Detailed information for compound 598177
Basic information
Technical information
- Name: Unnamed compound
- MW: 362.428 | Formula: C20H22N6O
-
H donors: 3
H acceptors: 3
LogP: 3.5
Rotable bonds: 7
Rule of 5 violations (Lipinski): 1 - SMILES: O=C(Nc1ccccc1)Nc1ccc(cc1)Nc1nc(C)cc(n1)N(C)C
- InChi: 1S/C20H22N6O/c1-14-13-18(26(2)3)25-19(21-14)22-16-9-11-17(12-10-16)24-20(27)23-15-7-5-4-6-8-15/h4-13H,1-3H3,(H,21,22,25)(H2,23,24,27)
- InChiKey: PNOKFRCVUHGEFF-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
No synonyms found for this compound
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Trypanosoma brucei | carbonic anhydrase-like protein | 0.0225 | 0.2876 | 0.6166 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0038 | 0.0305 | 0.0389 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0305 | 0.0277 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0113 | 0.0115 |
| Toxoplasma gondii | pyruvate dehydrogenase complex subunit PDH-E3II | 0.0076 | 0.0827 | 0.1712 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0171 | 0.031 |
| Trypanosoma cruzi | carbonic anhydrase-like protein, putative | 0.0225 | 0.2876 | 0.6166 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.0061 | 0.0071 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase, point mutation | 0.0076 | 0.0827 | 0.1729 |
| Loa Loa (eye worm) | eukaryotic-type carbonic anhydrase | 0.0122 | 0.1458 | 0.2425 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0282 | 0.0255 |
| Mycobacterium ulcerans | hypothetical protein | 0.0038 | 0.0305 | 0.0601 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0123 | 0.014 |
| Echinococcus multilocularis | Regulator of G protein signaling 20 | 0.0021 | 0.0071 | 0.0043 |
| Wolbachia endosymbiont of Brugia malayi | exonuclease III | 0.002 | 0.0062 | 0.043 |
| Mycobacterium tuberculosis | Probable soluble pyridine nucleotide transhydrogenase SthA (STH) (NAD(P)(+) transhydrogenase [B-specific]) (nicotinamide nucleot | 0.0076 | 0.0827 | 0.1081 |
| Schistosoma mansoni | carbonic anhydrase II (carbonate dehydratase II) | 0.0225 | 0.2876 | 0.2856 |
| Toxoplasma gondii | phosphofructokinase PFKII | 0.0096 | 0.1098 | 0.2293 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0171 | 0.0144 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Onchocerca volvulus | 0.0038 | 0.0305 | 0.0405 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 0.1458 | 0.2425 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0028 | 0.0046 |
| Plasmodium falciparum | NAD(P)H-dependent glutamate synthase, putative | 0.002 | 0.0061 | 0.0046 |
| Trypanosoma cruzi | calpain cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Echinococcus granulosus | dihydropyrimidine dehydrogenase NADP | 0.002 | 0.0061 | 0.0033 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.0157 | 0.1948 | 0.1926 |
| Echinococcus multilocularis | musashi | 0.0029 | 0.0187 | 0.016 |
| Mycobacterium ulcerans | dehydrogenase | 0.002 | 0.0061 | 0.0071 |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0242 | 0.3117 | 0.4181 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0391 | 0.0786 |
| Loa Loa (eye worm) | RGS-3 protein | 0.0021 | 0.0071 | 0.0118 |
| Onchocerca volvulus | 0.0029 | 0.0187 | 0.0233 | |
| Mycobacterium tuberculosis | NADPH:adrenodoxin oxidoreductase FprA (NADPH-ferredoxin reductase) | 0.002 | 0.0061 | 0.0044 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0122 | 0.1458 | 0.2425 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.032 | 0.041 |
| Loa Loa (eye worm) | hypothetical protein | 0.0065 | 0.0677 | 0.1126 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.002 | 0.0062 | 0.0074 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0354 | 0.4647 | 0.6746 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Leishmania major | 2,4-dienoyl-coa reductase fadh1, putative | 0.002 | 0.0061 | 0.0071 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.0065 | 0.0677 | 0.1392 |
| Giardia lamblia | NADH oxidase lateral transfer candidate | 0.0076 | 0.0827 | 0.1934 |
| Echinococcus multilocularis | neutral alpha glucosidase AB | 0.0039 | 0.0325 | 0.0298 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0354 | 0.4647 | 0.6746 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0305 | 0.0277 |
| Giardia lamblia | Fructose-bisphosphate aldolase | 0.0318 | 0.4158 | 1 |
| Brugia malayi | 6-phosphofructokinase | 0.0354 | 0.4648 | 0.7729 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 0.7156 | 1 |
| Schistosoma mansoni | microtubule-associated protein tau | 0.0743 | 1 | 1 |
| Mycobacterium ulcerans | NADPH dependent 2,4-dienoyl-CoA reductase FadH | 0.002 | 0.0061 | 0.0071 |
| Echinococcus granulosus | lysosomal alpha glucosidase | 0.0177 | 0.2222 | 0.2201 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0322 | 0.0637 |
| Wolbachia endosymbiont of Brugia malayi | NADPH-dependent glutamate synthase beta chain | 0.002 | 0.0061 | 0.041 |
| Giardia lamblia | Thioredoxin reductase | 0.002 | 0.0061 | 0.0079 |
| Mycobacterium tuberculosis | Probable thioredoxin reductase TrxB2 (TRXR) (TR) | 0.002 | 0.0061 | 0.0044 |
| Schistosoma mansoni | ap endonuclease | 0.002 | 0.0062 | 0.0034 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0177 | 0.2222 | 0.3695 |
| Trypanosoma cruzi | ATP-dependent 6-phosphofructokinase, glycosomal | 0.0354 | 0.4647 | 1 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Loa Loa (eye worm) | calpain 5 | 0.0021 | 0.0071 | 0.0118 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0508 |
| Schistosoma mansoni | alpha-glucosidase | 0.0153 | 0.1883 | 0.186 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0047 | 0.0433 | 0.0406 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0506 |
| Brugia malayi | phosphofructokinase | 0.0354 | 0.4647 | 0.7727 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.0076 | 0.0827 | 0.0801 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0039 | 0.0325 | 0.054 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 0.1458 | 0.2425 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0038 | 0.0305 | 0.0376 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0453 | 0.6014 | 1 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0391 | 0.0786 |
| Echinococcus granulosus | carbonic anhydrase II | 0.0225 | 0.2876 | 0.2856 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0322 | 0.0637 |
| Trypanosoma brucei | trypanothione reductase | 0.0219 | 0.2793 | 0.5987 |
| Echinococcus granulosus | A kinase anchor protein 10 mitochondrial | 0.0021 | 0.0071 | 0.0043 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0078 | 0.0109 |
| Echinococcus multilocularis | diuretic hormone 44 receptor GPRdih2 | 0.0051 | 0.0484 | 0.0458 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Brugia malayi | GTP-binding regulatory protein Gs alpha-S chain, putative | 0.0047 | 0.0433 | 0.072 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0391 | 0.0786 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.011 | 0.1298 | 0.2158 |
| Mycobacterium tuberculosis | Probable 6-phosphofructokinase PfkA (phosphohexokinase) (phosphofructokinase) | 0.0354 | 0.4647 | 0.6253 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0391 | 0.0509 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0508 |
| Echinococcus granulosus | family C2 unassigned peptidase C02 family | 0.0074 | 0.0797 | 0.0772 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Echinococcus multilocularis | dihydropyrimidine dehydrogenase (NADP+) | 0.002 | 0.0061 | 0.0033 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.0065 | 0.0677 | 0.0651 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0074 | 0.0797 | 0.0772 |
| Brugia malayi | PXA domain containing protein | 0.0021 | 0.0071 | 0.0118 |
| Trypanosoma brucei | pyridine nucleotide-disulphide oxidoreductase, putative | 0.002 | 0.0061 | 0.0071 |
| Schistosoma mansoni | glutamate synthase | 0.002 | 0.0061 | 0.0033 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0028 | 0.0046 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.032 | 0.0565 |
| Toxoplasma gondii | non-proton pumping type-II NADH dehydrogenase I | 0.002 | 0.0061 | 0.007 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0039 | 0.0325 | 0.0576 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0171 | 0.0144 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0354 | 0.4647 | 0.6746 |
| Plasmodium vivax | NAD(P)H-dependent glutamate synthase, putative | 0.002 | 0.0061 | 0.0046 |
| Plasmodium falciparum | protein kinase 6 | 0.0536 | 0.7156 | 1 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0171 | 0.0144 |
| Wolbachia endosymbiont of Brugia malayi | thioredoxin reductase | 0.002 | 0.0061 | 0.041 |
| Schistosoma mansoni | hypothetical protein | 0.002 | 0.0061 | 0.0033 |
| Trypanosoma brucei | dihydrolipoyl dehydrogenase | 0.0076 | 0.0827 | 0.1729 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0305 | 0.0404 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0028 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0171 | 0.0285 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase, dimerisation domain containing protein | 0.0056 | 0.055 | 0.0914 |
| Plasmodium falciparum | ferrodoxin reductase-like protein | 0.002 | 0.0061 | 0.0046 |
| Trypanosoma brucei | NADH dehydrogenase | 0.002 | 0.0061 | 0.0071 |
| Trypanosoma brucei | polo-like protein kinase | 0.0105 | 0.1231 | 0.2604 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0207 | 0.0344 |
| Brugia malayi | alpha keto acid dehydrogenase complex, E3 component, lipoamide dehydrogenase | 0.0056 | 0.055 | 0.0914 |
| Echinococcus multilocularis | beta adrenergic receptor kinase | 0.0024 | 0.0108 | 0.0081 |
| Echinococcus multilocularis | axis inhibition protein axin | 0.0021 | 0.0071 | 0.0043 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Trichomonas vaginalis | disulfide oxidoreductase, putative | 0.002 | 0.0061 | 0.0048 |
| Entamoeba histolytica | fructose-1,6-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.8935 |
| Loa Loa (eye worm) | hypothetical protein | 0.007 | 0.0748 | 0.1244 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0506 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase | 0.0076 | 0.0827 | 0.1729 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0219 | 0.2793 | 0.3744 |
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.0065 | 0.0677 | 0.0651 |
| Echinococcus granulosus | serine:threonine protein kinase PLK1 | 0.0105 | 0.1231 | 0.1206 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.032 | 0.0565 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Echinococcus multilocularis | expressed protein | 0.0406 | 0.5371 | 0.5358 |
| Toxoplasma gondii | exonuclease III APE | 0.002 | 0.0062 | 0.0074 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0322 | 0.043 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Entamoeba histolytica | fructose-1,6-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.8935 |
| Trichomonas vaginalis | 6-phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Entamoeba histolytica | phosphofructokinase, putative | 0.0354 | 0.4647 | 1 |
| Brugia malayi | Ets-domain containing protein | 0.0071 | 0.076 | 0.1264 |
| Trichomonas vaginalis | maltase-glucoamylase, putative | 0.0039 | 0.0325 | 0.0434 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Schistosoma mansoni | alpha-glucosidase | 0.0153 | 0.1883 | 0.186 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0028 | 0.0046 |
| Brugia malayi | Putative carbonic anhydrase 5 precursor | 0.0225 | 0.2876 | 0.4782 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0171 | 0.0144 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0038 | 0.0305 | 0.0278 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0047 | 0.0433 | 0.0406 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.152 | 0.1496 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.002 | 0.0062 | 0.0103 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Trypanosoma brucei | ATP-dependent 6-phosphofructokinase, glycosomal | 0.0354 | 0.4647 | 1 |
| Echinococcus granulosus | axis inhibition protein axin | 0.0021 | 0.0071 | 0.0043 |
| Echinococcus multilocularis | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0391 | 0.0778 |
| Schistosoma mansoni | carbonic anhydrase II (carbonate dehydratase II) | 0.0225 | 0.2876 | 0.2856 |
| Brugia malayi | calpain family protein 1 | 0.007 | 0.0748 | 0.1244 |
| Entamoeba histolytica | serine/threonine protein kinase, putative | 0.0105 | 0.1231 | 0.2552 |
| Brugia malayi | calpain family protein 1 | 0.007 | 0.0748 | 0.1244 |
| Toxoplasma gondii | 6-phosphofructokinase | 0.0096 | 0.1098 | 0.2293 |
| Echinococcus granulosus | beta-adrenergic receptor kinase | 0.0024 | 0.0108 | 0.0081 |
| Plasmodium falciparum | glutathione reductase | 0.0076 | 0.0827 | 0.1121 |
| Brugia malayi | regulator of G-protein signaling rgs-7 | 0.0021 | 0.0071 | 0.0118 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0171 | 0.0347 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0065 | 0.0677 | 0.0651 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.0161 | 0.1998 | 0.3323 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0171 | 0.031 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.0187 | 0.0312 |
| Mycobacterium tuberculosis | Putative ferredoxin reductase | 0.0499 | 0.6649 | 0.8963 |
| Brugia malayi | glutathione reductase | 0.0219 | 0.2793 | 0.4645 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0029 | 0.0187 | 0.0312 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1276 | 0.1251 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 0.0071 | 0.0063 |
| Trichomonas vaginalis | dihydropyrimidine dehydrogenase, putative | 0.002 | 0.0061 | 0.0048 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0322 | 0.0637 |
| Echinococcus granulosus | cadherin EGF LAG seven pass G type receptor | 0.0051 | 0.0484 | 0.0458 |
| Echinococcus granulosus | NADPH:adrenodoxin oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0171 | 0.0285 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.032 | 0.0293 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0028 | 0.0046 |
| Loa Loa (eye worm) | AGC/GRK/GRK protein kinase | 0.0024 | 0.0108 | 0.018 |
| Loa Loa (eye worm) | PLK/PLK1 protein kinase | 0.0105 | 0.1231 | 0.2047 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0038 | 0.0305 | 0.0405 |
| Brugia malayi | Muscleblind-like protein | 0.0157 | 0.1948 | 0.324 |
| Echinococcus multilocularis | cadherin EGF LAG seven pass G type receptor | 0.0051 | 0.0484 | 0.0458 |
| Echinococcus multilocularis | apoptosis inducing factor 1 mitochondrial | 0.002 | 0.0061 | 0.0033 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0028 | 0.0046 |
| Schistosoma mansoni | axis inhibition protein axin | 0.0021 | 0.0071 | 0.0043 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0322 | 0.043 |
| Echinococcus multilocularis | calpain family protein 1, d | 0.0049 | 0.0461 | 0.0434 |
| Trypanosoma brucei | antigen, putative | 0.0021 | 0.0071 | 0.0093 |
| Onchocerca volvulus | 0.0038 | 0.0305 | 0.0405 | |
| Entamoeba histolytica | hypothetical protein | 0.0021 | 0.0071 | 0.0022 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0047 | 0.0433 | 0.0406 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.002 | 0.0062 | 0.0074 |
| Schistosoma mansoni | gabp alpha | 0.0071 | 0.076 | 0.0735 |
| Trichomonas vaginalis | glutamate synthase, putative | 0.002 | 0.0061 | 0.0048 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0555 | 0.7415 | 1 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.002 | 0.0062 | 0.0046 |
| Entamoeba histolytica | phosphofructokinase, putative | 0.0354 | 0.4647 | 1 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Loa Loa (eye worm) | AGC/GRK/BARK protein kinase | 0.0024 | 0.0108 | 0.018 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0508 |
| Trichomonas vaginalis | dihydrolipoamide dehydrogenase, putative | 0.002 | 0.0061 | 0.0048 |
| Chlamydia trachomatis | fructose-6-phosphate phosphotransferase | 0.0096 | 0.1098 | 1 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0038 | 0.0305 | 0.0333 |
| Echinococcus granulosus | GA binding protein alpha chain | 0.0071 | 0.076 | 0.0735 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.002 | 0.0062 | 0.0034 |
| Leishmania major | protein kinase, putative,polo-like protein kinase, putative | 0.0105 | 0.1231 | 0.2604 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0063 | 0.0644 | 0.0618 |
| Trichomonas vaginalis | disulfide oxidoreductase, putative | 0.002 | 0.0061 | 0.0048 |
| Leishmania major | NADH dehydrogenase, putative | 0.002 | 0.0061 | 0.0071 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0029 | 0.0187 | 0.0312 |
| Echinococcus granulosus | regulator of G protein signaling 7 | 0.0021 | 0.0071 | 0.0043 |
| Echinococcus multilocularis | regulator of G protein signaling 3 | 0.0021 | 0.0071 | 0.0043 |
| Echinococcus multilocularis | NADPH:adrenodoxin oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Brugia malayi | calpain 5 | 0.0021 | 0.0071 | 0.0118 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0171 | 0.1067 |
| Loa Loa (eye worm) | hypothetical protein | 0.002 | 0.0061 | 0.0101 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Loa Loa (eye worm) | GTP-binding regulatory protein Gs alpha-S chain | 0.0047 | 0.0433 | 0.072 |
| Brugia malayi | glutamate synthase | 0.002 | 0.0061 | 0.0101 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus multilocularis | glutamate synthase | 0.002 | 0.0061 | 0.0033 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0039 | 0.0325 | 0.0434 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0499 | 0.6649 | 0.8963 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.002 | 0.0062 | 0.0103 |
| Schistosoma mansoni | carbonic anhydrase-related | 0.0122 | 0.1458 | 0.1434 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0039 | 0.0325 | 0.0643 |
| Toxoplasma gondii | hypothetical protein | 0.0122 | 0.1458 | 0.3066 |
| Echinococcus multilocularis | dihydropyrimidine dehydrogenase (NADP+) | 0.002 | 0.0061 | 0.0033 |
| Mycobacterium tuberculosis | Conserved protein | 0.0038 | 0.0305 | 0.0376 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0038 | 0.0305 | 0.0601 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Trichomonas vaginalis | disulfide oxidoreductase, putative | 0.002 | 0.0061 | 0.0048 |
| Brugia malayi | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Schistosoma mansoni | calpain C (C02 family) | 0.0021 | 0.0071 | 0.0043 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.4693 | 0.6545 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 0.0071 | 0.0063 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0171 | 0.015 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0391 | 0.0786 |
| Schistosoma mansoni | hypothetical protein | 0.0122 | 0.1458 | 0.1434 |
| Echinococcus multilocularis | regulator of G protein signaling 7 | 0.0021 | 0.0071 | 0.0043 |
| Plasmodium vivax | 6-phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1501 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0028 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus granulosus | dihydropyrimidine dehydrogenase NADP | 0.002 | 0.0061 | 0.0033 |
| Trypanosoma cruzi | carbonic anhydrase-like protein, putative | 0.0225 | 0.2876 | 0.6166 |
| Brugia malayi | 6-phosphofructokinase | 0.0354 | 0.4647 | 0.7727 |
| Plasmodium vivax | SET domain protein, putative | 0.0065 | 0.0677 | 0.0911 |
| Echinococcus multilocularis | lamin dm0 | 0.0029 | 0.0187 | 0.016 |
| Loa Loa (eye worm) | phosphofructokinase | 0.0354 | 0.4647 | 0.7727 |
| Trichomonas vaginalis | glutamate synthase, putative | 0.002 | 0.0061 | 0.0048 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0024 | 0.0108 | 0.0081 |
| Schistosoma mansoni | hypothetical protein | 0.0051 | 0.0484 | 0.0458 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.152 | 0.2527 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus granulosus | neutral alpha glucosidase AB | 0.0039 | 0.0325 | 0.0298 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Leishmania major | hypothetical protein, conserved | 0.002 | 0.0061 | 0.0071 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 0.0071 | 0.0063 |
| Brugia malayi | Fli-1 protein | 0.0216 | 0.2749 | 0.4571 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0053 | 0.0508 | 0.0674 |
| Loa Loa (eye worm) | G protein signaling regulator EGL-10 | 0.0021 | 0.0071 | 0.0118 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.0076 | 0.0827 | 0.0801 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus multilocularis | Ataxin 2, N terminal,domain containing protein | 0.0024 | 0.0109 | 0.0081 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Mycobacterium leprae | PROBABLE 6-PHOSPHOFRUCTOKINASE PFKA (PHOSPHOHEXOKINASE) (PHOSPHOFRUCTOKINASE) | 0.0354 | 0.4647 | 0.6236 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0219 | 0.2793 | 0.388 |
| Leishmania major | kinesin, putative | 0.0021 | 0.0071 | 0.0093 |
| Schistosoma mansoni | regulator of G protein signaling 17 19 20 (rgs17 19 20) | 0.0021 | 0.0071 | 0.0043 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Echinococcus granulosus | lamin | 0.0029 | 0.0187 | 0.016 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0038 | 0.0305 | 0.0601 |
| Toxoplasma gondii | pyridine nucleotide-disulfide oxidoreductase domain-containing protein | 0.002 | 0.0061 | 0.007 |
| Schistosoma mansoni | z-protein (S1r protein) | 0.0021 | 0.0071 | 0.0043 |
| Leishmania major | 2-oxoglutarate dehydrogenase, e3 component, lipoamidedehydrogenase-like protein | 0.0076 | 0.0827 | 0.1729 |
| Schistosoma mansoni | calpain-7 (C02 family) | 0.0021 | 0.0071 | 0.0043 |
| Mycobacterium leprae | PROBABLE NADH DEHYDROGENASE NDH | 0.0499 | 0.6649 | 0.8958 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0053 | 0.0517 | 0.0714 |
| Plasmodium falciparum | carbonic anhydrase | 0.0122 | 0.1458 | 0.2007 |
| Trichomonas vaginalis | dihydroorotate dehydrogenase, putative | 0.002 | 0.0061 | 0.0048 |
| Mycobacterium tuberculosis | Dihydrolipoamide dehydrogenase LpdC (lipoamide reductase (NADH)) (lipoyl dehydrogenase) (dihydrolipoyl dehydrogenase) (diaphoras | 0.0555 | 0.7415 | 1 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0024 | 0.0108 | 0.0081 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.032 | 0.0532 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0038 | 0.0305 | 0.0278 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Schistosoma mansoni | hypothetical protein | 0.011 | 0.1298 | 0.1273 |
| Echinococcus granulosus | axis inhibition protein axin | 0.0021 | 0.0071 | 0.0043 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0039 | 0.0325 | 0.0434 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0039 | 0.0325 | 0.0434 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Trichomonas vaginalis | disulfide oxidoreductase, putative | 0.002 | 0.0061 | 0.0048 |
| Loa Loa (eye worm) | PXA domain-containing protein | 0.0021 | 0.0071 | 0.0118 |
| Trypanosoma cruzi | pyridine nucleotide-disulphide oxidoreductase, putative | 0.002 | 0.0061 | 0.0071 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0391 | 0.0786 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.032 | 0.0293 |
| Echinococcus multilocularis | regulator of G protein signaling 3 | 0.0021 | 0.0071 | 0.0043 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.032 | 0.041 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.0074 | 0.0797 | 0.0772 |
| Leishmania major | trypanothione reductase | 0.0219 | 0.2793 | 0.5987 |
| Echinococcus granulosus | Regulator of G protein signaling 20 | 0.0021 | 0.0071 | 0.0043 |
| Loa Loa (eye worm) | fli-1 protein | 0.0216 | 0.2749 | 0.4571 |
| Onchocerca volvulus | 0.0049 | 0.0461 | 0.0633 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0049 | 0.0461 | 0.0767 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase family protein | 0.002 | 0.0061 | 0.0101 |
| Brugia malayi | hypothetical protein | 0.0034 | 0.0251 | 0.0418 |
| Plasmodium vivax | ferrodoxin reductase, putative | 0.002 | 0.0061 | 0.0046 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, mitochondrial, putative | 0.0076 | 0.0827 | 0.1121 |
| Leishmania major | ATP-dependent phosphofructokinase | 0.0354 | 0.4647 | 1 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | 0.0076 | 0.0827 | 0.1121 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.002 | 0.0062 | 0.0034 |
| Loa Loa (eye worm) | hypothetical protein | 0.0029 | 0.018 | 0.0299 |
| Echinococcus multilocularis | regulator of G protein signaling 7 | 0.0021 | 0.0071 | 0.0043 |
| Schistosoma mansoni | lamin | 0.0029 | 0.0187 | 0.016 |
| Mycobacterium ulcerans | NADH dehydrogenase | 0.002 | 0.0061 | 0.0071 |
| Mycobacterium ulcerans | NADH dehydrogenase Ndh1 | 0.002 | 0.0061 | 0.0071 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.0161 | 0.1998 | 0.3323 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0038 | 0.0305 | 0.0405 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.002 | 0.0062 | 0.0048 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.032 | 0.0627 |
| Trypanosoma brucei | calpain-like protein, putative | 0.0021 | 0.0071 | 0.0093 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0065 | 0.0677 | 0.0651 |
| Wolbachia endosymbiont of Brugia malayi | thioredoxin reductase | 0.002 | 0.0061 | 0.041 |
| Schistosoma mansoni | ap endonuclease | 0.002 | 0.0062 | 0.0034 |
| Echinococcus granulosus | geminin | 0.0529 | 0.7057 | 0.7049 |
| Trypanosoma brucei | 2,4-dienoyl-coa reductase-like protein | 0.002 | 0.0061 | 0.0071 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0322 | 0.043 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0038 | 0.0305 | 0.0278 |
| Entamoeba histolytica | exodeoxyribonuclease III, putative | 0.002 | 0.0062 | 0.0003 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0322 | 0.043 |
| Plasmodium vivax | 6-phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1501 |
| Mycobacterium ulcerans | fructose-bisphosphate aldolase | 0.0155 | 0.1921 | 0.4098 |
| Plasmodium falciparum | type II NADH:ubiquinone oxidoreductase | 0.002 | 0.0061 | 0.0046 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0053 | 0.0508 | 0.104 |
| Trypanosoma cruzi | NADH dehydrogenase, putative | 0.002 | 0.0061 | 0.0071 |
| Treponema pallidum | fructose-bisphosphate aldolase | 0.0318 | 0.4158 | 0.8935 |
| Schistosoma mansoni | 6-phosphofructokinase | 0.0354 | 0.4647 | 0.4632 |
| Brugia malayi | calcium-independent alpha-latrotoxin receptor 2, putative | 0.0051 | 0.0484 | 0.0806 |
| Trypanosoma brucei | pyridine nucleotide-disulphide oxidoreductase, putative | 0.002 | 0.0061 | 0.0071 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0028 | 0.0046 |
| Treponema pallidum | diphosphate--fructose-6-phosphate 1-phosphotransferase | 0.0096 | 0.1098 | 0.2261 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0038 | 0.0305 | 0.0405 |
| Toxoplasma gondii | NADH dehydrogenase (NDH2-II) | 0.002 | 0.0061 | 0.007 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0024 | 0.0108 | 0.0081 |
| Mycobacterium leprae | Probable lipase LipE | 0.0038 | 0.0305 | 0.0333 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0305 | 0.067 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.152 | 0.1496 |
| Mycobacterium leprae | Probable fructose bisphosphate aldolase Fba | 0.0155 | 0.1921 | 0.2529 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0219 | 0.2793 | 0.5987 |
| Mycobacterium tuberculosis | Probable NADH-dependent glutamate synthase (small subunit) GltD (L-glutamate synthase) (L-glutamate synthetase) (NADH-glutamate | 0.002 | 0.0061 | 0.0044 |
| Schistosoma mansoni | hypothetical protein | 0.0051 | 0.0484 | 0.0458 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.032 | 0.0632 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.032 | 0.0293 |
| Onchocerca volvulus | 0.002 | 0.0061 | 0.0048 | |
| Schistosoma mansoni | regulator of G protein signaling | 0.0021 | 0.0071 | 0.0043 |
| Plasmodium vivax | glutathione reductase, putative | 0.0219 | 0.2793 | 0.388 |
| Echinococcus multilocularis | muscleblind protein | 0.0157 | 0.1948 | 0.1926 |
| Schistosoma mansoni | regulator of G protein signaling | 0.0021 | 0.0071 | 0.0043 |
| Schistosoma mansoni | sulfide quinone reductase | 0.002 | 0.0061 | 0.0033 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0171 | 0.0201 |
| Trypanosoma brucei | calpain-like protein, putative | 0.0021 | 0.0071 | 0.0093 |
| Echinococcus multilocularis | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Leishmania major | hypothetical protein, conserved | 0.002 | 0.0061 | 0.0071 |
| Loa Loa (eye worm) | 6-phosphofructokinase | 0.0354 | 0.4647 | 0.7727 |
| Schistosoma mansoni | ets-related | 0.0216 | 0.2749 | 0.2728 |
| Entamoeba histolytica | pyrophosphate-dependent phosphofructokinase | 0.0096 | 0.1098 | 0.2261 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.002 | 0.0062 | 0.0074 |
| Leishmania major | hypothetical protein, conserved | 0.0053 | 0.0508 | 0.104 |
| Trichomonas vaginalis | regulator of G protein signaling 5, rgs5, putative | 0.0021 | 0.0071 | 0.0063 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.4693 | 1 |
| Echinococcus granulosus | calpain A | 0.0074 | 0.0797 | 0.0772 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0508 |
| Loa Loa (eye worm) | glutathione reductase | 0.0219 | 0.2793 | 0.4645 |
| Trichomonas vaginalis | set domain proteins, putative | 0.0516 | 0.6874 | 1 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0225 | 0.2876 | 0.4782 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.032 | 0.0427 |
| Trichomonas vaginalis | disulfide oxidoreductase, putative | 0.002 | 0.0061 | 0.0048 |
| Trypanosoma brucei | calpain-like cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Schistosoma mansoni | alpha glucosidase | 0.0039 | 0.0325 | 0.0298 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Echinococcus granulosus | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Echinococcus multilocularis | pyridine nucleotide disulfide oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Echinococcus granulosus | GPCR family 2 | 0.0051 | 0.0484 | 0.0458 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.152 | 0.3198 |
| Mycobacterium ulcerans | flavoprotein disulfide reductase | 0.0076 | 0.0827 | 0.1729 |
| Echinococcus granulosus | calpain 5 | 0.0021 | 0.0071 | 0.0043 |
| Brugia malayi | Carbonic anhydrase like protein 2 precursor | 0.0122 | 0.1458 | 0.2425 |
| Mycobacterium tuberculosis | Probable nitrite reductase [NAD(P)H] large subunit [FAD flavoprotein] NirB | 0.0499 | 0.6649 | 0.8963 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.032 | 0.0627 |
| Trypanosoma cruzi | kinesin, putative | 0.0021 | 0.0071 | 0.0093 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0177 | 0.2222 | 0.2201 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Loa Loa (eye worm) | calpain | 0.0021 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.032 | 0.041 |
| Toxoplasma gondii | glycosyl hydrolase, family 31 protein | 0.0039 | 0.0325 | 0.0637 |
| Echinococcus multilocularis | GA binding protein alpha chain | 0.0071 | 0.076 | 0.0735 |
| Loa Loa (eye worm) | D-ets-4 DNA binding domain-containing protein | 0.0071 | 0.076 | 0.1264 |
| Trypanosoma brucei | glucosidase, putative | 0.0039 | 0.0325 | 0.0643 |
| Onchocerca volvulus | 0.0516 | 0.6874 | 1 | |
| Leishmania major | 2,4-dienoyl-coa reductase-like protein | 0.002 | 0.0061 | 0.0071 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.032 | 0.0532 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus multilocularis | hypothetical protein | 0.0021 | 0.0071 | 0.0043 |
| Leishmania major | hypothetical protein, conserved | 0.0038 | 0.0305 | 0.0601 |
| Giardia lamblia | Pyrophosphate-fructose 6-phosphate 1-phosphotransferase alpha subunit | 0.0096 | 0.1098 | 0.259 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0065 | 0.0677 | 0.0651 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.002 | 0.0061 | 0.0071 |
| Onchocerca volvulus | 0.0029 | 0.0187 | 0.0233 | |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.0053 | 0.0508 | 0.104 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase, LpdB | 0.0076 | 0.0827 | 0.1729 |
| Trichomonas vaginalis | dihydroorotate dehydrogenase, putative | 0.002 | 0.0061 | 0.0048 |
| Echinococcus multilocularis | 6 phosphofructokinase | 0.0354 | 0.4647 | 0.4632 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0038 | 0.0305 | 0.0376 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0047 | 0.0433 | 0.0406 |
| Mycobacterium tuberculosis | Conserved protein | 0.0038 | 0.0305 | 0.0376 |
| Mycobacterium tuberculosis | Probable membrane NADH dehydrogenase NdhA | 0.0499 | 0.6649 | 0.8963 |
| Schistosoma mansoni | hypothetical protein | 0.0529 | 0.7057 | 0.7049 |
| Entamoeba histolytica | phosphofructokinase, putative | 0.0354 | 0.4647 | 1 |
| Echinococcus granulosus | guanine nucleotide binding protein Gs subunit | 0.0047 | 0.0433 | 0.0406 |
| Loa Loa (eye worm) | eukaryotic-type carbonic anhydrase | 0.0225 | 0.2876 | 0.4782 |
| Trichomonas vaginalis | glutathione reductase, putative | 0.0076 | 0.0827 | 0.1167 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0039 | 0.0325 | 0.0434 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0305 | 0.0277 |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0038 | 0.0305 | 0.0508 |
| Brugia malayi | Probable G protein-coupled receptor kinase F19C6.1, putative | 0.0024 | 0.0108 | 0.018 |
| Echinococcus granulosus | muscleblind protein | 0.0157 | 0.1948 | 0.1926 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.002 | 0.0062 | 0.0074 |
| Echinococcus granulosus | calpain | 0.0021 | 0.0071 | 0.0043 |
| Schistosoma mansoni | hypothetical protein | 0.0024 | 0.0109 | 0.0081 |
| Loa Loa (eye worm) | glycosyl hydrolase family 31 protein | 0.0177 | 0.2222 | 0.3695 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0219 | 0.2793 | 0.4645 |
| Toxoplasma gondii | NADPH-glutathione reductase | 0.0076 | 0.0827 | 0.1712 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.0053 | 0.0508 | 0.104 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Onchocerca volvulus | 0.0103 | 0.1194 | 0.1703 | |
| Brugia malayi | intermediate filament protein | 0.0029 | 0.0187 | 0.0312 |
| Schistosoma mansoni | regulator of G protein signaling 3 rgs3 | 0.0021 | 0.0071 | 0.0043 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.032 | 0.041 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Plasmodium falciparum | thioredoxin reductase | 0.0219 | 0.2793 | 0.388 |
| Mycobacterium ulcerans | lipase LipD | 0.0038 | 0.0305 | 0.0601 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Brugia malayi | Pre-SET motif family protein | 0.0453 | 0.6014 | 1 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.0053 | 0.0508 | 0.0674 |
| Mycobacterium tuberculosis | Probable NADH dehydrogenase Ndh | 0.0499 | 0.6649 | 0.8963 |
| Echinococcus granulosus | pyridine nucleotide disulfide oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.002 | 0.0062 | 0.005 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.152 | 0.1496 |
| Loa Loa (eye worm) | hypothetical protein | 0.0157 | 0.1948 | 0.324 |
| Echinococcus multilocularis | regulator of G protein signaling | 0.0021 | 0.0071 | 0.0043 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.032 | 0.0632 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Schistosoma mansoni | regulator of G protein signaling | 0.0021 | 0.0071 | 0.0043 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0322 | 0.0637 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Brugia malayi | beta-lactamase family protein | 0.0038 | 0.0305 | 0.0508 |
| Echinococcus granulosus | calpain A | 0.0021 | 0.0071 | 0.0043 |
| Brugia malayi | hypothetical protein | 0.0053 | 0.0508 | 0.0845 |
| Echinococcus multilocularis | lysosomal alpha glucosidase | 0.0177 | 0.2222 | 0.2201 |
| Trypanosoma cruzi | kinesin, putative | 0.0021 | 0.0071 | 0.0093 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.007 | 0.0748 | 0.1244 |
| Schistosoma mansoni | regulator of G protein signaling | 0.0021 | 0.0071 | 0.0043 |
| Treponema pallidum | exodeoxyribonuclease (exoA) | 0.002 | 0.0062 | 0.0003 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Brugia malayi | Regulator of G protein signaling domain containing protein | 0.0021 | 0.0071 | 0.0118 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0113 | 0.0115 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0053 | 0.0517 | 0.0714 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0076 | 0.0827 | 0.1729 |
| Loa Loa (eye worm) | latrophilin receptor protein 2 | 0.0051 | 0.0484 | 0.0806 |
| Loa Loa (eye worm) | beta-lactamase | 0.0038 | 0.0305 | 0.0508 |
| Trichomonas vaginalis | esterase, putative | 0.0038 | 0.0305 | 0.0405 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0029 | 0.0187 | 0.0312 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.152 | 0.2179 |
| Brugia malayi | Ets-domain containing protein | 0.0071 | 0.076 | 0.1264 |
| Schistosoma mansoni | family C2 unassigned peptidase (C02 family) | 0.007 | 0.0748 | 0.0722 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0076 | 0.0827 | 1 |
| Schistosoma mansoni | carbonic anhydrase-related | 0.0122 | 0.1458 | 0.1434 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.152 | 0.1496 |
| Mycobacterium ulcerans | NADH dehydrogenase Ndh | 0.002 | 0.0061 | 0.0071 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0038 | 0.0305 | 0.0376 |
| Echinococcus multilocularis | calpain 7 (C02 family) | 0.0021 | 0.0071 | 0.0043 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0354 | 0.4647 | 0.6746 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Mycobacterium ulcerans | NADPH:adrenodoxin oxidoreductase FprA | 0.002 | 0.0061 | 0.0071 |
| Mycobacterium tuberculosis | Probable fructose-bisphosphate aldolase Fba | 0.0155 | 0.1921 | 0.2562 |
| Loa Loa (eye worm) | calpain family protein 1 | 0.0049 | 0.0461 | 0.0767 |
| Plasmodium falciparum | ATP-dependent 6-phosphofructokinase | 0.0096 | 0.1098 | 0.1501 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.152 | 0.2527 |
| Trypanosoma brucei | calpain-like protein, putative | 0.0021 | 0.0071 | 0.0093 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0038 | 0.0305 | 0.0405 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Echinococcus granulosus | calpain 7 C02 family | 0.0021 | 0.0071 | 0.0043 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.0053 | 0.0508 | 0.0674 |
| Echinococcus granulosus | intermediate filament protein | 0.0029 | 0.0187 | 0.016 |
| Trypanosoma cruzi | NADH dehydrogenase, putative | 0.002 | 0.0061 | 0.0071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Plasmodium falciparum | ATP-dependent 6-phosphofructokinase | 0.0096 | 0.1098 | 0.1501 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.032 | 0.0532 |
| Echinococcus granulosus | diuretic hormone 44 receptor GPRdih2 | 0.0051 | 0.0484 | 0.0458 |
| Echinococcus granulosus | glutamate synthase | 0.002 | 0.0061 | 0.0033 |
| Brugia malayi | Pre-SET motif family protein | 0.0065 | 0.0677 | 0.1126 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Schistosoma mansoni | lamin | 0.0029 | 0.0187 | 0.016 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0065 | 0.0677 | 0.0651 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Brugia malayi | beta-lactamase | 0.0038 | 0.0305 | 0.0508 |
| Treponema pallidum | diphosphate--fructose-6-phosphate 1-phosphotransferase | 0.0354 | 0.4647 | 1 |
| Echinococcus granulosus | regulator of G protein signaling 7 | 0.0021 | 0.0071 | 0.0043 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.032 | 0.0532 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0171 | 0.031 |
| Schistosoma mansoni | regulator of G protein signaling 17 19 20 (rgs17 19 20) | 0.0021 | 0.0071 | 0.0043 |
| Trypanosoma cruzi | 2,4-dienoyl-coa reductase fadh1, putative | 0.002 | 0.0061 | 0.0071 |
| Echinococcus granulosus | Ataxin 2 N terminaldomain containing protein | 0.0024 | 0.0109 | 0.0081 |
| Toxoplasma gondii | ABC1 family protein | 0.0038 | 0.0305 | 0.0595 |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0038 | 0.0305 | 0.0601 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0171 | 0.0209 |
| Schistosoma mansoni | hypothetical protein | 0.0051 | 0.0484 | 0.0458 |
| Loa Loa (eye worm) | hypothetical protein | 0.0161 | 0.1998 | 0.3323 |
| Mycobacterium ulcerans | NADPH:adrenodoxin oxidoreductase FprA | 0.002 | 0.0061 | 0.0071 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus granulosus | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0076 | 0.0827 | 1 |
| Echinococcus granulosus | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0038 | 0.0305 | 0.0508 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0305 | 0.0277 |
| Toxoplasma gondii | thioredoxin reductase | 0.0219 | 0.2793 | 0.5928 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0171 | 0.031 |
| Trichomonas vaginalis | apoptosis inducing factor, putative | 0.002 | 0.0061 | 0.0048 |
| Schistosoma mansoni | dihydrolipoamide dehydrogenase | 0.0076 | 0.0827 | 0.0801 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Trypanosoma brucei | kinesin, putative | 0.0021 | 0.0071 | 0.0093 |
| Mycobacterium ulcerans | monoxygenase | 0.002 | 0.0061 | 0.0071 |
| Echinococcus multilocularis | calpain | 0.0021 | 0.0071 | 0.0043 |
| Trichomonas vaginalis | disulfide oxidoreductase, putative | 0.002 | 0.0061 | 0.0048 |
| Brugia malayi | Carbonic anhydrase like protein 2 precursor | 0.0122 | 0.1458 | 0.2425 |
| Loa Loa (eye worm) | hypothetical protein | 0.0157 | 0.1948 | 0.324 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0171 | 0.0241 |
| Trypanosoma cruzi | pyridine nucleotide-disulphide oxidoreductase, putative | 0.002 | 0.0061 | 0.0071 |
| Brugia malayi | Glycosyl hydrolases family 31 protein | 0.0039 | 0.0325 | 0.054 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.2593 | 0.3599 |
| Plasmodium vivax | calpain, putative | 0.0021 | 0.0071 | 0.006 |
| Trypanosoma brucei | calpain-like protein, putative | 0.0021 | 0.0071 | 0.0093 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.032 | 0.0532 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0043 | 0.0369 | 0.0479 |
| Mycobacterium ulcerans | beta-lactamase | 0.0038 | 0.0305 | 0.0601 |
| Leishmania major | calpain, putative,cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.032 | 0.041 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0305 | 0.0532 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.152 | 0.2093 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0122 | 0.1458 | 0.2425 |
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.0161 | 0.1998 | 0.3323 |
| Mycobacterium ulcerans | NADPH:adrenodoxin oxidoreductase FprB | 0.002 | 0.0061 | 0.0071 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0322 | 0.0637 |
| Trypanosoma cruzi | 2,4-dienoyl-coa reductase-like protein, putative | 0.002 | 0.0061 | 0.0071 |
| Plasmodium falciparum | glutathione reductase | 0.0219 | 0.2793 | 0.388 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Trichomonas vaginalis | sucrase-isomaltase, putative | 0.0039 | 0.0325 | 0.0434 |
| Plasmodium vivax | type II NADH:ubiquinone oxidoreductase, putative | 0.002 | 0.0061 | 0.0046 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0282 | 0.0255 |
| Schistosoma mansoni | glutamate synthase | 0.002 | 0.0061 | 0.0033 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0038 | 0.0305 | 0.0376 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0113 | 0.0071 |
| Trypanosoma cruzi | cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Schistosoma mansoni | carbonic anhydrase-related | 0.0122 | 0.1458 | 0.1434 |
| Echinococcus multilocularis | lamin | 0.0029 | 0.0187 | 0.016 |
| Trypanosoma brucei | NADPH:adrenodoxin oxidoreductase, mitochondrial, putative | 0.002 | 0.0061 | 0.0071 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.032 | 0.0293 |
| Schistosoma mansoni | sulfide quinone reductase | 0.002 | 0.0061 | 0.0033 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 0.0071 | 0.0063 |
| Echinococcus granulosus | sulfide:quinone oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0322 | 0.0637 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0038 | 0.0305 | 0.0376 |
| Loa Loa (eye worm) | carbonic anhydrase 3 | 0.0225 | 0.2876 | 0.4782 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 0.0071 | 0.0063 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0071 | 0.0118 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase family protein | 0.002 | 0.0061 | 0.0101 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.032 | 0.0293 |
| Brugia malayi | regulator of G-protein signaling egl-10 | 0.0021 | 0.0071 | 0.0118 |
| Entamoeba histolytica | protein kinase, putative | 0.0024 | 0.0108 | 0.0104 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.032 | 0.0627 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0039 | 0.0325 | 0.0434 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.032 | 0.041 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Echinococcus multilocularis | GPCR, family 2 | 0.0051 | 0.0484 | 0.0458 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.152 | 0.2093 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.032 | 0.041 |
| Leishmania major | acetoin dehydrogenase e3 component-like protein | 0.0076 | 0.0827 | 0.1729 |
| Loa Loa (eye worm) | hypothetical protein | 0.0049 | 0.0461 | 0.0767 |
| Brugia malayi | serine/threonine-protein kinase plk-2 | 0.0105 | 0.1231 | 0.2047 |
| Brugia malayi | PXA domain containing protein | 0.0021 | 0.0071 | 0.0118 |
| Giardia lamblia | Glycerol-3-phosphate dehydrogenase | 0.002 | 0.0061 | 0.0079 |
| Schistosoma mansoni | hypothetical protein | 0.0529 | 0.7057 | 0.7049 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.2593 | 0.3599 |
| Mycobacterium tuberculosis | NAD(P)H quinone reductase LpdA | 0.0555 | 0.7415 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 0.0484 | 0.0806 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Giardia lamblia | Glutamate synthase | 0.002 | 0.0061 | 0.0079 |
| Mycobacterium tuberculosis | Possible dehydrogenase/reductase | 0.002 | 0.0061 | 0.0044 |
| Trichomonas vaginalis | fructose-bisphosphate aldolase, putative | 0.0318 | 0.4158 | 0.6033 |
| Loa Loa (eye worm) | 6-phosphofructokinase | 0.0354 | 0.4647 | 0.7727 |
| Schistosoma mansoni | Mername-AA248 (C02 family) | 0.0021 | 0.0071 | 0.0043 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0038 | 0.0305 | 0.0601 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0171 | 0.031 |
| Leishmania major | calpain-like cysteine peptidase, putative,cysteine peptidase, Clan CA, family C2, putative | 0.0021 | 0.0071 | 0.0093 |
| Echinococcus granulosus | regulator of G protein signaling 3 | 0.0021 | 0.0071 | 0.0043 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0322 | 0.043 |
| Mycobacterium ulcerans | 6-phosphofructokinase | 0.0354 | 0.4647 | 1 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0065 | 0.0677 | 0.0651 |
| Loa Loa (eye worm) | pyridine nucleotide-disufhide oxidoreductase | 0.002 | 0.0061 | 0.0101 |
| Brugia malayi | beta-lactamase family protein | 0.0038 | 0.0305 | 0.0508 |
| Leishmania major | alpha glucosidase II subunit, putative | 0.0039 | 0.0325 | 0.0643 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0105 | 0.1231 | 0.1206 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1276 | 0.1251 |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0555 | 0.7415 | 1 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Treponema pallidum | NADH oxidase | 0.0076 | 0.0827 | 0.167 |
| Echinococcus granulosus | 6 phosphofructokinase | 0.0354 | 0.4647 | 0.4632 |
| Loa Loa (eye worm) | hypothetical protein | 0.007 | 0.0748 | 0.1244 |
| Echinococcus multilocularis | axis inhibition protein axin | 0.0021 | 0.0071 | 0.0043 |
| Brugia malayi | Eukaryotic-type carbonic anhydrase family protein | 0.0122 | 0.1458 | 0.2425 |
| Schistosoma mansoni | regulator of G protein signaling | 0.0021 | 0.0071 | 0.0043 |
| Giardia lamblia | Kinase, PLK | 0.0105 | 0.1231 | 0.2912 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0171 | 0.0201 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0322 | 0.0637 |
| Echinococcus multilocularis | carbonic anhydrase II | 0.0225 | 0.2876 | 0.2856 |
| Mycobacterium ulcerans | ferredoxin reductase | 0.002 | 0.0061 | 0.0071 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0038 | 0.0305 | 0.0278 |
| Schistosoma mansoni | kinase | 0.0055 | 0.0535 | 0.0509 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.0053 | 0.0508 | 0.1029 |
| Schistosoma mansoni | intermediate filament proteins | 0.0029 | 0.0187 | 0.016 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.022 | 0.2815 | 0.2795 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Echinococcus granulosus | apoptosis inducing factor 1 mitochondrial | 0.002 | 0.0061 | 0.0033 |
| Brugia malayi | A-kinase anchor protein 10, precursor | 0.0021 | 0.0071 | 0.0118 |
| Toxoplasma gondii | pyridine nucleotide-disulfide oxidoreductase domain-containing protein | 0.002 | 0.0061 | 0.007 |
| Echinococcus multilocularis | A kinase anchor protein 10, mitochondrial | 0.0021 | 0.0071 | 0.0043 |
| Loa Loa (eye worm) | programmed cell death 8 | 0.002 | 0.0061 | 0.0101 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.032 | 0.0293 |
| Schistosoma mansoni | glutamate synthase | 0.002 | 0.0061 | 0.0033 |
| Schistosoma mansoni | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Schistosoma mansoni | disulfide oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0508 |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0038 | 0.0305 | 0.0376 |
| Toxoplasma gondii | selenide, water dikinase | 0.002 | 0.0061 | 0.007 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0305 | 0.0508 |
| Loa Loa (eye worm) | hypothetical protein | 0.011 | 0.1298 | 0.2158 |
| Echinococcus multilocularis | guanine nucleotide binding protein G(s) subunit | 0.0047 | 0.0433 | 0.0406 |
| Trichomonas vaginalis | alpha-glucosidase, putative | 0.0039 | 0.0325 | 0.0434 |
| Plasmodium falciparum | thioredoxin reductase | 0.0076 | 0.0827 | 0.1121 |
| Trichomonas vaginalis | mercuric reductase, putative | 0.0076 | 0.0827 | 0.1167 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0171 | 0.0307 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0076 | 0.0827 | 0.1375 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.002 | 0.0062 | 0.0074 |
| Trypanosoma cruzi | calpain-like cysteine peptidase, putative | 0.0021 | 0.0071 | 0.0093 |
| Schistosoma mansoni | Guanine nucleotide-binding protein G(s) subunit alpha (Adenylate cyclase-stimulating G alpha protein) | 0.0047 | 0.0433 | 0.0406 |
| Mycobacterium tuberculosis | Probable reductase | 0.0499 | 0.6649 | 0.8963 |
| Entamoeba histolytica | hypothetical protein | 0.0021 | 0.0071 | 0.0022 |
| Trypanosoma cruzi | polo-like protein kinase, putative | 0.0105 | 0.1231 | 0.2604 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0322 | 0.043 |
| Loa Loa (eye worm) | hypothetical protein | 0.0053 | 0.0508 | 0.0845 |
| Leishmania major | hypothetical protein, conserved | 0.002 | 0.0061 | 0.0071 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.022 | 0.2815 | 0.2795 |
| Mycobacterium ulcerans | glutamate synthase subunit beta | 0.002 | 0.0061 | 0.0071 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.002 | 0.0062 | 0.0048 |
| Trypanosoma cruzi | NADPH:adrenodoxin oxidoreductase, mitochondrial, putative | 0.002 | 0.0061 | 0.0071 |
| Schistosoma mansoni | calpain (C02 family) | 0.0021 | 0.0071 | 0.0043 |
| Echinococcus granulosus | expressed protein | 0.0406 | 0.5371 | 0.5358 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0076 | 0.0827 | 0.1729 |
| Echinococcus multilocularis | microtubule associated protein 2 | 0.0743 | 1 | 1 |
| Echinococcus granulosus | lamin dm0 | 0.0029 | 0.0187 | 0.016 |
| Trypanosoma cruzi | polo-like protein kinase, putative | 0.0105 | 0.1231 | 0.2604 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0028 | 0.0046 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.032 | 0.041 |
| Echinococcus multilocularis | geminin | 0.0529 | 0.7057 | 0.7049 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0076 | 0.0827 | 0.1729 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0305 | 0.0506 |
| Brugia malayi | Latrophilin receptor protein 2 | 0.0051 | 0.0484 | 0.0806 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0305 | 0.0506 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.152 | 0.1496 |
| Brugia malayi | calpain 7 | 0.0021 | 0.0071 | 0.0118 |
| Echinococcus multilocularis | family C2 unassigned peptidase (C02 family) | 0.0074 | 0.0797 | 0.0772 |
| Onchocerca volvulus | 0.0065 | 0.0677 | 0.0949 | |
| Mycobacterium tuberculosis | Conserved protein | 0.0038 | 0.0305 | 0.0376 |
| Entamoeba histolytica | glycosyl hydrolase, family 31 protein | 0.0039 | 0.0325 | 0.0576 |
| Echinococcus multilocularis | calpain A | 0.0074 | 0.0797 | 0.0772 |
| Schistosoma mansoni | axis inhibition protein axin | 0.0021 | 0.0071 | 0.0043 |
| Trichomonas vaginalis | neutral alpha-glucosidase ab precursor, putative | 0.0039 | 0.0325 | 0.0434 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.0061 | 0.0071 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0038 | 0.0305 | 0.0405 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0039 | 0.0325 | 0.0643 |
| Echinococcus multilocularis | carbonic anhydrase | 0.0122 | 0.1458 | 0.1434 |
| Chlamydia trachomatis | dihydrolipoyl dehydrogenase | 0.0076 | 0.0827 | 0.7388 |
| Trichomonas vaginalis | ap endonuclease, putative | 0.002 | 0.0062 | 0.005 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0391 | 0.0509 |
| Trichomonas vaginalis | phosphofructokinase, putative | 0.0096 | 0.1098 | 0.1562 |
| Loa Loa (eye worm) | hypothetical protein | 0.0122 | 0.1458 | 0.2425 |
| Chlamydia trachomatis | fructose-6-phosphate phosphotransferase | 0.0096 | 0.1098 | 1 |
| Echinococcus granulosus | regulator of G protein signaling 3 | 0.0021 | 0.0071 | 0.0043 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0322 | 0.0637 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Entamoeba histolytica | hypothetical protein | 0.0021 | 0.0071 | 0.0022 |
| Schistosoma mansoni | 6-phosphofructokinase | 0.0354 | 0.4647 | 0.4632 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0105 | 0.1231 | 0.1757 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0076 | 0.0827 | 0.1729 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0038 | 0.0305 | 0.0376 |
| Leishmania major | carbonic anhydrase-like protein | 0.0225 | 0.2876 | 0.6166 |
| Brugia malayi | Regulator of G protein signaling domain containing protein | 0.0021 | 0.0071 | 0.0118 |
| Mycobacterium tuberculosis | Probable NADPH dependent 2,4-dienoyl-CoA reductase FadH (2,4-dienoyl coenzyme A reductase) (4-enoyl-CoA reductase) | 0.002 | 0.0061 | 0.0044 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0028 | 0.0046 |
| Schistosoma mansoni | hypothetical protein | 0.0051 | 0.0484 | 0.0458 |
| Echinococcus multilocularis | calpain 5 | 0.0021 | 0.0071 | 0.0043 |
| Echinococcus multilocularis | serine:threonine protein kinase PLK1 | 0.0105 | 0.1231 | 0.1206 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0021 | 0.0071 | 0.0063 |
| Brugia malayi | Thioredoxin reductase | 0.0219 | 0.2793 | 0.4645 |
| Mycobacterium tuberculosis | Probable NADPH:adrenodoxin oxidoreductase FprB (adrenodoxin reductase) (AR) (ferredoxin-NADP(+) reductase) | 0.002 | 0.0061 | 0.0044 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.002 | 0.0062 | 0.0083 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, apicoplast, putative | 0.0076 | 0.0827 | 0.1121 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.2593 | 0.55 |
| Mycobacterium ulcerans | hypothetical protein | 0.002 | 0.0061 | 0.0071 |
| Brugia malayi | NADPH:adrenodoxin oxidoreductase, mitochondrial precursor | 0.002 | 0.0061 | 0.0101 |
| Onchocerca volvulus | 0.0038 | 0.0305 | 0.0405 | |
| Schistosoma mansoni | calpain-7 (C02 family) | 0.0021 | 0.0071 | 0.0043 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0305 | 0.0332 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0038 | 0.0305 | 0.0601 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0322 | 0.043 |
| Echinococcus multilocularis | sulfide:quinone oxidoreductase | 0.002 | 0.0061 | 0.0033 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, mitochondrial | 0.0076 | 0.0827 | 0.1121 |
| Mycobacterium ulcerans | thioredoxin reductase TrxB2 | 0.002 | 0.0061 | 0.0071 |
| Loa Loa (eye worm) | hypothetical protein | 0.0061 | 0.0619 | 0.1029 |
| Toxoplasma gondii | pyridine nucleotide-disulfide oxidoreductase domain-containing protein | 0.002 | 0.0061 | 0.007 |
| Entamoeba histolytica | calpain large subunit domain III containing protein | 0.0021 | 0.0071 | 0.0022 |
| Toxoplasma gondii | phosphofructokinase domain-containing protein | 0.0096 | 0.1098 | 0.2293 |
| Onchocerca volvulus | Serine\/threonine kinase homolog | 0.0105 | 0.1231 | 0.1757 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| EC50 (functional) | = 1150 nM | MMV: Inhibition of Plasmodium falciparum 3D7 (EC50). | ChEMBL. | No reference |
| Growth Inhibition (functional) | = 16.1034 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 972.9 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | = 6745 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | = 6745 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | = 6745 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | = 1.0273736715316772 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 1.02737367153168 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | = 1.25009167194366 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 4.320239067077637 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 4.32023906707764 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | = 5.54269742965698 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IC50 | = 23.775909423828125 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| Inhibition (functional) | = -35.3775482932095 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -29.1598651151287 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -29.159865115128696 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -9.06996770175644 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -1 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 0 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 LDH activity, using an LDH reporter assay. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 2 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 2.43 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 3.62 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 3.74 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 4.26 % | ST_JUDE_LEISH: Cytotoxicity at 2uM final concentration against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| Inhibition (functional) | = 10 % | GSK_TCMDC: Percent inhibition of human HepG2 cell line. Test compounds present at 10uM. | ChEMBL. | 20485427 |
| Inhibition (functional) | = 33.5671178116203 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 33.56711781162035 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 98.1 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 100 % | GSK_TCMDC: Inhibition of Plasmodium falciparum Dd2 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition (functional) | = 100 % | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole red blood cells, using parasite LDH activity as an index of growth. Test compounds present at 2uM | ChEMBL. | 20485427 |
| Inhibition frequency index (IFI) (functional) | = 6 | Inhibition Frequency Index (IFI) | GSK. | 20485427 |
| MIC90 (functional) | = 19.3 uM | MMV: CRC and MIC90 against Mtb (replicating) | ChEMBL. | No reference |
| MIC90 (functional) | > 100 uM | MMV: CRC and MIC90 against Mtb (non replicating) | ChEMBL. | No reference |
| Percent growth inhibition (functional) | = -2 % | Percent inhibition of P. falciparum lactate dehydrogenase activity (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 10 % | Percent inhibition of HepG2 growth (at 10 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 100 % | Percent inhibition of P. falciparum Dd2 growth (at 2 uM) | GSK. | 20485427 |
| Percent growth inhibition (functional) | = 101 % | Percent inhibition of P. falciparum 3D7 growth (at 2 uM) | GSK. | 20485427 |
| Ratio (functional) | = 1.01724137931034 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.3445 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0678 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0299 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 3 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 3 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| XC50 (functional) | = 6.87 | XC50 determination of P. falciparum 3D7 growth | GSK. | 20485427 |
| XC50 (functional) | = 0.13426 uM | GSK_TCMDC: Inhibition of Plasmodium falciparum 3D7 in whole erythrocytes, using parasite LDH activity as an index of growth. | ChEMBL. | 20485427 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | ||
| Trypanosoma brucei gambiense | |||
| Trypanosoma cruzi | ChEMBL23 | ||
| Leishmania infantum | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL582547
- Search by GSK
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.