027 |
| Chlamydia trachomatis | proline--tRNA ligase | 0.0013 | 0.0159 | 0.2978 |
| Trypanosoma cruzi | GTP-binding nuclear protein rtb2, putative | 0.0021 | 0.0298 | 0.3822 |
| Loa Loa (eye worm) | threonyl-tRNA synthetase | 0.0007 | 0.0041 | 0.006 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0025 | 0.0375 | 0.0367 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0644 | 0.2797 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0017 | 0.0236 | 0.5101 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0438 | 0.0773 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0023 | 0.0347 | 0.5461 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0023 | 0.0349 | 0.15 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0739 | 1 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0025 | 0.0375 | 0.5022 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.02 | 0.0358 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0153 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0438 | 0.0431 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0241 | 0.042 |
| Trypanosoma brucei | GTP-binding nuclear protein rtb2, putative | 0.0021 | 0.0298 | 0.3972 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0347 | 0.128 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0241 | 0.0882 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0023 | 0.0347 | 0.5461 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0438 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.001 | 0.0089 | 0.0135 |
| Giardia lamblia | Sgs1 DNA helicase, putative | 0.001 | 0.0089 | 0.0841 |
| Mycobacterium tuberculosis | Probable peptide synthetase Nrp (peptide synthase) | 0.0007 | 0.0036 | 0.0529 |
| Brugia malayi | Bloom's syndrome protein homolog | 0.0023 | 0.0349 | 0.1289 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0644 | 0.8712 |
| Brugia malayi | hypothetical protein | 0.0025 | 0.0375 | 0.1385 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0635 | 0.1127 |
| Toxoplasma gondii | HEAT repeat-containing protein | 0.0005 | 0.0007 | 0.0011 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Schistosoma mansoni | blooms syndrome DNA helicase | 0.0019 | 0.0256 | 0.0459 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0358 | 0.5587 |
| Brugia malayi | Muscleblind-like protein | 0.0146 | 0.2659 | 1 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0241 | 0.0364 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Echinococcus granulosus | importin subunit beta 1 | 0.0028 | 0.0438 | 0.0773 |
| Trypanosoma brucei | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0036 | 0.0392 |
| Echinococcus multilocularis | GTP binding nuclear protein Ran | 0.0021 | 0.0298 | 0.0521 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0347 | 0.0609 |
| Toxoplasma gondii | AMP-binding enzyme domain-containing protein | 0.0007 | 0.0036 | 0.0055 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0392 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0438 | 1 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trypanosoma brucei | threonyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0456 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0241 | 0.1027 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Giardia lamblia | Sugar-proton symporter | 0.0018 | 0.0241 | 0.346 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.057 | 0.8969 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0153 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0016 | 0.02 | 0.0345 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0025 | 0.0375 | 0.0565 |
| Schistosoma mansoni | acetyl-CoA synthetase | 0.0007 | 0.0036 | 0.0065 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Schistosoma mansoni | ran | 0.0021 | 0.0298 | 0.0534 |
| Echinococcus granulosus | ATP dependent DNA helicase Q5 | 0.001 | 0.0089 | 0.0147 |
| Echinococcus granulosus | muscleblind protein | 0.0146 | 0.2659 | 0.476 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0347 | 0.7796 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.2285 | 0.2279 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0241 | 0.0882 |
| Leishmania major | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0013 | 0.0143 | 0.1857 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0016 | 0.02 | 0.0345 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0644 | 0.868 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.001 | 0.0089 | 0.031 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Echinococcus multilocularis | bloom syndrome protein | 0.0023 | 0.0349 | 0.0614 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0036 | 0.0052 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0358 | 1 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0644 | 0.8712 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0636 | 0.0629 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0006 | 0.0025 | 0.0207 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Entamoeba histolytica | HEAT repeat domain containing protein | 0.0005 | 0.0007 | 0.0117 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0636 | 0.0629 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | ATP-dependent DNA helicase | 0.001 | 0.0089 | 0.0147 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0025 | 0.0375 | 0.4898 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.062 | 0.2691 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0016 | 0.02 | 0.0725 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0241 | 0.0364 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0236 | 0.041 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2285 | 0.4097 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Brugia malayi | hypothetical protein | 0.0016 | 0.0209 | 0.076 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0644 | 0.2797 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0636 | 0.0629 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0016 | 0.02 | 0.0345 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0013 | 0.0143 | 0.0596 |
| Loa Loa (eye worm) | hypothetical protein | 0.0146 | 0.2659 | 0.476 |
| Echinococcus multilocularis | importin subunit beta 1 | 0.0028 | 0.0438 | 0.0773 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0016 | 0.02 | 0.0725 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0241 | 0.6604 |
| Brugia malayi | Importin beta-1 subunit | 0.0028 | 0.0438 | 0.1625 |
| Mycobacterium ulcerans | prolyl-tRNA synthetase | 0.0013 | 0.0159 | 0.3243 |
| Schistosoma mansoni | ran | 0.0021 | 0.0298 | 0.0534 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.062 | 0.1101 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0635 | 1 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.0146 | 0.2659 | 0.476 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0241 | 0.042 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0023 | 0.0347 | 0.7796 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0036 | 0.0153 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0241 | 0.0234 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0241 | 0.0433 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0049 | 0.0832 | 0.311 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0636 | 0.0629 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.375 | 0.5659 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.2285 | 0.4089 |
| Toxoplasma gondii | propionate-CoA ligase | 0.0007 | 0.0036 | 0.0055 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0241 | 0.1027 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0241 | 0.5239 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0023 | 0.0347 | 0.5461 |
| Plasmodium falciparum | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0029 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD10 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0036 | 0.0529 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.2285 | 0.8591 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0241 | 0.0234 |
| Plasmodium vivax | GTP-binding nuclear protein RAN/TC4, putative | 0.0021 | 0.0298 | 0.0291 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0218 | 0.5876 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus multilocularis | muscleblind protein | 0.0146 | 0.2659 | 0.476 |
| Giardia lamblia | GTP-binding nuclear protein RAN/TC4 | 0.0021 | 0.0298 | 0.4436 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0007 | 0.0036 | 0.0052 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0636 | 0.0959 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0644 | 0.8712 |
| Mycobacterium tuberculosis | P-hydroxybenzoyl-AMP ligase FadD22 | 0.0007 | 0.0036 | 0.0529 |
| Echinococcus granulosus | bloom syndrome protein | 0.0023 | 0.0349 | 0.0614 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q1 | 0.001 | 0.0089 | 0.0147 |
| Loa Loa (eye worm) | GTP-binding nuclear protein RAN/TC4 | 0.0021 | 0.0298 | 0.0521 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0438 | 0.0661 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0438 | 0.5783 |
| Mycobacterium ulcerans | acetyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0218 | 0.5876 |
| Echinococcus granulosus | ATP dependent DNA helicase Q1 | 0.001 | 0.0089 | 0.0147 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0007 | 0.0036 | 0.0108 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0007 | 0.0036 | 0.0108 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0025 | 0.0078 |
| Echinococcus multilocularis | Ataxin 2, N terminal,domain containing protein | 0.0011 | 0.0117 | 0.0196 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0241 | 0.0433 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0739 | 0.1115 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0034 | 0.0539 | 0.2006 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.02 | 0.0358 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0241 | 0.303 |
| Mycobacterium tuberculosis | Probable medium chain fatty-acid-CoA ligase FadD14 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0036 | 0.0529 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.062 | 0.9768 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.057 | 0.8969 |
| Mycobacterium tuberculosis | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase)(ThrRS) (threonine-tRNA ligase) | 0.0007 | 0.0041 | 0.0665 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Entamoeba histolytica | recQ family helicase, putative | 0.0013 | 0.0143 | 0.2255 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0016 | 0.0202 | 0.0305 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0438 | 0.0785 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0739 | 1 |
| Trichomonas vaginalis | importin beta-1, putative | 0.0023 | 0.0338 | 0.145 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.062 | 0.1101 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0636 | 0.0959 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0347 | 0.128 |
| Toxoplasma gondii | threonyl-tRNA synthetase family protein | 0.0007 | 0.0041 | 0.0061 |
| Trypanosoma brucei | importin beta-1 subunit, putative | 0.0028 | 0.0438 | 0.589 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.057 | 0.8969 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0035 | 0.057 | 0.1009 |
| Echinococcus granulosus | acetyl coenzyme A synthetase cytoplasmic | 0.0007 | 0.0036 | 0.0052 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Mycobacterium ulcerans | glycyl-tRNA synthetase | 0.0007 | 0.0041 | 0.0377 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0041 | 0.006 |
| Schistosoma mansoni | hypothetical protein | 0.0011 | 0.0117 | 0.0209 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0347 | 0.4642 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0036 | 0.0052 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0241 | 0.042 |
| Entamoeba histolytica | Ran family GTPase | 0.0021 | 0.0298 | 0.469 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0236 | 0.041 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0635 | 0.2368 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0023 | 0.0347 | 0.7796 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.062 | 0.1112 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0023 | 0.0347 | 0.5404 |
| Echinococcus granulosus | Threonyl tRNA synthetase C | 0.0007 | 0.0041 | 0.006 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Plasmodium falciparum | threonine--tRNA ligase | 0.0007 | 0.0041 | 0.0033 |
| Echinococcus granulosus | GPCR family 2 | 0.0016 | 0.02 | 0.0345 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0347 | 0.0609 |
| Trypanosoma brucei | Aminoacyl-tRNA editing domain containing protein, putative | 0.0006 | 0.0025 | 0.0243 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Plasmodium vivax | ADP-dependent DNA helicase RecQ, putative | 0.0016 | 0.0206 | 0.0199 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0241 | 0.303 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.057 | 0.1021 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0241 | 0.0433 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1951 | 0.3489 |
| Trichomonas vaginalis | threonyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0146 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | glycyl-tRNA synthetase | 0.0007 | 0.0041 | 0.006 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.057 | 0.8969 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0241 | 0.042 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0438 | 0.0785 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0241 | 0.0364 |
| Trichomonas vaginalis | ran, putative | 0.0021 | 0.0298 | 0.1275 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0007 | 0.0036 | 0.0126 |
| Toxoplasma gondii | glycyl-tRNA synthetase | 0.0007 | 0.0041 | 0.0061 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0241 | 0.0364 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0049 | 0.0832 | 0.311 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0372 | 0.1602 |
| Loa Loa (eye worm) | oxidoreductase | 0.0007 | 0.0036 | 0.0052 |
| Echinococcus multilocularis | acetyl coenzyme A synthetase, cytoplasmic | 0.0007 | 0.0036 | 0.0052 |
| Toxoplasma gondii | YbaK/proline-tRNA ligase associated domain-containing protein | 0.0006 | 0.0025 | 0.0038 |
| Loa Loa (eye worm) | hypothetical protein | 0.0049 | 0.0832 | 0.148 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD1 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0036 | 0.0529 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0023 | 0.0347 | 0.9679 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.6626 | 1 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0635 | 0.1127 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0438 | 0.5885 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0007 | 0.0036 | 0.0108 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.2285 | 0.3449 |
| Trichomonas vaginalis | DNA helicase recq1, putative | 0.0023 | 0.0349 | 0.15 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0007 | 0.0036 | 0.0126 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0438 | 0.5885 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.062 | 0.1101 |
| Schistosoma mansoni | DNA helicase recq5 | 0.001 | 0.0089 | 0.016 |
| Plasmodium falciparum | importin beta, putative | 0.0028 | 0.0438 | 0.0431 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2285 | 0.4097 |
| Loa Loa (eye worm) | hypothetical protein | 0.0016 | 0.02 | 0.0345 |
| Trypanosoma cruzi | GTP-binding nuclear protein rtb2, putative | 0.0021 | 0.0298 | 0.3822 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0635 | 0.1139 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.062 | 0.2312 |
| Schistosoma mansoni | hypothetical protein | 0.0016 | 0.02 | 0.0358 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Plasmodium falciparum | ATP-dependent DNA helicase Q1 | 0.001 | 0.0089 | 0.0082 |
| Leishmania major | importin beta-1 subunit, putative | 0.0023 | 0.0338 | 0.4516 |
| Echinococcus multilocularis | glycyl tRNA synthetase | 0.0007 | 0.0041 | 0.006 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q5 | 0.001 | 0.0089 | 0.0147 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.059 | 0.1046 |
| Leishmania major | hypothetical protein, conserved | 0.0006 | 0.0025 | 0.0243 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0644 | 0.2797 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0241 | 0.042 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0635 | 0.1139 |
| Trypanosoma brucei | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0392 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0236 | 0.041 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.062 | 0.1101 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0347 | 0.0609 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.2285 | 0.2279 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0241 | 0.3199 |
| Trichomonas vaginalis | Importin beta-1 subunit, putative | 0.0023 | 0.0338 | 0.145 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0635 | 0.8585 |
| Mycobacterium tuberculosis | Bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ArCP synthetase | 0.0007 | 0.0036 | 0.0529 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.2285 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0034 | 0.0539 | 0.0955 |
| Brugia malayi | probable proline-trna synthetase - fission yeast, putative | 0.0007 | 0.0041 | 0.0126 |
| Trypanosoma brucei | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0013 | 0.0143 | 0.1857 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0644 | 0.868 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0636 | 0.0629 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0644 | 0.8712 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0636 | 0.0629 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0635 | 0.2368 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0017 | 0.0236 | 0.6404 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.0159 | 1 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0438 | 0.1889 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0241 | 0.042 |
| Schistosoma mansoni | importin-beta 2 | 0.0005 | 0.0007 | 0.0013 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0241 | 0.0882 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0438 | 0.6849 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0347 | 0.7796 |
| Trypanosoma cruzi | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0013 | 0.0143 | 0.1654 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0241 | 0.0882 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.0241 | 0.6572 |
| Mycobacterium tuberculosis | Peptide synthetase MbtE (peptide synthase) | 0.0007 | 0.0036 | 0.0529 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0241 | 0.0882 |
| Leishmania major | hypothetical protein, conserved | 0.0006 | 0.0025 | 0.0243 |
| Echinococcus granulosus | GTP binding nuclear protein Ran | 0.0021 | 0.0298 | 0.0521 |
| Loa Loa (eye worm) | nucleolar RNA-associated protein alpha | 0.0301 | 0.5577 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0023 | 0.0347 | 0.7796 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0236 | 0.041 |
| Loa Loa (eye worm) | hypothetical protein | 0.0146 | 0.2659 | 0.476 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Entamoeba histolytica | long-chain-fatty-acid--CoA ligase, putative | 0.0007 | 0.0036 | 0.0569 |
| Toxoplasma gondii | Acetyl-coenzyme A synthetase 2, putative | 0.0007 | 0.0036 | 0.0055 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.02 | 0.0345 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Mycobacterium ulcerans | hypothetical protein | 0.0023 | 0.0347 | 0.7796 |
| Leishmania major | GTP-binding protein, putative | 0.0021 | 0.0298 | 0.3972 |
| Mycobacterium leprae | Probable fatty-acid-CoA synthetase FadD22 (fatty-acid-CoA ligase) (fatty-acid-CoA synthase) | 0.0007 | 0.0036 | 0.0184 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0016 | 0.02 | 0.0345 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0644 | 0.8712 |
| Mycobacterium leprae | POSSIBLE FATTY-ACID-CoA LIGASE FADD10 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0007 | 0.0036 | 0.0184 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0241 | 0.303 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0635 | 0.1127 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.2285 | 0.4097 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0241 | 0.3199 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Toxoplasma gondii | HEAT repeat-containing protein | 0.0028 | 0.0438 | 0.0661 |
| Mycobacterium tuberculosis | Phenyloxazoline synthase MbtB (phenyloxazoline synthetase) | 0.0007 | 0.0036 | 0.0529 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Brugia malayi | GTP-binding nuclear protein RAN/TC4 | 0.0021 | 0.0298 | 0.1096 |
| Mycobacterium tuberculosis | Fatty-acid-CoA synthetase FadD17 (fatty-acid-CoA synthase) (fatty-acid-CoA ligase) | 0.0007 | 0.0036 | 0.0529 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.062 | 0.2312 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0644 | 0.2797 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Mycobacterium tuberculosis | Peptide synthetase MbtF (peptide synthase) | 0.0007 | 0.0036 | 0.0529 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0016 | 0.02 | 0.0345 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0644 | 0.868 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0636 | 0.0629 |
| Echinococcus granulosus | snurportin 1 | 0.0301 | 0.5577 | 1 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0739 | 1 |
| Brugia malayi | glycyl-tRNA synthetase | 0.0007 | 0.0041 | 0.0126 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0241 | 0.0882 |
| Mycobacterium ulcerans | phenyloxazoline synthase MbtB | 0.0007 | 0.0036 | 0.0265 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0358 | 1 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.001 | 0.0089 | 0.0135 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0241 | 0.3199 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.0241 | 0.6572 |
| Plasmodium vivax | importin-beta 2, putative | 0.0028 | 0.0438 | 0.0431 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0739 | 1 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.062 | 1 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0218 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0438 | 0.0773 |
| Schistosoma mansoni | DNA helicase recq1 | 0.001 | 0.0089 | 0.016 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0007 | 0.0036 | 0.0108 |
| Mycobacterium leprae | POSSIBLE O-SUCCINYLBENZOIC ACID--CoA LIGASE MENE (OSB-CoA SYNTHETASE) (O-SUCCINYLBENZOATE-CoA SYNTHASE) | 0.0007 | 0.0036 | 0.0184 |
| Mycobacterium ulcerans | peptide synthetase Nrp (peptide synthase) | 0.0007 | 0.0036 | 0.0265 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0035 | 0.057 | 0.1021 |
| Plasmodium falciparum | GTP-binding nuclear protein RAN/TC4 | 0.0021 | 0.0298 | 0.0291 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0644 | 0.2797 |
| Onchocerca volvulus | 0.0023 | 0.0347 | 1 | |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0636 | 0.0629 |
| Mycobacterium ulcerans | bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ACP synthetase | 0.0007 | 0.0036 | 0.0265 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0347 | 0.128 |
| Mycobacterium ulcerans | threonyl-tRNA synthetase | 0.0007 | 0.0041 | 0.0377 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0438 | 0.6892 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Leishmania major | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0036 | 0.0392 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.001 | 0.0089 | 0.031 |
| Loa Loa (eye worm) | RecQ helicase | 0.0023 | 0.0349 | 0.0614 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0241 | 0.0433 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.375 | 0.3745 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.6626 | 0.6623 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0739 | 0.0732 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0635 | 1 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0739 | 1 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0036 | 0.0153 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | Importin beta-1 subunit, putative | 0.0023 | 0.0338 | 0.145 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1951 | 0.3489 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0241 | 0.5239 |
| Schistosoma mansoni | glycyl-tRNA synthetase | 0.0007 | 0.0041 | 0.0073 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0241 | 0.042 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0487 | 0.086 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0635 | 0.2756 |
| Plasmodium vivax | threonine--tRNA ligase, putative | 0.0007 | 0.0041 | 0.0033 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0636 | 0.0629 |
| Trypanosoma brucei | importin beta-1 subunit, putative | 0.0028 | 0.0438 | 0.589 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0644 | 0.8712 |
| Plasmodium vivax | glycine--tRNA ligase, putative | 0.0007 | 0.0041 | 0.0033 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.2285 | 0.4089 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0218 | 0.5876 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Echinococcus granulosus | glycyl tRNA synthetase | 0.0007 | 0.0041 | 0.006 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0023 | 0.0347 | 0.7796 |
| Mycobacterium ulcerans | long-chain-acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0006 | 0.0025 | 0.0078 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0347 | 0.4642 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0347 | 0.4642 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0635 | 0.8585 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0241 | 0.042 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0644 | 0.2797 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0241 | 0.0882 |
| Schistosoma mansoni | importin beta-1 | 0.0028 | 0.0438 | 0.0786 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0025 | 0.0375 | 0.0367 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trypanosoma brucei | ULK family serine/threonine-protein kinase, putative | 0.0008 | 0.0053 | 0.0622 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0241 | 0.5239 |
| Plasmodium falciparum | ADP-dependent DNA helicase RecQ | 0.0021 | 0.0295 | 0.0288 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0236 | 0.041 |
| Loa Loa (eye worm) | hypothetical protein | 0.0025 | 0.0375 | 0.0659 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtF | 0.0007 | 0.0036 | 0.0265 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0644 | 0.868 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD8 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0036 | 0.0529 |
| Echinococcus granulosus | Ataxin 2 N terminaldomain containing protein | 0.0011 | 0.0117 | 0.0196 |
| Brugia malayi | threonyl-tRNA synthetase, cytoplasmic | 0.0007 | 0.0041 | 0.0126 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0241 | 0.0882 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.2285 | 0.4097 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Echinococcus multilocularis | Threonyl tRNA synthetase, C | 0.0007 | 0.0041 | 0.006 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0438 | 0.0773 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0241 | 0.0433 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0438 | 0.1623 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.031 | 0.3994 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0644 | 0.8712 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0036 | 0.0265 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Mycobacterium leprae | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase) (ThrRS) (Threonine-tRNA ligase) | 0.0007 | 0.0041 | 0.0262 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0025 | 0.0375 | 0.4898 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0635 | 0.1127 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0241 | 0.5239 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0635 | 0.1127 |
| Leishmania major | hypothetical protein, conserved | 0.0025 | 0.0375 | 0.5022 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0007 | 0.0036 | 0.0392 |
| Toxoplasma gondii | GTP-binding nuclear protein ran/tc4 | 0.0021 | 0.0298 | 0.045 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Mycobacterium ulcerans | O-succinylbenzoic acid--CoA ligase | 0.0007 | 0.0036 | 0.0265 |
| Loa Loa (eye worm) | hypothetical protein | 0.0118 | 0.2133 | 0.3816 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0241 | 0.042 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0041 | 0.0218 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0035 | 0.057 | 0.1009 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0007 | 0.0036 | 0.0108 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.059 | 0.1046 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0241 | 0.0882 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.062 | 0.1112 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0636 | 0.0959 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0241 | 0.1027 |
| Onchocerca volvulus | 0.0018 | 0.0241 | 0.6604 | |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0049 | 0.0832 | 0.148 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0023 | 0.0347 | 0.9679 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0241 | 0.1027 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | NOVARTIS: Antimalarial liver stage activity measured as a greater than 50% reduction in Plasmodium yoelii schizont area in HepG2-A16-CD81 cells at 10uM compound concentration, determined by immuno-fluorescence. | ChEMBL. | 22096101 | |
| CC50 (functional) | = 20.52 uM | Huh7 cytotoxicity for Pf inhibitors | Novartis-GNF Malaria Box. | No reference |
| CC50 | = 20.52 uM | NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7) | ChEMBL. | 18579783 |
| EC50 (functional) | = 532 nM | MMV: Inhibition of Plasmodium falciparum K1 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 846 nM | MMV: Inhibition of Plasmodium falciparum 3D7 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 0.408 uM | PF proliferation inhibition 3D7 | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.408 uM | NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| EC50 (functional) | = 0.863 uM | W2 Pf proliferation inhibition | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.863 uM | NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| Growth Inhibition (functional) | = 18.578 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 542.8 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 4.0866756439209 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 10.079368591308594 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 10.0793685913086 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 15.0008955001831 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 15.594473838806152 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 15.5944738388062 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IFI promiscuity index | = 0 | IFI promiscuity index | Novartis-GNF Malaria Box. | No reference |
| Inhibition (functional) | = -9.89303434123297 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.84723771054887 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -2.260912167303543 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -2.26091216730354 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 7.737445953524347 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 7.73744595352435 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 14.3 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 24.2 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 89 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 97 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Inhibition (functional) | = 101 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Ratio (functional) | = 1.0188679245283 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0193 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = 0.014 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = 0.0246 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 1 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 2 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 2 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Trypanosoma brucei gambiense | |||
| Trypanosoma cruzi | ChEMBL23 | ||
| Leishmania infantum | ChEMBL23 | ||
| Plasmodium falciparum | ChEMBL23 | 18579783 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL579300
- Search by Novartis-GNF Malaria Box
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.