Detailed information for compound 607942
Basic information
Technical information
- TDR Targets ID: 607942
- Name: 8-(benzoyl)-4,9-dimethylfuro[5,4-h]chromen-2- one
- MW: 318.323 | Formula: C20H14O4
-
H donors: 0
H acceptors: 2
LogP: 4.27
Rotable bonds: 2
Rule of 5 violations (Lipinski): 1 - SMILES: O=c1cc(C)c2c(o1)c1c(cc2)oc(c1C)C(=O)c1ccccc1
- InChi: 1S/C20H14O4/c1-11-10-16(21)24-20-14(11)8-9-15-17(20)12(2)19(23-15)18(22)13-6-4-3-5-7-13/h3-10H,1-2H3
- InChiKey: UEYKQFKCXMRWNW-UHFFFAOYSA-N
Network
Hover on a compound node to display the structore
Synonyms
- 8-(benzoyl)-4,9-dimethyl-furo[5,4-h]chromen-2-one
- 4,9-dimethyl-8-(oxo-phenylmethyl)-2-furo[2,3-h]chromenone
- 4,9-dimethyl-8-phenylcarbonyl-furo[2,3-h]chromen-2-one
- STOCK1N-25652
- ZINC00478309
- AH-034/10857044
- Oprea1_523380
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Plasmodium falciparum (isolate 3D7) | Calcium-dependent protein kinase 4 | Starlite/ChEMBL | No references |
| Plasmodium falciparum (isolate 3D7) | Proline--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | lysine--tRNA ligase | Starlite/ChEMBL | No references |
| Plasmodium falciparum | hexose transporter | Starlite/ChEMBL | No references |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | Starlite/ChEMBL | No references |
| Homo sapiens | solute carrier family 2 (facilitated glucose transporter), member 1 | Starlite/ChEMBL | No references |
| Leishmania mexicana | glucose transporter, lmgt2 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 7 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | protein kinase 6 | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Brugia malayi | lysyl-tRNA synthetase | 0.0028 | 0.0279 | 0.0946 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0025 | 0.0234 | 0.1536 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0016 | 0.0128 | 0.1799 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Plasmodium falciparum | cysteine proteinase falcipain 1 | 0.0008 | 0.0027 | 0.0031 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0008 | 0.0027 | 0.0136 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.001 | 0.0046 | 0.0136 |
| Entamoeba histolytica | cysteine proteinase 2 | 0.0008 | 0.0027 | 0.0511 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Brugia malayi | Smad1 | 0.0008 | 0.0021 | 0.0051 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0146 | 0.0484 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0412 | 1 |
| Brugia malayi | Cathepsin L-like precursor | 0.0016 | 0.0128 | 0.0423 |
| Mycobacterium ulcerans | lipase LipD | 0.0036 | 0.0372 | 0.9814 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0011 | 0.0059 | 0.0348 |
| Plasmodium falciparum | major facilitator superfamily domain-containing protein, putative | 0.0018 | 0.0146 | 0.0207 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Echinococcus granulosus | cathepsin L | 0.0008 | 0.0027 | 0.0136 |
| Trypanosoma cruzi | sugar transporter, putative | 0.0018 | 0.0146 | 0.2047 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0418 | 0.274 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0016 | 0.0128 | 0.3001 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1526 | 1 |
| Loa Loa (eye worm) | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0013 |
| Schistosoma mansoni | nuclear hormone receptor | 0.001 | 0.0046 | 0.0257 |
| Schistosoma mansoni | inositol monophosphatase | 0.0036 | 0.0379 | 0.2452 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Onchocerca volvulus | 0.0036 | 0.0372 | 1 | |
| Leishmania major | cathepsin L-like protease | 0.0016 | 0.0128 | 0.1799 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0215 | 0.5665 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0036 | 0.0372 | 0.5219 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Chlamydia trachomatis | proline--tRNA ligase | 0.0013 | 0.009 | 0.2978 |
| Onchocerca volvulus | 0.0011 | 0.0059 | 0.1444 | |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0279 | 0.179 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0372 | 0.1271 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 1 LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0225 | 0.08 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0036 | 0.0372 | 0.2439 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0023 | 0.0215 | 0.5138 |
| Loa Loa (eye worm) | calcium/calmodulin-dependent protein kinase ID | 0.0039 | 0.0412 | 0.1409 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.001 | 0.0046 | 0.0136 |
| Trichomonas vaginalis | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0069 |
| Entamoeba histolytica | prolyl-tRNA synthetase, putative | 0.0038 | 0.0402 | 0.9754 |
| Trypanosoma brucei | sugar transporter, putative | 0.0018 | 0.0146 | 0.2047 |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0402 | 0.1374 |
| Treponema pallidum | prolyl-tRNA synthetase | 0.0013 | 0.009 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.0405 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0412 | 0.2667 |
| Loa Loa (eye worm) | intermediate filament tail domain-containing protein | 0.0027 | 0.0259 | 0.0877 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0062 | 0.0713 | 1 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0036 | 0.0372 | 0.9814 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Brugia malayi | Intermediate filament tail domain containing protein | 0.0027 | 0.0259 | 0.0877 |
| Trypanosoma cruzi | cysteine peptidase, clan CA, family C1, cathepsin L-like, putative | 0.0057 | 0.0644 | 0.9035 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Brugia malayi | MH2 domain containing protein | 0.0008 | 0.0021 | 0.0051 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 1 |
| Schistosoma mansoni | serine/threonine protein kinase | 0.0039 | 0.0412 | 0.2667 |
| Mycobacterium leprae | Possible lysyl-tRNA synthetase 2 LysX | 0.0028 | 0.0279 | 0.6932 |
| Trichomonas vaginalis | myo inositol monophosphatase, putative | 0.0036 | 0.0379 | 0.2486 |
| Echinococcus multilocularis | synaptic vesicle 2 protein | 0.0018 | 0.0146 | 0.0139 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0036 | 0.0372 | 0.2439 |
| Entamoeba histolytica | acyl-coA synthetase, putative | 0.0023 | 0.0215 | 0.5138 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Trypanosoma cruzi | major cysteine proteinase, putative | 0.0049 | 0.0543 | 0.762 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0023 | 0.0215 | 0.5665 |
| Mycobacterium tuberculosis | Fatty-acid-CoA synthetase FadD17 (fatty-acid-CoA synthase) (fatty-acid-CoA ligase) | 0.0007 | 0.0007 | 0.0024 |
| Wolbachia endosymbiont of Brugia malayi | fructose-1,6-bisphosphatase | 0.0036 | 0.0379 | 1 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0016 | 0.0128 | 0.3327 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0215 | 0.5665 |
| Plasmodium vivax | vivapain-3 | 0.0008 | 0.0027 | 0.0031 |
| Onchocerca volvulus | Steroid hormone receptor family member cnr14 homolog | 0.001 | 0.0046 | 0.107 |
| Brugia malayi | Cathepsin L-like precursor | 0.0011 | 0.0059 | 0.0184 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0215 | 0.0724 |
| Toxoplasma gondii | propionate-CoA ligase | 0.0007 | 0.0007 | 0.0015 |
| Loa Loa (eye worm) | hypothetical protein | 0.0027 | 0.0259 | 0.0877 |
| Echinococcus multilocularis | inositol monophosphatase 1 | 0.0036 | 0.0379 | 0.0373 |
| Toxoplasma gondii | prolyl-tRNA synthetase (ProRS) | 0.0044 | 0.0482 | 0.1081 |
| Brugia malayi | Cathepsin L-like precursor | 0.0016 | 0.0128 | 0.0423 |
| Mycobacterium leprae | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase) (ThrRS) (Threonine-tRNA ligase) | 0.0007 | 0.0011 | 0.0262 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0094 |
| Echinococcus multilocularis | cytoplasmic intermediate filament protein | 0.0013 | 0.0084 | 0.0077 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Mycobacterium ulcerans | sugar-transport integral membrane protein SugI | 0.0018 | 0.0146 | 0.3848 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0008 | 0.0027 | 0.0136 |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0227 | 0.2808 | 1 |
| Loa Loa (eye worm) | Smad1 | 0.0008 | 0.0021 | 0.0051 |
| Leishmania major | cathepsin L-like protease | 0.0062 | 0.0713 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0008 | 0.0027 | 0.0179 |
| Brugia malayi | intermediate filament protein | 0.0027 | 0.0259 | 0.0877 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Brugia malayi | probable proline-trna synthetase - fission yeast, putative | 0.0007 | 0.0011 | 0.0013 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0016 | 0.0128 | 0.0122 |
| Echinococcus multilocularis | musashi | 0.0027 | 0.0259 | 0.0252 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0023 | 0.0215 | 0.5665 |
| Mycobacterium tuberculosis | Peptide synthetase MbtE (peptide synthase) | 0.0007 | 0.0007 | 0.0024 |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0036 | 0.0372 | 0.1325 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0036 | 0.0372 | 0.2406 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Leishmania major | glucose transporter, lmgt2 | 0.0039 | 0.0418 | 0.5864 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.001 | 0.0046 | 0.0257 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0146 | 0.0956 |
| Schistosoma mansoni | smad1 5 8 and | 0.0008 | 0.0021 | 0.0096 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.001 | 0.0046 | 0.0257 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.0405 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Loa Loa (eye worm) | sugar transporter | 0.0126 | 0.1526 | 0.5283 |
| Schistosoma mansoni | lamin | 0.0027 | 0.0259 | 0.1659 |
| Onchocerca volvulus | Putative transporter | 0.0018 | 0.0146 | 0.381 |
| Loa Loa (eye worm) | bifunctional aminoacyl-tRNA synthetase | 0.0016 | 0.0118 | 0.0387 |
| Trichomonas vaginalis | inositol monophosphatase, putative | 0.0036 | 0.0379 | 0.2486 |
| Echinococcus granulosus | General substrate transporter | 0.0108 | 0.13 | 0.8514 |
| Loa Loa (eye worm) | fibroinase | 0.0016 | 0.0128 | 0.0423 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0412 | 0.2667 |
| Brugia malayi | MH2 domain containing protein | 0.0117 | 0.1404 | 0.486 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2A | 0.0039 | 0.0412 | 0.0925 |
| Loa Loa (eye worm) | ctsf protein | 0.0016 | 0.0128 | 0.0423 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.001 | 0.0046 | 0.0136 |
| Plasmodium falciparum | threonine--tRNA ligase | 0.0007 | 0.0011 | 0.0006 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0008 | 0.0027 | 0.0384 |
| Plasmodium vivax | glycine--tRNA ligase, putative | 0.0007 | 0.0011 | 0.0006 |
| Toxoplasma gondii | transporter, major facilitator family protein | 0.0018 | 0.0146 | 0.0327 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.0405 |
| Schistosoma mansoni | TGF-beta signal transducer Smad2 | 0.0008 | 0.0021 | 0.0096 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0482 | 0.6755 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD5 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0128 | 0.0457 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Plasmodium vivax | CDK-related protein kinase 6, putative | 0.0536 | 0.6736 | 1 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0094 |
| Plasmodium vivax | mitogen-activated protein kinase 2, putative | 0.0204 | 0.2515 | 0.3728 |
| Trypanosoma cruzi | cruzipain precursor, putative | 0.0062 | 0.0713 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.0367 | 0.8902 |
| Onchocerca volvulus | 0.0023 | 0.0215 | 0.5695 | |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0036 | 0.0372 | 0.1271 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Entamoeba histolytica | acyl-CoA synthetase, putative | 0.0023 | 0.0215 | 0.5138 |
| Trypanosoma cruzi | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0094 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Schistosoma mansoni | smad1 5 8 and | 0.0008 | 0.0021 | 0.0096 |
| Entamoeba histolytica | myo-inositol monophosphatase, putative | 0.0036 | 0.0379 | 0.9196 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.001 | 0.0046 | 0.0039 |
| Leishmania major | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0094 |
| Loa Loa (eye worm) | CAMK/CAMK2 protein kinase | 0.0039 | 0.0412 | 0.1409 |
| Echinococcus granulosus | cathepsin L cysteine proteinase | 0.0016 | 0.0128 | 0.08 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type 1 | 0.0039 | 0.0412 | 0.2667 |
| Mycobacterium ulcerans | threonyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0277 |
| Toxoplasma gondii | AMP-binding enzyme domain-containing protein | 0.0007 | 0.0007 | 0.0015 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Toxoplasma gondii | inositol(myo)-1(or 4)-monophosphatase 2, putative | 0.0036 | 0.0379 | 0.0851 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0016 | 0.0128 | 0.0122 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0402 | 0.2601 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0036 | 0.0372 | 0.1325 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK3 | 0.0039 | 0.0412 | 0.0925 |
| Loa Loa (eye worm) | hypothetical protein | 0.0028 | 0.0279 | 0.0946 |
| Loa Loa (eye worm) | hypothetical protein | 0.0016 | 0.0128 | 0.0423 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0077 | 0.0246 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0016 | 0.0128 | 0.3001 |
| Mycobacterium ulcerans | bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ACP synthetase | 0.0007 | 0.0007 | 0.0177 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | threonyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0013 |
| Trichomonas vaginalis | esterase, putative | 0.0036 | 0.0372 | 0.2439 |
| Echinococcus multilocularis | lamin dm0 | 0.0027 | 0.0259 | 0.0252 |
| Trichomonas vaginalis | lysyl-tRNA synthetase, putative | 0.0028 | 0.0279 | 0.1826 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0011 | 0.0059 | 0.039 |
| Plasmodium vivax | calcium-dependent protein kinase 4, putative | 0.0039 | 0.0412 | 0.0603 |
| Echinococcus granulosus | cytoplasmic intermediate filament protein | 0.0013 | 0.0084 | 0.0506 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.014 | 0.0465 |
| Schistosoma mansoni | thyroid hormone receptor | 0.001 | 0.0046 | 0.0257 |
| Brugia malayi | Cathepsin L-like precursor | 0.0016 | 0.0128 | 0.0423 |
| Plasmodium vivax | calcium-dependent protein kinase 1, putative | 0.0039 | 0.0412 | 0.0603 |
| Echinococcus multilocularis | lamin | 0.0027 | 0.0259 | 0.0252 |
| Brugia malayi | Cathepsin L-like precursor | 0.0016 | 0.0128 | 0.0423 |
| Loa Loa (eye worm) | hypothetical protein | 0.0039 | 0.0412 | 0.1409 |
| Trypanosoma cruzi | myo-inositol-1(or 4)-monophosphatase 1, putative | 0.0036 | 0.0379 | 0.5318 |
| Trypanosoma brucei | glucose transporter 1E | 0.0039 | 0.0418 | 0.5864 |
| Plasmodium vivax | hexose transporter | 0.0126 | 0.1526 | 0.2258 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.001 | 0.0046 | 0.0136 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Loa Loa (eye worm) | inositol-1 | 0.0036 | 0.0379 | 0.1296 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1526 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Schistosoma mansoni | smad | 0.0008 | 0.0021 | 0.0096 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0008 | 0.0027 | 0.0072 |
| Brugia malayi | nuclear receptor NHR-88 | 0.001 | 0.0046 | 0.0136 |
| Plasmodium vivax | calcium-dependent protein kinase, putative | 0.0039 | 0.0412 | 0.0603 |
| Plasmodium falciparum | calcium-dependent protein kinase 2 | 0.0039 | 0.0412 | 0.0603 |
| Trypanosoma brucei | glycyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0147 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0146 | 0.0484 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.001 | 0.0046 | 0.0257 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0146 | 0.0956 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0146 | 0.0917 |
| Echinococcus granulosus | Threonyl tRNA synthetase C | 0.0007 | 0.0011 | 0.0025 |
| Plasmodium falciparum | calcium-dependent protein kinase 4 | 0.0039 | 0.0412 | 0.0603 |
| Plasmodium falciparum | calcium-dependent protein kinase 5 | 0.0039 | 0.0412 | 0.0603 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0011 | 0.0059 | 0.1303 |
| Brugia malayi | bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0402 | 0.1374 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0016 | 0.0128 | 0.08 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L or K-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.001 | 0.0046 | 0.0039 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0036 | 0.0372 | 0.0366 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.014 | 0.0465 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Loa Loa (eye worm) | MH1 domain-containing protein | 0.0008 | 0.0021 | 0.0051 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Mycobacterium ulcerans | fusion protein of transposase for IS2606 and sialic acid-transport integral membrane protein NanT | 0.0018 | 0.0146 | 0.3848 |
| Mycobacterium ulcerans | peptide synthetase Nrp (peptide synthase) | 0.0007 | 0.0007 | 0.0177 |
| Brugia malayi | ecdysteroid receptor | 0.001 | 0.0046 | 0.0136 |
| Plasmodium vivax | proline--tRNA ligase, putative | 0.0044 | 0.0482 | 0.0706 |
| Schistosoma mansoni | protein kinase | 0.0039 | 0.0412 | 0.2667 |
| Leishmania major | myo-inositol-1(or 4)-monophosphatase 1, putative | 0.0036 | 0.0379 | 0.5318 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0146 | 0.0139 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0008 | 0.0027 | 0.0072 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 1 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Mycobacterium tuberculosis | Probable threonyl-tRNA synthetase ThrS (threonine-tRNA synthetase)(ThrRS) (threonine-tRNA ligase) | 0.0007 | 0.0011 | 0.0037 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0094 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Mycobacterium ulcerans | long-chain-fatty-acid-CoA ligase | 0.0023 | 0.0215 | 0.5665 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0035 | 0.0367 | 0.2374 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0008 | 0.0027 | 0.0384 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0418 | 0.274 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Schistosoma mansoni | lamin | 0.0027 | 0.0259 | 0.1659 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD8 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0024 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0117 | 0.1404 | 0.486 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.0367 | 0.2374 |
| Plasmodium vivax | lysine--tRNA ligase, putative | 0.0028 | 0.0279 | 0.0404 |
| Leishmania major | cathepsin L-like protease | 0.0016 | 0.0128 | 0.1799 |
| Echinococcus granulosus | mothers against decapentaplegic 5 | 0.0008 | 0.0021 | 0.0096 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0146 | 0.0484 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0482 | 0.6755 |
| Mycobacterium tuberculosis | Probable medium chain fatty-acid-CoA ligase FadD14 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0024 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Schistosoma mansoni | inositol monophosphatase | 0.0036 | 0.0379 | 0.2452 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.001 | 0.0046 | 0.0257 |
| Mycobacterium tuberculosis | Probable dicarboxylic acid transport integral membrane protein KgtP (dicarboxylate transporter) | 0.0018 | 0.0146 | 0.052 |
| Echinococcus granulosus | synaptic vesicle 2 protein | 0.0018 | 0.0146 | 0.0917 |
| Trypanosoma cruzi | prolyl-tRNA synthetase, putative | 0.0044 | 0.0482 | 0.6755 |
| Echinococcus granulosus | lamin dm0 | 0.0027 | 0.0259 | 0.1659 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Trichomonas vaginalis | CAMK family protein kinase | 0.0039 | 0.0412 | 0.2699 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0008 | 0.0027 | 0.0511 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0147 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trichomonas vaginalis | myo-inositol transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Onchocerca volvulus | 0.0036 | 0.0372 | 1 | |
| Echinococcus multilocularis | Smad4 | 0.0008 | 0.0021 | 0.0015 |
| Echinococcus granulosus | calcium dependent protein kinase | 0.0036 | 0.0381 | 0.2467 |
| Echinococcus granulosus | cathepsin l1 | 0.0011 | 0.0059 | 0.0348 |
| Echinococcus multilocularis | Threonyl tRNA synthetase, C | 0.0007 | 0.0011 | 0.0004 |
| Brugia malayi | follicle stimulating hormone receptor | 0.0233 | 0.2882 | 1 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0279 | 0.7345 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0036 | 0.0372 | 0.2406 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0215 | 0.0724 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 1 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0008 | 0.0027 | 0.0511 |
| Echinococcus multilocularis | lysyl tRNA synthetase | 0.0028 | 0.0279 | 0.0272 |
| Echinococcus granulosus | cysteine protease | 0.0008 | 0.0027 | 0.0136 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.001 | 0.0046 | 0.0257 |
| Echinococcus granulosus | TGF beta signal transducer SmadC | 0.0008 | 0.0021 | 0.0096 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0062 | 0.0713 | 1 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0146 | 0.0139 |
| Loa Loa (eye worm) | hypothetical protein | 0.0011 | 0.0059 | 0.0184 |
| Mycobacterium leprae | possible inositol monophosphatase SubH (IMPase) (inositol-1-phosphatase) (I-1-Pase ). | 0.0032 | 0.0331 | 0.824 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.001 | 0.0046 | 0.0039 |
| Trypanosoma cruzi | cysteine protease, putative | 0.0008 | 0.0027 | 0.0384 |
| Echinococcus granulosus | Sugar transporter ERD6 protein | 0.0018 | 0.0146 | 0.0917 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Giardia lamblia | Prolyl-tRNA synthetase | 0.0038 | 0.0402 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Echinococcus multilocularis | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0402 | 0.0395 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Brugia malayi | Cathepsin L-like precursor | 0.0011 | 0.0059 | 0.0184 |
| Echinococcus multilocularis | cathepsin l cysteine peptidase | 0.0016 | 0.0128 | 0.0122 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0023 | 0.0215 | 0.5665 |
| Schistosoma mansoni | Smad4 | 0.0008 | 0.0021 | 0.0096 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0117 | 0.1404 | 0.486 |
| Plasmodium falciparum | calcium-dependent protein kinase 3 | 0.0039 | 0.0412 | 0.0603 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.001 | 0.0046 | 0.0136 |
| Mycobacterium ulcerans | extragenic suppressor protein SuhB | 0.0036 | 0.0379 | 1 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.001 | 0.0046 | 0.0257 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 0.152 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Mycobacterium ulcerans | prolyl-tRNA synthetase | 0.0013 | 0.009 | 0.2382 |
| Toxoplasma gondii | ABC1 family protein | 0.0036 | 0.0372 | 0.0835 |
| Mycobacterium leprae | Probable prolyl tRNA synthetase ProS | 0.0038 | 0.0402 | 1 |
| Mycobacterium tuberculosis | Fatty-acid-AMP ligase FadD30 (fatty-acid-AMP synthetase) (fatty-acid-AMP synthase) | 0.0017 | 0.014 | 0.05 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Trypanosoma brucei | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0094 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.001 | 0.0046 | 0.0257 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0008 | 0.0027 | 0.0384 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0036 | 0.0372 | 0.2439 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD3 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0128 | 0.0457 |
| Schistosoma mansoni | lysyl-tRNA synthetase | 0.0028 | 0.0279 | 0.179 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0146 | 0.0917 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Brugia malayi | Sugar transporter family protein | 0.0126 | 0.1526 | 0.5283 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0372 | 0.1271 |
| Mycobacterium tuberculosis | P-hydroxybenzoyl-AMP ligase FadD22 | 0.0007 | 0.0007 | 0.0024 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Plasmodium vivax | threonine--tRNA ligase, putative | 0.0007 | 0.0011 | 0.0006 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD35 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0128 | 0.0457 |
| Echinococcus multilocularis | TGF beta signal transducer SmadC | 0.0008 | 0.0021 | 0.0015 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0008 | 0.0027 | 0.0511 |
| Mycobacterium ulcerans | long-chain-acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Onchocerca volvulus | Bile acid receptor homolog | 0.001 | 0.0046 | 0.107 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0146 | 0.0956 |
| Plasmodium falciparum | cysteine proteinase falcipain 2b | 0.0016 | 0.0128 | 0.0181 |
| Plasmodium vivax | vivapain-1 | 0.0008 | 0.0027 | 0.0031 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.001 | 0.0046 | 0.0136 |
| Echinococcus granulosus | smad | 0.0008 | 0.0021 | 0.0096 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0036 | 0.0372 | 0.1325 |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0215 | 0.0724 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0036 | 0.0372 | 0.1325 |
| Brugia malayi | Papain family cysteine protease containing protein | 0.0016 | 0.0128 | 0.0423 |
| Onchocerca volvulus | 0.0027 | 0.0259 | 0.6896 | |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD1 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0024 |
| Brugia malayi | Cathepsin L-like precursor | 0.0016 | 0.0128 | 0.0423 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.001 | 0.0046 | 0.0257 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0011 | 0.0059 | 0.039 |
| Schistosoma mansoni | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0025 |
| Trypanosoma brucei | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0147 |
| Toxoplasma gondii | protein kinase, putative | 0.0357 | 0.4457 | 1 |
| Trypanosoma brucei | glucose transporter 2A | 0.0039 | 0.0418 | 0.5864 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0036 | 0.0372 | 0.0543 |
| Leishmania major | protein kinase, putative | 0.0039 | 0.0412 | 0.5775 |
| Echinococcus granulosus | glutamyl tRNA synthetase cytoplasmic | 0.0038 | 0.0402 | 0.2601 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.001 | 0.0046 | 0.0257 |
| Plasmodium vivax | vivapain-2 | 0.0016 | 0.0128 | 0.0181 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trypanosoma cruzi | glucose transporter, putative | 0.0018 | 0.0146 | 0.2047 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0146 | 0.0917 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.001 | 0.0046 | 0.0257 |
| Wolbachia endosymbiont of Brugia malayi | major facilitator superfamily permease | 0.0018 | 0.0146 | 0.3673 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0008 | 0.0027 | 0.0384 |
| Brugia malayi | cytoplasmic intermediate filament protein | 0.0014 | 0.0102 | 0.033 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0007 | 0.0007 | 0.0044 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0418 | 0.274 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0036 | 0.0372 | 0.1271 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.001 | 0.0046 | 0.0039 |
| Onchocerca volvulus | 0.001 | 0.0046 | 0.107 | |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.001 | 0.0046 | 0.0257 |
| Echinococcus granulosus | glycyl tRNA synthetase | 0.0007 | 0.0011 | 0.0025 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.2667 |
| Loa Loa (eye worm) | intermediate filament protein | 0.0027 | 0.0259 | 0.0877 |
| Loa Loa (eye worm) | hypothetical protein | 0.0012 | 0.0077 | 0.0246 |
| Mycobacterium ulcerans | acetyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0036 | 0.0372 | 0.2439 |
| Giardia lamblia | Lysyl-tRNA synthetase | 0.0028 | 0.0279 | 0.6849 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0372 | 0.1271 |
| Mycobacterium ulcerans | beta-lactamase | 0.0036 | 0.0372 | 0.9814 |
| Plasmodium falciparum | acyl-CoA synthetase | 0.0017 | 0.014 | 0.0199 |
| Loa Loa (eye worm) | papain family cysteine protease containing protein | 0.0016 | 0.0128 | 0.0423 |
| Trichomonas vaginalis | antibiotic synthetase, putative | 0.0007 | 0.0007 | 0.0044 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Trypanosoma brucei | calcium/calmodulin-dependent protein kinase, putative | 0.0039 | 0.0412 | 0.5775 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.001 | 0.0046 | 0.0136 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Brugia malayi | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0013 |
| Leishmania major | cathepsin L-like protease | 0.0016 | 0.0128 | 0.1799 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.014 | 0.0465 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.001 | 0.0046 | 0.0136 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0146 | 0.0917 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | cytoplasmic intermediate filament protein | 0.0014 | 0.0102 | 0.033 |
| Leishmania major | cathepsin L-like protease | 0.0062 | 0.0713 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Mycobacterium tuberculosis | Probable conserved integral membrane transport protein | 0.0018 | 0.0146 | 0.052 |
| Mycobacterium ulcerans | lysyl-tRNA synthetase | 0.0028 | 0.0279 | 0.7345 |
| Mycobacterium ulcerans | long-chain fatty-acid CoA ligase | 0.0023 | 0.0215 | 0.5665 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.001 | 0.0046 | 0.0136 |
| Echinococcus multilocularis | cathepsin L cysteine protease | 0.0016 | 0.0128 | 0.0122 |
| Schistosoma mansoni | SmCL2-like peptidase (C01 family) | 0.0008 | 0.0027 | 0.0136 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Brugia malayi | AMP-binding enzyme family protein | 0.0023 | 0.0215 | 0.0724 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0036 | 0.0372 | 0.9814 |
| Plasmodium falciparum | proline--tRNA ligase | 0.0044 | 0.0482 | 0.0706 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.001 | 0.0046 | 0.0257 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0018 | 0.0146 | 0.2047 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Toxoplasma gondii | threonyl-tRNA synthetase family protein | 0.0007 | 0.0011 | 0.0024 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD2 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0023 | 0.0215 | 0.5346 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0418 | 0.274 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0036 | 0.0372 | 0.5219 |
| Onchocerca volvulus | Protein ultraspiracle homolog | 0.001 | 0.0046 | 0.107 |
| Loa Loa (eye worm) | sugar transporter | 0.0018 | 0.0146 | 0.0484 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0039 | 0.0418 | 0.274 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtE | 0.0007 | 0.0007 | 0.0177 |
| Leishmania major | prolyl-tRNA synthetase, putative,bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0482 | 0.6755 |
| Mycobacterium ulcerans | hypothetical protein | 0.0036 | 0.0372 | 0.9814 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Leishmania major | cathepsin L-like protease | 0.0062 | 0.0713 | 1 |
| Brugia malayi | beta-lactamase family protein | 0.0036 | 0.0372 | 0.1271 |
| Trichomonas vaginalis | prolyl-tRNA synthetase, putative | 0.0038 | 0.0402 | 0.2634 |
| Onchocerca volvulus | Cathepsin L homolog | 0.0016 | 0.0128 | 0.3327 |
| Trypanosoma cruzi | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0147 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0035 | 0.0367 | 0.0361 |
| Mycobacterium tuberculosis | Probable chain -fatty-acid-CoA ligase FadD13 (fatty-acyl-CoA synthetase) | 0.0023 | 0.0215 | 0.0765 |
| Plasmodium falciparum | cysteine proteinase falcipain 3 | 0.0016 | 0.0128 | 0.0181 |
| Mycobacterium leprae | Probable lysyl-tRNA synthase LysS (lysine--tRNA ligase 1) (LysRS 1) (lysine translase) | 0.0024 | 0.0225 | 0.5587 |
| Schistosoma mansoni | glutamyl-tRNA synthetase cytoplasmic (glutamate--tRNA ligase) (glurs) | 0.0038 | 0.0402 | 0.2601 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.0367 | 0.8902 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Leishmania major | cathepsin L-like protease | 0.0016 | 0.0128 | 0.1799 |
| Plasmodium vivax | acyl-CoA synthetase, putative | 0.0017 | 0.014 | 0.0199 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0008 | 0.0021 | 0.0051 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | hypothetical protein | 0.0011 | 0.0059 | 0.0184 |
| Echinococcus multilocularis | mothers against decapentaplegic 5 | 0.0008 | 0.0021 | 0.0015 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD2 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0023 | 0.0215 | 0.0765 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.001 | 0.0046 | 0.0039 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0039 | 0.0418 | 0.274 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Leishmania major | hypothetical protein, conserved | 0.0036 | 0.0372 | 0.5219 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.014 | 0.0465 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Toxoplasma gondii | sugar transporter ST1 | 0.0018 | 0.0146 | 0.0327 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0146 | 0.0917 |
| Entamoeba histolytica | protein kinase, putative | 0.0039 | 0.0412 | 1 |
| Toxoplasma gondii | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0024 |
| Brugia malayi | Calcium/calmodulin-dependent protein kinase type II alpha chain | 0.0039 | 0.0412 | 0.1409 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.001 | 0.0046 | 0.0136 |
| Toxoplasma gondii | facilitative glucose transporter GT1 | 0.0126 | 0.1526 | 0.3424 |
| Mycobacterium ulcerans | integral membrane transport protein | 0.0018 | 0.0146 | 0.3848 |
| Mycobacterium tuberculosis | Probable peptide synthetase Nrp (peptide synthase) | 0.0007 | 0.0007 | 0.0024 |
| Echinococcus granulosus | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 1 |
| Chlamydia trachomatis | acylglycerophosphoethanolamine acyltransferase | 0.0017 | 0.014 | 0.4844 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Trypanosoma brucei | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0146 | 0.2047 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.001 | 0.0046 | 0.0136 |
| Leishmania major | hypothetical protein, conserved | 0.0018 | 0.0146 | 0.2047 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Mycobacterium tuberculosis | Conserved protein | 0.0036 | 0.0372 | 0.1325 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0146 | 0.0956 |
| Loa Loa (eye worm) | hypothetical protein | 0.0031 | 0.0312 | 0.106 |
| Brugia malayi | Cathepsin L-like cysteine proteinase | 0.0011 | 0.0059 | 0.0184 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.2667 |
| Plasmodium vivax | calcium-dependent protein kinase 3, putative | 0.0039 | 0.0412 | 0.0603 |
| Trypanosoma cruzi | cysteine peptidase (N-terminal), putative | 0.0008 | 0.0027 | 0.0384 |
| Brugia malayi | MH1 domain containing protein | 0.0008 | 0.0021 | 0.0051 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.001 | 0.0046 | 0.0136 |
| Trypanosoma brucei | THT1 - hexose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Loa Loa (eye worm) | Papain cysteine protease/cathepsin propeptide inhibitor-containing protein | 0.0016 | 0.0128 | 0.0423 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0018 | 0.0146 | 0.0956 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Brugia malayi | hypothetical protein | 0.0035 | 0.0367 | 0.1254 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Echinococcus granulosus | cathepsin l1 | 0.0016 | 0.0128 | 0.08 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Echinococcus multilocularis | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.0405 |
| Giardia lamblia | Sugar-proton symporter | 0.0018 | 0.0146 | 0.346 |
| Toxoplasma gondii | cell-cycle-associated protein kinase MAPK, putative | 0.0204 | 0.2515 | 0.5643 |
| Schistosoma mansoni | glucose transport protein | 0.0126 | 0.1526 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Mycobacterium ulcerans | phenyloxazoline synthase MbtB | 0.0007 | 0.0007 | 0.0177 |
| Entamoeba histolytica | hypothetical protein | 0.0028 | 0.0279 | 0.6711 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0215 | 0.0724 |
| Mycobacterium tuberculosis | Probable fatty-acid-CoA ligase FadD7 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0016 | 0.0128 | 0.0457 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.001 | 0.0046 | 0.0257 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0215 | 0.3013 |
| Echinococcus granulosus | cathepsin L cysteine protease | 0.0008 | 0.0027 | 0.0136 |
| Trypanosoma brucei | inositol-1(or 4)-monophosphatase 1, putative | 0.0036 | 0.0379 | 0.5318 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Leishmania major | cathepsin L-like protease | 0.0016 | 0.0128 | 0.1799 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 0.152 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | hypothetical protein | 0.0026 | 0.0253 | 0.0855 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0146 | 0.0484 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0146 | 0.0484 |
| Mycobacterium tuberculosis | Lysyl-tRNA synthetase 2 LysX | 0.0024 | 0.0225 | 0.08 |
| Brugia malayi | Sugar transporter family protein | 0.0018 | 0.0146 | 0.0484 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.001 | 0.0046 | 0.0136 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.001 | 0.0046 | 0.0039 |
| Plasmodium vivax | sugar transporter, putative | 0.0018 | 0.0146 | 0.0207 |
| Brugia malayi | Cam kinase protein 1 | 0.0039 | 0.0412 | 0.1409 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0146 | 0.0917 |
| Trypanosoma cruzi | myo-inositol-1(or 4)-monophosphatase 1, putative | 0.0036 | 0.0379 | 0.5318 |
| Echinococcus multilocularis | solute carrier family 2 facilitated glucose | 0.0126 | 0.1526 | 0.152 |
| Leishmania major | glucose transporter/membrane transporter D2, putative | 0.0039 | 0.0418 | 0.5864 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.001 | 0.0046 | 0.0136 |
| Trypanosoma brucei | lysyl-tRNA synthetase, putative | 0.0028 | 0.0279 | 0.3906 |
| Mycobacterium leprae | conserved hypothetical protein | 0.0036 | 0.0372 | 0.9261 |
| Echinococcus granulosus | FTZ F1 alpha | 0.001 | 0.0046 | 0.0257 |
| Brugia malayi | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Entamoeba histolytica | glycyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0094 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0146 | 0.0139 |
| Toxoplasma gondii | Acetyl-coenzyme A synthetase 2, putative | 0.0007 | 0.0007 | 0.0015 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.001 | 0.0046 | 0.0039 |
| Echinococcus multilocularis | solute carrier family 2, facilitated glucose | 0.0126 | 0.1526 | 0.152 |
| Leishmania major | glucose transporter, lmgt1 | 0.0039 | 0.0418 | 0.5864 |
| Loa Loa (eye worm) | hypothetical protein | 0.0023 | 0.0215 | 0.0724 |
| Plasmodium vivax | unspecified product | 0.0008 | 0.0027 | 0.0031 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0036 | 0.0372 | 0.5219 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0372 | 0.1271 |
| Echinococcus multilocularis | Sugar transporter ERD6 protein | 0.0018 | 0.0146 | 0.0139 |
| Leishmania major | lysyl-tRNA synthetase, putative | 0.0028 | 0.0279 | 0.3906 |
| Loa Loa (eye worm) | hypothetical protein | 0.0007 | 0.0011 | 0.0013 |
| Brugia malayi | MH1 domain containing protein | 0.0008 | 0.0021 | 0.0051 |
| Echinococcus multilocularis | cysteine protease | 0.0016 | 0.0128 | 0.0122 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Mycobacterium ulcerans | fatty-acid-CoA ligase | 0.0017 | 0.014 | 0.3701 |
| Echinococcus multilocularis | cysteine protease | 0.0016 | 0.0128 | 0.0122 |
| Chlamydia trachomatis | lysine--tRNA ligase | 0.0028 | 0.0279 | 1 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Trypanosoma cruzi | acetyl-CoA synthetase, putative | 0.0007 | 0.0007 | 0.0094 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0008 | 0.0027 | 0.0179 |
| Mycobacterium ulcerans | O-succinylbenzoic acid--CoA ligase | 0.0007 | 0.0007 | 0.0177 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.001 | 0.0046 | 0.0257 |
| Leishmania major | glucose transporter, lmgt3 | 0.0039 | 0.0418 | 0.5864 |
| Echinococcus multilocularis | calcium dependent protein kinase | 0.0036 | 0.0381 | 0.0375 |
| Brugia malayi | nuclear hormone receptor | 0.001 | 0.0046 | 0.0136 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Brugia malayi | MH2 domain containing protein | 0.0008 | 0.0021 | 0.0051 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.001 | 0.0046 | 0.0136 |
| Plasmodium falciparum | lysine--tRNA ligase | 0.0028 | 0.0279 | 0.0404 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0036 | 0.0372 | 0.1325 |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0036 | 0.0372 | 0.1325 |
| Echinococcus granulosus | Smad4 | 0.0008 | 0.0021 | 0.0096 |
| Trypanosoma cruzi | cysteine peptidase, putative | 0.0062 | 0.0713 | 1 |
| Brugia malayi | Inositol-1 | 0.0036 | 0.0379 | 0.1296 |
| Toxoplasma gondii | sugar transporter ST3 | 0.0018 | 0.0146 | 0.0327 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Trichomonas vaginalis | myo inositol monophosphatase, putative | 0.0036 | 0.0379 | 0.2486 |
| Brugia malayi | beta-lactamase family protein | 0.0036 | 0.0372 | 0.1271 |
| Toxoplasma gondii | lysine-tRNA ligase | 0.0028 | 0.0279 | 0.0625 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Brugia malayi | Cathepsin L-like precursor | 0.0016 | 0.0128 | 0.0423 |
| Echinococcus granulosus | solute carrier family 22 | 0.0018 | 0.0146 | 0.0917 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0036 | 0.0372 | 0.2439 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Echinococcus multilocularis | solute carrier family 22 | 0.0018 | 0.0146 | 0.0139 |
| Onchocerca volvulus | 0.0027 | 0.0259 | 0.6896 | |
| Echinococcus granulosus | intermediate filament protein | 0.0027 | 0.0259 | 0.1659 |
| Entamoeba histolytica | cysteine proteinase 1, putative | 0.0008 | 0.0027 | 0.0511 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Plasmodium vivax | vivapain-2 | 0.0016 | 0.0128 | 0.0181 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0215 | 0.3013 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.001 | 0.0046 | 0.0136 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0038 | 0.0402 | 0.1374 |
| Loa Loa (eye worm) | hypothetical protein | 0.0017 | 0.014 | 0.0465 |
| Echinococcus granulosus | lamin | 0.0027 | 0.0259 | 0.1659 |
| Schistosoma mansoni | hypothetical protein | 0.0126 | 0.1526 | 1 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0036 | 0.0372 | 0.1325 |
| Plasmodium falciparum | protein kinase 6 | 0.0536 | 0.6736 | 1 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Schistosoma mansoni | glucose transporter | 0.0018 | 0.0146 | 0.0917 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.0367 | 0.8902 |
| Schistosoma mansoni | thyroid hormone receptor | 0.001 | 0.0046 | 0.0257 |
| Plasmodium falciparum | hexose transporter | 0.0126 | 0.1526 | 0.2258 |
| Brugia malayi | threonyl-tRNA synthetase, cytoplasmic | 0.0007 | 0.0011 | 0.0013 |
| Plasmodium falciparum | calcium-dependent protein kinase 1 | 0.0039 | 0.0412 | 0.0603 |
| Mycobacterium ulcerans | non-ribosomal peptide synthetase MbtF | 0.0007 | 0.0007 | 0.0177 |
| Schistosoma mansoni | smad1 5 8 and | 0.0008 | 0.0021 | 0.0096 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0021 | 0.0192 | 0.2698 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Entamoeba histolytica | cysteine proteinase, putative | 0.0008 | 0.0027 | 0.0511 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0126 | 0.1526 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Mycobacterium tuberculosis | Conserved protein | 0.0036 | 0.0372 | 0.1325 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | hypothetical protein | 0.0013 | 0.0084 | 0.0267 |
| Schistosoma mansoni | intermediate filament proteins | 0.0027 | 0.0259 | 0.1659 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Trypanosoma cruzi | lysyl-tRNA synthetase, putative | 0.0028 | 0.0279 | 0.3906 |
| Echinococcus granulosus | lysyl tRNA synthetase | 0.0028 | 0.0279 | 0.179 |
| Trichomonas vaginalis | Clan CA, family C1, papain-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Loa Loa (eye worm) | beta-lactamase | 0.0036 | 0.0372 | 0.1271 |
| Mycobacterium tuberculosis | Phenyloxazoline synthase MbtB (phenyloxazoline synthetase) | 0.0007 | 0.0007 | 0.0024 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Echinococcus granulosus | inositol monophosphatase 1 | 0.0036 | 0.0379 | 0.2452 |
| Mycobacterium tuberculosis | Bifunctional enzyme MbtA: salicyl-AMP ligase (SAL-AMP ligase) + salicyl-S-ArCP synthetase | 0.0007 | 0.0007 | 0.0024 |
| Echinococcus granulosus | cathepsin l cysteine peptidase | 0.0016 | 0.0128 | 0.08 |
| Loa Loa (eye worm) | major facilitator superfamily transporter | 0.0018 | 0.0146 | 0.0484 |
| Entamoeba histolytica | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0094 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Echinococcus multilocularis | cathepsin L | 0.0008 | 0.0027 | 0.0021 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.001 | 0.0046 | 0.0136 |
| Mycobacterium ulcerans | long-chain-fatty-acid--CoA ligase | 0.0007 | 0.0007 | 0.0177 |
| Toxoplasma gondii | calcium-dependent protein kinase CDPK2B | 0.0039 | 0.0412 | 0.0925 |
| Mycobacterium ulcerans | glycyl-tRNA synthetase | 0.0007 | 0.0011 | 0.0277 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0023 | 0.0215 | 0.5665 |
| Toxoplasma gondii | cathepsin CPL | 0.0016 | 0.0128 | 0.0288 |
| Leishmania major | cysteine peptidase A (CPA) | 0.0016 | 0.0128 | 0.1799 |
| Onchocerca volvulus | 0.0036 | 0.0372 | 1 | |
| Trichomonas vaginalis | sugar transporter, putative | 0.0039 | 0.0418 | 0.274 |
| Toxoplasma gondii | sugar transporter ST2 | 0.0018 | 0.0146 | 0.0327 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.001 | 0.0046 | 0.0136 |
| Leishmania major | 4-coumarate:coa ligase-like protein | 0.0023 | 0.0215 | 0.3013 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Brugia malayi | beta-lactamase | 0.0036 | 0.0372 | 0.1271 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Mycobacterium tuberculosis | Inositol-1-monophosphatase SuhB | 0.0032 | 0.0331 | 0.1179 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.001 | 0.0046 | 0.0136 |
| Plasmodium falciparum | protein kinase 7 | 0.0357 | 0.4457 | 0.6614 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0036 | 0.0372 | 0.2406 |
| Leishmania major | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0094 |
| Mycobacterium leprae | Probable lipase LipE | 0.0036 | 0.0372 | 0.9261 |
| Leishmania major | myo-inositol/proton symporter (MIT) | 0.0018 | 0.0146 | 0.2047 |
| Loa Loa (eye worm) | cysteine protease | 0.0016 | 0.0128 | 0.0423 |
| Echinococcus multilocularis | General substrate transporter | 0.0108 | 0.13 | 0.1294 |
| Mycobacterium leprae | PROBABLE FATTY-ACID-CoA LIGASE FADD7 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0023 | 0.0215 | 0.5346 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.001 | 0.0046 | 0.0257 |
| Entamoeba histolytica | cysteine protease, putative | 0.0008 | 0.0027 | 0.0511 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Plasmodium falciparum | cysteine proteinase falcipain 2a | 0.0016 | 0.0128 | 0.0181 |
| Trypanosoma cruzi | hexose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Schistosoma mansoni | cathepsin F (C01 family) | 0.0016 | 0.0128 | 0.08 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.001 | 0.0046 | 0.0257 |
| Trypanosoma brucei | cysteine peptidase, Clan CA, family C1, Cathepsin L-like | 0.0062 | 0.0713 | 1 |
| Mycobacterium leprae | POSSIBLE FATTY-ACID-CoA LIGASE FADD10 (FATTY-ACID-CoA SYNTHETASE) (FATTY-ACID-CoA SYNTHASE) | 0.0007 | 0.0007 | 0.0167 |
| Trypanosoma brucei | bifunctional aminoacyl-tRNA synthetase, putative | 0.0044 | 0.0482 | 0.6755 |
| Mycobacterium tuberculosis | Conserved protein | 0.0036 | 0.0372 | 0.1325 |
| Echinococcus multilocularis | glycyl tRNA synthetase | 0.0007 | 0.0011 | 0.0004 |
| Trypanosoma brucei | glucose transporter, putative | 0.0039 | 0.0418 | 0.5864 |
| Giardia lamblia | Hexose transporter | 0.0018 | 0.0146 | 0.346 |
| Loa Loa (eye worm) | follicle stimulating hormone receptor | 0.0233 | 0.2882 | 1 |
| Plasmodium falciparum | mitogen-activated protein kinase 2 | 0.0204 | 0.2515 | 0.3728 |
| Leishmania major | threonyl-tRNA synthetase, putative | 0.0007 | 0.0011 | 0.0147 |
| Loa Loa (eye worm) | hypothetical protein | 0.001 | 0.0046 | 0.0136 |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0372 | 0.1271 |
| Entamoeba histolytica | hypothetical protein | 0.0035 | 0.0367 | 0.8902 |
| Brugia malayi | major facilitator superfamily protein | 0.0018 | 0.0146 | 0.0484 |
| Onchocerca volvulus | 0.0018 | 0.0146 | 0.381 | |
| Brugia malayi | Bifunctional aminoacyl-tRNA synthetase | 0.0038 | 0.0402 | 0.1374 |
| Schistosoma mansoni | nuclear transcription factor X-box binding 1 (nfx1) | 0.0018 | 0.0146 | 0.0917 |
| Loa Loa (eye worm) | hypothetical protein | 0.0018 | 0.0146 | 0.0484 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.001 | 0.0046 | 0.0039 |
| Schistosoma mansoni | coup transcription factor | 0.001 | 0.0046 | 0.0257 |
| Mycobacterium ulcerans | sugar transporter | 0.0018 | 0.0146 | 0.3848 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0035 | 0.0367 | 0.2374 |
| Trichomonas vaginalis | glucose transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Brugia malayi | cathepsin L-like precursor | 0.0011 | 0.0059 | 0.0184 |
| Schistosoma mansoni | sugar transporter | 0.0018 | 0.0146 | 0.0917 |
| Mycobacterium ulcerans | acyl-CoA synthetase | 0.0007 | 0.0007 | 0.0177 |
| Brugia malayi | steroid hormone receptor | 0.001 | 0.0046 | 0.0136 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.001 | 0.0046 | 0.0257 |
| Mycobacterium leprae | POSSIBLE O-SUCCINYLBENZOIC ACID--CoA LIGASE MENE (OSB-CoA SYNTHETASE) (O-SUCCINYLBENZOATE-CoA SYNTHASE) | 0.0007 | 0.0007 | 0.0167 |
| Onchocerca volvulus | Cathepsin F homolog | 0.0016 | 0.0128 | 0.3327 |
| Echinococcus granulosus | calcium:calmodulin dependent protein kinase type | 0.0039 | 0.0412 | 0.2667 |
| Trichomonas vaginalis | sugar transport protein, putative | 0.0018 | 0.0146 | 0.0956 |
| Echinococcus multilocularis | smad | 0.0008 | 0.0021 | 0.0015 |
| Mycobacterium leprae | Probable fatty-acid-CoA synthetase FadD22 (fatty-acid-CoA ligase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0167 |
| Brugia malayi | Major Facilitator Superfamily protein | 0.0018 | 0.0146 | 0.0484 |
| Mycobacterium tuberculosis | Peptide synthetase MbtF (peptide synthase) | 0.0007 | 0.0007 | 0.0024 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.001 | 0.0046 | 0.0039 |
| Loa Loa (eye worm) | hypothetical protein | 0.0011 | 0.0059 | 0.0184 |
| Onchocerca volvulus | 0.0016 | 0.0128 | 0.3327 | |
| Loa Loa (eye worm) | hypothetical protein | 0.0036 | 0.0372 | 0.1271 |
| Trypanosoma brucei | long-chain-fatty-acid-CoA ligase, putative | 0.0007 | 0.0007 | 0.0094 |
| Trichomonas vaginalis | Clan CA, family C1, cathepsin L-like cysteine peptidase | 0.0016 | 0.0128 | 0.0841 |
| Trypanosoma cruzi | cysteine proteinase, putative | 0.0008 | 0.0027 | 0.0384 |
| Entamoeba histolytica | cysteine protease, putative | 0.0016 | 0.0128 | 0.3001 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
| Trypanosoma cruzi | hexose transporter | 0.0039 | 0.0418 | 0.5864 |
| Mycobacterium tuberculosis | Possible fatty-acid-CoA ligase FadD10 (fatty-acid-CoA synthetase) (fatty-acid-CoA synthase) | 0.0007 | 0.0007 | 0.0024 |
| Trichomonas vaginalis | sugar transporter, putative | 0.0018 | 0.0146 | 0.0956 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| Activity (functional) | NOVARTIS: Antimalarial liver stage activity measured as a greater than 50% reduction in Plasmodium yoelii schizont area in HepG2-A16-CD81 cells at 10uM compound concentration, determined by immuno-fluorescence. | ChEMBL. | 22096101 | |
| CC50 (functional) | > 100 uM | Huh7 cytotoxicity for Pf inhibitors | Novartis-GNF Malaria Box. | No reference |
| CC50 | > 100 uM | NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7) | ChEMBL. | 18579783 |
| EC50 (functional) | = 683 nM | MMV: Inhibition of Plasmodium falciparum K1 (EC50). | ChEMBL. | No reference |
| EC50 (functional) | = 0.392 uM | W2 Pf proliferation inhibition | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.392 uM | NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| EC50 (functional) | = 0.441 uM | PF proliferation inhibition 3D7 | Novartis-GNF Malaria Box. | No reference |
| EC50 (functional) | = 0.441 uM | NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in erythrocyte-based infection assay | ChEMBL. | 18579783 |
| Growth Inhibition (functional) | = 19.40425 % | MMV: Measure of pLDH activity as indication of parasite viability. Gametocytogenesis of 3D7 Plasmodium falciparum strain was induced in vitro and asexual parasites were depleted with N-acetylglucosamine. Gametocytes were treated with dihydroartemisinin, epoxomicin, methylene blue, primaquine, puromycin or chloroquine in 96-well plates and the pLDH activity was evaluated using a modified Makler protocol. Mosquito infectivity was measured by the standard membrane feeding assay. | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGT2 that are glucose transport deficient and complemented with the L. Mexicana glucose transporter 2. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmGLUT1 that are glucose transport deficient and complemented with the human glucose transporter GLUT1. Activity is measured by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 12000 nM | ST_JUDE_LEISH: Cytotoxicity against transgenic Leishmania Mexicana promastigotes LmPfHT that are glucose transport deficient and complemented with the Plasmodium falciparum hexose transporter. Activity is measured by by DNA content using SYBR green in vitro | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: MAP2K Protein kinase inhibition assay using recombinant PfMAP2K, protein substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 0.5 mM DTT, 1 mM MgCl2, 0.5 mg/mL BSA, and 10 ug/ml MAP2 in a buffer of 50 mM HEPES (pH 7.0). 0.5 mg/mL histone III-S served as the substrate (13); 100 uM AMP-PNP, an ATP analog, was used as a control inhibitor. Incubation time was 4 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK6 Protein kinase inhibition assay using recombinant PfPK6, Myelin Basic Protein (MBP) substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1.5 uM ATP, 5 mM MnCl2, and 15 ug/ml PK6 in a buffer of 100 mM Tris-HCl (pH 7.5). 50 ug/mL MBP was provided as the substrate; 10 uM staurosporine was used as a control inhibitor. Incubation time was 3 hours and 40 minutes.The catalytic activity of each kinase was considered proportional to ATP consumed, as determined from measurements of residual [ATP] with the luciferase-based reagent Kinase-Glo (Promega) following incubation. Luminescence (proportional to residual [ATP]) was measured on the plate readers FLx800 (BioTek Instruments, Winooski, VT, USA) and MicroBeta2. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK1 Protein kinase inhibition assay using recombinant PfCDPK1, syntide 2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: PK7 Protein kinase inhibition assay using recombinant PfPK7, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. Final concentrations were 1 uM ATP, 2 mM DTT, 20 mM MgCl2, 2 mM MnCl2, 0.01% BSA, and 6 ug/ml PK7, in a buffer of 20 mM Tris-HCl (pH 7.5). The enzyme itself was the only substrate present (since autophosphorylation occurs); 100 uM 1NA-PP1 was used as a control inhibitor. Incubation time was 3 hours. | ChEMBL. | No reference |
| IC50 (functional) | > 1 uM | MMV: CDPK4 Protein kinase inhibition assay using recombinant PfCDPK4, syntide2 peptide substrate, ATP and KinaseGlo to measure % inhibition at 1 uM MMV box compound. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: ProRS recombinant Plasmodium falciparum Prolyl-tRNA-synthetase, assay with yeast tRNA, ATP, and proline and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 (functional) | > 2.5 uM | MMV: KRS recombinant Plasmodium falciparum Lysyl-tRNA-synthetase, assay with yeast tRNA, ATP, and lysine and 3 uM MMV malaria box compound, assay read out with kinase glo as % inhibition. | ChEMBL. | No reference |
| IC50 | = 6.34960412979126 uM | MMV: Cytotoxicity against human fibroblasts (MRC-5) cells. | ChEMBL. | No reference |
| IC50 (functional) | = 20.8255348205566 uM | MMV: Inhibition of Trypanosoma brucei rhodesiense (STIB 900) (HAT in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: Primary screening was performed with each compound at a 30 uM final concentration and in triplicate in sealed 96-well polystyrene microtiter plates. Parasite inocula (100 ul) comprising 20000 parasites/ml were added to each well and grown at 37 degrees C in a humidified atmosphere of 5% CO2 for 72 h. Positive controls consisted of metronidazole at 1 mg/ml. The growth of E. histolytica trophozoites in each well was determined microscopically by measuring the diameters of the confluent cells in drug-containing wells relative to those in the nega- tive-control wells. | ChEMBL. | No reference |
| IC50 (functional) | > 30 uM | MMV: A total of 100ul of inoculum was added to each well (parasite/cell ratio, ~10:1; final volume, 200 ul). Six hours after inoculation, nonadherent parasites were removed, and 100 ul of complete DMEM (1% penicillin-streptomycin, 3% FBS) supplemented with inhibitors at different concentrations (2-fold serial dilutions starting from 30 uM) was added to all except the negative-control wells. Positive controls, consisting of pyrimethamine (PYR) and sulfadiazine (SDZ) (20-mg/ml stocks in DMSO), were tested at a 2mg/ml final concentration. Each test was performed in triplicate. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Leishmania infantum (MHOM/MA/BE/67) in vitro. | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma cruzi (Tulahuen C4 LacZ) (Chagas in vitro). | ChEMBL. | No reference |
| IC50 (functional) | > 32 uM | MMV: Inhibition of Trypanosoma brucei brucei (Squib 427) (HAT in vitro). | ChEMBL. | No reference |
| IFI promiscuity index | = 0.05505 | IFI promiscuity index | Novartis-GNF Malaria Box. | No reference |
| Inhibition (functional) | = -19.6223128433924 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Female gamete formation was recorded 24 hr later by automated microscopy detection of surface labelling of female gametes with a Cy3-conjugated antibody reactive to Pfs25. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -11.4976068311173 % | MMV: P. falciparum NF54 functionally mature Stage V gametocytes were incubated for 24 hr in the presence of the test compounds. Gamete formation was then triggered by addition of 2uM xantheurenic acid and temperature decrease to ~20C. Male gamete exflagellation was recorded and analysed by automated microscopy after 20 min. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = -6 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 1.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 6 % | MMV: Malaria Box compounds were tested for inhibition of the human ether a go-go related gene (hERG), Kv11.1 channel, using IonWorks 384-well patch clamp electrophysiology at 11.1uM (3 independent assay plates up to 12 cells per concentration). | ChEMBL. | No reference |
| Inhibition (functional) | = 6.0575687822684 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 6.057568782268405 % | MMV: P. berghei-infected blood was withdrawn from mice by cardiac pucture before being immediately added to ookinete culture medium containing test compounds. 26 hr later, GFP-positive ookinetes were identified and counted by automated microscopy. All compounds were tested in 4 independent experiments and data presented here is the mean. | ChEMBL. | No reference |
| Inhibition (functional) | = 13.4 % | MMV: Screen against Mtb, single point, replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 21.4 % | MMV: Screen against Mtb, single point, non replicating, at 25uM | ChEMBL. | No reference |
| Inhibition (functional) | = 64.8616877224788 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 64.86168772247882 % | MMV: Cryptosporidium parvum oocysts (Iowa Strain) were prepared for use by treatment with 10 mM HCl (37 degrees C, 10 min) followed by 2 mM sodium taurocholate in phosphate-buffered saline (PBS) with Ca2+ and Mg2+ (16 degrees C, 10 min) in order to stimulate excystation. The high-throughput screen was carried out by inoculating >90% confluent human ileocecal adenocarcinoma (HCT-8) cells (ATCC) with ~5.5 x 10^3 primed oocysts per well. Experimental compounds or DMSO (vehicle) were added three hours after infection, and cells were incubated for 48 hours. | ChEMBL. | No reference |
| Inhibition (functional) | = 83.29802101 % | MMV: NCI60 panel. Malaria Box compounds were tested for inhibition of the human Ovarian Cancer cell line NCI/ADR-RES | ChEMBL. | No reference |
| Inhibition (functional) | = 94 % | MMV: Inhibition of Plasmodium falciparum 3D7 at 5uM compound concentration. | ChEMBL. | No reference |
| Ratio (functional) | = 1.06666666666667 | MMV: Compounds (1uM) were screened in a 72hr growth assay monitored by flow cytometry both in the presence and absence of supplemental isopentenyl pyrophosphate (IPP) 200uM. Compounds which fail to show anti-malarial activity when chemically rescued by IPP are therefore specific to the apicoplast. The values are expressed as the ratio of the corresponding activity with and without IPP, respectively. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.3574 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing ethanol and glycerol as carbon sources (Yeast Nitrogen Base, Ethanol, Glycerol; YNBEG). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 180 OD readings, corresponding to roughly 45 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = -0.1287 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in minimal media containing dextrose as a carbon source (Yeast Nitrogen Base, Dextrose; YNBD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings, corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Relative Growth (functional) | = 0.0119 | MMV: Growth assays were conducted using the prototrophic S. cerevisiae strain JHY222. Each MMV compound (0.1 mM) was tested in rich media containing dextrose as a carbon source (Yeast Extract, Peptone, Dextrose; YPD). The growth rate in the presence of each MMV compound was calculated as follows: (i) the first 10 OD readings were averaged and subtracted from all OD readings of the corresponding curve to set the baseline of the growth curve to zero, and (ii) the area under the curve (AUC) was then calculated as the sum of all OD readings. AUC was calculated following 80 OD readings corresponding to roughly 20 h of growth. A relative growth value was calculated as follows: AUC(DRUG) - AUC(DMSO)/AUC(DMSO); where AUC(DMSO) represents growth measured in a DMSO control well that was on the same microtiter plate of the drug-treated culture. A relative growth value near zero means the compound had little or no effect on growth, whereas a value near -1 means the compound strongly or completely inhibited growth. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 24 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 48 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
| Toxicity (functional) | = 0 | MMV: Toxicity @ 2.5 uM to newly transformed Schistosoma mansoni somules after 72 h on a scale of 0 (none) - 4 (most) as judged visually: includes short descriptors of effects (PMID:19597541). Caffrey group UCSF. | ChEMBL. | No reference |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Plasmodium falciparum | ChEMBL23 | 18579783 | |
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL599886
- Search by Novartis-GNF Malaria Box
Bibliographic References
No literature references available for this target.
If you have references for this compound, please enter them in a user comment (below) or Contact us.