Detailed information for compound 607052
Basic information
Technical information
- TDR Targets ID: 607052
- Name: [4-(4-ethylpiperazin-1-yl)-6,7-dimethoxyquino lin-3-yl]-phenylmethanone
- MW: 405.489 | Formula: C24H27N3O3
-
H donors: 0
H acceptors: 2
LogP: 3.78
Rotable bonds: 6
Rule of 5 violations (Lipinski): 1 - SMILES: CCN1CCN(CC1)c1c(cnc2c1cc(OC)c(c2)OC)C(=O)c1ccccc1
- InChi: 1S/C24H27N3O3/c1-4-26-10-12-27(13-11-26)23-18-14-21(29-2)22(30-3)15-20(18)25-16-19(23)24(28)17-8-6-5-7-9-17/h5-9,14-16H,4,10-13H2,1-3H3
- InChiKey: AQPNTDLFSJHABR-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- [4-(4-ethylpiperazin-1-yl)-6,7-dimethoxy-3-quinolyl]-phenyl-methanone
- [4-(4-ethyl-1-piperazinyl)-6,7-dimethoxy-3-quinolyl]-phenylmethanone
- [4-(4-ethylpiperazin-1-yl)-6,7-dimethoxy-quinolin-3-yl]-phenyl-methanone
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0036 | 0.0382 | 0.7297 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.5109 | 1 |
| Brugia malayi | beta-lactamase family protein | 0.0036 | 0.0382 | 0.0637 |
| Mycobacterium ulcerans | long-chain-acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Echinococcus multilocularis | cytoplasmic intermediate filament protein | 0.0026 | 0.0236 | 0.0236 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0417 | 0.0687 |
| Schistosoma mansoni | microtubule-associated protein tau | 0.0688 | 1 | 1 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD10 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0015 | 0.0071 | 0.0097 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0108 | 0.0074 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0036 | 0.0382 | 0.106 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Leishmania major | hypothetical protein, conserved | 0.0036 | 0.0382 | 0.5757 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtE | 0.0015 | 0.0071 | 0.0482 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0381 | 0.0381 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0108 | 0.018 |
| Echinococcus multilocularis | musashi | 0.0055 | 0.0653 | 0.0653 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Brugia malayi | MH2 domain containing protein | 0.0382 | 0.5489 | 0.9136 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus granulosus | TGF beta signal transducer SmadC | 0.0026 | 0.0231 | 0.0231 |
| Loa Loa (eye worm) | cytoplasmic intermediate filament protein | 0.0029 | 0.0279 | 0.0464 |
| Mycobacterium tuberculosis | Conserved protein | 0.0036 | 0.0382 | 0.106 |
| Trichomonas vaginalis | esterase, putative | 0.0036 | 0.0382 | 0.0459 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Onchocerca volvulus | 0.0015 | 0.0071 | 0.0104 | |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0262 | 0.0262 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Mycobacterium tuberculosis | Bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ArCP synthetase | 0.0015 | 0.0071 | 0.0097 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0424 | 0.052 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0498 | 1 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0015 | 0.0071 | 0.0118 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.0108 | 0.0212 |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0036 | 0.0382 | 0.0637 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0382 | 0.0637 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0108 | 0.0055 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0036 | 0.0382 | 0.106 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Wolbachia endosymbiont of Brugia malayi | bacterioferritin/cytochrome b1 | 0.0025 | 0.0222 | 1 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0424 | 0.8272 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0417 | 0.045 |
| Trichomonas vaginalis | set domain proteins, putative | 0.0475 | 0.6859 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0382 | 0.0637 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0015 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0076 | 0.0126 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0052 | 0.0612 | 0.1018 |
| Treponema pallidum | bacterioferrin (TpF1) | 0.0025 | 0.0222 | 1 |
| Schistosoma mansoni | ferritin | 0.0025 | 0.0222 | 0.0222 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0417 | 0.045 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.03 | 0.05 |
| Echinococcus granulosus | lamin | 0.0055 | 0.0653 | 0.0653 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | MH1 domain-containing protein | 0.0026 | 0.0231 | 0.0384 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0052 | 0.0612 | 1 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0052 | 0.0612 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.2856 | 0.5528 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0199 | 0.0494 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0405 | 0.0405 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0162 | 0.2133 |
| Schistosoma mansoni | Smad4 | 0.0012 | 0.0018 | 0.0018 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0036 | 0.0382 | 0.0382 |
| Loa Loa (eye worm) | nuclear factor I | 0.0014 | 0.0059 | 0.0098 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0052 | 0.0612 | 1 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0036 | 0.0382 | 0.5962 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0612 | 0.1018 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0052 | 0.0612 | 1 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0039 | 0.0418 | 0.6594 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0108 | 0.018 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Trichomonas vaginalis | ferritin, putative | 0.0025 | 0.0222 | 0.0223 |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0036 | 0.0382 | 0.5962 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0026 | 0.0231 | 0.0384 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0417 | 0.045 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0405 | 0.0405 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0015 | 0.0071 | 0.0118 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0052 | 0.0612 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0052 | 0.0612 | 1 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0037 | 0.0387 | 0.1075 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1709 | 0.1709 |
| Mycobacterium tuberculosis | Conserved protein | 0.0036 | 0.0382 | 0.106 |
| Echinococcus granulosus | cytoplasmic intermediate filament protein | 0.0026 | 0.0236 | 0.0236 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1709 | 0.1709 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0108 | 0.0108 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.006 | 0.073 | 0.073 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0417 | 0.045 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.006 | 0.073 | 0.073 |
| Mycobacterium tuberculosis | Bacterioferritin BfrB | 0.0025 | 0.0222 | 0.0564 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0036 | 0.0382 | 0.0459 |
| Echinococcus multilocularis | TGF beta signal transducer SmadC | 0.0026 | 0.0231 | 0.0231 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0417 | 0.0694 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0405 | 0.0674 |
| Echinococcus multilocularis | lamin | 0.0055 | 0.0653 | 0.0653 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0036 | 0.0382 | 0.0459 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Mycobacterium leprae | conserved hypothetical protein | 0.0036 | 0.0382 | 0.5757 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0015 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0211 | 0.0206 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0108 | 0.0108 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0612 | 0.1018 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0055 | 0.0653 | 0.1087 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0424 | 0.052 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0108 | 0.087 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0036 | 0.0382 | 0.7297 |
| Mycobacterium ulcerans | O-succinylbenzoic acid--CoA ligase | 0.0015 | 0.0071 | 0.0482 |
| Brugia malayi | beta-lactamase | 0.0036 | 0.0382 | 0.0637 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0417 | 0.045 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0424 | 0.052 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0036 | 0.0382 | 0.106 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0108 | 0.0108 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Schistosoma mansoni | ferritin | 0.0025 | 0.0222 | 0.0222 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0424 | 0.6526 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0417 | 0.6391 |
| Mycobacterium tuberculosis | Probable peptide synthetase Nrp (peptide synthase) | 0.0015 | 0.0071 | 0.0097 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0382 | 0.0637 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0108 | 0.018 |
| Schistosoma mansoni | ferritin light chain | 0.0025 | 0.0222 | 0.0222 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0036 | 0.0382 | 0.7297 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus multilocularis | Mitotic checkpoint protein PRCC, C terminal | 0.013 | 0.1761 | 0.1761 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0418 | 0.0696 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0405 | 1 |
| Brugia malayi | MH1 domain containing protein | 0.0026 | 0.0231 | 0.0384 |
| Onchocerca volvulus | 0.0052 | 0.0612 | 0.0892 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0025 | 0.0221 | 0.0368 |
| Onchocerca volvulus | 0.0475 | 0.6859 | 1 | |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.1709 | 0.1709 |
| Schistosoma mansoni | lamin | 0.0055 | 0.0653 | 0.0653 |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0405 | 0.0674 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0382 | 0.5489 | 0.9136 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.1709 | 0.2845 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0039 | 0.0418 | 0.0452 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0108 | 0.0108 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0424 | 0.6526 |
| Echinococcus multilocularis | mothers against decapentaplegic 6 | 0.0012 | 0.0018 | 0.0018 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0037 | 0.0387 | 0.1075 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0262 | 0.0436 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0418 | 0.0696 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0108 | 0.0687 |
| Schistosoma mansoni | acetyl-CoA synthetase | 0.0015 | 0.0071 | 0.0071 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0108 | 0.1136 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0052 | 0.0612 | 1 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0108 | 0.1136 |
| Plasmodium falciparum | protein kinase 6 | 0.0536 | 0.7752 | 1 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0108 | 0.018 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0018 | 0.003 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0199 | 0.2373 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD1 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0015 | 0.0071 | 0.0097 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0052 | 0.0612 | 1 |
| Brugia malayi | acetyl-Coenzyme A synthetase 2 | 0.0015 | 0.0071 | 0.0118 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0108 | 0.0158 |
| Echinococcus granulosus | mothers against decapentaplegic 5 | 0.0026 | 0.0231 | 0.0231 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0417 | 0.045 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus granulosus | mothers against decapentaplegic 2 | 0.0012 | 0.0018 | 0.0018 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0052 | 0.0612 | 1 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0262 | 0.0262 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.1709 | 0.2845 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.006 | 0.073 | 0.073 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0052 | 0.0612 | 1 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0036 | 0.0382 | 0.0459 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 0.7752 | 1 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0424 | 0.6526 |
| Schistosoma mansoni | smad1 5 8 and | 0.0026 | 0.0231 | 0.0231 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0108 | 0.0055 |
| Schistosoma mansoni | thyroid hormone receptor | 0.014 | 0.1915 | 0.1915 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0052 | 0.0612 | 0.1018 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Mycobacterium tuberculosis | Phenyloxazoline synthase MbtB (phenyloxazoline synthetase) | 0.0015 | 0.0071 | 0.0097 |
| Onchocerca volvulus | 0.0036 | 0.0382 | 0.0558 | |
| Brugia malayi | MH2 domain containing protein | 0.0026 | 0.0231 | 0.0384 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0015 | 0.0071 | 0.0482 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0108 | 0.0055 |
| Schistosoma mansoni | Smad4 | 0.0026 | 0.0231 | 0.0231 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0108 | 0.0687 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Schistosoma mansoni | smad | 0.0012 | 0.0018 | 0.0018 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0424 | 0.052 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0417 | 0.0417 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1709 | 0.1709 |
| Mycobacterium tuberculosis | Probable bacterioferritin BfrA | 0.0025 | 0.0222 | 0.0564 |
| Mycobacterium tuberculosis | Probable medium chain fatty-acid-CoA ligase FadD14 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0015 | 0.0071 | 0.0097 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Echinococcus granulosus | lamin dm0 | 0.0055 | 0.0653 | 0.0653 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0417 | 0.0687 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Brugia malayi | beta-lactamase family protein | 0.0036 | 0.0382 | 0.0637 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0039 | 0.0418 | 0.0452 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Echinococcus granulosus | smad | 0.0026 | 0.0231 | 0.0231 |
| Brugia malayi | MH2 domain containing protein | 0.0026 | 0.0231 | 0.0384 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0108 | 0.018 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0108 | 0.087 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0052 | 0.0612 | 1 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0036 | 0.0382 | 0.106 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0055 | 0.0653 | 0.1087 |
| Echinococcus granulosus | intermediate filament protein | 0.0055 | 0.0653 | 0.0653 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0424 | 0.052 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0108 | 0.0074 |
| Mycobacterium tuberculosis | P-hydroxybenzoyl-AMP ligase FadD22 | 0.0015 | 0.0071 | 0.0097 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.0236 | 0.0392 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0036 | 0.0382 | 0.0637 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.1447 | 0.1447 |
| Chlamydia trachomatis | acylglycerophosphoethanolamine acyltransferase | 0.0039 | 0.0418 | 1 |
| Mycobacterium ulcerans | beta-lactamase | 0.0036 | 0.0382 | 0.5962 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0405 | 0.6177 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0262 | 0.3843 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.1709 | 0.2413 |
| Loa Loa (eye worm) | beta-lactamase | 0.0036 | 0.0382 | 0.0637 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0262 | 0.0436 |
| Loa Loa (eye worm) | hypothetical protein | 0.0015 | 0.0071 | 0.0118 |
| Loa Loa (eye worm) | hypothetical protein | 0.0025 | 0.0221 | 0.0368 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0424 | 0.052 |
| Schistosoma mansoni | TGF-beta signal transducer Smad2 | 0.0026 | 0.0231 | 0.0231 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0417 | 0.6391 |
| Echinococcus multilocularis | mothers against decapentaplegic 2 | 0.0012 | 0.0018 | 0.0018 |
| Mycobacterium ulcerans | bacterioferritin BfrA | 0.0025 | 0.0222 | 0.3142 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Onchocerca volvulus | 0.0015 | 0.0071 | 0.0104 | |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0262 | 0.0281 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.006 | 0.073 | 0.073 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0262 | 0.3532 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0417 | 0.81 |
| Schistosoma mansoni | smad | 0.0026 | 0.0231 | 0.0231 |
| Mycobacterium tuberculosis | Peptide synthetase MbtE (peptide synthase) | 0.0015 | 0.0071 | 0.0097 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0262 | 0.3843 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0417 | 0.0509 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0036 | 0.0382 | 0.0459 |
| Schistosoma mansoni | ferritin | 0.0025 | 0.0222 | 0.0222 |
| Loa Loa (eye worm) | hypothetical protein | 0.0014 | 0.0059 | 0.0098 |
| Brugia malayi | Smad1 | 0.0026 | 0.0231 | 0.0384 |
| Mycobacterium ulcerans | bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ACP synthetase | 0.0015 | 0.0071 | 0.0482 |
| Loa Loa (eye worm) | Smad1 | 0.0026 | 0.0231 | 0.0384 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Echinococcus granulosus | 5'partial|histone lysine N methyltransferase SETDB2 | 0.0058 | 0.0698 | 0.0698 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0036 | 0.0382 | 0.0405 |
| Loa Loa (eye worm) | oxidoreductase | 0.0015 | 0.0071 | 0.0118 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0417 | 0.045 |
| Echinococcus multilocularis | ferritin | 0.0025 | 0.0222 | 0.0222 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0418 | 0.0696 |
| Plasmodium vivax | SET domain protein, putative | 0.006 | 0.073 | 0.0858 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0405 | 0.6177 |
| Onchocerca volvulus | 0.006 | 0.073 | 0.1064 | |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.1709 | 0.3251 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.1447 | 0.1447 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0424 | 0.8272 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0417 | 0.0694 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0382 | 0.0637 |
| Mycobacterium ulcerans | hypothetical protein | 0.0052 | 0.0612 | 1 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0417 | 0.0694 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0417 | 0.045 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0108 | 0.0048 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0262 | 0.0249 |
| Onchocerca volvulus | 0.0015 | 0.0071 | 0.0104 | |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0036 | 0.0382 | 0.106 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus multilocularis | mothers against decapentaplegic 5 | 0.0026 | 0.0231 | 0.0231 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0417 | 0.0417 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0052 | 0.0612 | 0.177 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0405 | 0.0492 |
| Onchocerca volvulus | Mothers against decapentaplegic homolog | 0.0012 | 0.0018 | 0.0026 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Brugia malayi | MH1 domain containing protein | 0.0014 | 0.0059 | 0.0098 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0417 | 0.0417 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0418 | 0.0696 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0498 | 0.0847 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0036 | 0.0382 | 0.0382 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0262 | 0.5829 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Schistosoma mansoni | ferritin | 0.0025 | 0.0222 | 0.0222 |
| Schistosoma mansoni | apoferritin-2 | 0.0025 | 0.0222 | 0.0222 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0418 | 0.0696 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0417 | 0.0694 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0417 | 0.0694 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0108 | 0.0055 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0108 | 0.087 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0108 | 0.0074 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0108 | 0.018 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0262 | 0.0249 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0498 | 1 |
| Mycobacterium ulcerans | peptide synthetase Nrp (peptide synthase) | 0.0015 | 0.0071 | 0.0482 |
| Echinococcus granulosus | mothers against decapentaplegic 6 | 0.0012 | 0.0018 | 0.0018 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0036 | 0.0382 | 0.106 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0012 | 0.0018 | 0.003 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0036 | 0.0382 | 0.0382 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0424 | 0.6526 |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.073 | 0.1215 |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0262 | 0.4477 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0262 | 0.5182 |
| Brugia malayi | intermediate filament protein | 0.0055 | 0.0653 | 0.1087 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0108 | 0.018 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0108 | 0.0074 |
| Echinococcus multilocularis | expressed protein | 0.0025 | 0.0222 | 0.0222 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.2856 | 0.3626 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0052 | 0.0612 | 1 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtF | 0.0015 | 0.0071 | 0.0482 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0052 | 0.0612 | 1 |
| Mycobacterium ulcerans | lipase LipD | 0.0036 | 0.0382 | 0.5962 |
| Schistosoma mansoni | Smad4 | 0.0012 | 0.0018 | 0.0018 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0417 | 0.6391 |
| Mycobacterium ulcerans | acetyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0417 | 0.045 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0039 | 0.0418 | 0.1171 |
| Onchocerca volvulus | 0.0036 | 0.0382 | 0.0558 | |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0036 | 0.0382 | 0.106 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0015 | 0.0071 | 0.0118 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0405 | 0.0405 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0498 | 1 |
| Schistosoma mansoni | apoferritin-2 | 0.0025 | 0.0222 | 0.0222 |
| Loa Loa (eye worm) | MH1 domain-containing protein | 0.0012 | 0.0018 | 0.003 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0382 | 0.0637 |
| Schistosoma mansoni | smad1 5 8 and | 0.0026 | 0.0231 | 0.0231 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Brugia malayi | oxidoreductase, short chain dehydrogenase/reductase family protein | 0.0015 | 0.0071 | 0.0118 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0262 | 0.0379 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0405 | 0.0674 |
| Mycobacterium ulcerans | phenyloxazoline synthase MbtB | 0.0015 | 0.0071 | 0.0482 |
| Mycobacterium tuberculosis | Fatty-acid-CoA synthetase FadD17 (fatty-acid-CoA synthase) (fatty-acid-CoA ligase) | 0.0015 | 0.0071 | 0.0097 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.5109 | 0.6559 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0108 | 0.0108 |
| Onchocerca volvulus | 0.0055 | 0.0653 | 0.0952 | |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0262 | 0.3532 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0108 | 0.0108 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0108 | 0.018 |
| Schistosoma mansoni | histone-lysine n-methyltransferase suv9 | 0.006 | 0.073 | 0.073 |
| Toxoplasma gondii | histone lysine methyltransferase SET/SUV39 | 0.006 | 0.073 | 0.1308 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Onchocerca volvulus | 0.0015 | 0.0071 | 0.0104 | |
| Echinococcus multilocularis | microtubule associated protein 2 | 0.0688 | 1 | 1 |
| Loa Loa (eye worm) | pre-SET domain-containing protein family protein | 0.0417 | 0.6008 | 1 |
| Echinococcus granulosus | acetyl coenzyme A synthetase cytoplasmic | 0.0015 | 0.0071 | 0.0071 |
| Brugia malayi | Pre-SET motif family protein | 0.006 | 0.073 | 0.1215 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0381 | 0.0381 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Mycobacterium tuberculosis | Conserved protein | 0.0036 | 0.0382 | 0.106 |
| Echinococcus multilocularis | acetyl coenzyme A synthetase, cytoplasmic | 0.0015 | 0.0071 | 0.0071 |
| Mycobacterium ulcerans | bacterioferritin BfrB | 0.0025 | 0.0222 | 0.3142 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0037 | 0.0387 | 0.1075 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.1709 | 0.2132 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0262 | 0.3532 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Echinococcus multilocularis | lamin dm0 | 0.0055 | 0.0653 | 0.0653 |
| Echinococcus granulosus | expressed protein | 0.0025 | 0.0222 | 0.0222 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0382 | 0.5489 | 0.9136 |
| Schistosoma mansoni | thyroid hormone receptor | 0.014 | 0.1915 | 0.1915 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0262 | 0.0262 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0382 | 0.0637 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0036 | 0.0382 | 0.0382 |
| Mycobacterium ulcerans | hypothetical protein | 0.0036 | 0.0382 | 0.5962 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0108 | 0.018 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0052 | 0.0612 | 1 |
| Brugia malayi | MH1 domain containing protein | 0.0026 | 0.0231 | 0.0384 |
| Brugia malayi | MH2 domain containing protein | 0.0012 | 0.0018 | 0.003 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Loa Loa (eye worm) | hypothetical protein | 0.0054 | 0.0638 | 0.1063 |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0232 | 0.3272 | 1 |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0055 | 0.0653 | 0.1087 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0108 | 0.0108 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0108 | 0.0108 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0262 | 0.4477 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0498 | 0.7889 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0108 | 0.087 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0108 | 0.018 |
| Schistosoma mansoni | intermediate filament proteins | 0.0055 | 0.0653 | 0.0653 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0424 | 0.052 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD8 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0015 | 0.0071 | 0.0097 |
| Loa Loa (eye worm) | hypothetical protein | 0.0055 | 0.0653 | 0.1087 |
| Mycobacterium leprae | Probable lipase LipE | 0.0036 | 0.0382 | 0.5757 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0037 | 0.0387 | 0.1075 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0108 | 0.0108 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Mycobacterium tuberculosis | Peptide synthetase MbtF (peptide synthase) | 0.0015 | 0.0071 | 0.0097 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.2856 | 0.3626 |
| Toxoplasma gondii | ABC1 family protein | 0.0036 | 0.0382 | 0.0618 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus granulosus | Smad4 | 0.0026 | 0.0231 | 0.0231 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0405 | 0.0405 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0108 | 0.1136 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Echinococcus multilocularis | histone lysine N methyltransferase SETMAR | 0.006 | 0.073 | 0.073 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0417 | 0.0687 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0417 | 0.0417 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0199 | 0.0494 |
| Echinococcus granulosus | ferritin | 0.0025 | 0.0222 | 0.0222 |
| Echinococcus granulosus | Mitotic checkpoint protein PRCC C terminal | 0.013 | 0.1761 | 0.1761 |
| Echinococcus multilocularis | Smad4 | 0.0026 | 0.0231 | 0.0231 |
| Schistosoma mansoni | ferritin light chain | 0.0025 | 0.0222 | 0.0222 |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.0108 | 0.0212 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.014 | 0.1915 | 0.1915 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0262 | 0.0262 |
| Brugia malayi | mothers against decapentaplegic homolog 3 | 0.0012 | 0.0018 | 0.003 |
| Brugia malayi | MH1 domain containing protein | 0.0014 | 0.0059 | 0.0098 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0498 | 0.7889 |
| Brugia malayi | Pre-SET motif family protein | 0.0417 | 0.6008 | 1 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.006 | 0.073 | 0.073 |
| Schistosoma mansoni | smad1 5 8 and | 0.0026 | 0.0231 | 0.0231 |
| Brugia malayi | cytoplasmic intermediate filament protein | 0.0029 | 0.0279 | 0.0464 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0424 | 0.8272 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0108 | 0.0108 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0108 | 0.087 |
| Mycobacterium leprae | PROBABLE BACTERIOFERRITIN BFRA | 0.0025 | 0.0222 | 0.2795 |
| Onchocerca volvulus | 0.0055 | 0.0653 | 0.0952 | |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1709 | 0.1709 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0417 | 0.0417 |
| Loa Loa (eye worm) | AMP-binding enzyme family protein | 0.0015 | 0.0071 | 0.0118 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0498 | 0.0555 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0052 | 0.0612 | 0.1018 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0498 | 0.0555 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0052 | 0.0612 | 0.177 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0108 | 0.0055 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0417 | 0.0417 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0108 | 0.0108 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0612 | 0.1018 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0052 | 0.0612 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Schistosoma mansoni | lamin | 0.0055 | 0.0653 | 0.0653 |
| Onchocerca volvulus | 0.0018 | 0.0108 | 0.0158 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0108 | 0.0055 |
| Schistosoma mansoni | hypothetical protein | 0.013 | 0.1761 | 0.1761 |
| Onchocerca volvulus | 0.0036 | 0.0382 | 0.0558 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0405 | 0.0674 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0015 | 0.0071 | 0.0482 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0424 | 0.8272 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0108 | 0.018 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0108 | 0.1136 |
| Echinococcus multilocularis | smad | 0.0026 | 0.0231 | 0.0231 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0036 | 0.0382 | 0.0459 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.1709 | 0.2132 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0108 | 0.0048 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| CC50 (functional) | > 100 uM | Huh7 cytotoxicity for Pf inhibitors | Novartis-GNF Malaria Box. | No reference |
| CC50 | > 100 uM | NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7) | ChEMBL. | 18579783 |
| EC50 (functional) | = 1.225 uM | W2 Pf proliferation inhibition | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 1.225 uM | NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| EC50 (functional) | = 3.022 uM | PF proliferation inhibition 3D7 | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 3.022 uM | NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| Growth Inhibition (functional) | = -1.335 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | = 3337 nM | MMV: IC50 determined against P. falciparum Dd2-luc strain using a Malaria Sybr Green I Fluorescence assay. Starting conditions were 1% trophozoite synchronised parasites at 2% haematocrit. Fluorescence detection completed after 48hr incubation at 37 degrees C under 1% O2, 3% CO2 and balance N2. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | = 0.367 uM | NOVARTIS: Antimalarial liver stage activity measured as reduction in Plasmodium yoelii schizont area in HepG2-A16-CD81 cells by immuno-fluorescence, and median schizont size at 10uM compound concentration | ChEMBL. | 22096101 |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | = 17.8505268096924 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 | > 32 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IFI promiscuity index | = 0.02222 | IFI promiscuity index | Novartis-GNF Malaria Box. | No reference |
| Inhibition (functional) | = -41.4326002989837 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -6.15841693436462 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.456166877976223 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -4.45616687797622 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -1.2307889433257337 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = -1.23078894332573 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 1.14 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 5.25 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 36 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 40 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 59 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Ratio (functional) | = 0.982758620689655 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.2869 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.0459 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = 0.0169 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Schizont size (functional) | = 89.76 um | NOVARTIS: Antimalarial liver stage activity measured as reduction in Plasmodium yoelii schizont area in HepG2-A16-CD81 cells by immuno-fluorescence, and median schizont size at 10uM compound concentration | ChEMBL. | 22096101 |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium yoelii | ChEMBL23 | 22096101 | |
| Plasmodium falciparum | ChEMBL23 | 18579783 | |
| Trypanosoma brucei gambiense |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL606252
- Search by Novartis-GNF Malaria Box
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.