Detailed information for compound 112114
Basic information
Technical information
- TDR Targets ID: 112114
- Name: (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enyli dene]-2-sulfanylidene-1,3-thiazolidin-4-one
- MW: 282.296 | Formula: C10H6N2O4S2
-
H donors: 1
H acceptors: 3
LogP: 2.7
Rotable bonds: 3
Rule of 5 violations (Lipinski): 1 - SMILES: S=C1NC(=O)/C(=C/C=C/c2ccc(o2)[N+](=O)[O-])/S1
- InChi: 1S/C10H6N2O4S2/c13-9-7(18-10(17)11-9)3-1-2-6-4-5-8(16-6)12(14)15/h1-5H,(H,11,13,17)/b2-1+,7-3-
- InChiKey: VGDGBMXDKZEVTF-YDCWOTKKSA-N
Network
Hover on a compound node to display the structore
Synonyms
- (5Z)-5-[(E)-3-(5-nitro-2-furyl)prop-2-enylidene]-2-thioxo-thiazolidin-4-one
- (5Z)-5-[(E)-3-(5-nitro-2-furyl)prop-2-enylidene]-2-thioxo-4-thiazolidinone
- 5-[3-(5-nitrofuran-2-yl)prop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
- 5-[3-(5-nitro-2-furyl)prop-2-enylidene]-2-thioxo-thiazolidin-4-one
- 5-[3-(5-nitro-2-furyl)prop-2-enylidene]-2-thioxo-4-thiazolidinone
- P00052
- (5Z)-5-[(2E)-3-(5-nitro-2-furyl)prop-2-enylidene]-2-thioxo-1,3-thiazolidin-4-one
- MLS000722913
- SMR000304908
- ZINC05172555
Targets
Known targets for this compound
| Species | Target name | Source | Bibliographic reference |
|---|---|---|---|
| Homo sapiens | muscleblind-like splicing regulator 1 | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific demethylase 4A | Starlite/ChEMBL | No references |
| Schistosoma mansoni | Thioredoxin glutathione reductase | Starlite/ChEMBL | No references |
| Homo sapiens | ataxin 2 | Starlite/ChEMBL | No references |
| Homo sapiens | geminin, DNA replication inhibitor | Starlite/ChEMBL | No references |
| Homo sapiens | synuclein, alpha (non A4 component of amyloid precursor) | Starlite/ChEMBL | No references |
| Homo sapiens | apolipoprotein B mRNA editing enzyme, catalytic polypeptide-like 3G | Starlite/ChEMBL | No references |
| Homo sapiens | RAB9A, member RAS oncogene family | Starlite/ChEMBL | No references |
| Homo sapiens | APEX nuclease (multifunctional DNA repair enzyme) 1 | Starlite/ChEMBL | No references |
| Mus musculus | DNA-damage inducible transcript 3 | Starlite/ChEMBL | No references |
| Homo sapiens | huntingtin | Starlite/ChEMBL | No references |
| Homo sapiens | X-box binding protein 1 | Starlite/ChEMBL | No references |
| Plasmodium falciparum | heat shock protein 90, putative | Starlite/ChEMBL | No references |
| Homo sapiens | nuclear factor, erythroid 2-like 2 | Starlite/ChEMBL | No references |
| Homo sapiens | ATPase family, AAA domain containing 5 | Starlite/ChEMBL | No references |
| Influenza A virus | Nonstructural protein 1 | Starlite/ChEMBL | No references |
| Homo sapiens | Niemann-Pick disease, type C1 | Starlite/ChEMBL | No references |
| Homo sapiens | glucagon-like peptide 1 receptor | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed) kappa | Starlite/ChEMBL | No references |
| Homo sapiens | myeloid cell leukemia 1 | Starlite/ChEMBL | No references |
| Homo sapiens | thyroid hormone receptor, beta | Starlite/ChEMBL | No references |
| Homo sapiens | heat shock protein 90kDa alpha (cytosolic), class A member 1 | Starlite/ChEMBL | No references |
| Human immunodeficiency virus type 1 group M subtype B (isolate HXB2)(HIV-1) | Human immunodeficiency virus type 1 Tat protein | Starlite/ChEMBL | No references |
| Enterobacter cloacae | Beta-lactamase | Starlite/ChEMBL | References |
| Homo sapiens | neuropeptide S receptor 1 | Starlite/ChEMBL | No references |
| Rattus norvegicus | Thioredoxin reductase 1, cytoplasmic | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed) iota | Starlite/ChEMBL | No references |
| Homo sapiens | glycoprotein hormones, alpha polypeptide | Starlite/ChEMBL | No references |
| Trypanosoma brucei | phosphoglycerate kinase | Starlite/ChEMBL | No references |
| Mycobacterium tuberculosis | Probable UDP-N-acetylglucosamine pyrophosphorylase GlmU | Starlite/ChEMBL | No references |
| Homo sapiens | RecQ helicase-like | Starlite/ChEMBL | No references |
| Homo sapiens | tyrosyl-DNA phosphodiesterase 1 | Starlite/ChEMBL | No references |
| Homo sapiens | bromodomain adjacent to zinc finger domain, 2B | Starlite/ChEMBL | No references |
| Homo sapiens | lysine (K)-specific demethylase 4E | Starlite/ChEMBL | No references |
| Homo sapiens | polymerase (DNA directed), eta | Starlite/ChEMBL | No references |
| Mus musculus | RAR-related orphan receptor gamma | Starlite/ChEMBL | No references |
| Homo sapiens | SMAD family member 2 | Starlite/ChEMBL | No references |
| Homo sapiens | isocitrate dehydrogenase 1 (NADP+), soluble | Starlite/ChEMBL | No references |
Predicted pathogen targets for this compound
By orthology
By sequence similarity to non orthologous known druggable targets
Obtained from network model
Ranking Plot
Putative Targets List
| Species | Potential target | Raw | Global | Species |
|---|---|---|---|---|
| Brugia malayi | Calcitonin receptor-like protein seb-1 | 0.006 | 0.0434 | 0.246 |
| Schistosoma mansoni | transcription factor LCR-F1 | 0.0043 | 0.026 | 0.0758 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Echinococcus granulosus | neuropeptide s receptor | 0.0558 | 0.562 | 1 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0024 | 0.0057 | 0.0153 |
| Leishmania major | lipophosphoglycan biosynthetic protein, putative,heat shock protein 90, putative,glucose regulated protein 94, putative | 0.0052 | 0.0348 | 0.3969 |
| Schistosoma mansoni | acetyl-CoA C-acetyltransferase | 0.0027 | 0.0091 | 0.0266 |
| Mycobacterium tuberculosis | Probable esterase LipL | 0.0043 | 0.026 | 0.0367 |
| Echinococcus granulosus | geminin | 0.0205 | 0.1938 | 0.3441 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0351 | 0.3996 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0043 | 0.026 | 0.128 |
| Plasmodium vivax | endoplasmin, putative | 0.0055 | 0.0384 | 0.1902 |
| Trypanosoma brucei | dihydrolipoyl dehydrogenase | 0.0036 | 0.0178 | 0.2033 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.0125 | 0.1419 |
| Echinococcus granulosus | X box binding protein 1 | 0.0348 | 0.3429 | 0.6097 |
| Echinococcus granulosus | dna polymerase eta | 0.0095 | 0.0795 | 0.1405 |
| Treponema pallidum | heat shock protein 90 | 0.0052 | 0.0348 | 0.2844 |
| Echinococcus multilocularis | COUP TF:Svp nuclear hormone receptor | 0.0024 | 0.0062 | 0.0056 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0036 | 0.0178 | 0.2033 |
| Schistosoma mansoni | coup transcription factor | 0.0024 | 0.0062 | 0.018 |
| Loa Loa (eye worm) | hypothetical protein | 0.0182 | 0.1707 | 1 |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0043 | 0.026 | 0.0759 |
| Onchocerca volvulus | Huntingtin homolog | 0.0148 | 0.1348 | 0.7815 |
| Echinococcus multilocularis | X box binding protein 1 | 0.0348 | 0.3429 | 0.3425 |
| Mycobacterium tuberculosis | Conserved protein | 0.0043 | 0.026 | 0.0367 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q5 | 0.0024 | 0.0057 | 0.0051 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0057 | 0.0299 |
| Trypanosoma cruzi | trypanothione reductase, putative | 0.0103 | 0.0877 | 1 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.003 | 0.0123 | 0.0689 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Mycobacterium tuberculosis | Probable nitrite reductase [NAD(P)H] large subunit [FAD flavoprotein] NirB | 0.0234 | 0.2248 | 0.3238 |
| Schistosoma mansoni | methyl-cpg binding protein mbd | 0.0021 | 0.0022 | 0.0064 |
| Leishmania major | hypothetical protein, conserved | 0.003 | 0.0125 | 0.1419 |
| Trypanosoma brucei | phosphoglycerate kinase, putative | 0.0038 | 0.02 | 0.2283 |
| Loa Loa (eye worm) | PHD-finger family protein | 0.0035 | 0.0174 | 0.0989 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.0043 | 0.026 | 0.2966 |
| Loa Loa (eye worm) | steroid hormone receptor | 0.0024 | 0.0062 | 0.0328 |
| Trypanosoma cruzi | PAS-domain containing phosphoglycerate kinase, putative | 0.0038 | 0.02 | 0.2283 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0043 | 0.026 | 0.2966 |
| Loa Loa (eye worm) | hypothetical protein | 0.0021 | 0.0022 | 0.0095 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-1 | 0.0024 | 0.0062 | 0.0328 |
| Toxoplasma gondii | heat shock protein HSP90 | 0.0055 | 0.0384 | 0.1902 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, mitochondrial, putative | 0.0036 | 0.0178 | 0.0868 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Schistosoma mansoni | bromodomain containing protein | 0.0076 | 0.0603 | 0.1759 |
| Trichomonas vaginalis | conserved hypothetical protein | 0.0051 | 0.0339 | 0.3536 |
| Schistosoma mansoni | nuclear hormone receptor nor-1/nor-2 | 0.0024 | 0.0062 | 0.018 |
| Leishmania major | DNA polymerase kappa, putative,DNA polymerase IV, putative | 0.0072 | 0.0558 | 0.6355 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0349 | 0.3977 |
| Schistosoma mansoni | terminal deoxycytidyl transferase | 0.0064 | 0.0475 | 0.1385 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0116 | 0.1014 | 0.2959 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 0.0062 | 0.0099 |
| Mycobacterium ulcerans | exodeoxyribonuclease III protein XthA | 0.0023 | 0.0044 | 0.0042 |
| Mycobacterium tuberculosis | Probable hydrolase | 0.0043 | 0.026 | 0.0367 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.026 | 0.2156 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, apicoplast | 0.0036 | 0.0178 | 0.0868 |
| Schistosoma mansoni | zinc finger protein | 0.0024 | 0.0054 | 0.0157 |
| Loa Loa (eye worm) | isocitrate dehydrogenase | 0.0019 | 0.0006 | 0.0002 |
| Leishmania major | DNA damage repair protein, putative | 0.002 | 0.0015 | 0.0168 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.003 | 0.0123 | 0.1403 |
| Plasmodium falciparum | phd finger protein, putative | 0.0035 | 0.0174 | 0.0846 |
| Mycobacterium tuberculosis | Probable chaperone protein HtpG (heat shock protein) (HSP90 family protein) (high temperature protein G) | 0.0052 | 0.0348 | 0.0494 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Wolbachia endosymbiont of Brugia malayi | N-acetylglucosamine-1-phosphate uridyltransferase | 0.0684 | 0.693 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0116 | 0.1014 | 0.5929 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0351 | 0.3996 |
| Leishmania major | PAS-domain containing phosphoglycerate kinase, putative | 0.0038 | 0.02 | 0.2283 |
| Brugia malayi | Bloom's syndrome protein homolog | 0.0024 | 0.0057 | 0.0292 |
| Echinococcus granulosus | Protein patched homolog 1 | 0.0051 | 0.0339 | 0.0593 |
| Plasmodium vivax | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0044 | 0.0191 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Echinococcus multilocularis | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.0637 | 0.0632 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Schistosoma mansoni | bcl-2 homologous antagonist/killer (bak) | 0.01 | 0.0849 | 0.2475 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-49 | 0.0024 | 0.0062 | 0.0328 |
| Echinococcus multilocularis | geminin | 0.0205 | 0.1938 | 0.1933 |
| Loa Loa (eye worm) | hypothetical protein | 0.0148 | 0.1348 | 0.7887 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.0125 | 0.0596 |
| Echinococcus granulosus | dihydrolipoamide dehydrogenase | 0.0036 | 0.0178 | 0.0307 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma cruzi | 3-phosphoglycerate kinase, glycosomal | 0.0038 | 0.02 | 0.2283 |
| Schistosoma mansoni | RAR-like nuclear receptor | 0.0024 | 0.0062 | 0.018 |
| Schistosoma mansoni | hypothetical protein | 0.0348 | 0.3429 | 1 |
| Brugia malayi | Apoptosis regulator proteins, Bcl-2 family protein | 0.01 | 0.0849 | 0.4839 |
| Schistosoma mansoni | FTZ-F1 nuclear receptor-like protein | 0.0024 | 0.0062 | 0.018 |
| Toxoplasma gondii | heat shock protein 90, putative | 0.0055 | 0.0384 | 0.1902 |
| Toxoplasma gondii | histone lysine demethylase JMJD6a | 0.003 | 0.0123 | 0.0589 |
| Leishmania major | DNA polymerase eta, putative | 0.0095 | 0.0795 | 0.9059 |
| Echinococcus multilocularis | Jumonji, AT rich interactive domain 1B | 0.0033 | 0.0147 | 0.0141 |
| Brugia malayi | jmjC domain containing protein | 0.003 | 0.0123 | 0.0673 |
| Onchocerca volvulus | 0.0182 | 0.1707 | 1 | |
| Schistosoma mansoni | family S12 unassigned peptidase (S12 family) | 0.0043 | 0.026 | 0.0759 |
| Echinococcus granulosus | ecdysone induced protein 78C | 0.0024 | 0.0062 | 0.0099 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase, LpdB | 0.0036 | 0.0178 | 0.0237 |
| Wolbachia endosymbiont of Brugia malayi | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.121 |
| Toxoplasma gondii | ImpB/MucB/SamB family protein | 0.0051 | 0.0335 | 0.1656 |
| Echinococcus granulosus | phosphoglycerate kinase 1 | 0.0103 | 0.0877 | 0.1552 |
| Brugia malayi | Nuclear hormone receptor-like 1 | 0.0024 | 0.0062 | 0.032 |
| Echinococcus multilocularis | histone lysine methyltransferase setb histone lysine methyltransferase eggless | 0.0021 | 0.0022 | 0.0016 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0043 | 0.026 | 0.2594 |
| Trypanosoma cruzi | heat shock protein, putative | 0.0037 | 0.019 | 0.2169 |
| Wolbachia endosymbiont of Brugia malayi | heat shock protein 90 | 0.0052 | 0.0348 | 0.0442 |
| Loa Loa (eye worm) | hypothetical protein | 0.0046 | 0.029 | 0.167 |
| Echinococcus granulosus | EGFP:Bcl2 fusion protein | 0.01 | 0.0849 | 0.1501 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0036 | 0.0178 | 0.2033 |
| Loa Loa (eye worm) | hypothetical protein | 0.0103 | 0.0877 | 0.5122 |
| Schistosoma mansoni | protein phosphatase 2C | 0.003 | 0.0123 | 0.0359 |
| Echinococcus multilocularis | dna polymerase kappa | 0.0096 | 0.0809 | 0.0804 |
| Leishmania major | DNA polymerase kappa, putative | 0.0072 | 0.0558 | 0.6355 |
| Schistosoma mansoni | dihydrolipoamide dehydrogenase | 0.0036 | 0.0178 | 0.052 |
| Giardia lamblia | Phosphoglycerate kinase | 0.0103 | 0.0877 | 1 |
| Plasmodium vivax | hypothetical protein, conserved | 0.0035 | 0.0174 | 0.0846 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0038 | 0.02 | 0.2283 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0006 | 0.0017 |
| Entamoeba histolytica | recQ family helicase, putative | 0.0024 | 0.0057 | 0.0127 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.003 | 0.0123 | 0.0689 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0006 | 0.0017 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.002 | 0.0015 | 0.0168 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Mycobacterium tuberculosis | Possible penicillin-binding protein | 0.0278 | 0.2699 | 0.3889 |
| Mycobacterium tuberculosis | Probable phosphoglycerate kinase Pgk | 0.0103 | 0.0877 | 0.1258 |
| Brugia malayi | jmjC domain containing protein | 0.003 | 0.0123 | 0.0673 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 0.0062 | 0.032 |
| Echinococcus granulosus | dna polymerase kappa | 0.0096 | 0.0809 | 0.143 |
| Onchocerca volvulus | Huntingtin homolog | 0.0148 | 0.1348 | 0.7815 |
| Brugia malayi | Bromodomain containing protein | 0.0091 | 0.075 | 0.4275 |
| Brugia malayi | hypothetical protein | 0.0182 | 0.1707 | 0.977 |
| Plasmodium vivax | heat shock protein 90, putative | 0.0037 | 0.019 | 0.0928 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-14 | 0.0024 | 0.0062 | 0.0328 |
| Brugia malayi | Tyrosyl-DNA phosphodiesterase family protein | 0.008 | 0.0637 | 0.3627 |
| Treponema pallidum | licC protein (licC) | 0.0125 | 0.1114 | 1 |
| Trichomonas vaginalis | glutathione reductase, putative | 0.0036 | 0.0178 | 0.1612 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0021 | 0.0022 | 0.0064 |
| Echinococcus granulosus | histone lysine methyltransferase setb | 0.0021 | 0.0022 | 0.0029 |
| Echinococcus granulosus | endoplasmin | 0.0052 | 0.0348 | 0.061 |
| Loa Loa (eye worm) | heat shock protein 90 | 0.0055 | 0.0384 | 0.222 |
| Echinococcus multilocularis | dihydrolipoamide dehydrogenase | 0.0036 | 0.0178 | 0.0173 |
| Trypanosoma cruzi | isocitrate dehydrogenase, putative | 0.0019 | 0.0006 | 0.0072 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Echinococcus granulosus | Transcription factor JmjC domain containing protein | 0.0186 | 0.1747 | 0.3101 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Leishmania major | apurinic/apyrimidinic endonuclease-redox protein | 0.0023 | 0.0044 | 0.0502 |
| Trypanosoma brucei | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0024 | 0.0057 | 0.0647 |
| Mycobacterium leprae | PROBABLE CHAPERONE PROTEIN HTPG (HEAT SHOCK PROTEIN) (HSP90 FAMILY PROTEIN) (HIGH TEMPERATURE PROTEIN G) | 0.0052 | 0.0348 | 0.0132 |
| Echinococcus granulosus | Niemann Pick C1 protein | 0.0119 | 0.1045 | 0.1851 |
| Schistosoma mansoni | endoplasmin | 0.0055 | 0.0384 | 0.1119 |
| Loa Loa (eye worm) | pigment dispersing factor receptor c | 0.006 | 0.0434 | 0.2518 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Echinococcus granulosus | neuropeptide receptor A26 | 0.0558 | 0.562 | 1 |
| Loa Loa (eye worm) | bromodomain containing protein | 0.0021 | 0.003 | 0.014 |
| Echinococcus multilocularis | Basic leucine zipper (bZIP) transcription | 0.0043 | 0.026 | 0.0254 |
| Brugia malayi | polk-prov protein | 0.0052 | 0.0349 | 0.197 |
| Echinococcus granulosus | Mitotic checkpoint protein PRCC C terminal | 0.0152 | 0.139 | 0.2465 |
| Leishmania major | phosphoglycerate kinase B, cytosolic | 0.0103 | 0.0877 | 0.9998 |
| Loa Loa (eye worm) | hypothetical protein | 0.0043 | 0.026 | 0.1495 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0051 | 0.0335 | 0.3817 |
| Brugia malayi | Steroid receptor seven-up type 2 | 0.0024 | 0.0062 | 0.032 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.032 | 0.0932 |
| Loa Loa (eye worm) | heat shock protein 75 | 0.0037 | 0.019 | 0.1084 |
| Toxoplasma gondii | PHD-finger domain-containing protein | 0.0035 | 0.0174 | 0.0846 |
| Brugia malayi | MH2 domain containing protein | 0.0144 | 0.1308 | 0.748 |
| Entamoeba histolytica | deoxycytidyl transferase, putative | 0.0064 | 0.0475 | 0.4302 |
| Toxoplasma gondii | phosphoglycerate kinase PGKI | 0.0103 | 0.0877 | 0.439 |
| Brugia malayi | nuclear receptor NHR-88 | 0.0024 | 0.0062 | 0.032 |
| Trypanosoma cruzi | JmjC domain, hydroxylase, putative | 0.003 | 0.0123 | 0.1403 |
| Giardia lamblia | Heat shock protein HSP 90-alpha | 0.0055 | 0.0384 | 0.4277 |
| Giardia lamblia | DINP protein human, muc B family | 0.0072 | 0.0558 | 0.6295 |
| Echinococcus granulosus | lysine specific demethylase 6a | 0.003 | 0.0123 | 0.0209 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0096 | 0.0809 | 0.1149 |
| Brugia malayi | Hypothetical 52.5 kDa protein ZK945.1 in chromosome II, putative | 0.0043 | 0.026 | 0.146 |
| Echinococcus multilocularis | FTZ F1 nuclear receptor protein | 0.0024 | 0.0062 | 0.0056 |
| Mycobacterium tuberculosis | Probable conserved lipoprotein | 0.0043 | 0.026 | 0.0367 |
| Entamoeba histolytica | tyrosyl-DNA phosphodiesterase, putative | 0.008 | 0.0637 | 0.5927 |
| Loa Loa (eye worm) | MH2 domain-containing protein | 0.0144 | 0.1308 | 0.7656 |
| Schistosoma mansoni | patched 1 | 0.0051 | 0.0339 | 0.0988 |
| Plasmodium falciparum | AP endonuclease (DNA-[apurinic or apyrimidinic site] lyase), putative | 0.0023 | 0.0044 | 0.0191 |
| Schistosoma mansoni | hypothetical protein | 0.0041 | 0.0236 | 0.0688 |
| Brugia malayi | beta-lactamase | 0.0043 | 0.026 | 0.146 |
| Mycobacterium tuberculosis | Probable membrane NADH dehydrogenase NdhA | 0.0234 | 0.2248 | 0.3238 |
| Mycobacterium tuberculosis | Probable reductase | 0.0234 | 0.2248 | 0.3238 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Trypanosoma brucei | PAB1-binding protein , putative | 0.003 | 0.0125 | 0.1419 |
| Trichomonas vaginalis | phosphoglycerate kinase, putative | 0.0103 | 0.0877 | 1 |
| Loa Loa (eye worm) | ImpB/MucB/SamB family protein | 0.0064 | 0.0475 | 0.2756 |
| Brugia malayi | Corticotropin releasing factor receptor 2 precursor, putative | 0.006 | 0.0434 | 0.246 |
| Loa Loa (eye worm) | tyrosyl-DNA phosphodiesterase | 0.008 | 0.0637 | 0.3712 |
| Onchocerca volvulus | Heat shock protein 75 kDa, mitochondrial homolog | 0.0037 | 0.019 | 0.0781 |
| Trichomonas vaginalis | DNA helicase recq, putative | 0.0024 | 0.0057 | 0.0153 |
| Toxoplasma gondii | histone lysine demethylase JMJC1/KDM5D/JARID1D | 0.003 | 0.0123 | 0.0589 |
| Brugia malayi | jmjC domain containing protein | 0.0116 | 0.1014 | 0.5792 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Schistosoma mansoni | jumonji domain containing protein | 0.003 | 0.0123 | 0.0359 |
| Trypanosoma cruzi | PAS-domain containing phosphoglycerate kinase, putative | 0.0038 | 0.02 | 0.2283 |
| Loa Loa (eye worm) | hypothetical protein | 0.0085 | 0.0697 | 0.406 |
| Leishmania major | hypothetical protein, conserved | 0.003 | 0.0123 | 0.1403 |
| Mycobacterium tuberculosis | Probable oxidoreductase | 0.0261 | 0.252 | 0.3631 |
| Echinococcus multilocularis | muscleblind protein 1 | 0.018 | 0.1685 | 0.168 |
| Brugia malayi | photoreceptor-specific nuclear receptor | 0.0024 | 0.0062 | 0.032 |
| Echinococcus granulosus | heat shock protein 75 kDa mitochondrial | 0.0037 | 0.019 | 0.0328 |
| Schistosoma mansoni | hypothetical protein | 0.01 | 0.0849 | 0.2475 |
| Brugia malayi | hypothetical protein | 0.003 | 0.0125 | 0.0681 |
| Echinococcus multilocularis | lysine specific demethylase 6a | 0.003 | 0.0123 | 0.0117 |
| Echinococcus granulosus | NADP dependent isocitrate dehydrogenase | 0.0019 | 0.0006 | 0.0001 |
| Brugia malayi | Phosphoglycerate kinase | 0.0103 | 0.0877 | 0.5004 |
| Brugia malayi | PHD-finger family protein | 0.003 | 0.0121 | 0.066 |
| Schistosoma mansoni | steroid hormone receptor ad4bp | 0.0024 | 0.0062 | 0.018 |
| Schistosoma mansoni | hypothetical protein | 0.0205 | 0.1938 | 0.5651 |
| Echinococcus multilocularis | bloom syndrome protein | 0.0024 | 0.0057 | 0.0051 |
| Brugia malayi | Endoplasmin precursor | 0.0055 | 0.0384 | 0.2169 |
| Plasmodium falciparum | glutathione reductase | 0.0036 | 0.0178 | 0.0868 |
| Schistosoma mansoni | hypothetical protein | 0.0025 | 0.0067 | 0.0196 |
| Echinococcus multilocularis | beta LACTamase domain containing family member | 0.0043 | 0.026 | 0.0254 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.032 | 0.0932 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Schistosoma mansoni | jumonji domain containing protein | 0.0163 | 0.15 | 0.4376 |
| Schistosoma mansoni | hypothetical protein | 0.01 | 0.0849 | 0.2475 |
| Echinococcus multilocularis | Transcription factor, JmjC domain containing protein | 0.0186 | 0.1747 | 0.1742 |
| Mycobacterium leprae | Probable phosphoglycerate kinase Pgk | 0.0103 | 0.0877 | 0.0925 |
| Brugia malayi | CHE-14 protein | 0.0051 | 0.0339 | 0.1911 |
| Plasmodium falciparum | DNA repair protein REV1, putative | 0.002 | 0.0015 | 0.0043 |
| Schistosoma mansoni | hypothetical protein | 0.0205 | 0.1938 | 0.5651 |
| Mycobacterium ulcerans | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.1247 |
| Entamoeba histolytica | 90 kDa heat shock protein, putative | 0.0037 | 0.019 | 0.1461 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Mycobacterium ulcerans | hypothetical protein | 0.0125 | 0.1114 | 0.1589 |
| Schistosoma mansoni | hypothetical protein | 0.0035 | 0.0174 | 0.0508 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0043 | 0.026 | 0.2594 |
| Leishmania major | trypanothione reductase | 0.0103 | 0.0877 | 1 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0176 | 0.1644 | 0.4795 |
| Plasmodium falciparum | glutathione reductase | 0.0103 | 0.0877 | 0.4391 |
| Brugia malayi | Pyridine nucleotide-disulphide oxidoreductase, dimerisation domain containing protein | 0.0026 | 0.008 | 0.0425 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0055 | 0.0384 | 0.4372 |
| Brugia malayi | beta-lactamase family protein | 0.0043 | 0.026 | 0.146 |
| Trypanosoma brucei | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0044 | 0.0502 |
| Trypanosoma brucei | isocitrate dehydrogenase, putative | 0.0019 | 0.0006 | 0.0072 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0103 | 0.0877 | 0.9998 |
| Schistosoma mansoni | nuclear receptor 2DBD-gamma | 0.0024 | 0.0062 | 0.018 |
| Onchocerca volvulus | 0.0043 | 0.026 | 0.1206 | |
| Brugia malayi | Nuclear hormone receptor family member nhr-49 | 0.0024 | 0.0062 | 0.032 |
| Echinococcus multilocularis | FTZ F1 alpha | 0.0024 | 0.0062 | 0.0056 |
| Echinococcus multilocularis | Niemann Pick C1 protein | 0.0119 | 0.1045 | 0.104 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0036 | 0.0178 | 0.0195 |
| Echinococcus multilocularis | zinc finger protein | 0.0024 | 0.0054 | 0.0048 |
| Brugia malayi | Bromodomain containing protein | 0.0038 | 0.0204 | 0.1137 |
| Trypanosoma cruzi | Heat shock protein 83, putative | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0096 | 0.0809 | 0.9219 |
| Schistosoma mansoni | hypothetical protein | 0.0043 | 0.026 | 0.0758 |
| Brugia malayi | Niemann-Pick C1 protein precursor | 0.0119 | 0.1045 | 0.5969 |
| Trypanosoma brucei | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.9998 |
| Echinococcus granulosus | tyrosyl DNA phosphodiesterase 1 | 0.008 | 0.0637 | 0.1125 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0044 | 0.0129 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 0.0062 | 0.032 |
| Leishmania major | phosphoglycerate kinase C, glycosomal | 0.0103 | 0.0877 | 0.9998 |
| Schistosoma mansoni | histone-lysine n-methyltransferase setb1 | 0.0021 | 0.0022 | 0.0064 |
| Mycobacterium tuberculosis | Possible DNA-damage-inducible protein P DinP (DNA polymerase V) (pol IV 2) (DNA nucleotidyltransferase (DNA-directed)) | 0.0072 | 0.0558 | 0.0796 |
| Chlamydia trachomatis | phosphoglycerate kinase | 0.0103 | 0.0877 | 1 |
| Plasmodium falciparum | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.439 |
| Schistosoma mansoni | bromodomain-containing nuclear protein 1 brd1 | 0.0035 | 0.0174 | 0.0508 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0349 | 0.3977 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Mycobacterium ulcerans | lipase LipD | 0.0043 | 0.026 | 0.0355 |
| Mycobacterium ulcerans | molybdopterin-guanine dinucleotide biosynthesis protein A | 0.0125 | 0.1114 | 0.1589 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Plasmodium falciparum | dihydrolipoyl dehydrogenase, mitochondrial | 0.0036 | 0.0178 | 0.0868 |
| Echinococcus granulosus | JmjC domain containing protein 4 | 0.003 | 0.0123 | 0.0209 |
| Toxoplasma gondii | ImpB/MucB/SamB family protein | 0.002 | 0.0015 | 0.0043 |
| Echinococcus granulosus | DNA apurinic or apyrimidinic site lyase | 0.0023 | 0.0044 | 0.0068 |
| Schistosoma mansoni | NADP-specific isocitrate dehydrogenase | 0.0019 | 0.0006 | 0.0018 |
| Echinococcus granulosus | bromodomain adjacent to zinc finger domain | 0.0072 | 0.0558 | 0.0983 |
| Brugia malayi | heat shock protein 90 | 0.0055 | 0.0384 | 0.2169 |
| Echinococcus multilocularis | terminal deoxycytidyl transferase rev1 | 0.0064 | 0.0475 | 0.0469 |
| Echinococcus multilocularis | transcription factor Dp 1 | 0.0046 | 0.0288 | 0.0282 |
| Schistosoma mansoni | tyrosyl-DNA phosphodiesterase | 0.008 | 0.0637 | 0.1859 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0006 | 0.0017 |
| Schistosoma mansoni | DNA helicase recq5 | 0.0024 | 0.0057 | 0.0166 |
| Wolbachia endosymbiont of Brugia malayi | dihydrolipoamide dehydrogenase E3 component | 0.0036 | 0.0178 | 0.0195 |
| Leishmania major | acetoin dehydrogenase e3 component-like protein | 0.0036 | 0.0178 | 0.2033 |
| Mycobacterium tuberculosis | Probable soluble pyridine nucleotide transhydrogenase SthA (STH) (NAD(P)(+) transhydrogenase [B-specific]) (nicotinamide nucleot | 0.0036 | 0.0178 | 0.0249 |
| Schistosoma mansoni | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.2559 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0055 | 0.0384 | 0.4372 |
| Brugia malayi | Thioredoxin reductase | 0.0103 | 0.0877 | 0.5005 |
| Giardia lamblia | Heat shock protein HSP 90-alpha | 0.0047 | 0.03 | 0.3312 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 0.0062 | 0.032 |
| Entamoeba histolytica | Niemann-Pick C1 protein, putative | 0.0119 | 0.1045 | 1 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-40 | 0.0024 | 0.0062 | 0.0328 |
| Echinococcus granulosus | fetal alzheimer antigen falz | 0.0027 | 0.0091 | 0.0152 |
| Trypanosoma brucei | DNA damage repair protein, putative | 0.002 | 0.0015 | 0.0168 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase | 0.0036 | 0.0178 | 0.2033 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0055 | 0.0384 | 0.4372 |
| Mycobacterium ulcerans | bifunctional N-acetylglucosamine-1-phosphate uridyltransferase/glucosamine-1-phosphate acetyltransferase | 0.0684 | 0.693 | 1 |
| Trypanosoma brucei | JmjC domain, hydroxylase, putative | 0.003 | 0.0123 | 0.1403 |
| Echinococcus granulosus | jumonji domain containing 1A | 0.003 | 0.0123 | 0.0209 |
| Toxoplasma gondii | heat shock protein 75, putative | 0.0037 | 0.019 | 0.0928 |
| Trypanosoma brucei | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0637 | 0.7264 |
| Schistosoma mansoni | ubiquitously transcribed sex (X/Y) chromosome tetratricopeptide repeat protein-related | 0.003 | 0.0123 | 0.0359 |
| Echinococcus multilocularis | phd:f box containing protein | 0.003 | 0.0123 | 0.0117 |
| Mycobacterium tuberculosis | Probable lipase LipE | 0.0043 | 0.026 | 0.0367 |
| Echinococcus multilocularis | EGFP:Bcl2 fusion protein | 0.01 | 0.0849 | 0.0843 |
| Echinococcus granulosus | heat shock protein | 0.0055 | 0.0384 | 0.0673 |
| Brugia malayi | Nuclear hormone receptor family member nhr-19 | 0.0024 | 0.0062 | 0.032 |
| Brugia malayi | Phosphoglycerate kinase | 0.0038 | 0.02 | 0.1116 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.0043 | 0.026 | 0.2966 |
| Echinococcus multilocularis | Bcl 2 ous antagonist:killer | 0.01 | 0.0849 | 0.0843 |
| Mycobacterium ulcerans | hypothetical protein | 0.0043 | 0.026 | 0.0355 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.0015 | 0.0168 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Echinococcus granulosus | Nuclear hormone receptor family member nhr 41 | 0.0024 | 0.0062 | 0.0099 |
| Echinococcus granulosus | FTZ F1 nuclear receptor protein | 0.0024 | 0.0062 | 0.0099 |
| Brugia malayi | nuclear hormone receptor | 0.0024 | 0.0062 | 0.032 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0349 | 0.2016 |
| Trypanosoma brucei | unspecified product | 0.0044 | 0.0268 | 0.3051 |
| Trichomonas vaginalis | DNA helicase recq1, putative | 0.0024 | 0.0057 | 0.0153 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.032 | 0.0932 |
| Echinococcus multilocularis | jumonji domain containing protein | 0.0049 | 0.0318 | 0.0312 |
| Brugia malayi | hypothetical protein | 0.0148 | 0.1348 | 0.7705 |
| Echinococcus granulosus | jumonji domain containing protein | 0.0049 | 0.0318 | 0.0555 |
| Trypanosoma cruzi | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.0006 | 0.0072 |
| Echinococcus granulosus | sterol regulatory element binding protein | 0.0051 | 0.0339 | 0.0593 |
| Loa Loa (eye worm) | transcription factor SMAD2 | 0.0144 | 0.1308 | 0.7656 |
| Schistosoma mansoni | endoplasmin | 0.0055 | 0.0384 | 0.1119 |
| Echinococcus multilocularis | DNA (apurinic or apyrimidinic site) lyase | 0.0023 | 0.0044 | 0.0038 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0047 | 0.03 | 0.3077 |
| Schistosoma mansoni | thyroid hormone receptor | 0.0176 | 0.1644 | 0.4795 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-31 | 0.0024 | 0.0062 | 0.0328 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.026 | 0.2156 |
| Plasmodium vivax | ataxin-2 like protein, putative | 0.003 | 0.0125 | 0.0596 |
| Echinococcus granulosus | bromodomain adjacent to zinc finger domain | 0.0043 | 0.0259 | 0.0451 |
| Mycobacterium tuberculosis | NADPH-dependent mycothiol reductase Mtr | 0.0103 | 0.0877 | 0.1258 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0123 | 0.0689 |
| Echinococcus multilocularis | neuropeptide receptor A26 | 0.0558 | 0.562 | 0.5617 |
| Toxoplasma gondii | thioredoxin reductase | 0.0103 | 0.0877 | 0.4391 |
| Mycobacterium ulcerans | heat shock protein 90 | 0.0052 | 0.0348 | 0.0482 |
| Trichomonas vaginalis | endoplasmin, putative | 0.004 | 0.0226 | 0.218 |
| Plasmodium falciparum | JmjC domain-containing protein, putative | 0.003 | 0.0123 | 0.0589 |
| Brugia malayi | Muscleblind-like protein | 0.018 | 0.1685 | 0.9645 |
| Echinococcus granulosus | bloom syndrome protein | 0.0024 | 0.0057 | 0.0091 |
| Echinococcus multilocularis | heat shock protein 90 | 0.0047 | 0.03 | 0.0295 |
| Trypanosoma cruzi | dihydrolipoyl dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Mycobacterium tuberculosis | Probable NADH dehydrogenase Ndh | 0.0234 | 0.2248 | 0.3238 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease | 0.0023 | 0.0044 | 0.0502 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0047 | 0.03 | 0.3424 |
| Echinococcus granulosus | hepatocyte nuclear factor 4 alpha | 0.0024 | 0.0062 | 0.0099 |
| Echinococcus multilocularis | ecdysone induced protein 78C | 0.0024 | 0.0062 | 0.0056 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Toxoplasma gondii | Hsp90 domain-containing protein | 0.021 | 0.199 | 1 |
| Mycobacterium ulcerans | hypothetical protein | 0.0125 | 0.1114 | 0.1589 |
| Trypanosoma cruzi | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Echinococcus granulosus | heat shock protein heat shock protein 90 alpha | 0.0047 | 0.03 | 0.0525 |
| Brugia malayi | ecdysteroid receptor | 0.0024 | 0.0062 | 0.032 |
| Schistosoma mansoni | heat shock protein | 0.0055 | 0.0384 | 0.1119 |
| Plasmodium falciparum | ATP-dependent DNA helicase Q1 | 0.0024 | 0.0057 | 0.0255 |
| Schistosoma mansoni | photoreceptor-specific nuclear receptor related | 0.0024 | 0.0062 | 0.018 |
| Brugia malayi | jmjC domain containing protein | 0.0186 | 0.1747 | 1 |
| Trichomonas vaginalis | penicillin-binding protein, putative | 0.0043 | 0.026 | 0.2594 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0023 | 0.0049 | 0.0557 |
| Brugia malayi | steroid hormone receptor | 0.0024 | 0.0062 | 0.032 |
| Trypanosoma brucei | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.0006 | 0.0072 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0123 | 0.0689 |
| Trypanosoma brucei | Heat shock protein 83, putative | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma brucei | heat shock protein 90, putative | 0.0055 | 0.0384 | 0.4372 |
| Trichomonas vaginalis | DNA polymerase IV / kappa, putative | 0.0096 | 0.0809 | 0.918 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.026 | 0.2156 |
| Echinococcus granulosus | retinoic acid receptor rxr beta a | 0.0024 | 0.0062 | 0.0099 |
| Schistosoma mansoni | DNA helicase recq1 | 0.0024 | 0.0057 | 0.0166 |
| Leishmania major | hypothetical protein, conserved | 0.0043 | 0.026 | 0.2966 |
| Toxoplasma gondii | phosphoglycerate kinase PGKII | 0.0103 | 0.0877 | 0.439 |
| Plasmodium vivax | dihydrolipoyl dehydrogenase, apicoplast, putative | 0.0036 | 0.0178 | 0.0868 |
| Mycobacterium tuberculosis | Dihydrolipoamide dehydrogenase LpdC (lipoamide reductase (NADH)) (lipoyl dehydrogenase) (dihydrolipoyl dehydrogenase) (diaphoras | 0.0261 | 0.252 | 0.3631 |
| Mycobacterium ulcerans | fusion of enoyl-CoA hydratase, EchA21 and lipase, LipE | 0.0043 | 0.026 | 0.0355 |
| Schistosoma mansoni | DNA polymerase IV / kappa | 0.002 | 0.0015 | 0.0043 |
| Echinococcus granulosus | expressed conserved protein | 0.0112 | 0.097 | 0.1717 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Mycobacterium tuberculosis | Conserved protein | 0.0043 | 0.026 | 0.0367 |
| Brugia malayi | Nuclear hormone receptor family member nhr-31 | 0.0024 | 0.0062 | 0.032 |
| Mycobacterium tuberculosis | Probable exodeoxyribonuclease III protein XthA (exonuclease III) (EXO III) (AP endonuclease VI) | 0.0023 | 0.0044 | 0.0055 |
| Loa Loa (eye worm) | nuclear Hormone Receptor family member | 0.0024 | 0.0062 | 0.0328 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0052 | 0.0351 | 0.3996 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0052 | 0.0348 | 0.365 |
| Entamoeba histolytica | phosphoglycerate kinase, putative | 0.0103 | 0.0877 | 0.8323 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0637 | 0.7264 |
| Echinococcus granulosus | thioredoxin glutathione reductase | 0.0103 | 0.0884 | 0.1564 |
| Brugia malayi | Nuclear hormone receptor family member nhr-40 | 0.0024 | 0.0062 | 0.032 |
| Entamoeba histolytica | heat shock protein 90, putative | 0.0055 | 0.0384 | 0.3392 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 0.0062 | 0.0056 |
| Trypanosoma cruzi | DNA damage repair protein, putative | 0.002 | 0.0015 | 0.0168 |
| Schistosoma mansoni | phosphatidylserine receptor | 0.003 | 0.0123 | 0.0359 |
| Giardia lamblia | PHD finger protein 15 | 0.0035 | 0.0174 | 0.1848 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0072 | 0.0558 | 0.6355 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Schistosoma mansoni | hypothetical protein | 0.0019 | 0.0006 | 0.0017 |
| Trichomonas vaginalis | heat shock protein, putative | 0.004 | 0.0226 | 0.218 |
| Trypanosoma brucei | chrX additional, unordered contigs | 0.002 | 0.0015 | 0.0168 |
| Trypanosoma cruzi | heat shock protein 85, putative | 0.0055 | 0.0384 | 0.4372 |
| Mycobacterium ulcerans | esterase/lipase LipP | 0.0043 | 0.026 | 0.0355 |
| Brugia malayi | hypothetical protein | 0.0043 | 0.026 | 0.1458 |
| Onchocerca volvulus | 0.0043 | 0.026 | 0.1206 | |
| Loa Loa (eye worm) | hypothetical protein | 0.006 | 0.0434 | 0.2518 |
| Loa Loa (eye worm) | nuclear hormone receptor family member nhr-41 | 0.0024 | 0.0062 | 0.0328 |
| Echinococcus multilocularis | Mitotic checkpoint protein PRCC, C terminal | 0.0152 | 0.139 | 0.1385 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Echinococcus granulosus | peregrin | 0.0038 | 0.0204 | 0.0353 |
| Loa Loa (eye worm) | abnormal chemotaxis protein 14 | 0.0051 | 0.0339 | 0.1956 |
| Loa Loa (eye worm) | RecQ helicase | 0.0024 | 0.0057 | 0.0299 |
| Brugia malayi | beta-lactamase family protein | 0.0043 | 0.026 | 0.146 |
| Brugia malayi | jmjC domain containing protein | 0.003 | 0.0123 | 0.0673 |
| Loa Loa (eye worm) | beta-lactamase | 0.0043 | 0.026 | 0.1495 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0024 | 0.0057 | 0.0255 |
| Schistosoma mansoni | heat shock protein | 0.0037 | 0.019 | 0.0555 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Treponema pallidum | NADH oxidase | 0.0036 | 0.0178 | 0.1256 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0055 | 0.0384 | 0.4075 |
| Echinococcus granulosus | lysine specific demethylase 5A | 0.0116 | 0.1014 | 0.1796 |
| Echinococcus granulosus | phd:f box containing protein | 0.003 | 0.0123 | 0.0209 |
| Trypanosoma brucei | heat shock protein 90, putative | 0.0055 | 0.0384 | 0.4372 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Loa Loa (eye worm) | hypothetical protein | 0.0079 | 0.0633 | 0.3687 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Echinococcus multilocularis | hepatocyte nuclear factor 4 alpha | 0.0024 | 0.0062 | 0.0056 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0095 | 0.0795 | 0.4531 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Plasmodium vivax | JmjC domain containing protein | 0.003 | 0.0123 | 0.0589 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Echinococcus multilocularis | endoplasmin | 0.0052 | 0.0348 | 0.0342 |
| Echinococcus multilocularis | nuclear receptor 2DBD gamma | 0.0024 | 0.0062 | 0.0056 |
| Brugia malayi | Nuclear hormone receptor family member nhr-25 | 0.0024 | 0.0062 | 0.032 |
| Plasmodium falciparum | thioredoxin reductase | 0.0036 | 0.0178 | 0.0868 |
| Trypanosoma brucei | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.9998 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.0024 | 0.0057 | 0.0292 |
| Onchocerca volvulus | 0.0043 | 0.026 | 0.1206 | |
| Echinococcus multilocularis | jumonji domain containing 1A | 0.003 | 0.0123 | 0.0117 |
| Leishmania major | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Toxoplasma gondii | pyruvate dehydrogenase complex subunit PDH-E3II | 0.0036 | 0.0178 | 0.0868 |
| Giardia lamblia | Sgs1 DNA helicase, putative | 0.0024 | 0.0057 | 0.0488 |
| Schistosoma mansoni | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.2559 |
| Leishmania major | tyrosyl-DNA phosphodiesterase 1 | 0.008 | 0.0637 | 0.7264 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Plasmodium falciparum | ataxin-2 like protein, putative | 0.003 | 0.0125 | 0.0596 |
| Plasmodium vivax | glutathione reductase, putative | 0.0103 | 0.0877 | 0.4391 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0038 | 0.02 | 0.2283 |
| Schistosoma mansoni | hypothetical protein | 0.0049 | 0.032 | 0.0932 |
| Loa Loa (eye worm) | glutathione reductase | 0.0103 | 0.0877 | 0.5124 |
| Entamoeba histolytica | hypothetical protein | 0.0043 | 0.026 | 0.2156 |
| Mycobacterium leprae | Probable UDP-N-acetylglucosamine pyrophosphorylase GlmU | 0.0684 | 0.693 | 1 |
| Trypanosoma brucei | dihydrolipoamide dehydrogenase, point mutation | 0.0036 | 0.0178 | 0.2033 |
| Toxoplasma gondii | exonuclease III APE | 0.0023 | 0.0044 | 0.0191 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Leishmania major | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0024 | 0.0057 | 0.0647 |
| Loa Loa (eye worm) | hypothetical protein | 0.01 | 0.0849 | 0.4953 |
| Echinococcus multilocularis | sterol regulatory element binding protein | 0.0051 | 0.0339 | 0.0333 |
| Echinococcus granulosus | ATP dependent DNA helicase Q1 | 0.0024 | 0.0057 | 0.0091 |
| Loa Loa (eye worm) | hypothetical protein | 0.0024 | 0.0062 | 0.0328 |
| Trypanosoma cruzi | PAB1-binding protein , putative | 0.003 | 0.0125 | 0.1419 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0052 | 0.0348 | 0.365 |
| Plasmodium falciparum | ADP-dependent DNA helicase RecQ | 0.0024 | 0.0057 | 0.0255 |
| Echinococcus multilocularis | thyroid hormone receptor alpha | 0.0176 | 0.1644 | 0.1639 |
| Brugia malayi | Isocitrate dehydrogenase | 0.0019 | 0.0006 | 0.0002 |
| Loa Loa (eye worm) | hypothetical protein | 0.0051 | 0.0339 | 0.1956 |
| Echinococcus multilocularis | Niemann Pick C1 protein | 0.017 | 0.1576 | 0.1571 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Toxoplasma gondii | PHD-finger domain-containing protein | 0.0035 | 0.0174 | 0.0846 |
| Brugia malayi | dihydrolipoyl dehydrogenase, mitochondrial precursor, putative | 0.0036 | 0.0178 | 0.099 |
| Trypanosoma cruzi | hypothetical protein, conserved | 0.002 | 0.0015 | 0.0168 |
| Brugia malayi | latrophilin 2 splice variant baaae | 0.0041 | 0.0236 | 0.1321 |
| Brugia malayi | exodeoxyribonuclease III family protein | 0.0023 | 0.0044 | 0.0219 |
| Loa Loa (eye worm) | hypothetical protein | 0.0041 | 0.0236 | 0.1353 |
| Echinococcus granulosus | ATP dependent DNA helicase Q5 | 0.0024 | 0.0057 | 0.0091 |
| Loa Loa (eye worm) | PHD-finger family protein | 0.0025 | 0.0067 | 0.0359 |
| Echinococcus multilocularis | thioredoxin glutathione reductase | 0.0103 | 0.0884 | 0.0878 |
| Loa Loa (eye worm) | hypothetical protein | 0.0043 | 0.026 | 0.1495 |
| Plasmodium vivax | thioredoxin reductase, putative | 0.0103 | 0.0877 | 0.4391 |
| Toxoplasma gondii | ATP-dependent DNA helicase, RecQ family protein | 0.0024 | 0.0057 | 0.0255 |
| Trypanosoma cruzi | phosphoglycerate kinase, putative | 0.0103 | 0.0877 | 0.9998 |
| Mycobacterium tuberculosis | Putative ferredoxin reductase | 0.0234 | 0.2248 | 0.3238 |
| Echinococcus multilocularis | expressed conserved protein | 0.0112 | 0.097 | 0.0965 |
| Schistosoma mansoni | DNA polymerase eta | 0.0095 | 0.0795 | 0.2318 |
| Brugia malayi | jmjC domain containing protein | 0.003 | 0.0123 | 0.0673 |
| Brugia malayi | Nuclear hormone receptor family member nhr-1 | 0.0024 | 0.0062 | 0.032 |
| Schistosoma mansoni | phd/f-box containing protein | 0.003 | 0.0123 | 0.0359 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Echinococcus granulosus | FTZ F1 alpha | 0.0024 | 0.0062 | 0.0099 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Plasmodium falciparum | thioredoxin reductase | 0.0103 | 0.0877 | 0.4391 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0125 | 0.1114 | 0.1599 |
| Echinococcus multilocularis | fetal alzheimer antigen, falz | 0.0027 | 0.0091 | 0.0085 |
| Brugia malayi | ImpB/MucB/SamB family protein | 0.0064 | 0.0475 | 0.2692 |
| Mycobacterium leprae | DIHYDROLIPOAMIDE DEHYDROGENASE LPD (LIPOAMIDE REDUCTASE (NADH)) (LIPOYL DEHYDROGENASE) (DIHYDROLIPOYL DEHYDROGENASE) (DIAPHORASE | 0.0261 | 0.252 | 0.3389 |
| Echinococcus multilocularis | heat shock protein 90 | 0.0055 | 0.0384 | 0.0378 |
| Brugia malayi | isocitrate dehydrogenase | 0.0019 | 0.0006 | 0.0002 |
| Loa Loa (eye worm) | hypothetical protein | 0.003 | 0.0125 | 0.0697 |
| Brugia malayi | PHD-finger family protein | 0.0035 | 0.0174 | 0.0966 |
| Mycobacterium tuberculosis | Probable lipase LipD | 0.0043 | 0.026 | 0.0367 |
| Echinococcus multilocularis | lysine specific demethylase 5A | 0.0114 | 0.099 | 0.0985 |
| Leishmania major | DNA polymerase eta, putative | 0.0051 | 0.0335 | 0.3817 |
| Echinococcus granulosus | COUP TF:Svp nuclear hormone receptor | 0.0024 | 0.0062 | 0.0099 |
| Schistosoma mansoni | Tr4/Tr2 (homologue) | 0.0024 | 0.0062 | 0.018 |
| Trypanosoma cruzi | DNA polymerase eta, putative | 0.0095 | 0.0795 | 0.9059 |
| Loa Loa (eye worm) | hypothetical protein | 0.0043 | 0.026 | 0.1495 |
| Plasmodium falciparum | heat shock protein 90, putative | 0.0032 | 0.0143 | 0.0686 |
| Loa Loa (eye worm) | hypothetical protein | 0.0095 | 0.0795 | 0.4638 |
| Echinococcus granulosus | beta LACTamase domain containing family member | 0.0043 | 0.026 | 0.0453 |
| Loa Loa (eye worm) | hypothetical protein | 0.0062 | 0.0458 | 0.2659 |
| Schistosoma mansoni | apoptosis regulator bax | 0.01 | 0.0849 | 0.2475 |
| Echinococcus granulosus | Bcl 2 ous antagonist:killer | 0.01 | 0.0849 | 0.1501 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.003 | 0.0123 | 0.0689 |
| Schistosoma mansoni | retinoid-x-receptor (RXR) | 0.0024 | 0.0062 | 0.018 |
| Leishmania major | 2-oxoglutarate dehydrogenase, e3 component, lipoamidedehydrogenase-like protein | 0.0036 | 0.0178 | 0.2033 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Echinococcus multilocularis | dna polymerase eta | 0.0095 | 0.0795 | 0.0789 |
| Schistosoma mansoni | nuclear hormone receptor | 0.0024 | 0.0062 | 0.018 |
| Trypanosoma cruzi | DNA damage repair protein, putative | 0.002 | 0.0015 | 0.0168 |
| Loa Loa (eye worm) | hypothetical protein | 0.0148 | 0.1348 | 0.7887 |
| Loa Loa (eye worm) | apoptosis regulator protein | 0.01 | 0.0849 | 0.4953 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma cruzi | apurinic/apyrimidinic endonuclease, putative | 0.0023 | 0.0044 | 0.0502 |
| Echinococcus multilocularis | muscleblind protein | 0.018 | 0.1685 | 0.168 |
| Brugia malayi | ATP-dependent DNA helicase, RecQ family protein | 0.0024 | 0.0057 | 0.0292 |
| Onchocerca volvulus | Alhambra homolog | 0.0035 | 0.0174 | 0.0683 |
| Echinococcus multilocularis | heat shock protein 75 kDa, mitochondrial | 0.0037 | 0.019 | 0.0184 |
| Trypanosoma brucei | DNA polymerase kappa, putative | 0.0096 | 0.0809 | 0.9219 |
| Echinococcus granulosus | muscleblind protein | 0.018 | 0.1685 | 0.2991 |
| Mycobacterium ulcerans | flavoprotein disulfide reductase | 0.0036 | 0.0178 | 0.0237 |
| Trypanosoma brucei | heat shock protein 84, putative | 0.0037 | 0.019 | 0.2169 |
| Echinococcus multilocularis | peregrin | 0.0038 | 0.0204 | 0.0198 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma cruzi | heat shock protein 90, putative | 0.0047 | 0.03 | 0.3424 |
| Loa Loa (eye worm) | jmjC domain-containing protein | 0.0073 | 0.0564 | 0.3283 |
| Trypanosoma brucei | hypothetical protein, conserved | 0.002 | 0.0015 | 0.0168 |
| Mycobacterium ulcerans | beta-lactamase | 0.0043 | 0.026 | 0.0355 |
| Echinococcus multilocularis | ATP dependent DNA helicase Q1 | 0.0024 | 0.0057 | 0.0051 |
| Schistosoma mansoni | rab geranylgeranyl transferase alpha subunit | 0.0064 | 0.0475 | 0.1385 |
| Echinococcus multilocularis | protein dispatched 1 | 0.0058 | 0.0414 | 0.0408 |
| Mycobacterium tuberculosis | NAD(P)H quinone reductase LpdA | 0.0261 | 0.252 | 0.3631 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0096 | 0.0809 | 0.9219 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Loa Loa (eye worm) | hypothetical protein | 0.0043 | 0.026 | 0.1495 |
| Plasmodium falciparum | heat shock protein 90, putative | 0.021 | 0.199 | 1 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Brugia malayi | Hsp90 protein | 0.0037 | 0.019 | 0.1059 |
| Plasmodium vivax | phosphoglycerate kinase, putative | 0.0103 | 0.0877 | 0.439 |
| Mycobacterium tuberculosis | Conserved protein | 0.0043 | 0.026 | 0.0367 |
| Toxoplasma gondii | eukaryotic initiation factor-2B, gamma subunit, putative | 0.0125 | 0.1114 | 0.5581 |
| Plasmodium falciparum | heat shock protein 90 | 0.0055 | 0.0384 | 0.1902 |
| Schistosoma mansoni | methyl-cpg binding protein mbd | 0.0021 | 0.0022 | 0.0064 |
| Brugia malayi | alpha keto acid dehydrogenase complex, E3 component, lipoamide dehydrogenase | 0.0026 | 0.008 | 0.0425 |
| Echinococcus granulosus | Jumonji AT rich interactive domain 1B | 0.0033 | 0.0147 | 0.0251 |
| Echinococcus granulosus | terminal deoxycytidyl transferase rev1 | 0.0064 | 0.0475 | 0.0835 |
| Echinococcus multilocularis | neuropeptide s receptor | 0.0558 | 0.562 | 0.5617 |
| Brugia malayi | hypothetical protein | 0.002 | 0.0012 | 0.0036 |
| Mycobacterium tuberculosis | Possible conserved lipoprotein LpqK | 0.0043 | 0.026 | 0.0367 |
| Echinococcus multilocularis | methyl CpG binding domain protein 2 | 0.0021 | 0.0022 | 0.0016 |
| Trypanosoma brucei | unspecified product | 0.0088 | 0.0726 | 0.8274 |
| Echinococcus granulosus | Basic leucine zipper bZIP transcription | 0.0043 | 0.026 | 0.0452 |
| Echinococcus multilocularis | bromodomain adjacent to zinc finger domain | 0.0043 | 0.0259 | 0.0254 |
| Treponema pallidum | phosphoglycerate kinase | 0.0103 | 0.0877 | 0.779 |
| Loa Loa (eye worm) | beta-LACTamase domain containing family member | 0.0043 | 0.026 | 0.1495 |
| Plasmodium falciparum | endoplasmin, putative | 0.004 | 0.0226 | 0.1106 |
| Toxoplasma gondii | NADPH-glutathione reductase | 0.0036 | 0.0178 | 0.0868 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.1685 | 0.9872 |
| Schistosoma mansoni | niemann-pick C1 (NPC1) | 0.0121 | 0.1064 | 0.3104 |
| Toxoplasma gondii | BRCA1 C Terminus (BRCT) domain-containing protein | 0.0028 | 0.0098 | 0.0461 |
| Schistosoma mansoni | retinoic acid receptor RXR | 0.0024 | 0.0062 | 0.018 |
| Echinococcus multilocularis | heat shock protein | 0.0055 | 0.0384 | 0.0378 |
| Leishmania major | isocitrate dehydrogenase [NADP], mitochondrial precursor, putative | 0.0019 | 0.0006 | 0.0072 |
| Trypanosoma cruzi | ATP-dependent DEAD/H DNA helicase recQ, putative | 0.0024 | 0.0057 | 0.0647 |
| Echinococcus multilocularis | phosphoglycerate kinase 1 | 0.0103 | 0.0877 | 0.0872 |
| Giardia lamblia | NADH oxidase lateral transfer candidate | 0.0036 | 0.0178 | 0.1898 |
| Loa Loa (eye worm) | hypothetical protein | 0.0043 | 0.026 | 0.1495 |
| Trypanosoma cruzi | dihydrolipoamide dehydrogenase, putative | 0.0036 | 0.0178 | 0.2033 |
| Loa Loa (eye worm) | exodeoxyribonuclease III family protein | 0.0023 | 0.0044 | 0.0224 |
| Leishmania major | heat shock protein, putative | 0.0037 | 0.019 | 0.2169 |
| Brugia malayi | Ligand-binding domain of nuclear hormone receptor family protein | 0.0024 | 0.0062 | 0.032 |
| Trypanosoma brucei | DNA polymerase eta, putative | 0.0095 | 0.0795 | 0.9059 |
| Brugia malayi | Nuclear hormone receptor family member nhr-41 | 0.0024 | 0.0062 | 0.032 |
| Loa Loa (eye worm) | hypothetical protein | 0.0119 | 0.1045 | 0.6109 |
| Echinococcus multilocularis | PHD finger protein rhinoceros | 0.0035 | 0.0174 | 0.0168 |
| Brugia malayi | glutathione reductase | 0.0103 | 0.0877 | 0.5005 |
| Trichomonas vaginalis | heat shock protein, putative | 0.0032 | 0.0143 | 0.1181 |
| Schistosoma mansoni | ap endonuclease | 0.0023 | 0.0044 | 0.0129 |
| Echinococcus granulosus | heat shock protein 90 | 0.0047 | 0.03 | 0.0525 |
| Mycobacterium ulcerans | DNA polymerase IV | 0.0096 | 0.0809 | 0.1149 |
| Trypanosoma brucei | trypanothione reductase | 0.0103 | 0.0877 | 1 |
| Trypanosoma cruzi | tyrosyl-DNA Phosphodiesterase (Tdp1), putative | 0.008 | 0.0637 | 0.7264 |
| Schistosoma mansoni | hypothetical protein | 0.01 | 0.0849 | 0.2475 |
| Echinococcus multilocularis | JmjC domain containing protein 4 | 0.003 | 0.0123 | 0.0117 |
| Trypanosoma brucei | DNA polymerase IV, putative | 0.0088 | 0.0726 | 0.8274 |
| Schistosoma mansoni | jumonji/arid domain-containing protein | 0.0116 | 0.1014 | 0.2959 |
| Echinococcus granulosus | PHD finger protein rhinoceros | 0.0035 | 0.0174 | 0.03 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0043 | 0.026 | 0.2594 |
| Leishmania major | heat shock protein 83-1 | 0.0055 | 0.0384 | 0.4372 |
| Mycobacterium leprae | PROBABLE NADH DEHYDROGENASE NDH | 0.0234 | 0.2248 | 0.298 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0064 | 0.0475 | 0.0677 |
| Plasmodium vivax | DNA repair protein REV1, putative | 0.002 | 0.0015 | 0.0043 |
| Loa Loa (eye worm) | hypothetical protein | 0.0052 | 0.0344 | 0.1986 |
| Giardia lamblia | Endonuclease/Exonuclease/phosphatase | 0.0023 | 0.0044 | 0.034 |
| Echinococcus granulosus | nuclear receptor 2DBD gamma | 0.0024 | 0.0062 | 0.0099 |
| Schistosoma mansoni | hypothetical protein | 0.0152 | 0.139 | 0.4054 |
| Brugia malayi | Nuclear hormone receptor family member nhr-3 | 0.0024 | 0.0062 | 0.032 |
| Echinococcus multilocularis | Nuclear hormone receptor family member nhr 41 | 0.0024 | 0.0062 | 0.0056 |
| Mycobacterium tuberculosis | Conserved hypothetical protein | 0.0125 | 0.1114 | 0.1599 |
| Trichomonas vaginalis | mercuric reductase, putative | 0.0036 | 0.0178 | 0.1612 |
| Mycobacterium tuberculosis | Probable UDP-N-acetylglucosamine pyrophosphorylase GlmU | 0.0684 | 0.693 | 1 |
| Giardia lamblia | Grp94/Hsp90 | 0.0052 | 0.0348 | 0.3867 |
| Loa Loa (eye worm) | endoplasmin | 0.0055 | 0.0384 | 0.222 |
| Entamoeba histolytica | heat shock protein 90, putative | 0.0055 | 0.0384 | 0.3392 |
| Loa Loa (eye worm) | hypothetical protein | 0.0043 | 0.026 | 0.1495 |
| Echinococcus granulosus | heat shock protein 90 | 0.0055 | 0.0384 | 0.0673 |
| Echinococcus granulosus | Niemann Pick C1 protein | 0.017 | 0.1576 | 0.2797 |
| Trichomonas vaginalis | D-aminoacylase, putative | 0.0043 | 0.026 | 0.2594 |
| Loa Loa (eye worm) | hypothetical protein | 0.018 | 0.1685 | 0.9872 |
| Mycobacterium tuberculosis | Probable dehydrogenase | 0.0234 | 0.2248 | 0.3238 |
| Trypanosoma brucei | DNA damage repair protein, putative | 0.002 | 0.0015 | 0.0168 |
| Echinococcus multilocularis | bromodomain adjacent to zinc finger domain | 0.0072 | 0.0558 | 0.0552 |
| Plasmodium vivax | heat shock protein, putative | 0.021 | 0.199 | 1 |
| Loa Loa (eye worm) | hypothetical protein | 0.0035 | 0.0174 | 0.0989 |
| Brugia malayi | Nuclear hormone receptor family member nhr-14 | 0.0024 | 0.0062 | 0.032 |
| Echinococcus granulosus | methyl CpG binding domain protein 2 | 0.0021 | 0.0022 | 0.0029 |
| Schistosoma mansoni | heat shock protein | 0.0055 | 0.0384 | 0.1119 |
| Brugia malayi | Bromodomain containing protein | 0.0046 | 0.0289 | 0.1626 |
| Echinococcus multilocularis | protein patched | 0.0051 | 0.0339 | 0.0333 |
| Loa Loa (eye worm) | hypothetical protein | 0.0049 | 0.032 | 0.1845 |
| Leishmania major | DNA polymerase kappa, putative | 0.002 | 0.0015 | 0.0168 |
| Toxoplasma gondii | ABC1 family protein | 0.0043 | 0.026 | 0.128 |
| Mycobacterium tuberculosis | Probable esterase/lipase LipP | 0.0043 | 0.026 | 0.0367 |
| Trichomonas vaginalis | DNA polymerase eta, putative | 0.0096 | 0.0809 | 0.918 |
| Loa Loa (eye worm) | ATP-dependent DNA helicase | 0.0024 | 0.0057 | 0.0299 |
| Trichomonas vaginalis | phosphoglycerate kinase, putative | 0.0103 | 0.0877 | 1 |
| Trichomonas vaginalis | esterase, putative | 0.0043 | 0.026 | 0.2594 |
| Toxoplasma gondii | LsmAD domain-containing protein | 0.003 | 0.0125 | 0.0596 |
| Trypanosoma brucei | heat shock protein, putative | 0.0055 | 0.0384 | 0.4372 |
| Trypanosoma brucei | phosphoglycerate kinase | 0.0038 | 0.02 | 0.2283 |
| Loa Loa (eye worm) | thioredoxin reductase | 0.0103 | 0.0877 | 0.5124 |
| Echinococcus granulosus | zinc finger protein | 0.0024 | 0.0054 | 0.0085 |
| Mycobacterium ulcerans | dihydrolipoamide dehydrogenase | 0.0036 | 0.0178 | 0.0237 |
| Echinococcus granulosus | transcription factor Dp 1 | 0.0046 | 0.0288 | 0.0502 |
| Plasmodium vivax | heat shock protein 86, putative | 0.0055 | 0.0384 | 0.1902 |
| Trypanosoma brucei | unspecified product | 0.0044 | 0.0268 | 0.3051 |
Activities
| Activity type | Activity value | Assay description | Source | Reference |
|---|---|---|---|---|
| AC50 (functional) | = 1.731 uM | PUBCHEM_BIOASSAY: HsHsp90 Counterscreen Measured in Microorganism System Using Plate Reader - 2121-02_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504596] | ChEMBL. | No reference |
| AC50 (functional) | = 2.45 uM | PUBCHEM_BIOASSAY: Anti-Malarial Hsp90 Inhibitors Measured in Microorganism System Using Plate Reader - 2121-01_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504596] | ChEMBL. | No reference |
| AC50 (functional) | = 12.502 uM | PUBCHEM_BIOASSAY: 24 hour HeLa Cytotox assay Measured in Cell-Based System Using Plate Reader - 2117-03_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504431] | ChEMBL. | No reference |
| AC50 (binding) | = 71.417 uM | PUBCHEM_BIOASSAY: C-LANA FP assay Measured in Biochemical System Using Plate Reader - 2117-01_Inhibitor_Dose_CherryPick_Activity. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504431] | ChEMBL. | No reference |
| IC50 (binding) | = 0.45 uM | Inhibitory activity against class C Beta-lactamase isolated from Enterobacter cloacae | ChEMBL. | 11012024 |
| IC50 (binding) | = 0.45 uM | Inhibitory activity against class C Beta-lactamase isolated from Enterobacter cloacae | ChEMBL. | 11012024 |
| IC50 (functional) | = 1.920964755 um | PUBCHEM_BIOASSAY: Dose Response Confirmation for Mcl-1/Noxa Interaction Inhibitors. (Class of assay: confirmatory) [Related pubchem assays: 1022 (Primary screen preceding this dose-response assay.)] | ChEMBL. | No reference |
| IC50 (functional) | 2.759 uM | PubChem BioAssay. An HIV-1 Tat-TAR Fluorescence Polarization (FP) Counter Screen to evaluate Inhibitors Targeting HIV-1 Vif-dependent Degradation of Human APOBEC3G. (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (functional) | > 9.29 uM | PUBCHEM_BIOASSAY: CHOP dose-response primary assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2732, AID493217] | ChEMBL. | No reference |
| IC50 (functional) | > 9.63 uM | PUBCHEM_BIOASSAY: XBP1 DR counterscreen for CHOP. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2732, AID493217] | ChEMBL. | No reference |
| IC50 (binding) | = 19.07 um | PUBCHEM_BIOASSAY: Inhibitors of Mycobacterial Glucosamine-1-phosphate acetyl transferase (GlmU). Secondary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (functional) | 37.73 uM | PubChem BioAssay. Discovery of small molecule inhibitors of the oncogenic and cytokinetic protein MgcRacGAP - Primary and Confirmatory Screens. (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (binding) | = 40.212 uM | PUBCHEM_BIOASSAY: Fluorescence-based biochemical high throughput dose response assay for inhibitors of the calcium sensitivity of cardiac Regulated Thin Filaments (RTF). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493244, AID504337, AID504635] | ChEMBL. | No reference |
| IC50 (functional) | > 94.096 uM | PubChem BioAssay. Counterscreen for inhibitors of T-cell receptor (TCR)-CD3 interaction: Fluorescence-based biochemical high throughput dose response assay to identify inhibitors of T-cell receptor (TCR)-CD3 interaction using a TAMRA-labeled BSA probe. (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (binding) | = 100 uM | Inhibitory activity against class A Beta-lactamase TEM isolated from Enterobacter coli | ChEMBL. | 11012024 |
| IC50 (binding) | = 100 uM | Inhibitory activity against class A Beta-lactamase TEM isolated from Enterobacter coli | ChEMBL. | 11012024 |
| IC50 (binding) | 122.468 uM | PubChem BioAssay. Counterscreen for inhibitors of phospholipase C isozymes (PLC-B3): Fluorescence-based biochemical high throughput dose response assay to identify inhibitors of phospholipase C isozymes (PLC-gamma1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| IC50 (binding) | 122.468 uM | PubChem BioAssay. Fluorescence-based biochemical high throughput dose response assay to identify inhibitors of phospholipase C isozymes (PLC-B3). (Class of assay: confirmatory) | ChEMBL. | No reference |
| MIC (functional) | = 2 ug ml-1 | The compound was evaluated for antimicrobial activity against Escherichia coli OC 4075 by inhibiting enzyme TEM-1 | ChEMBL. | 11012024 |
| MIC (functional) | = 2 ug ml-1 | The compound was evaluated for antimicrobial activity against Enterobacter cloacae OC 4080 by inhibiting enzyme P99 | ChEMBL. | 11012024 |
| MIC (functional) | = 2 ug ml-1 | The compound was evaluated for antimicrobial activity against Escherichia coli OC 4075 by inhibiting enzyme TEM-1 | ChEMBL. | 11012024 |
| MIC (functional) | = 8 ug ml-1 | The compound was evaluated for antimicrobial activity against S. marcescens OC 4101 by inhibiting enzyme AmpC(ind) | ChEMBL. | 11012024 |
| MIC (functional) | = 8 ug ml-1 | The compound was evaluated for antimicrobial activity against S. marcescens OC 4294 by inhibiting enzyme AmpC(const) | ChEMBL. | 11012024 |
| MIC (functional) | = 32 ug ml-1 | The compound was evaluated for antimicrobial activity against P. aeruginosa OC 4270 by inhibiting enzyme AmpC(ind) | ChEMBL. | 11012024 |
| MIC (functional) | = 32 ug ml-1 | The compound was evaluated for antimicrobial activity against P. aeruginosa OC 4290 by inhibiting enzyme AmpC(const) | ChEMBL. | 11012024 |
| MIC (functional) | = 32 ug ml-1 | The compound was evaluated for antimicrobial activity against Enterobacter cloacae OC 4092 by inhibiting enzyme E2 (ind) | ChEMBL. | 11012024 |
| MIC (functional) | = 32 ug ml-1 | The compound was evaluated for antimicrobial activity against Enterobacter cloacae OC 4081 by inhibiting enzyme E2 (const) | ChEMBL. | 11012024 |
| Potency (functional) | 0.2936 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 96 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488745, AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 0.2936 uM | PUBCHEM_BIOASSAY: Primary qHTS for delayed death inhibitors of the malarial parasite plastid, 48 hour incubation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488752, AID488774, AID504848, AID504850] | ChEMBL. | No reference |
| Potency (functional) | 0.3256 uM | PUBCHEM_BIOASSAY: qHTS of small molecules that selectively kill Giardia lamblia: Hit Validation. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID540272] | ChEMBL. | No reference |
| Potency (functional) | 0.5012 uM | PubChem BioAssay. qHTS of Nrf2 Activators. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 0.631 uM | PubChem BioAssay. qHTS for Inhibitors of Vif-A3G Interactions: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 0.6513 uM | PubChem BioAssay. A quantitative high throughput screen for small molecules that induce DNA re-replication in SW480 colon adenocarcinoma cells. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (binding) | = 0.7079 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Tyrosyl-DNA Phosphodiesterase (TDP1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 1.122 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Influenza NS1 Protein Function. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 1.5849 uM | PubChem BioAssay. qHTS for Activators of Integrin-Mediated Alleviation for Muscular Dystrophy. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 2.2387 um | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of Schistosoma Mansoni Peroxiredoxins. (Class of assay: confirmatory) [Related pubchem assays: 1011 (Confirmation Concentration-Response Assay for Inhibitors of the Schistosoma mansoni Redox Cascade ), 448 (Schistosoma Mansoni Peroxiredoxins (Prx2) and thioredoxin glutathione reductase (TGR) coupled assay)] | ChEMBL. | No reference |
| Potency (functional) | 2.2387 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Iota. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588623] | ChEMBL. | No reference |
| Potency (functional) | 2.2387 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Eta. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588636] | ChEMBL. | No reference |
| Potency (functional) | 2.2387 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588856, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 2.5902 uM | PubChem BioAssay. qHTS for inhibitors of Phosphogylcerate Kinase: Hit Validation Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 2.6679 uM | PubChem BioAssay. qHTS for Inhibitors of Polymerase Iota: Confirmatory Assay for Cherry-picked Compounds. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 2.8184 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 3.1623 um | PUBCHEM_BIOASSAY: qHTS Assay for NPC1 Promoter Activators. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 3.2629 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that induce genotoxicity in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493106, AID493143] | ChEMBL. | No reference |
| Potency (functional) | 3.2885 uM | PUBCHEM_BIOASSAY: qHTS of small molecules that selectively kill Giardia lamblia: Hit Validation in HepG2 cytotox. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID540272] | ChEMBL. | No reference |
| Potency (functional) | = 3.9811 um | PUBCHEM_BIOASSAY: qHTS Assay for Rab9 Promoter Activators. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 4.4668 um | PUBCHEM_BIOASSAY: VP16 counterscreen qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.4668 uM | PubChem BioAssay. qHTS of alpha-syn Inhibitors. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.7444 uM | PubChem BioAssay. qHTS for Inhibitors of Polymerase Kappa: Confirmatory Assay for Cherry-picked Compounds. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 4.7755 uM | PubChem BioAssay. qHTS for Inhibitors of Polymerase Eta: Confirmatory Assay for Cherry-picked Compounds. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 5.0119 um | PUBCHEM_BIOASSAY: qHTS Multiplex Assay to Identify Dual Action Probes in a Cell Model of Huntington: Aggregate Formation (GFP). (Class of assay: confirmatory) [Related pubchem assays: 1482, 1471 ] | ChEMBL. | No reference |
| Potency (functional) | = 5.6234 um | PUBCHEM_BIOASSAY: qHTS for inhibitors of ROR gamma transcriptional activity. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 5.8048 uM | PubChem BioAssay. qHTS for induction of synthetic lethality in tumor cells producing 2HG: qHTS for the HT-1080-NT fibrosarcoma cell line. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 7.9433 um | PUBCHEM_BIOASSAY: qHTS Assay for Antagonists of the Neuropeptide S Receptor: cAMP Signal Transduction. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 8.9125 uM | PubChem BioAssay. qHTS for Inhibitors of ATXN expression. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Mammalian Selenoprotein Thioredoxin Reductase 1 (TrxR1): qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488771] | ChEMBL. | No reference |
| Potency (functional) | 10 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Polymerase Kappa. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588638] | ChEMBL. | No reference |
| Potency (functional) | 11.2202 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of BAZ2B. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504391] | ChEMBL. | No reference |
| Potency (functional) | = 12.5893 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1). (Class of assay: confirmatory) [Related pubchem assays: 594 (Rhodamine region spectral profiling screen), 593 (Fluorescein region spectral profiling screen), 2367 (Probe Development Summary for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1)), 2353 (qHTS Validation Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1))] | ChEMBL. | No reference |
| Potency (functional) | 12.5893 uM | PubChem BioAssay. qHTS of GLP-1 Receptor Inverse Agonists (Inhibition Mode). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 12.5893 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of binding or entry into cells for Lassa Virus. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID463114, AID540249] | ChEMBL. | No reference |
| Potency (binding) | 14.1254 uM | PubChem BioAssay. qHTS Assay for Inhibitors of MBNL1-poly(CUG) RNA binding. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 15.8489 uM | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of JMJD2A-Tudor Domain. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504402] | ChEMBL. | No reference |
| Potency (functional) | = 19.9526 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Human Jumonji Domain Containing 2E (JMJD2E). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 19.9526 um | PUBCHEM_BIOASSAY: Total Fluorescence Counterscreen for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 21.1923 uM | PubChem BioAssay. qHTS for Inhibitors of PLK1-PDB (polo-like kinase 1 - polo-box domain): Primary Screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 23.9341 uM | PUBCHEM_BIOASSAY: qHTS profiling assay for firefly luciferase inhibitor/activator using purified enzyme and Km concentrations of substrates (counterscreen for miR-21 project). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID2288, AID2289, AID2598, AID411] | ChEMBL. | No reference |
| Potency (functional) | 28.1838 uM | PUBCHEM_BIOASSAY: qHTS Assay to Find Inhibitors of Phosphoglycerate Kinase. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 29.081 uM | PUBCHEM_BIOASSAY: qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493107, AID493125] | ChEMBL. | No reference |
| Potency (functional) | 29.0929 uM | PUBCHEM_BIOASSAY: Nrf2 qHTS screen for inhibitors. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493153, AID493163, AID504648] | ChEMBL. | No reference |
| Potency (functional) | = 31.6228 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay; Stimulation with EGF. (Class of assay: confirmatory) [Related pubchem assays: 995 ] | ChEMBL. | No reference |
| Potency (functional) | 31.6228 uM | PUBCHEM_BIOASSAY: HTS for Inhibitors of HP1-beta Chromodomain Interactions with Methylated Histone Tails. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488962] | ChEMBL. | No reference |
| Potency (functional) | 31.6228 uM | PUBCHEM_BIOASSAY: qHTS Assay for the Inhibitors of Human Flap endonuclease 1 (FEN1). (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID488813] | ChEMBL. | No reference |
| Potency (functional) | 31.6228 uM | PubChem BioAssay. qHTS for Antagonists of gsp, the Etiologic Mutation Responsible for Fibrous Dysplasia/McCune-Albright Syndrome: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 35.4813 um | PUBCHEM_BIOASSAY: qHTS Fluorescence Polarization Assay for Inhibitors of MLL CXXC domain - DNA interaction. (Class of assay: confirmatory) [Related pubchem assays: 2698 (Summary assay.)] | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of Vif-A3F Interactions: qHTS. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 35.4813 uM | PUBCHEM_BIOASSAY: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID588855, AID588860] | ChEMBL. | No reference |
| Potency (functional) | 39.8107 uM | PubChem BioAssay. qHTS for Inhibitors of WRN Helicase. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 39.8107 uM | PubChem BioAssay. qHTS Assay for Inhibitors of the HIV-1 protein Vpr. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 44.6684 um | PUBCHEM_BIOASSAY: qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase). (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | = 50.1187 um | PUBCHEM_BIOASSAY: Confirmation qHTS Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1). (Class of assay: confirmatory) [Related pubchem assays: 593 (Fluorescein region spectral profiling screen), 594 (Rhodamine region spectral profiling screen), 2367 (Probe Development Summary for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1)), 2353 (qHTS Validation Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1)), 2549 (qHTS Assay for Inhibitors of RecQ-Like Dna Helicase 1 (RECQ1))] | ChEMBL. | No reference |
| Potency (functional) | 50.1187 uM | PubChem BioAssay. qHTS for Antagonist of cAMP-regulated guanine nucleotide exchange factor 2 (EPAC2): primary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 56.2341 uM | PubChem BioAssay. qHTS for Antagonist of cAMP-regulated guanine nucleotide exchange factor 3 (EPAC1): primary screen. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 58.4789 uM | PubChem BioAssay. qHTS for Inhibitors of Cell Surface uPA Generation: Confirmatory Assay for Cherry-picked Compounds. (Class of assay: confirmatory) | ChEMBL. | No reference |
| Potency (functional) | 100 uM | PUBCHEM_BIOASSAY: Inhibitors of Regulator of G Protein Signaling (RGS) 4: qHTS. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID504856] | ChEMBL. | No reference |
| Ratio (functional) | NA 0 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against Escherichia coli OC 4075 by inhibiting enzyme TEM-1 at 4 ug/mL; not applicable | ChEMBL. | 11012024 |
| Ratio (functional) | NA 0 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against Enterobacter cloacae OC 4080 by inhibiting enzyme P99 at 4 ug/mL; not applicable | ChEMBL. | 11012024 |
| Ratio (functional) | = 2 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against S. marcescens OC 4101 by inhibiting enzyme AmpC(ind) at 1 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 2 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against S. marcescens OC 4101 by inhibiting enzyme AmpC(ind) at 4 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 4 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against P. aeruginosa OC 4270 by inhibiting enzyme AmpC(ind) at 1 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 4 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against P. aeruginosa OC 4270 by inhibiting enzyme AmpC(ind) at 4 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 8 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against S. marcescens OC 4294 by inhibiting enzyme AmpC(const) at 4 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 8 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against P. aeruginosa OC 4290 by inhibiting enzyme AmpC(const) at 4 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 16 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against P. aeruginosa OC 4290 by inhibiting enzyme AmpC(const) at 1 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 32 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against S. marcescens OC 4294 by inhibiting enzyme AmpC(const) at 1 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 64 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against Escherichia coli OC 4075 by inhibiting enzyme TEM-1 at 1 ug/mL | ChEMBL. | 11012024 |
| Ratio (functional) | = 64 | The ratio of compound to that of piperacillin was evaluated for antimicrobial activity against Enterobacter cloacae OC 4080 by inhibiting enzyme P99 at 1 ug/mL | ChEMBL. | 11012024 |
Phenotypes
Whole-cell/tissue/organism interactions
| Species name | Source | Reference | Is orphan |
|---|---|---|---|
| Giardia lamblia | |||
| Plasmodium falciparum | ChEMBL23 | ||
| Homo sapiens | ChEMBL23 |
Many chemical entities in TDR Targets come from high-throughput screenings with whole cells or tissue samples, and not all assayed compounds have been tested against a single a single target protein, probably because they get ruled out during screening process. Even if these compounds may have not been of interest in the original screening, they may come as interesting leads for other screening assays. Furthermore, we may be able to propose drug-target associations using chemical similarities and network patterns.
Annotated phenotypes:
We have no manually annotated phenotypes for this drug.
What does this mean? / Care to help?
In TDR Targets, information about phenotypes that are caused by
drugs, or by genetic manipulation of cells (e.g. gene knockouts or
knockdowns) is manually curated from the literature. These
descriptions help to describe the potential of the target for drug
development. If no information is available for this gene or if the
information is incomplete, this may mean that i) the papers
containing this information either appeared after the curation
effort for this organism was carried out or they were inadvertently
missed by curators; or that ii) the curation effort for this
organism has not yet started.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
In any case, if you have information about papers containing relevant validation data for this target, please log in using your TDR Targets username and password and send them to us using the corresponding form in this page (only visible to registered users) or contact us.
External resources for this compound
- ChEMBL: CHEMBL69612
- PubChem: 5335985
Bibliographic References
1 literature reference was collected for this gene.
If you have references for this compound, please enter them in a user comment (below) or Contact us.