Detailed information for compound 614850
Basic information
Technical information
- TDR Targets ID: 614850
- Name: 4-tert-butyl-N-[2-(3-chlorophenyl)-4,6-dihydr othieno[3,4-d]pyrazol-3-yl]benzamide
- MW: 411.948 | Formula: C22H22ClN3OS
-
H donors: 1
H acceptors: 2
LogP: 5.42
Rotable bonds: 5
Rule of 5 violations (Lipinski): 1 - SMILES: Clc1cccc(c1)n1nc2c(c1NC(=O)c1ccc(cc1)C(C)(C)C)CSC2
- InChi: 1S/C22H22ClN3OS/c1-22(2,3)15-9-7-14(8-10-15)21(27)24-20-18-12-28-13-19(18)25-26(20)17-6-4-5-16(23)11-17/h4-11H,12-13H2,1-3H3,(H,24,27)
- InChiKey: WYEUQKAJSMQNMO-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- Oprea1_187347
- EU-0062202
- ZINC04088740
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0024 | 0.0229 | 0.037 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 0.0321 | 0.0313 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0218 |
| Mycobacterium tuberculosis | Bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ArCP synthetase | 0.0007 | 0.0007 | 0.0106 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.042 | 0.0602 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0141 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0284 | 0.0462 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0132 | 0.1894 |
| Entamoeba histolytica | hypothetical protein | 0.0041 | 0.0444 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.0444 | 0.0437 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0144 | 0.0229 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.006 | 0.0697 | 1 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Loa Loa (eye worm) | hypothetical protein | 0.015 | 0.1858 | 0.3096 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0419 | 0.0412 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0426 | 0.145 |
| Mycobacterium tuberculosis | Probable medium chain fatty-acid-CoA ligase FadD14 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0106 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0149 | 0.2131 |
| Echinococcus granulosus | tar DNA binding protein | 0.0063 | 0.0741 | 0.0734 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.042 | 0.0602 |
| Echinococcus multilocularis | Threonyl tRNA synthetase, C | 0.0007 | 0.0011 | 0.0003 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.049 | 0.1081 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0419 | 0.0689 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0023 | 0.0221 | 0.3166 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0031 | 0.0321 | 0.0524 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0132 | 0.1894 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0023 | 0.0221 | 0.3166 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Leishmania major | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0154 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.042 | 0.0602 |
| Echinococcus multilocularis | survival motor neuron protein 1 | 0.0468 | 0.5985 | 0.5982 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0098 | 0.1189 | 0.1976 |
| Brugia malayi | Iron-sulfur cluster assembly accessory protein | 0.0096 | 0.1156 | 0.1922 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0409 | 0.0672 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0149 | 0.0236 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0149 | 0.303 |
| Onchocerca volvulus | 0.015 | 0.1858 | 0.6318 | |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0149 | 0.0236 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0149 | 0.0236 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.2561 | 0.3727 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0229 | 0.3279 |
| Schistosoma mansoni | Smad4 | 0.0011 | 0.0057 | 0.005 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0149 | 0.0236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0031 | 0.0321 | 0.0524 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.042 | 0.0602 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.042 | 0.0602 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0426 | 0.6107 |
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.0029 | 0.0299 | 0.0292 |
| Mycobacterium tuberculosis | Probable aldehyde dehydrogenase | 0.006 | 0.0697 | 1 |
| Schistosoma mansoni | TGF-beta signal transducer Smad2 | 0.0024 | 0.0229 | 0.0221 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Echinococcus multilocularis | mothers against decapentaplegic 2 | 0.0011 | 0.0057 | 0.005 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0419 | 0.0412 |
| Schistosoma mansoni | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0003 |
| Trichomonas vaginalis | set domain proteins, putative | 0.0233 | 0.2936 | 1 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0017 | 0.0144 | 0.2071 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0409 | 0.1394 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0221 | 0.3166 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Brugia malayi | mothers against decapentaplegic homolog 3 | 0.0011 | 0.0057 | 0.0083 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0063 | 0.0741 | 0.0734 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0149 | 0.0506 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0149 | 0.0236 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.0092 | 1 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD8 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0106 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.006 | 0.0697 | 1 |
| Onchocerca volvulus | 0.0233 | 0.2936 | 1 | |
| Loa Loa (eye worm) | TAR-binding protein | 0.0063 | 0.0741 | 0.1227 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0419 | 0.855 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Brugia malayi | MH1 domain containing protein | 0.0024 | 0.0229 | 0.037 |
| Echinococcus multilocularis | TGF beta signal transducer SmadC | 0.0024 | 0.0229 | 0.0221 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0284 | 0.4068 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Chlamydia trachomatis | acylglycerophosphoethanolamine acyltransferase | 0.0017 | 0.0144 | 0.4898 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0149 | 0.0327 |
| Echinococcus granulosus | aldehyde dehydrogenase mitochondrial | 0.006 | 0.0697 | 0.069 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Brugia malayi | probable proline-trna synthetase - fission yeast, putative | 0.0007 | 0.0011 | 0.0006 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0149 | 0.0141 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0023 | 0.0221 | 0.5394 |
| Onchocerca volvulus | 0.0029 | 0.0299 | 0.0996 | |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1554 | 0.1547 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0149 | 0.0141 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Brugia malayi | TAR-binding protein | 0.0063 | 0.0741 | 0.1227 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.2561 | 0.3727 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.4538 | 0.6614 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0221 | 0.0357 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Loa Loa (eye worm) | hypothetical protein | 0.0011 | 0.0057 | 0.0083 |
| Brugia malayi | RNA recognition motif domain containing protein | 0.0063 | 0.0741 | 0.1227 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Loa Loa (eye worm) | threonyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0006 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0098 | 0.1189 | 0.1976 |
| Loa Loa (eye worm) | hypothetical protein | 0.0468 | 0.5985 | 1 |
| Schistosoma mansoni | microtubule-associated protein tau | 0.0778 | 1 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0011 | 0.0006 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0098 | 0.1189 | 0.1976 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0028 | 0.0285 | 0.0278 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0284 | 0.6323 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.042 | 0.0925 |
| Entamoeba histolytica | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0076 |
| Brugia malayi | MH2 domain containing protein | 0.0351 | 0.4469 | 0.7463 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0506 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0063 | 0.0741 | 0.0734 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0221 | 0.0357 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Brugia malayi | MH2 domain containing protein | 0.0024 | 0.0229 | 0.037 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0426 | 0.868 |
| Mycobacterium leprae | POSSIBLE FATTY-ACID-CoA LIGASE FADD10 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0007 | 0.0007 | 0.0181 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.1554 | 0.1547 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0023 | 0.0221 | 0.3166 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0149 | 0.0236 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0106 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0317 | 0.0518 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0007 | 0.0007 | 0.0106 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0218 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0426 | 0.145 |
| Loa Loa (eye worm) | MH1 domain-containing protein | 0.0024 | 0.0229 | 0.037 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0426 | 0.868 |
| Loa Loa (eye worm) | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0006 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0284 | 0.0276 |
| Brugia malayi | MH1 domain containing protein | 0.0013 | 0.009 | 0.0138 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD1 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0106 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0029 | 0.0299 | 0.0292 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0149 | 0.0236 |
| Mycobacterium ulcerans | phenyloxazoline synthase MbtB | 0.0007 | 0.0007 | 0.0106 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Echinococcus granulosus | Threonyl tRNA synthetase C | 0.0007 | 0.0011 | 0.0003 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.049 | 1 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0205 | 0.257 | 0.4287 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0041 | 0.0444 | 0.0437 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0229 | 0.3279 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0409 | 0.9197 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0388 | 0.0381 |
| Loa Loa (eye worm) | hypothetical protein | 0.0098 | 0.1189 | 0.1976 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0221 | 0.3166 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0149 | 0.2131 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0149 | 0.0236 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0023 | 0.0221 | 0.3166 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0063 | 0.0741 | 0.0734 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0132 | 0.1894 |
| Schistosoma mansoni | Smad4 | 0.0011 | 0.0057 | 0.005 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0221 | 0.3166 |
| Leishmania major | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0106 |
| Mycobacterium ulcerans | prolyl-tRNA synthetase | 0.0013 | 0.0092 | 0.1319 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0426 | 0.145 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0284 | 0.5783 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0141 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtE | 0.0007 | 0.0007 | 0.0106 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0239 | 0.0813 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0426 | 0.6107 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0419 | 0.9429 |
| Echinococcus granulosus | mothers against decapentaplegic 2 | 0.0011 | 0.0057 | 0.005 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Schistosoma mansoni | smad | 0.0011 | 0.0057 | 0.005 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0419 | 0.1428 |
| Echinococcus granulosus | TGF beta signal transducer SmadC | 0.0024 | 0.0229 | 0.0221 |
| Mycobacterium ulcerans | hypothetical protein | 0.0023 | 0.0221 | 0.3166 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.0149 | 0.2131 |
| Echinococcus multilocularis | mothers against decapentaplegic 6 | 0.0011 | 0.0057 | 0.005 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.042 | 0.0602 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0017 | 0.0144 | 0.02 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0419 | 0.6015 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0419 | 0.0689 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0149 | 0.0327 |
| Mycobacterium tuberculosis | Peptide synthetase MbtF (peptide synthase) | 0.0007 | 0.0007 | 0.0106 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.042 | 0.0925 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0144 | 0.0229 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0426 | 0.145 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0031 | 0.0321 | 0.0313 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Brugia malayi | MH1 domain containing protein | 0.0024 | 0.0229 | 0.037 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.049 | 0.7035 |
| Toxoplasma gondii | AMP-binding enzyme domain-containing protein | 0.0007 | 0.0007 | 0.0016 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0409 | 1 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0409 | 0.0402 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0149 | 0.2131 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0221 | 0.3166 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0284 | 0.0403 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0151 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0149 | 0.2131 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0419 | 0.0412 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0067 | 0.0787 | 0.1304 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.0029 | 0.0299 | 0.0659 |
| Loa Loa (eye worm) | hypothetical protein | 0.0067 | 0.0787 | 0.1304 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1324 | 0.1317 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0284 | 1 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0149 | 0.2131 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Brugia malayi | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0006 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0132 | 0.1894 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0031 | 0.0321 | 0.0313 |
| Trypanosoma brucei | glycyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0218 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0063 | 0.0741 | 0.0734 |
| Echinococcus multilocularis | mothers against decapentaplegic 5 | 0.0024 | 0.0229 | 0.0221 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0221 | 0.3166 |
| Schistosoma mansoni | hypothetical protein | 0.0067 | 0.0787 | 0.078 |
| Onchocerca volvulus | 0.0023 | 0.0221 | 0.0728 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Plasmodium vivax | threonine--tRNA ligase, putative | 0.0007 | 0.0011 | 0.0005 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 0.0321 | 0.0313 |
| Mycobacterium ulcerans | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0154 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0023 | 0.0221 | 0.3166 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.042 | 0.0602 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0196 | 0.3994 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0149 | 0.303 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Mycobacterium leprae | POSSIBLE O-SUCCINYLBENZOIC ACID--CoA LIGASE MENE (OSB-CoA SYNTHETASE) (O-SUCCINYLBENZOATE-CoA SYNTHASE) | 0.0007 | 0.0007 | 0.0181 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Brugia malayi | Smad1 | 0.0024 | 0.0229 | 0.037 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0023 | 0.0221 | 0.5394 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0151 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Mycobacterium tuberculosis | Fatty-acid-CoA synthetase FadD17 (fatty-acid-CoA synthase) (fatty-acid-CoA ligase) | 0.0007 | 0.0007 | 0.0106 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtF | 0.0007 | 0.0007 | 0.0106 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0229 | 0.5587 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1324 | 0.1317 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0284 | 0.6849 |
| Plasmodium vivax | SET domain protein, putative | 0.0029 | 0.0299 | 0.0426 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0023 | 0.0221 | 0.4883 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0284 | 0.5783 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.006 | 0.0697 | 0.069 |
| Echinococcus multilocularis | tar DNA binding protein | 0.0063 | 0.0741 | 0.0734 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.042 | 0.0925 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0149 | 0.303 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0221 | 0.0357 |
| Giardia lamblia | Hexose transporter | 0.0018 | 0.0149 | 0.346 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Entamoeba histolytica | hypothetical protein | 0.0041 | 0.0444 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0409 | 0.0672 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0284 | 0.6932 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0409 | 0.0402 |
| Loa Loa (eye worm) | MH1 domain-containing protein | 0.0011 | 0.0057 | 0.0083 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0426 | 0.6107 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1554 | 0.1547 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1554 | 0.1547 |
| Mycobacterium ulcerans | threonyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0154 |
| Brugia malayi | RNA binding protein | 0.0063 | 0.0741 | 0.1227 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0149 | 0.0236 |
| Mycobacterium ulcerans | peptide synthetase Nrp (peptide synthase) | 0.0007 | 0.0007 | 0.0106 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0419 | 0.0412 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0419 | 0.9429 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0149 | 0.0206 |
| Chlamydia trachomatis | proline--tRNA ligase | 0.0013 | 0.0092 | 0.2978 |
| Toxoplasma gondii | Acetyl-coenzyme A synthetase 2, putative | 0.0007 | 0.0007 | 0.0016 |
| Toxoplasma gondii | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0024 |
| Leishmania major | aldehyde dehydrogenase, mitochondrial precursor | 0.006 | 0.0697 | 1 |
| Echinococcus multilocularis | Smad4 | 0.0024 | 0.0229 | 0.0221 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Toxoplasma gondii | propionate-CoA ligase | 0.0007 | 0.0007 | 0.0016 |
| Mycobacterium tuberculosis | Peptide synthetase MbtE (peptide synthase) | 0.0007 | 0.0007 | 0.0106 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0149 | 0.0141 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0149 | 0.0482 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0141 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0149 | 0.0236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.2561 | 0.5643 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.049 | 1 |
| Schistosoma mansoni | hypothetical protein | 0.0096 | 0.1156 | 0.115 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0284 | 0.4068 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 0.6858 | 1 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Mycobacterium ulcerans | O-succinylbenzoic acid--CoA ligase | 0.0007 | 0.0007 | 0.0106 |
| Echinococcus granulosus | GPCR family 2 | 0.0031 | 0.0321 | 0.0313 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Toxoplasma gondii | aldehyde dehydrogenase | 0.006 | 0.0697 | 0.1536 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0221 | 0.0357 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0151 |
| Schistosoma mansoni | aldehyde dehydrogenase | 0.006 | 0.0697 | 0.069 |
| Mycobacterium leprae | Probable fatty-acid-CoA synthetase FadD22 (fatty-acid-CoA ligase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0181 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0149 | 0.0141 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 0.0321 | 0.0313 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0149 | 0.0141 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Mycobacterium ulcerans | long-chain-acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0007 | 0.0007 | 0.0025 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.049 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Plasmodium falciparum | protein kinase 6 | 0.0536 | 0.6858 | 1 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0029 | 0.0299 | 0.0292 |
| Brugia malayi | MH2 domain containing protein | 0.0011 | 0.0057 | 0.0083 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0419 | 0.0689 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0221 | 0.0357 |
| Plasmodium vivax | glycine--tRNA ligase, putative | 0.0007 | 0.0011 | 0.0005 |
| Trypanosoma brucei | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0151 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.1554 | 0.2257 |
| Trypanosoma brucei | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0218 |
| Schistosoma mansoni | hypothetical protein | 0.0031 | 0.0321 | 0.0313 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.4538 | 1 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1554 | 0.1547 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0409 | 1 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0106 |
| Brugia malayi | Pre-SET motif family protein | 0.0029 | 0.0299 | 0.0488 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0426 | 0.145 |
| Echinococcus granulosus | survival motor neuron protein 1 | 0.0468 | 0.5985 | 0.5982 |
| Mycobacterium ulcerans | aldehyde dehydrogenase | 0.006 | 0.0697 | 1 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.1554 | 0.3424 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0149 | 0.0206 |
| Echinococcus granulosus | smad | 0.0024 | 0.0229 | 0.0221 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0017 | 0.0144 | 0.02 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0284 | 0.0403 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0506 |
| Brugia malayi | hypothetical protein | 0.015 | 0.1858 | 0.3096 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0419 | 0.0412 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0426 | 0.6107 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0284 | 0.0276 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.009 | 0.0138 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0149 | 0.0141 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0149 | 1 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.042 | 0.0602 |
| Mycobacterium leprae | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase) (ThrRS) (Threonine-tRNA ligase) | 0.0007 | 0.0011 | 0.0262 |
| Echinococcus multilocularis | aldehyde dehydrogenase, mitochondrial | 0.006 | 0.0697 | 0.069 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0011 | 0.0057 | 0.0083 |
| Echinococcus granulosus | mothers against decapentaplegic 6 | 0.0011 | 0.0057 | 0.005 |
| Brugia malayi | threonyl-tRNA synthetase, cytoplasmic | 0.0007 | 0.0011 | 0.0006 |
| Schistosoma mansoni | smad | 0.0024 | 0.0229 | 0.0221 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0029 | 0.0299 | 0.0292 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0031 | 0.0321 | 0.0524 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.012 | 0.0188 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0041 | 0.0444 | 0.0437 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0419 | 0.0412 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0299 | 0.0488 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0419 | 0.0689 |
| Schistosoma mansoni | smad1 5 8 and | 0.0024 | 0.0229 | 0.0221 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Mycobacterium tuberculosis | Probable peptide synthetase Nrp (peptide synthase) | 0.0007 | 0.0007 | 0.0106 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0506 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0017 | 0.0144 | 0.2071 |
| Echinococcus multilocularis | glycyl tRNA synthetase | 0.0007 | 0.0011 | 0.0003 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Onchocerca volvulus | 0.0096 | 0.1156 | 0.3922 | |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0388 | 0.0381 |
| Schistosoma mansoni | survival motor neuron protein | 0.0096 | 0.1156 | 0.115 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0149 | 0.0327 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.0029 | 0.0299 | 0.0292 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0029 | 0.0299 | 0.0292 |
| Loa Loa (eye worm) | RNA binding protein | 0.0063 | 0.0741 | 0.1227 |
| Plasmodium falciparum | threonine--tRNA ligase | 0.0007 | 0.0011 | 0.0005 |
| Brugia malayi | MH1 domain containing protein | 0.0013 | 0.009 | 0.0138 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0426 | 0.868 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.1554 | 0.2587 |
| Onchocerca volvulus | Mothers against decapentaplegic homolog | 0.0011 | 0.0057 | 0.017 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Loa Loa (eye worm) | Smad1 | 0.0024 | 0.0229 | 0.037 |
| Mycobacterium tuberculosis | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase)(ThrRS) (threonine-tRNA ligase) | 0.0007 | 0.0011 | 0.0154 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0031 | 0.0321 | 0.0313 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.049 | 0.7035 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0409 | 0.0672 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Entamoeba histolytica | hypothetical protein | 0.0041 | 0.0444 | 1 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0029 | 0.0299 | 0.0292 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.1554 | 0.2257 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0284 | 0.0276 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0149 | 0.0327 |
| Brugia malayi | hypothetical protein | 0.0041 | 0.0444 | 0.0731 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0041 | 0.0444 | 0.0437 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.042 | 0.0602 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0144 | 0.0229 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0321 | 0.0524 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Mycobacterium ulcerans | acetyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0284 | 0.0276 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0426 | 0.145 |
| Brugia malayi | Pre-SET motif family protein | 0.0205 | 0.257 | 0.4287 |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.0149 | 0.2131 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0149 | 0.2131 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0031 | 0.0321 | 0.0313 |
| Schistosoma mansoni | Smad4 | 0.0024 | 0.0229 | 0.0221 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0106 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0149 | 0.303 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0149 | 0.303 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.049 | 0.0705 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0409 | 0.0402 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0144 | 0.0229 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0149 | 0.0141 |
| Loa Loa (eye worm) | RNA recognition domain-containing protein domain-containing protein | 0.0063 | 0.0741 | 0.1227 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0023 | 0.0221 | 0.4883 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Entamoeba histolytica | hypothetical protein | 0.0041 | 0.0444 | 1 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.049 | 0.0705 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0506 |
| Brugia malayi | hypothetical protein | 0.0468 | 0.5985 | 1 |
| Brugia malayi | MH2 domain containing protein | 0.0024 | 0.0229 | 0.037 |
| Entamoeba histolytica | glycyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0076 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD10 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0106 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0419 | 0.0689 |
| Toxoplasma gondii | threonyl-tRNA synthetase family protein | 0.0007 | 0.0011 | 0.0024 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Echinococcus granulosus | Smad4 | 0.0024 | 0.0229 | 0.0221 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0149 | 0.0506 |
| Schistosoma mansoni | smad1 5 8 and | 0.0024 | 0.0229 | 0.0221 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.0144 | 0.0229 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0284 | 0.4068 |
| Trypanosoma brucei | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0151 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0409 | 0.0402 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0409 | 0.0672 |
| Giardia lamblia | Sugar-proton symporter | 0.0018 | 0.0149 | 0.346 |
| Echinococcus granulosus | glycyl tRNA synthetase | 0.0007 | 0.0011 | 0.0003 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0426 | 0.145 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0426 | 0.868 |
| Mycobacterium tuberculosis | Phenyloxazoline synthase MbtB (phenyloxazoline synthetase) | 0.0007 | 0.0007 | 0.0106 |
| Trichomonas vaginalis | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0036 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0351 | 0.4469 | 0.7463 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0149 | 0.0141 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0221 | 0.0357 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0284 | 0.0966 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0023 | 0.0221 | 0.4883 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0149 | 0.0506 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0023 | 0.0221 | 0.3166 |
| Mycobacterium tuberculosis | P-hydroxybenzoyl-AMP ligase FadD22 | 0.0007 | 0.0007 | 0.0106 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0221 | 0.3166 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0007 | 0.0007 | 0.0025 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0284 | 0.0462 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.1554 | 0.2587 |
| Schistosoma mansoni | tar DNA-binding protein | 0.0063 | 0.0741 | 0.0734 |
| Schistosoma mansoni | smad1 5 8 and | 0.0024 | 0.0229 | 0.0221 |
| Loa Loa (eye worm) | nuclear factor I | 0.0013 | 0.009 | 0.0138 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0351 | 0.4469 | 0.7463 |
| Echinococcus multilocularis | smad | 0.0024 | 0.0229 | 0.0221 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0151 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0149 | 0.0236 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0031 | 0.0321 | 0.0313 |
| Echinococcus multilocularis | microtubule associated protein 2 | 0.0778 | 1 | 1 |
| Mycobacterium ulcerans | bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ACP synthetase | 0.0007 | 0.0007 | 0.0106 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0284 | 0.0625 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.1554 | 0.5291 |
| Onchocerca volvulus | 0.0018 | 0.0149 | 0.0482 | |
| Echinococcus granulosus | mothers against decapentaplegic 5 | 0.0024 | 0.0229 | 0.0221 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 15 uM | Plasmodium falciparum 3D7 EC50 (uM) as measured by SYBR green dye | Saint Jude. | 20485428 |
| EC50 (functional) | = 15 uM | Plasmodium falciparum K1 EC50 (uM) as measured by SYBR green dye | Saint Jude. | 20485428 |
| EC50 (functional) | > 15 uM | ST_JUDE: Plasmodium falciparum K1 EC50 (uM) as measured by SYBR green dye | ChEMBL. | 20485428 |
| EC50 (functional) | > 15 uM | ST_JUDE: Plasmodium falciparum 3D7 EC50 (uM) as measured by SYBR green dye | ChEMBL. | 20485428 |
| Growth Inhibition (functional) | = 9.0986 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 16.117166519165 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| Inhibition (functional) | = -7.14026941148898 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -5.94811598220234 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.72 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = -1.02 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 0 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 4 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 7.32464924733365 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 7.324649247333653 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 25.7057699712686 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 93 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Percent growth inhibition (functional) | = 29.1 % | Plasmodium falciparum 3D7 % growth inhibition at 7uM as measured by SYBR green dye | Saint Jude. | 20485428 |
| Percent growth inhibition (functional) | = 45.4 % | Plasmodium falciparum 3D7 % growth inhibition at 7uM as measured by YOYO-3 red dye | Saint Jude. | 20485428 |
| Ratio (functional) | = 0.913793103448276 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.3492 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.291 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0819 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Trypanosoma brucei gambiense | |||
| Plasmodium falciparum | ChEMBL23 | 20485428 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL589951
- Search by Saint Jude
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.